ANHANG VI Harmonisierte Einstufung und Kennzeichnung für bestimmte gefährliche Stoffe — Einstufung, Verpackung und Etikettierung von chemischen Stoffen und ihren Gemischen
In Teil 1 dieses Anhangs wird eine Einführung zur Liste der harmonisierten Einstufungen und Kennzeichnungen gegeben, die auch die in Tabelle 3.1 aufgeführten Informationen je Eintrag und entsprechenden Einstufungen und Gefahrenhinweise umfasst, falls bei der Umwandlung der Einstufungen aus Anhang I der Richtlinie 67/548/EWG bestimmte Überlegungen zu beachten sind.
In Teil 2 dieses Anhangs werden allgemeine Grundsätze für die Vorbereitung der Dossiers festgelegt, mit denen eine harmonisierte Einstufung und Kennzeichnung von Stoffen auf Gemeinschaftsebene vorgeschlagen und begründet wird.
In Teil 3 dieses Anhangs sind gefährliche Stoffe aufgeführt, für die eine harmonisierte Einstufung und Kennzeichnung auf Gemeinschaftsebene erstellt wurde. In der Tabelle 3.1 beruhen die Einstufungen und Kennzeichnungen auf den Kriterien in Anhang I dieser Verordnung. In der Tabelle 3.2 beruhen die Einstufungen und Kennzeichnungen auf den Kriterien in Anhang I der Richtlinie 67/548/EWG.
Die Einträge in Teil 3 sind nach der Ordnungszahl des Elements geordnet, das für die Eigenschaften des jeweiligen Stoffes am kennzeichnendsten ist. Organische Stoffe wurden aufgrund ihrer Vielfältigkeit in Klassen eingeordnet. Die Indexnummer der einzelnen Stoffe besteht aus einer Zeichensequenz nach dem Muster ABC-RST-VW-Y. ABC entspricht der Ordnungszahl des Elements bzw. der organischen Gruppe, das bzw. die am kennzeichnendsten für das Molekül ist. RST ist die laufende Nummer des Stoffes in der ABC-Reihe. VW gibt die Form an, in der der Stoff hergestellt oder in den Verkehr gebracht wird. Y ist die Kontrollziffer, die nach der zehnstelligen ISBN-Methode berechnet wird. Diese Nummer ist in der Spalte „Index No“ angegeben.
ABl. C 146 A vom 15.6.1990
Ferner wird die CAS-Nummer (Chemical Abstracts Service) angegeben, um den Eintrag leichter identifizieren zu können. Es sei darauf hingewiesen, dass ein und dieselbe EINECS-Nummer Stoffe sowohl in ihrer wasserfreien Form als auch in ihrer Hydratform beinhaltet, während es dafür häufig unterschiedliche CAS-Nummern gibt. Die angegebene CAS-Nummer bezeichnet lediglich die wasserfreie Form und beschreibt deshalb den Eintrag nicht immer mit der gleichen Genauigkeit wie die EINECS-Nummer. Diese Nummer ist in der Spalte „CAS No“ angegeben.
Gefährliche Stoffe werden nach Möglichkeit mit ihren IUPAC-Namen bezeichnet. In EINECS, ELINCS oder in der Liste „No-longer-polymers“ aufgeführte Stoffe werden mit den dort verwendeten Namen bezeichnet. In einigen Fällen sind auch andere Namen, wie z. B. der Trivialname oder der gebräuchliche Name, angegeben. Pflanzenschutzmittel und Biozidwirkstoffe werden nach Möglichkeit mit ihren ISO-Namen bezeichnet.
Verunreinigungen, Beimengungen und unbedeutende Bestandteile werden normalerweise nicht angegeben, es sei denn, sie haben einen wesentlichen Einfluss auf die Einstufung des Stoffes.
Bei einigen Stoffen wird der spezifische Reinheitsgrad prozentual angegeben. Stoffe mit einem höheren Gehalt an Wirkstoffen (z. B. organische Peroxide) als dieser Prozentanteil werden nicht in den Eintrag in Teil 3 aufgenommen und können andere gefährliche Eigenschaften haben (z. B. Explosionsgefahr); sie sollten entsprechend eingestuft und gekennzeichnet werden.
Stoffspezifische Konzentrationsgrenzen beziehen sich auf den Stoff bzw. die Stoffe des Eintrags. Insbesondere bei Einträgen, bei denen es sich um Mischungen von Stoffen oder um Stoffe mit prozentualer Angabe des spezifischen Reinheitsgrades handelt, beziehen sich die Konzentrationsgrenzen nicht auf den reinen, sondern auf den in Teil 3 beschriebenen Stoff.
Für in Teil 3 aufgeführte Stoffe hat der auf dem Kennzeichnungsetikett zu verwendende Stoffname einer der Bezeichnungen zu entsprechen, die dort angegeben sind. Bei bestimmten Stoffen wurden zur leichteren Identifizierung des Stoffes zusätzliche Angaben in eckigen Klammern angefügt. Diese zusätzlichen Informationen brauchen nicht in das Kennzeichnungsetikett aufgenommen zu werden.
Bestimmte Einträge enthalten einen Verweis auf Verunreinigungen; in diesen Fällen steht hinter dem Namen des Stoffes folgender Wortlaut: „(enthält ≥xx % Verunreinigungen)“. Der Verweis in Klammern gilt dann als Bestandteil des Namens und muss in das Kennzeichnungsetikett aufgenommen werden.
Es werden eine Reihe von Gruppeneinträgen in Teil 3 aufgenommen. In diesen Fällen gelten die Vorschriften für die Einstufung und Kennzeichnung für alle von der Beschreibung erfassten Stoffe.
In einigen Fällen gibt es Einstufungs- und Kennzeichnungsanforderungen für bestimmte Stoffe eines Gruppeneintrags. Dann erfolgt für diesen Stoff ein eigener Eintrag in Anhang VI Teil 3, und beim Gruppeneintrag wird der Vermerk „mit Ausnahme der an einer anderen Stelle dieses Anhangs genannten Stoffe“ hinzugefügt.
In einigen Fällen können bestimmte Stoffe in verschiedenen Gruppeneinträgen erwähnt sein. In diesen Fällen entspricht die Einstufung des Stoffes derjenigen beider Gruppeneinträge. Sind für dieselbe Gefahr verschiedene Einstufungen angegeben, so ist die strengere Einstufung zu verwenden.
Einträge in Teil 3 für Salze (unter jeder Bezeichnung) gelten sowohl für Salze in wasserfreier Form als auch in Hydratform, sofern nicht etwas anderes festgelegt ist.
Bei Einträgen, die mehr als vier einzelne Stoffe umfassen, werden die EG- oder CAS-Nummern in der Regel nicht angegeben.
Die Einstufung für die einzelnen Einträge basiert auf den Kriterien des Anhangs I gemäß Artikel 13 Buchstabe a und wird in Form von Abkürzungen dargestellt, die für die Gefahrenklasse und die Gefahrenkategorie oder Gefahrenkategorien/-unterklassen/-typen innerhalb dieser Gefahrenklasse stehen.
Die Gefahrenklassen und die für die einzelnen Gefahrenkategorien einer Klasse verwendeten Abkürzungen sind in Tabelle 1.1 angegeben.
| Gefahrenklasse | Gefahrenklasse- und Gefahrenkategorie-Code |
| Explosive Stoffe/Gemische und Erzeugnisse mit Explosivstoff | Inst. Expl.Expl. 1.1Expl. 1.2Expl. 1.3Expl. 1.4Expl. 1.5Expl. 1.6 |
| Entzündbare Gase | Entz. Gas 1Entz. Gas 2 |
| Entzündbare Aerosole | Entz. Aerosol 1Entz. Aerosol 2 |
| oxidierende Gase | Oxid. Gas 1 |
| Gase unter Druck | Pressgas |
| Entzündbare Flüssigkeiten | Entz. Fl. 1Entz. Fl. 2Entz. Fl. 3 |
| Entzündbare Feststoffe | Entz. Festst. 1Entz. Festst. 2 |
| Selbstzersetzliche Stoffe oder Gemische | Selbstzers. ASelbstzers. BSelbstzers. CDSelbstzers. EFSelbstzers. G |
| pyrophore Flüssigkeiten | Pyr. FL. 1 |
| pyrophore Feststoffe | Pyr. Festst. 1 |
| Selbsterhitzungsfähige Stoffe oder Gemische | Selbsterh. 1Selbsterh. 2 |
| Stoffe oder Gemische, die bei Berührung mit Wasser entzündbare Gase abgeben | Wasserreakt. 1Wasserreakt. 2Wasserreakt. 3 |
| oxidierende Flüssigkeiten | Oxid. Fl. 1Oxid. Fl. 2Oxid. Fl. 3 |
| oxidierende Feststoffe | Oxid. Festst. 1Oxid. Festst. 2Oxid. Festst. 3 |
| Organische Peroxide | Org. Perox. AOrg. Perox. BOrg. Perox. CDOrg. Perox. EFOrg. Perox. G |
| Auf Metalle korrosiv wirkende Stoffe oder Gemische | Met. korr. 1 |
| Akute Toxizität | Akut Tox. 1Akut Tox. 2Akut Tox. 3Akut Tox. 4 |
| Ätz-/Reizwirkung auf die Haut | Hautätz. 1AHautätz. 1BHautätz. 1CHautreiz. 2 |
| Schwere Augenschädigung/Augenreizung; |
Die gemäß Artikel 13 Buchstabe b zugeordneten Gefahrenhinweise werden gemäß Anhang III angegeben. Darüber hinaus werden dem dreistelligen Code bei bestimmten Gefahrenhinweisen Buchstaben angefügt. Es werden die nachstehenden zusätzlichen Codes verwendet:
| H350i | Kann bei Einatmen Krebs erzeugen. |
| H360F | Kann die Fruchtbarkeit beeinträchtigen. |
| H360D | Kann das Kind im Mutterleib schädigen. |
| H361f | Kann vermutlich die Fruchtbarkeit beeinträchtigen. |
| H361d | Kann vermutlich das Kind im Mutterleib schädigen. |
| H360FD | Kann die Fruchtbarkeit beeinträchtigen. Kann das Kind im Mutterleib schädigen. |
| H361fd | Kann vermutlich die Fruchtbarkeit beeinträchtigen. Kann vermutlich das Kind im Mutterleib schädigen. |
| H360Fd | Kann die Fruchtbarkeit beeinträchtigen. Kann vermutlich das Kind im Mutterleib schädigen. |
| H360Df | Kann das Kind im Mutterleib schädigen. Kann vermutlich die Fruchtbarkeit beeinträchtigen. |
In der Kennzeichnungsspalte werden die folgenden Elemente aufgeführt:
i) die Gefahrenpiktogramm-Codes gemäß Anhang V und in Übereinstimmung mit den Rangfolgevorschriften in Artikel 26;
ii) der Signalwortcode „Gef.“ für „Gefahr“ oder „Achtg.“ für „Achtung“ in Übereinstimmung mit den Rangfolgevorschriften in Artikel 20 Absatz 3;
iii) die Gefahrenhinweis-Codes gemäß Anhang III und entsprechend der Einstufung;
iv) die Codes für die ergänzenden Hinweise gemäß Anhang II Teil 1, die in Übereinstimmung mit Artikel 25 Absatz 1 und den Vorschriften in Anhang II Teil 1 zugeordnet werden.
Im Falle einer Abweichung von den allgemeinen Konzentrationsgrenzwerten des Anhangs I werden für eine bestimmte Kategorie spezifische Konzentrationsgrenzwerte in einer eigenen Spalte zusammen mit der betreffenden Einstufung unter Verwendung der Codes nach Abschnitt 1.1.2.1.1.aufgeführt. Sind für eine bestimmte Kategorie in diesem Anhang keine spezifischen Konzentrationsgrenzwerte angegeben, gelten für die Einstufung von Stoffen, die Verunreinigungen, Beimengungen und einzelne Bestandteile enthalten, und für Gemische die allgemeinen Konzentrationsgrenzwerte von Anhang I. Das Sternchen (*) in dieser Spalte zeigt an, dass für den Eintrag spezifische Konzentrationsgrenzwerte für akute Toxizität gemäß der Richtlinie 67/548/EWG (Tabelle3.2) gelten; siehe auch Abschnitt 1.2.1.
Sofern nicht anders angegeben, sind die aufgeführten Konzentrationsgrenzen als Gewichtsprozent, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Für den Fall, dass ein Multiplikationsfaktor für Stoffe harmonisiert wurde, die als akut gewässergefährdend der Kategorie 1 oder chronisch gewässergefährdend der Kategorie 1 eingestuft sind, wird dieser Multiplikationsfaktor in derselben Spalte wie die spezifischen Konzentrationsgrenzwerte angegeben. Ist kein Multiplikationsfaktor in der Tabelle 3.1 angegeben, wird er auf der Grundlage der für den Stoff verfügbaren Daten vom Hersteller, Importeur oder nachgeschalteten Anwender festgelegt. Wird ein Gemisch, das den Stoff enthält, vom Hersteller, Importeur oder nachgeschalteten Anwender anhand der Summierungsmethode eingestuft, findet dieser Multiplikationsfaktor Anwendung. Zur Festlegung des Multiplikationsfaktors siehe Anhang I Abschnitt 4.1.3.5.5.5.
Die Anmerkung/-en, die einem Eintrag zugeordnet ist/sind, ist/sind in der Spalte „Notes“ aufgeführt. Der Inhalt der Anmerkungen lautet wie folgt:
Der Name des Stoffes muss auf dem Kennzeichnungsetikett mit einer der in der Liste des Teils 3 aufgeführten Bezeichnungen angegeben werden.
In einigen Fällen wird in Teil 3 eine allgemeine Beschreibung wie „…verbindungen“ oder „…salze“ verwendet. In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett den korrekten Namen angeben und dabei Abschnitt 1.1.1.4. gebührend beachten.
Manche Stoffe (Säuren, Basen usw.) werden als wässrige Lösungen in unterschiedlichen Konzentrationen in Verkehr gebracht; dies erfordert auch eine unterschiedliche Einstufung und Kennzeichnung, da von den verschiedenen Konzentrationen unterschiedliche Gefahren ausgehen können.
In Teil 3 haben Einträge mit der Anmerkung B allgemeine Bezeichnungen wie „Salpetersäure ... %“.
In diesem Fall muss der Lieferant die Konzentration in Prozent auf dem Kennzeichnungsetikett angeben. Unter % ist ohne anderslautende Angabe stets der Gewichtsprozentsatz zu verstehen.
Manche organischen Stoffe können entweder in einer genau definierten isomeren Form oder als Gemisch mehrerer Isomere in Verkehr gebracht werden.
In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett angeben, ob es sich um ein bestimmtes Isomer oder um ein Isomergemisch handelt.
Bestimmte Stoffe, die spontan polymerisieren oder sich zersetzen können, werden normalerweise in stabilisierter Form in Verkehr gebracht. Sie werden in dieser Form in Teil 3 aufgeführt.
Allerdings werden solche Stoffe manchmal auch in nicht stabilisierter Form in Verkehr gebracht. In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett nach dem Namen des Stoffes die Bezeichnung „nicht stabilisiert“ anfügen.
Stoffe mit spezifischen Auswirkungen auf die menschliche Gesundheit (siehe Kapitel 4 des Anhangs VI der Richtlinie 67/548/EWG), die als karzinogen, keimzellmutagen und/oder reproduktionstoxisch der Kategorie 1 oder 2 eingestuft sind, werden mit der Anmerkung E versehen, wenn sie darüber hinaus als sehr toxisch (T+), toxisch (T) oder gesundheitsschädlich (Xn) eingestuft sind. Bei diesen Stoffen ist den Gefahrensätzen R20, R21, R22, R23, R24, R25, R26, R27, R28, R39, R68 (gesundheitsschädlich), R48 und R65 sowie vor alle Kombinationen dieser Gefahrensätze das Wort „auch“ voranzustellen.
Dieser Stoff kann einen Stabilisator enthalten. Wenn dieser Stabilisator die mit der Einstufung in Teil 3 angegebenen gefährlichen Eigenschaften des Stoffes verändert, so sollten die Einstufung und die Kennzeichnung des Stoffes in Übereinstimmung mit den Vorschriften für die Einstufung und Kennzeichnung gefährlicher Gemische vorgenommen werden.
Diese Stoffe können in einer explosionsgefährlichen Form in Verkehr gebracht werden. In diesem Fall müssen die explosiven Eigenschaften durch entsprechende Prüfmethoden bestimmt werden. Die Einstufung und die Kennzeichnung müssen einen entsprechenden Hinweis auf diese Eigenschaften enthalten.
Die für diesen Stoff aufgeführte Einstufung und Kennzeichnung gilt für die gefährliche/-n Eigenschaft/-en, auf die der/die Gefahrenhinweis/-e im Zusammenhang mit der/den betreffenden Gefahrenklasse/-n und –kategorie/-n verweist/-en. Die Vorschriften von Artikel 4 für Hersteller, Importeure oder nachgeschaltete Anwender dieses Stoffes gelten für alle anderen Gefahrenklassen und –kategorien. Für Gefahrenklassen, bei denen der Expositionsweg oder die Art der Wirkungen zu einer Differenzierung der Einstufung der Gefahrenklasse führt, muss der Hersteller, Importeur oder nachgeschaltete Anwender diejenigen Expositionswege oder Wirkungsarten berücksichtigen, die noch nicht berücksichtigt worden sind.
Das endgültige Kennzeichnungsetikett hat den Anforderungen von Anhang I Kapitel 1.2 zu entsprechen.
Die für diesen Stoff anzuwendende Einstufung und das entsprechende Kennzeichnungsetikett gelten für die in dem/den R-Satz/R-Sätzen im Zusammenhang mit den betreffenden Gefahrenkategorien erwähnte/-n gefährliche/-n Eigenschaft/-en. Die Hersteller, Importeure und nachgeschalteten Anwender sind verpflichtet, Nachforschungen anzustellen, um sich für die Einstufung und Kennzeichnung des Stoffes die einschlägigen und zugänglichen Daten zu allen anderen Eigenschaften zu verschaffen. Das endgültige Kennzeichnungsetikett muss den Anforderungen von Teil 7 des Anhangs VI der Richtlinie 67/548/EWG entsprechen.
0,1
0,1
Die Einstufung als karzinogen ist nicht zwingend, wenn nachgewiesen werden kann, dass der Stoff weniger als 3 % DMSO-Extrakt, gemessen nach dem Verfahren IP 346 („Bestimmung der polyzyklischen Aromate in nicht verwendeten Schmierölen und asphaltenfreien Erdölfraktionen — Dimethylsulfoxid-Extraktion-Brechungsindex-Methode“, Institute of Petroleum, London), enthält. Diese Anmerkung gilt nur für bestimmte komplexe Ölderivate in Teil 3.
0,005
Die Einstufung als karzinogen ist nicht zwingend, wenn der ganze Raffinationsprozess bekannt ist und nachgewiesen werden kann, dass der Ausgangsstoff nicht karzinogen ist. Diese Anmerkung gilt nur für bestimmte komplexe Ölderivate in Teil 3.
0,1
Ist der Stoff nicht als karzinogen eingestuft, so sind zumindest die Sicherheitshinweise (102-)260-262-301 + 310-331 (Tabelle 3.1) oder die S-Sätze (2-)23-24-62 (Tabelle 3.2) anzuwenden.
Diese Anmerkung gilt nur für bestimmte komplexe Ölderivate in Teil 3.
Die Einstufung als karzinogen ist nicht zwingend, wenn nachgewiesen werden kann, dass der Stoff eine der nachstehenden Bedingungen erfüllt:
Mit einem Kurzzeit-Inhalationsbiopersistenztest wurde nachgewiesen, dass die gewichtete Halbwertszeit der Fasern mit einer Länge von über 20 μm weniger als 10 Tage beträgt.
Mit einem Kurzzeit-Intratrachealbiopersistenztest wurde nachgewiesen, dass die gewichtete Halbwertszeit der Fasern mit einer Länge von über 20 μm weniger als 40 Tage beträgt.
Bei einem geeigneten Intraperitonealtest ergaben sich keine Belege für übermäßige Karzinogenität.
Bei einem geeigneten Langzeit-Inhalationstest blieben eine relevante Pathogenität oder neoplastische Veränderungen aus.
Die Einstufung als karzinogen ist nicht zwingend für Fasern, bei denen der längengewichtete mittlere geometrische Durchmesser abzüglich der zweifachen geometrischen Standardabweichung größer ist als 6 μm.
Für diesen Stoff ist gegebenenfalls kein Kennzeichnungsetikett gemäß Artikel 17 erforderlich (siehe Anhang I Kapitel 1.3) (Tabelle 3.1).
Für diesen Stoff ist u. U. kein Kennzeichnungsetikett gemäß Artikel 23 der Richtlinie 67/548/EWG erforderlich (siehe Teil 8 des Anhangs VI jener Richtlinie) (Tabelle3.2).
Dieser Stoff kann in einer Form in Verkehr gebracht werden, die nicht die physikalischen Eigenschaften aufweist, wie im Einstufungseintrag in Teil 3 angegeben. Wenn die Ergebnisse der einschlägigen Methode/-n gemäß der Verordnung (EG) Nr. 440/2008 zeigen, dass die betreffende Form des in Verkehr gebrachten Stoffes diese physikalische/-n Eigenschaft/-en nicht aufweist, ist der Stoff gemäß den Ergebnissen dieser Prüfung/-en einzustufen. In das Sicherheitsdatenblatt sind die betreffenden Informationen aufzunehmen, einschließlich der Nennung der einschlägigen Prüfmethode/-n.
Beim Inverkehrbringen müssen die Gase als „Gase unter Druck“ in die Gruppe der verdichteten Gase, der verflüssigten Gase, der tiefgekühlten Gase oder der gelösten Gase eingestuft werden. Die Zuordnung zu einer Gruppe hängt vom Aggregatzustand ab, in dem das Gas verpackt wird, und muss deshalb von Fall zu Fall entschieden werden.
Die angegebenen Konzentrationen oder — bei Fehlen einer entsprechenden Angabe — die in der Verordnung festgelegten allgemeinen Konzentrationen (Tabelle 3.1) oder die in der Richtlinie 1999/45/EG festgelegten allgemeinen Konzentrationen sind als Gewichtsprozent des Metalls, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Die angegebenen Konzentrationen der Isocyanate sind als Gewichtsprozent des freien Monomers, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Die angegebenen Konzentrationen sind als Gewichtsprozent der in Wasser gelösten Chromationen, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Die Konzentrationsgrenzwerte für gasförmige Gemische werden in Volumenprozent angegeben.
0,5
2
Die Einstufung für jedes Gefährlichkeitsmerkmal (wie in Artikel 2 Absatz 2 der Richtlinie 67/548/EWG festgelegt) wird in der Regel in Form von Abkürzungen dargestellt, die dem jeweiligen Gefährlichkeitsmerkmal entsprechen, unter Angabe des/der entsprechenden R-Satzes/-Sätze. In bestimmten Fällen (z. B. bei Stoffen, die als entzündbar, sensibilisierend oder umweltgefährlich eingestuft wurden) wird jedoch lediglich der R-Satz angegeben.
Abkürzungen der einzelnen Gefährlichkeitsmerkmale:
explosiv: E
entzündend (oxidierend) wirkend: O
extrem entzündbar: F+
leicht entzündbar: F
entzündbar: R10
sehr giftig: T+
giftig: T
gesundheitsschädlich: Xn
ätzend: C
reizend: Xi
sensibilisierend: R42 und/oder R43
karzinogen: Carc. Cat. (1, 2 oder 3)
keimzellmutagen: Muta. Cat. (1, 2 or 3)
reproduktionstoxisch: Repr. Cat. (1, 2 oder 3)
umweltgefährlich: N oder R52 und/oder R53;
i) Buchstabe, der dem Stoff gemäß Anhang II der Richtlinie 67/548/EWG (siehe Artikel 23 Absatz 2 Buchstabe c der Richtlinie 67/548/EWG) zugeordnet ist. Dieser dient als Abkürzung des Symbols und der Gefahrenbezeichnung (falls diese zugeordnet wurden).
ii) Hinweise auf besondere Gefahren gemäß Anhang III der Richtlinie 67/548/EWG (siehe Artikel 23 Absatz 2 Buchstabe d der Richtlinie 67/548/EWG), die als eine Reihe von Ziffern mit vorangestelltem „R“ zur Bezeichnung der Art der besonderen Gefahren dargestellt werden. Zwischen den Ziffern steht ein Bindestrich (-) zur getrennten Angabe der besonderen Gefahren (R) oderein Schrägstrich (/) zur kombinierten Angabe der besonderen Gefahren in einem einzigen Satz gemäß Anhang III.
iii) Sicherheitsratschläge gemäß Anhang IV der Richtlinie 67/548/EWG (siehe Artikel 23 Absatz 2 Buchstabe e der Richtlinie 67/548/EWG), die als eine Reihe von Ziffern mit vorangestelltem „S“ dargestellt werden und die empfohlenen Sicherheitsvorkehrungen wiedergeben. Auch hier werden die Ziffern entweder durch einen Bindestrich oder durch einen Schrägstrich getrennt. Die Bedeutung der empfohlenen Sicherheitsratschläge ist in Anhang IV der Richtlinie 67/548/EWG dargelegt. Die angegebenen Sicherheitsratschläge beziehen sich ausschließlich auf Stoffe; bei Zubereitungen werden die Sätze nach dem üblichen Verfahren ausgewählt.
Konzentrationsgrenzwerte und die entsprechenden toxikologischen Einstufungen, die für eine Einstufung der den entsprechenden Stoff enthaltenden gefährlichen Gemische gemäß der Richtlinie 1999/45/EG erforderlich sind.
Sofern nicht anders angegeben, sind die aufgeführten Konzentrationsgrenzwerte als Gewichtsprozent, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Wenn keine Konzentrationsgrenzwerte angegeben sind, gelten bei Anwendung der konventionellen Methode zur Bewertung des Gesundheitsrisikos die Konzentrationsgrenzwerte des Anhangs II und bei Anwendung der konventionellen Methode zur Bewertung des Umweltrisikos die Konzentrationsgrenzwerte des Anhangs III der Richtlinie 1999/45/EWG des Europäischen Parlaments und des Rates.
Es wird empfohlen, die physikalischen Gefahren einiger Einträge in Tabelle 3.2 im Rahmen einer künftigen Anpassung an den technischen Fortschritt zu aktualisieren.
Solange diese Einträge nicht aktualisiert sind, stimmen die physikalischen Gefahren der entsprechenden Einträge in den beiden Tabellen nicht miteinander überein. Diese Einträge sind in Tabelle 3.2 durch „⊗“gekennzeichnet.
Für bestimmte Gefahrenklassen, darunter akute Toxizität und spezifische Zielorgan-Toxizität (wiederholte Exposition), entspricht die Einstufung gemäß den Kriterien der Richtlinie 67/548/EWG nicht direkt der Einstufung in eine Gefahrenklasse und –kategorie gemäß dieser Verordnung. In diesen Fällen gilt die Einstufung in diesen Anhang als Mindesteinstufung. Diese Einstufung gilt, wenn keine der nachstehenden Bedingungen gegeben ist:
Der Hersteller oder Importeur hat Zugang zu in Anhang I Teil 1 genannten Daten oder anderen Informationen, die zur Einstufung in eine im Vergleich zur Mindesteinstufung strengere Kategorie führen. Dann gilt die strengere Einstufung in die höhere Kategorie.
Die Mindesteinstufung kann auf der Grundlage der Umwandlungstabelle in Anhang VII weiter verfeinert werden, wenn dem Hersteller oder Importeur der Aggregatzustand des bei der Prüfung auf akute Inhalationstoxizität verwendeten Stoffes bekannt ist. Die sich aus Anhang VII ergebende Einstufung tritt dann an die Stelle der in diesem Anhang angegebenen Mindesteinstufung, falls sie von dieser abweicht.
Die Mindesteinstufung in Bezug auf eine Kategorie ist in Tabelle 3.1 in der Spalte „Einstufung“ durch „*“ gekennzeichnet.
Das Zeichen „*“ ist auch in der Spalte „Spezifische Konzentrationsgrenzwerte und M-Faktoren“ zu finden, wo es anzeigt, dass für den betreffenden Eintrag bestimmte Konzentrationsgrenzwert für akute Toxizität gemäß der Richtlinie 67/548/EWG (Tabelle 3.2) gelten. Die Konzentrationsgrenzwerte können allerdings nicht in Konzentrationsgrenzwerte dieser Verordnung umgewandelt werden, was insbesondere im Fall einer Mindesteinstufung ausgeschlossen ist. Wenn das Zeichen „*“ angegeben wird, ist der Einstufung dieses Eintrags als akut toxisch dennoch besondere Beachtung beizumessen.
Für bestimmte Gefahrenklassen, z. B. STOT, sollte der Expositionsweg im Gefahrenhinweis nur dann angegeben werden, wenn schlüssig belegt ist, dass diese Gefahr gemäß den Kriterien des Anhangs I bei keinem anderen Expositionsweg besteht. Gemäß der Richtlinie 67/548/EWG wurde der Expositionsweg für Einstufungen als R48 angegeben, wenn Daten vorlagen, die eine Einstufung für diesen Expositionsweg rechtfertigten. Die Einstufung gemäß der Richtlinie 67/548/EWG, bei der der Expositionsweg angegeben ist, wurde in die entsprechende Klasse und Kategorie gemäß dieser Verordnung umgewandelt, jedoch mit einem allgemeinen Gefahrenhinweis ohne Angabe des Expositionswegs, da die erforderlichen Informationen nicht verfügbar sind.
**
Die Gefahrenhinweise H360 und H361 weisen darauf hin, dass allgemein Anlass zur Besorgnis aufgrund von Wirkungen sowohl auf die Fruchtbarkeit als auch auf die Entwicklung besteht: „Kann die Fruchtbarkeit beeinträchtigen oder das Kind im Mutterleib schädigen“/„Kann vermutlich die Fruchtbarkeit beeinträchtigen oder das Kind im Mutterleib schädigen“. Den Kriterien zufolge kann der allgemeine Gefahrenhinweis ersetzt werden durch den Gefahrenhinweis, der nur die Eigenschaft anzeigt, aufgrund deren Anlass zu Besorgnis besteht, falls entweder die Wirkungen auf die Fruchtbarkeit oder die Wirkungen auf die Entwicklung nachweislich nicht relevant sind.
Damit keine Informationen aus den harmonisierten Einstufungen für Wirkungen auf Fruchtbarkeit oder Entwicklung gemäß der Richtlinie 67/548/EWG verlorengehen, wurden die Einstufungen nur für Wirkungen übertragen, die bereits im Rahmen dieser Richtlinie eingestuft sind.
***
Für einige Einträge konnte eine ordnungsgemäße Einstufung nach physikalischen Gefahren nicht vorgenommen werden, da keine ausreichenden Daten für die Anwendung der Einstufungskriterien dieser Verordnung zur Verfügung stehen. Der betreffende Eintrag kann einer anderen (auch höheren) Kategorie oder sogar einer anderen Gefahrenklasse als den angegebenen Kategorien oder Gefahrenklassen zugeordnet werden. Die ordnungsgemäße Einstufung ist durch Prüfungen zu bestätigen.
****
In diesem Teil werden allgemeine Grundsätze für die Vorbereitung der Dossiers festgelegt, mit denen eine harmonisierte Einstufung und Kennzeichnung vorgeschlagen und begründet wird.
Für Methodik und Format der Dossiers sind die einschlägigen Teile der Abschnitte 1, 2 und 3 des Anhangs I der Verordnung (EG) Nr. 1907/2006 zugrunde zu legen.
Für sämtliche Dossiers sind alle einschlägigen Informationen aus Registrierungsdossiers zu berücksichtigen und es können weitere verfügbare Informationen verwendet werden. Für Gefahrenmerkmale, die der Agentur noch nicht unterbreitet wurden, ist dem Dossier eine qualifizierte Studienzusammenfassung beizulegen.
Ein Dossier für die harmonisierte Einstufung und Kennzeichnung muss Folgendes enthalten:
VorschlagDer Vorschlag umfasst die Identität des/der betreffenden Stoffe/-s und die vorgeschlagene harmonisierte Einstufung und Kennzeichnung.
Begründung der vorgeschlagenen Einstufung und KennzeichnungDie verfügbaren Informationen sind mit den Kriterien des Anhangs I Teile 2 bis 5 unter besonderer Berücksichtigung der allgemeinen Grundsätze in Teil 1 zu vergleichen und in dem Format, das in Teil B des Stoffsicherheitsberichts des Anhangs I der Verordnung (EG) Nr. 1907/2006 festgelegt ist, zu dokumentieren.
Begründung für andere Wirkungen auf GemeinschaftsebeneFür andere Wirkungen als karzinogene, keinzellmutagene, reproduktionstoxische und die Atemwege sensibilisierende Wirkungen muss begründet werden, dass ein Handeln auf Gemeinschaftsebene erforderlich ist. Dies gilt nicht für Wirkstoffe im Sinne der Richtlinie 91/414/EWG oder der Richtlinie 98/8/EG.
Tabelle 3.1: Die Liste der harmonisierten Einstufung und Kennzeichnung gefährlicher Stoffe ist in einem eigenen Band IIIa enthalten.
Tabelle 3.2: Die Liste der harmonisierten Einstufung und Kennzeichnung gefährlicher Stoffe aus Anhang I der Richtlinie 67/548/EWG ist in einem eigenen Band IIIb enthalten.
| Index-Nr. | Internationale chemische Bezeichnung | EG-Nr. | CAS-Nr. | Einstufung | Kennzeichnung | Spezifische Konzentrationsgrenzen, M-Faktoren | Anmerkungen | |||
| Gefahrenklasse, Gefahrenkategorie und Gefahrenkodierung | Kodierung der Gefahrenhinweise | Piktogramm, Kodierung der Signalworte | Kodierung der Gefahrenhinweise | Kodierung der ergänzenden Gefahrenmerkmale | ||||||
| 001-001-00-9 | hydrogen | 215-605-7 | 1333-74-0 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U | ||
| 001-002-00-4 | aluminium lithium hydride | 240-877-9 | 16853-85-3 | Water-react. 1 | H260 | GHS02Dgr | H260 | |||
| 001-003-00-X | sodium hydride | 231-587-3 | 7646-69-7 | Water-react. 1 | H260 | GHS02Dgr | H260 | |||
| 001-004-00-5 | calcium hydride | 232-189-2 | 7789-78-8 | Water-react. 1 | H260 | GHS02Dgr | H260 | |||
| 003-001-00-4 | lithium | 231-102-5 | ||||||||
| Index-Nr. | Internationale chemische Bezeichnung | EG-Nr. | CAS-Nr. | Einstufung | Kennzeichnung | Konzentrationsgrenzen | Anmerkungen |
| 001-001-00-9 | hydrogen | 215-605-7 | 1333-74-0 | F+; R12 | F+R: 12S: (2-)9-16-33 | ||
| 001-002-00-4 | aluminium lithium hydride | 240-877-9 | 16853-85-3 | F; R15 | FR: 15S: (2-)7/8-24/25-43 | ||
| 001-003-00-X | sodium hydride | 231-587-3 | 7646-69-7 | F; R15 | FR: 15S: (2-)7/8-24/25-43 | ||
| 001-004-00-5 | calcium hydride | 232-189-2 | 7789-78-8 | F; R15 | FR: 15S: (2-)7/8-24/25-43 | ||
| 003-001-00-4 | lithium | 231-102-5 | 7439-93-2 | F; R15R14C; R34 | F; CR: 14/15-34S: (1/2-)8-43-45 | ||
| 003-002-00-X | n-hexyllithium | 404-950-0 | 21369-64-2 | F; R15-17R14C; R35 | F; CR: 14/15-17-35S: (1/2-)6-16-26-30-36/37/39-43-45 | ||
| 004-001-00-7 | beryllium | 231-150-7 | 7440-41-7 | Carc. Cat. 2; R49T+; R26T; R25-48/23Xi; R36/37/38R43 |
| Augenschäd. 1Augenreiz. 2 |
| Sensibilisierung der Atemwege/Haut | Sens. Atemw. 1Sens. Haut 1 |
| Keimzell-Mutagenität | Mutag. 1AMutag. 1BMutag. 2 |
| Karzinogenität | Karz. 1AKarz. 1BKarz. 2 |
| Reproduktionstoxizität | Repr. 1ARepr. 1BRepr. 2Lakt. |
| Spezifische Zielorgan-Toxizität (einmalige Exposition) | STOT einm. 1STOT einm. 2STOT einm. 3 |
| Spezifische Zielorgan-Toxizität (wiederholte Exposition) | STOT wdh. 1STOT wdh. 2 |
| Aspirationsgefahr | Asp. 1 |
| Gewässergefährdend | Aqu. akut 1Aqu. chron. 1Aqu. chron. 2Aqu. chron. 3Aqu. chron. 4 |
| Schädigt die Ozonschicht | Ozon |
| 7439-93-2 |
| Water-react. 1Skin Corr. 1B |
| H260H314 |
| GHS02GHS05Dgr |
| H260H314 |
| EUH014 |
| 003-002-00-X | n-hexyllithium | 404-950-0 | 21369-64-2 | Water-react. 1Pyr. Sol. 1Skin Corr. 1A | H260H250H314 | GHS02GHS05Dgr | H260H250H314 | EUH014 |
| 004-001-00-7 | beryllium | 231-150-7 | 7440-41-7 | Carc. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H350iH330H301H372 **H319H335H315H317 | GHS06GHS08Dgr | H350iH330H301H372 **H319H335H315H317 |
| 004-002-00-2 | beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex | — | — | Carc. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H350iH330H301H372 **H319H335H315H317H411 | GHS06GHS08GHS09Dgr | H350iH330H301H372 **H319H335H315H317H411 | A |
| 004-003-00-8 | beryllium oxide | 215-133-1 | 1304-56-9 | Carc. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H350iH330H301H372 **H319H335H315H317 | GHS06GHS08Dgr | H350iH330H301H372 **H319H335H315H317 |
| 005-001-00-X | boron trifluoride | 231-569-5 | 7637-07-2 | Press. GasAcute Tox. 2 *Skin Corr. 1A | H330H314 | GHS04GHS06GHS05Dgr | H330H314 | EUH014 | U |
| 005-002-00-5 | boron trichloride | 233-658-4 | 10294-34-5 | Press. GasAcute Tox. 2 *Acute Tox. 2 *Skin Corr. 1B | H330H300H314 | GHS04GHS06GHS05Dgr | H330H300H314 | EUH014 | U |
| 005-003-00-0 | boron tribromide | 233-657-9 | 10294-33-4 | Acute Tox. 2 *Acute Tox. 2 *Skin Corr. 1A | H330H300H314 | GHS06GHS05Dgr | H330H300H314 | EUH014 |
| 005-004-00-6 | trialkylboranes, solid | — | — | Pyr. Sol. 1Skin Corr. 1B | H250H314 | GHS02GHS05Dgr | H250H314 | A |
| 005-004-01-3 | trialkylboranes, liquid | — | — | Pyr. Liq. 1Skin Corr. 1B | H250H314 | GHS02GHS05Dgr | H250H314 | A |
| 005-005-00-1 | trimethyl borate | 204-468-9 | 121-43-7 | Flam. Liq. 3Acute Tox. 4 * | H226H312 | GHS02GHS07Wng | H226H312 |
| 005-006-00-7 | dibutyltin hydrogen borate | 401-040-5 | 75113-37-0 | STOT RE 1Acute Tox. 4 *Acute Tox. 4 *Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H372 **H312H302H318H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H372 **H312H302H318H317H410 |
| 005-009-00-3 | tetrabutylammonium butyltriphenylborate | 418-080-4 | 120307-06-4 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 005-010-00-9 | N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate | 422-050-6 | 118612-00-3 | Carc. 2Acute Tox. 4 *Skin Irrit. 2Eye Dam. 1 | H351H302H315H318 | GHS08GHS05GHS07Dgr | H351H302H315H318 |
| 005-012-00-X | diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}ammonium butyltriphenylborate | 418-070-1 | 141714-54-7 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 006-001-00-2 | carbon monoxide | 211-128-3 | 630-08-0 | Flam. Gas 1Press. GasRepr. 1AAcute Tox. 3 *STOT RE 1 | H220H360D ***H331H372 ** | GHS02GHS04GHS06GHS08Dgr | H220H360D ***H331H372 ** | U |
| 006-002-00-8 | phosgene;carbonyl chloride | 200-870-3 | 75-44-5 | Press. GasAcute Tox. 2 *Skin Corr. 1B | H330H314 | GHS04GHS06GHS05Dgr | H330H314 | U |
| 006-003-00-3 | carbon disulphide | 200-843-6 | 75-15-0 | Flam. Liq. 2Repr. 2STOT RE 1Eye Irrit. 2Skin Irrit. 2 | H225H361fdH372 **H319H315 | GHS02GHS08GHS07Dgr | H225H361fdH372 **H319H315 | Repr. 2; H361fd: C ≥ 1 %STOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0.2 % ≤C < 1 % |
| 006-004-00-9 | calcium carbide | 200-848-3 | 75-20-7 | Water-react. 1 | H260 | GHS02Dgr | H260 | T |
| 006-005-00-4 | thiram (ISO);tetramethylthiuram disulphide | 205-286-2 | 137-26-8 | Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H373 **H319H315H317H400H410 | GHS08GHS07GHS09Wng | H332H302H373 **H319H315H317H410 | M=10 |
| 006-006-00-X | hydrogen cyanide;hydrocyanic acid | 200-821-6 | 74-90-8 | Flam. Liq. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H224H330H400H410 | GHS02GHS06GHS09Dgr | H224H330H410 |
| 006-006-01-7 | hydrogen cyanide … %;hydrocyanic acid … % | 200-821-6 | 74-90-8 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 | B |
| 006-007-00-5 | salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide | — | — | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 | EUH032 | A |
| 006-008-00-0 | antu (ISO);1-(1-naphthyl)-2-thiourea | 201-706-3 | 86-88-4 | Acute Tox. 2 *Carc. 2 | H300H351 | GHS06GHS08Dgr | H300H351 |
| 006-009-00-6 | 1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate;isolan | 204-318-2 | 119-38-0 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 006-010-00-1 | 5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate;dimetan | 204-525-8 | 122-15-6 | Acute Tox. 3 * | H301 | GHS06Dgr | H301 |
| 006-011-00-7 | carbaryl (ISO);1-naphthyl methylcarbamate | 200-555-0 | 63-25-2 | Carc. 2Acute Tox. 4 *Aquatic Acute 1 | H351H302H400 | GHS08GHS07GHS09Wng | H351H302H400 |
| 006-012-00-2 | ziram (ISO);zinc bis dimethyldithiocarbamate | 205-288-3 | 137-30-4 | Acute Tox. 2 *Acute Tox. 4 *STOT RE 2 *STOT SE 3Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H302H373 **H335H318H317H400H410 | GHS06GHS08GHS05GHS09Dgr | H330H302H373 **H335H318H317H410 | M=100 |
| 006-013-00-8 | metam-sodium (ISO);sodium methyldithiocarbamate | 205-293-0 | 137-42-8 | Acute Tox. 4 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H302H314H317H410 | EUH031 |
| 006-014-00-3 | nabam (ISO);disodium ethylenebis(N, N'-dithiocarbamate) | 205-547-0 | 142-59-6 | Acute Tox. 4 *STOT SE 3Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H335H317H410 | GHS07GHS09Wng | H302H335H317H410 |
| 006-015-00-9 | diuron (ISO);3-(3,4-dichlorophenyl)-1,1-dimethylurea | 206-354-4 | 330-54-1 | Carc. 2Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H302H373 **H400H410 | GHS08GHS07GHS09Wng | H351H302H373 **H410 |
| 006-016-00-4 | propoxur (ISO);2-isopropyloxyphenyl N-methylcarbamate;2-isopropoxyphenyl methylcarbamate | 204-043-8 | 114-26-1 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 006-017-00-X | aldicarb (ISO);2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime | 204-123-2 | 116-06-3 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H330H300H311H400H410 | GHS06GHS09Dgr | H330H300H311H410 |
| 006-018-00-5 | aminocarb (ISO);4-dimethylamino-3-tolyl methylcarbamate | 217-990-7 | 2032-59-9 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 |
| 006-019-00-0 | di-allate (ISO);S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate | 218-961-1 | 2303-16-4 | Carc. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H302H400H410 | GHS08GHS07GHS09Wng | H351H302H410 |
| 006-020-00-6 | barban (ISO);4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate | 202-930-4 | 101-27-9 | Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 006-021-00-1 | linuron (ISO);3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | 206-356-5 | 330-55-2 | Repr. 1BCarc. 2Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH351H302H373 **H400H410 | GHS08GHS07GHS09Dgr | H360DfH351H302H373 **H410 |
| 006-022-00-7 | decarbofuran (ISO);2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate | — | 1563-67-3 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 006-023-00-2 | mercaptodimethur (ISO);methiocarb (ISO);3,5-dimethyl-4-methylthiophenyl N-methylcarbamate | 217-991-2 | 2032-65-7 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 006-024-00-8 | proxan-sodium (ISO);sodium O-isopropyldithiocarbonate | 205-443-5 | 140-93-2 | Acute Tox. 4 *Skin Irrit. 2Aquatic Chronic 2 | H302H315H411 | GHS07GHS09Wng | H302H315H411 |
| 006-025-00-3 | allethrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate;bioallethrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [1]S-bioallethrin;(S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [2]esbiothrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] | 209-542-4 [1]249-013-5 [2][3] | 584-79-2 [1]28434-00-6 [2]84030-86-4 [3] | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H302H400H410 | GHS07GHS09Wng | H332H302H410 | C |
| 006-026-00-9 | carbofuran (ISO);2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate | 216-353-0 | 1563-66-2 | Acute Tox. 2 *Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H300H400H410 | GHS06GHS09Dgr | H330H300H410 |
| 006-028-00-X | dinobuton (ISO);2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate | 213-546-1 | 973-21-7 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 006-029-00-5 | dioxacarb (ISO);2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate | 230-253-4 | 6988-21-2 | Acute Tox. 3 *Aquatic Chronic 2 | H301H411 | GHS06GHS09Dgr | H301H411 |
| 006-030-00-0 | EPTC (ISO);S-ethyl dipropylthiocarbamate | 212-073-8 | 759-94-4 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-031-00-6 | formetanate (ISO);3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate | 244-879-0 | 22259-30-9 | Acute Tox. 2 *Acute Tox. 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H300H317H400H410 | GHS06GHS09Dgr | H330H300H317H410 |
| 006-032-00-1 | monolinuron (ISO);3-(4-chlorophenyl)-1-methoxy-1-methylurea | 217-129-5 | 1746-81-2 | Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H400H410 | GHS08GHS07GHS09Wng | H302H373 **H410 |
| 006-033-00-7 | metoxuron (ISO);3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea | 243-433-2 | 19937-59-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 006-034-00-2 | pebulate (ISO);N-butyl-N-ethyl-S-propylthiocarbamate | 214-215-4 | 1114-71-2 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 006-035-00-8 | pirimicarb (ISO);5,6-dimethyl-2-dimethylamino-pyrimidin-4-yl N,N-dimethylcarbamate | 245-430-1 | 23103-98-2 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 006-036-00-3 | benzthiazuron (ISO);1-benzothiazol-2-yl-3-methylurea | 217-685-9 | 1929-88-0 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-037-00-9 | promecarb (ISO);3-isopropyl-5-methylphenyl N-methylcarbamate | 220-113-0 | 2631-37-0 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 006-038-00-4 | sulfallate (ISO);2-chloroallyl N,N-dimethyldithiocarbamate | 202-388-9 | 95-06-7 | Carc. 1BAcute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 |
| 006-039-00-X | tri-allate (ISO);S—2,3,3-trichloroallyl diisopropylthiocarbamate | 218-962-7 | 2303-17-5 | Acute Tox. 4 *STOT RE 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H317H400H410 | GHS08GHS07GHS09Wng | H302H373 **H317H410 |
| 006-040-00-5 | 3-methylpyrazol-5-yl-dimethylcarbamate;monometilan | — | 2532-43-6 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 006-041-00-0 | dimethylcarbamoyl chloride | 201-208-6 | 79-44-7 | Carc. 1BAcute Tox. 3 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H350H331H302H319H335H315 | GHS06GHS08Dgr | H350H331H302H319H335H315 | Carc. 1B; H350: C ≥ 0,001 % |
| 006-042-00-6 | monuron (ISO);3-(4-chlorophenyl)-1,1-dimethylurea | 205-766-1 | 150-68-5 | Carc. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H302H400H410 | GHS08GHS07GHS09Wng | H351H302H410 |
| 006-043-00-1 | 3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate;monuron-TCA | — | 140-41-0 | Carc. 2Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H319H315H400H410 | GHS08GHS07GHS09Wng | H351H319H315H410 |
| 006-044-00-7 | isoproturon (ISO);3-(4-isopropylphenyl)-1,1-dimethylurea | 251-835-4 | 34123-59-6 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 | M=10 |
| 006-045-00-2 | methomyl (ISO);1-(methylthio)ethylideneamino N-methylcarbamate | 240-815-0 | 16752-77-5 | Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H300H400H410 | GHS06GHS09Dgr | H300H410 |
| 006-046-00-8 | bendiocarb (ISO);2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate | 245-216-8 | 22781-23-3 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H312H410 | GHS06GHS09Dgr | H331H301H312H410 |
| 006-047-00-3 | bufencarb (ISO);reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate | — | 8065-36-9 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 |
| 006-048-00-9 | ethiofencarb (ISO);2-(ethylthiomethyl)phenyl N-methylcarbamate | 249-981-9 | 29973-13-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 006-049-00-4 | dixanthogen;O,O-diethyl dithiobis(thioformate) | 207-944-4 | 502-55-6 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-050-00-X | 1,1-dimethyl-3-phenyluronium trichloroacetate;fenuron-TCA | — | 4482-55-7 | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 006-051-00-5 | ferbam (ISO);iron tris(dimethyldithiocarbamate) | 238-484-2 | 14484-64-1 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H400H410 | GHS07GHS09Wng | H319H335H315H410 |
| 006-052-00-0 | formetanate hydrochloride;3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate | 245-656-0 | 23422-53-9 | Acute Tox. 2 *Acute Tox. 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H300H317H400H410 | GHS06GHS09Dgr | H330H300H317H410 |
| 006-053-00-6 | isoprocarb (ISO);2-isopropylphenyl N-methylcarbamate | 220-114-6 | 2631-40-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 006-054-00-1 | mexacarbate (ISO);3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate | 206-249-3 | 315-18-4 | Acute Tox. 2 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H300H312H400H410 | GHS06GHS09Dgr | H300H312H410 |
| 006-055-00-7 | xylylcarb (ISO);3,4-dimethylphenyl N-methylcarbamate;3,4-xylyl methylcarbamate;MPMC | 219-364-9 | 2425-10-7 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 006-056-00-2 | metolcarb (ISO);m-tolyl methylcarbamate;MTMC | 214-446-0 | 1129-41-5 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 006-057-00-8 | nitrapyrin (ISO);2-chloro-6-trichloromethylpyridine | 217-682-2 | 1929-82-4 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 006-058-00-3 | noruron (ISO);1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea | — | 2163-79-3 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-059-00-9 | oxamyl (ISO);N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate; | 245-445-3 | 23135-22-0 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 4 *Aquatic Chronic 2 | H330H300H312H411 | GHS06GHS09Dgr | H330H300H312H411 |
| 006-060-00-4 | oxycarboxin (ISO);2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide | 226-066-2 | 5259-88-1 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 006-061-00-X | S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride;prothiocarb hydrochloride | 243-193-9 | 19622-19-6 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 006-062-00-5 | methyl 3,4-dichlorophenylcarbanilate;SWEP. | — | 1918-18-9 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-063-00-0 | thiobencarb (ISO);S-4-chlorobenzyl diethylthiocarbamate | 248-924-5 | 28249-77-6 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 006-064-00-6 | thiofanox (ISO);3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime | 254-346-4 | 39196-18-4 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 006-065-00-1 | 3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime;triamid | — | 15271-41-7 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Chronic 2 | H300H311H411 | GHS06GHS09Dgr | H300H311H411 |
| 006-066-00-7 | vernolate (ISO);S-propyl dipropylthiocarbamate | 217-681-7 | 1929-77-7 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 006-067-00-2 | XMC;3,5-xylyl methylcarbamate | — | 2655-14-3 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 006-068-00-8 | diazomethane | 206-382-7 | 334-88-3 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 006-069-00-3 | thiophanate-methyl (ISO);1,2-di-(3-methoxycarbonyl-2-thioureido)benzene | 245-740-7 | 23564-05-8 | Muta. 2Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H332H317H400H410 | GHS08GHS07GHS09Wng | H341H332H317H410 |
| 006-070-00-9 | furmecyclox (ISO);N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide | 262-302-0 | 60568-05-0 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 006-071-00-4 | cyclooct-4-en-1-yl methyl carbonate | 401-620-8 | 87731-18-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 006-072-00-X | prosulfocarb (ISO);S-benzyl N,N-dipropylthiocarbamate | 401-730-6 | 52888-80-9 | Acute Tox. 4 *Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 006-073-00-5 | 3-(dimethylamino)propylurea | 401-950-2 | 31506-43-1 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 006-074-00-0 | 2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate | 402-440-2 | 2094-99-7 | Acute Tox. 2 *Skin Corr. 1BSTOT RE 2 *Resp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H314H373 **H334H317H400H410 | GHS06GHS08GHS05GHS09Dgr | H330H314H373 **H334H317H410 |
| 006-076-00-1 | mancozeb (ISO) | — | 8018-01-7 | STOT SE 3Skin Sens. 1 | H335H317 | GHS07Wng | H335H317 |
| 006-077-00-7 | maneb (ISO) | 235-654-8 | 12427-38-2 | STOT SE 3Skin Sens. 1 | H335H317 | GHS07Wng | H335H317 |
| 006-078-00-2 | zineb (ISO);zinc ethylenebis(dithiocarbamate) (polymeric) | 235-180-1 | 12122-67-7 | STOT SE 3Skin Sens. 1 | H335H317 | GHS07Wng | H335H317 |
| 006-079-00-8 | disulfiram;tetraethylthiuramdisulfide | 202-607-8 | 97-77-8 | Acute Tox. 4 *STOT RE 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H317H400H410 | GHS08GHS07GHS09Wng | H302H373 **H317H410 |
| 006-080-00-3 | tetramethylthiuram monosulphide | 202-605-7 | 97-74-5 | Acute Tox. 4 *Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 006-081-00-9 | zinc bis(dibutyldithiocarbamate) | 205-232-8 | 136-23-2 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H317H400H410 | GHS07GHS09Wng | H319H335H315H317H410 |
| 006-082-00-4 | zinc bis(diethyldithiocarbamate) | 238-270-9 | 14324-55-1 | Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H315H317H400H410 | GHS07GHS09Wng | H302H319H335H315H317H410 |
| 006-083-00-X | butocarboxim (ISO);3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime | 252-139-3 | 34681-10-2 | Flam. Liq. 3Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H226H331H311H301H319H400H410 | GHS02GHS06GHS09Dgr | H226H331H311H301H319H410 |
| 006-084-00-5 | carbosulfan (ISO);2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate | 259-565-9 | 55285-14-8 | Acute Tox. 3 *Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H301H317H400H410 | GHS06GHS09Dgr | H331H301H317H410 |
| 006-085-00-0 | fenobucarb (ISO);2-butylphenyl methylcarbamate | 223-188-8 | 3766-81-2 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 006-086-00-6 | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate;fenoxycarb | 276-696-7 | 72490-01-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 006-087-00-1 | 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate;furathiocarb | 265-974-3 | 65907-30-4 | Acute Tox. 2 *Acute Tox. 3 *STOT RE 2 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H301H373 **H319H315H317H400H410 | GHS06GHS08GHS09Dgr | H330H301H373 **H319H315H317H410 |
| 006-088-00-7 | benfuracarb;ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate | — | 82560-54-1 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 |
| 006-089-00-2 | chlorine dioxide | 233-162-8 | 10049-04-4 | Ox. Gas 1Press. GasAcute Tox. 2 *Skin Corr. 1BAquatic Acute 1 | H270H330H314H400 | GHS03GHS04GHS06GHS05GHS09Dgr | H270H330H314H400 | EUH006 | M=1000 | U |
| 006-089-01-X | chlorine dioxide . . . % | 233-162-8 | 10049-04-4 | Acute Tox. 3 *Skin Corr. 1BAquatic Acute 1 | H301H314H400 | GHS06GHS05GHS09Dgr | H301H314H400 | Skin Corr. 1B; H314: C ≥ 10 %Skin Irrit. 2; H315: 3 % ≤ C < 10 %Eye Irrit. 2; H319: 0,3 % ≤ C < 10 %STOT SE 3; H335: C ≥ 3 %M=10 | B |
| 006-090-00-8 | 2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate | 408-010-0 | 88558-41-2 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 3 | H332H318H412 | GHS05GHS07Dgr | H332H318H412 |
| 007-001-00-5 | ammonia, anhydrous | 231-635-3 | 7664-41-7 | Flam. Gas 2Press. GasAcute Tox. 3 *Skin Corr. 1BAquatic Acute 1 | H221H331H314H400 | GHS04GHS06GHS05GHS09Dgr | H221H331H314H400 | U |
| 007-001-01-2 | ammonia ….% | 215-647-6 | 1336-21-6 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | STOT SE 3; H335: C ≥ 5 % | B |
| 007-002-00-0 | nitrogen dioxide; [1]dinitrogen tetraoxide [2] | 233-272-6 [1]234-126-4 [2] | 10102-44-0 [1]10544-72-6 [2] | Press. GasAcute Tox. 2 *Skin Corr. 1B | H330H314 | GHS04GHS06GHS05Dgr | H330H314 | * | U5 |
| 007-003-00-6 | chlormequat chloride (ISO);2-chloroethyltrimethylammonium chloride | 213-666-4 | 999-81-5 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 007-004-00-1 | nitric acid … % | 231-714-2 | 7697-37-2 | Ox. Liq. 3Skin Corr. 1A | H272H314 | GHS03GHS05Dgr | H272H314 | Skin Corr. 1A; H314: C ≥ 20 %Skin Corr. 1B; H314: 5 % ≤ C < 20 %Ox. Liq. 3; H272: C ≥ 65 % | B |
| 007-006-00-2 | ethyl nitrite | 203-722-6 | 109-95-5 | Flam. Gas 1Press. GasAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H220H332H312H302 | GHS02GHS04GHS07Dgr | H220H332H312H302 | U |
| 007-007-00-8 | ethyl nitrate | 210-903-3 | 625-58-1 | Unst. Expl. | H200 | GHS01Dgr | H200 |
| 007-008-00-3 | hydrazine | 206-114-9 | 302-01-2 | Flam. Liq. 3Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H226H350H331H311H301H314H317H400H410 | GHS02GHS06GHS08GHS05GHS09Dgr | H226H350H331H311H301H314H317H410 | Skin Corr. 1B; H314: C ≥ 10 %Skin Irrit. 2; H315: 3 % ≤ C < 10 %Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
| 007-009-00-9 | dicyclohexylammonium nitrite | 221-515-9 | 3129-91-7 | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 | * |
| 007-010-00-4 | sodium nitrite | 231-555-9 | 7632-00-0 | Ox. Sol. 3Acute Tox. 3 *Aquatic Acute 1 | H272H301H400 | GHS03GHS06GHS09Dgr | H272H301H400 | * |
| 007-011-00-X | potassium nitrite | 231-832-4 | 7758-09-0 | Ox. Sol. 2Acute Tox. 3 *Aquatic Acute 1 | H272H301H400 | GHS03GHS06GHS09Dgr | H272H301H400 | * |
| 007-012-00-5 | N,N-dimethylhydrazine | 200-316-0 | 57-14-7 | Flam. Liq. 2Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Chronic 2 | H225H350H331H301H314H411 | GHS02GHS06GHS08GHS05GHS09Dgr | H225H350H331H301H314H411 |
| 007-013-00-0 | 1,2-dimethylhydrazine | — | 540-73-8 | Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Chronic 2 | H350H331H311H301H411 | GHS06GHS08GHS09Dgr | H350H331H311H301H411 | Carc. 1B; H350: C ≥ 0.01 % |
| 007-014-00-6 | salts of hydrazine | — | — | Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H331H311H301H317H400H410 | GHS06GHS08GHS09Dgr | H350H331H311H301H317H410 | A |
| 007-015-00-1 | O-ethylhydroxylamine | 402-030-3 | 624-86-2 | Flam. Liq. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1Eye Irrit. 2Skin Sens. 1Aquatic Acute 1 | H225H331H311H301H372 **H319H317H400 | GHS02GHS06GHS08GHS09Dgr | H225H331H311H301H372 **H319H317H400 |
| 007-016-00-7 | butyl nitrite | 208-862-1 | 544-16-1 | Flam. Liq. 2Acute Tox. 3 *Acute Tox. 3 * | H225H331H301 | GHS02GHS06Dgr | H225H331H301 |
| 007-017-00-2 | isobutyl nitrite | 208-819-7 | 542-56-3 | Flam. Liq. 2Carc. 1BMuta. 2Acute Tox. 4 *Acute Tox. 4 * | H225H350H341H332H302 | GHS02GHS08GHS07Dgr | H225H350H341H332H302 |
| 007-018-00-8 | sec-butyl nitrite | 213-104-8 | 924-43-6 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 * | H225H332H302 | GHS02GHS07Dgr | H225H332H302 |
| 007-019-00-3 | tert-butyl nitrite | 208-757-0 | 540-80-7 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 * | H225H332H302 | GHS02GHS07Dgr | H225H332H302 |
| 007-020-00-9 | pentyl nitrite; [1]’amyl nitrite’, mixed isomers [2] | 207-332-7 [1]203-770-8 [2] | 463-04-7 [1]110-46-3 [2] | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 * | H225H332H302 | GHS02GHS07Dgr | H225H332H302 |
| 007-021-00-4 | hydrazobenzene;1,2-diphenylhydrazine | 204-563-5 | 122-66-7 | Carc. 1BAcute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 |
| 007-022-00-X | hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) | 405-030-1 | — | Carc. 1BAcute Tox. 4 *Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H350H302H314H317H412 | GHS08GHS05GHS07Dgr | H350H302H314H317H412 |
| 007-023-00-5 | sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate | 405-510-0 | — | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 007-024-00-0 | 2-(decylthio)ethylammonium chloride | 405-640-8 | 36362-09-1 | STOT RE 2 *Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H373 **H315H318H400H410 | GHS08GHS05GHS09Dgr | H373 **H315H318H410 |
| 007-025-00-6 | (4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride | 406-090-1 | 81880-96-8 | Muta. 2Acute Tox. 3 *STOT RE 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H301H372 **H317H400H410 | GHS06GHS08GHS09Dgr | H341H301H372 **H317H410 |
| 007-026-00-1 | oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide | 413-230-5 | 122035-71-6 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 007-027-00-7 | 1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane | 420-190-2 | 771478-66-1 | Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H373 **H314H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H312H302H373 **H314H317H410 |
| 008-001-00-8 | oxygen | 231-956-9 | 7782-44-7 | Ox. Gas 1Press. Gas | H270 | GHS03GHS04Dgr | H270 | U |
| 008-003-00-9 | hydrogen peroxide solution ... % | 231-765-0 | 7722-84-1 | Ox. Liq. 1Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1A | H271H332H302H314 | GHS03GHS05GHS07Dgr | H271H332H302H314 | Ox. Liq. 1; H271: C ≥ 70 %****Ox. Liq. 2; H272: 50 % ≤ C < 70 %*****Skin Corr. 1A; H314: C ≥ 70 %Skin Corr. 1B; H314: 50 % ≤ C < 70 %Skin Irrit. 2; H315: 35 % ≤ C < 50 %Eye Dam. 1; H318: 8 % ≤ C < 50 %Eye Irrit. 2; H319: 5 % ≤ C < 8 %STOT SE 3; H335; C ≥ 35 % | B |
| 009-001-00-0 | fluorine | 231-954-8 | 7782-41-4 | Ox. Gas 1Press. GasAcute Tox. 2 *Skin Corr. 1A | H270H330H314 | GHS03GHS04GHS06GHS05Dgr | H270H330H314 | U |
| 009-002-00-6 | hydrogen fluoride | 231-634-8 | 7664-39-3 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Skin Corr. 1A | H330H310H300H314 | GHS06GHS05Dgr | H330H310H300H314 |
| 009-003-00-1 | hydrofluoric acid ... % | 231-634-8 | 7664-39-3 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Skin Corr. 1A | H330H310H300H314 | GHS06GHS05Dgr | H330H310H300H314 | Skin Corr. 1A; H314: C ≥ 7 %Skin Corr. 1B; H314: 1 % ≤ C < 7 %Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % | B |
| 009-004-00-7 | sodium fluoride | 231-667-8 | 7681-49-4 | Acute Tox. 3 *Eye Irrit. 2Skin Irrit. 2 | H301H319H315 | GHS06Dgr | H301H319H315 | EUH032 |
| 009-005-00-2 | potassium fluoride | 232-151-5 | 7789-23-3 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 009-006-00-8 | ammonium fluoride | 235-185-9 | 12125-01-8 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 009-007-00-3 | sodium bifluoride;sodium hydrogen difluoride | 215-608-3 | 1333-83-1 | Acute Tox. 3 *Skin Corr. 1B | H301H314 | GHS06GHS05Dgr | H301H314 | *Skin Corr. 1B; H314: C ≥ 1 %Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
| 009-008-00-9 | potassium bifluoride;potassium hydrogen difluoride | 232-156-2 | 7789-29-9 | Acute Tox. 3 *Skin Corr. 1B | H301H314 | GHS06GHS05Dgr | H301H314 | *Skin Corr. 1B; H314: C ≥ 1 %Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
| 009-009-00-4 | ammonium bifluoride;ammonium hydrogen difluoride | 215-676-4 | 1341-49-7 | Acute Tox. 3 *Skin Corr. 1B | H301H314 | GHS06GHS05Dgr | H301H314 | *Skin Corr. 1B; H314: C ≥ 1 %Skin Irrit. 2; H315: 0,1 % ≤ C < 1 %Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
| 009-010-00-X | fluoroboric acid ... % | 240-898-3 | 16872-11-0 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % | B |
| 009-011-00-5 | fluorosilicic acid ... % | 241-034-8 | 16961-83-4 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | B |
| 009-012-00-0 | alkali fluorosilicates(Na); [1]alkali fluorosilicates(K); [2]alkali fluorosilicates(NH4) [3] | 240-934-8 [1]240-896-2 [2]240-968-3 [3] | 16893-85-9 [1]16871-90-2 [2]16919-19-0 [3] | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 | * | A |
| 009-013-00-6 | fluorosilicates, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 4 * | H302 | GHS07Wng | H302 | * | A |
| 009-014-00-1 | lead hexafluorosilicate | 247-278-1 | 25808-74-6 | Repr. 1AAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH332H302H373 **H400H410 | GHS08GHS07GHS09Dgr | H360DfH332H302H373 **H410 | 1 |
| 009-015-00-7 | sulphuryl difluoride | 220-281-5 | 2699-79-8 | Press. GasAcute Tox. 3 *STOT RE 2 *Aquatic Acute 1 | H331H373 **H400 | GHS04GHS06GHS08GHS09Dgr | H331H373 **H400 | U |
| 009-016-00-2 | trisodium hexafluoroaluminate;cryolite | 237-410-6239-148-8 | 13775-53-615096-52-3 | STOT RE 1Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H372 **H332H302H411 | GHS08GHS07GHS09Dgr | H372 **H332H302H411 | C |
| 009-017-00-8 | potassium mu-fluoro-bis(triethylaluminium) | 400-040-2 | 12091-08-6 | Flam. Sol. 1Water-react. 1Skin Corr. 1AAcute Tox. 4 * | H228H270H314H332 | GHS02GHS05GHS07Dgr | H228H270H314H332 | EUH014 | T |
| 009-018-00-3 | magnesium hexafluorosilicate | 241-022-2 | 16949-65-8 | Acute Tox. 3 * | H301 | GHS06Dgr | H301 | * |
| 011-001-00-0 | sodium | 231-132-9 | 7440-23-5 | Water-react. 1Skin Corr. 1B | H260H314 | GHS02GHS05Dgr | H260H314 | EUH014 |
| 011-002-00-6 | sodium hydroxide;caustic soda | 215-185-5 | 1310-73-2 | Skin Corr. 1A | H314 | GHS05Dgr | H314 | Skin Corr. 1A; H314: C ≥ 5 %Skin Corr. 1B; H314: 2 % ≤ C < 5 %Skin Irrit. 2; H315: 0,5 % ≤ C < 2 %Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
| 011-003-00-1 | sodium peroxide | 215-209-4 | 1313-60-6 | Ox. Sol. 1Skin Corr. 1A | H271H314 | GHS03GHS05Dgr | H271H314 |
| 011-004-00-7 | sodium azide | 247-852-1 | 26628-22-8 | Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H300H400H410 | GHS06GHS09Dgr | H300H400H410 | EUH032 |
| 011-005-00-2 | sodium carbonate | 207-838-8 | 497-19-8 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 011-006-00-8 | sodium cyanate | 213-030-6 | 917-61-3 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 011-007-00-3 | propoxycarbazone-sodium | — | 181274-15-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 | M=10 |
| 012-001-00-3 | magnesium powder (pyrophoric) | 231-104-6 | 7439-95-4 | Water-react. 1Pyr. Sol. 1 | H260H250 | GHS02Dgr | H260H250 | T |
| 012-002-00-9 | magnesium, powder or turnings | 231-104-6 | — | Flam. Sol. 1Water-react. 2Self-heat. 1 | H228H261H252 | GHS02Dgr | H228H261H252 | T |
| 012-003-00-4 | magnesium alkyls | — | — | Pyr. Liq. 1Water-react. 1Skin Corr. 1B | H250H260H314 | GHS02GHS05Dgr | H250H260H314 | EUH014 | A |
| 013-001-00-6 | aluminium powder (pyrophoric) | 231-072-3 | 7429-90-5 | Water-react. 2Pyr. Sol. 1 | H261H250 | GHS02Dgr | H261H250 | T |
| 013-002-00-1 | aluminium powder (stabilised) | 231-072-3 | — | Water-react. 2Flam.Sol. 3 | H261H228 | GHS02Dgr | H261H228 | T |
| 013-003-00-7 | aluminium chloride, anhydrous | 231-208-1 | 7446-70-0 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 013-004-00-2 | aluminium alkyls | — | — | Pyr. Liq. 1Water-react. 1Skin Corr. 1B | H250H260H314 | GHS02GHS05Dgr | H250H260H314 | EUH014 | A |
| 013-005-00-8 | diethyl(ethyldimethylsilanolato)aluminium | 401-160-8 | 55426-95-4 | Water-react. 1Pyr. Liq. 1Skin Corr. 1A | H260H250H314 | GHS02GHS05Dgr | H260H250H314 | EUH014 |
| 013-006-00-3 | (ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised | 402-370-2 | — | Flam. Liq. 3Eye Dam. 1 | H226H318 | GHS02GHS05Dgr | H226H318 |
| 013-007-00-9 | poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) | 403-430-0 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 013-008-00-4 | di-n-octylaluminium iodide | 408-190-0 | 7585-14-0 | Pyr. Liq. 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H250H314H400H410 | GHS02GHS05GHS09Dgr | H250H314H410 | EUH014 |
| 013-009-00-X | sodium (n-butyl)x(ethyl)y-1,5-dihydro)aluminate x = 0.5 y = 1.5 | 418-720-2 | — | Flam. Sol. 1Water-react. 1Pyr. Sol. 1Acute Tox. 4 *Skin Corr. 1A | H228H260H250H332H314 | GHS02GHS05GHS07Dgr | H228H260H250H332H314 | EUH014 | T |
| 014-001-00-9 | trichlorosilane | 233-042-5 | 10025-78-2 | Flam. Liq. 1Pyr. Liq. 1Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1A | H224H250H332H302H314 | GHS02GHS05GHS07Dgr | H224H250H332H302H314 | EUH014EUH029 | *STOT SE 3; H335: C ≥ 1 % | T |
| 014-002-00-4 | silicon tetrachloride | 233-054-0 | 10026-04-7 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | EUH014 |
| 014-003-00-X | dimethyldichlorosilane | 200-901-0 | 75-78-5 | Flam. Liq. 2Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H225H319H335H315 | GHS02GHS07Dgr | H225H319H335H315 |
| 014-004-00-5 | trichloro(methyl)silane;methyltrichlorosilane | 200-902-6 | 75-79-6 | Flam. Liq. 2Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H225H319H335H315 | GHS02GHS07Dgr | H225H319H335H315 | EUH014 | Skin Irrit. 2; H315: C ≥ 1 %Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % |
| 014-005-00-0 | tetraethyl silicate;ethyl silicate | 201-083-8 | 78-10-4 | Flam. Liq. 3Acute Tox. 4 *Eye Irrit. 2STOT SE 3 | H226H332H319H335 | GHS02GHS07Wng | H226H332H319H335 |
| 014-006-00-6 | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride | 401-380-4 | — | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 014-007-00-1 | triethoxyisobutylsilane | 402-810-3 | 17980-47-1 | Skin Irrit. 2 | H315 | GHS07Wng | H315 |
| 014-008-00-7 | (chloromethyl)bis(4-fluorophenyl)methylsilane | 401-200-4 | 85491-26-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 014-009-00-2 | isobutylisopropyldimethoxysilane | 402-580-4 | 111439-76-0 | Flam. Liq. 3Acute Tox. 4 *Skin Irrit. 2 | H226H332H315 | GHS02GHS07Wng | H226H332H315 |
| 014-010-00-8 | disodium metasilicate | 229-912-9 | 6834-92-0 | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 |
| 014-011-00-3 | cyclohexyldimethoxymethylsilane | 402-140-1 | 17865-32-6 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 014-012-00-9 | bis(3-(trimethoxysilyl)propyl)amine | 403-480-3 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 014-013-00-4 | α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) | 404-920-7 | — | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 2 | H312H302H314H411 | GHS05GHS07GHS09Dgr | H312H302H314H411 |
| 014-014-00-X | etacelasil (ISO);6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane | 253-704-7 | 37894-46-5 | Repr. 1BAcute Tox. 4 *STOT RE 2 * | H360D ***H302H373 ** | GHS08GHS07Dgr | H360D ***H302H373 ** |
| 014-015-00-5 | α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]- co-oxy(dimethylsilane)) | 406-420-4 | 69430-40-6 | Aquatic Chronic 4 | H413 | — | H413 |
| 014-016-00-0 | reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane;1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane | 406-490-6 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 014-017-00-6 | flusilazole (ISO);bis(4-fluorophenyl)(methyl)(1H—1,2,4-triazol-1-ylmethyl)silane | — | 85509-19-9 | Carc. 2Repr. 1BAcute Tox. 4 *Aquatic Chronic 2 | H351H360D ***H302H411 | GHS08GHS07GHS09Dgr | H351H360D ***H302H411 |
| 014-018-00-1 | octamethylcyclotetrasiloxane | 209-136-7 | 556-67-2 | Repr. 2Aquatic Chronic 4 | H361f ***H413 | GHS08Wng | H361f ***H413 |
| 014-019-00-7 | reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H—1,2,4-triazole;1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H—1,2,4-triazole | 403-250-2 | — | Carc. 2Repr. 1BAcute Tox. 4 *Aquatic Chronic 2 | H351H360D ***H302H411 | GHS08GHS07GHS09Dgr | H351H360D ***H302H411 |
| 014-020-00-2 | bis(1,1-dimethyl-2-propynyloxy)dimethylsilane | 414-960-7 | 53863-99-3 | Acute Tox. 4 * | H332 | GHS07Wng | H332 |
| 014-021-00-8 | tris(isopropenyloxy)phenyl silane | 411-340-8 | 52301-18-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H400H410 |
| 014-022-00-3 | reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) | 401-530-9 | — | Flam. Sol. 1STOT SE 1Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H228H370 **H332H312H302 | GHS02GHS08GHS07Dgr | H228H370 **H332H312H302 | T |
| 014-023-00-9 | α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole | 408-160-7 | 125613-45-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 014-024-00-4 | 1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene | 412-620-2 | 121626-74-2 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 014-025-00-X | 4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine | 411-400-3 | 102089-33-8 | Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H302H373 **H315H318H412 | GHS08GHS05GHS07Dgr | H302H373 **H315H318H412 |
| 014-026-00-5 | dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane | 407-180-3 | 770722-36-6 | Skin Corr. 1A | H314 | GHS05Dgr | H314 |
| 014-027-00-0 | chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane | 410-270-5 | 770722-46-8 | Skin Corr. 1A | H314 | GHS05Dgr | H314 |
| 014-028-00-6 | α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) | 415-290-8 | 193159-06-7 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 014-029-00-1 | O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] | 421-870-1 | 156145-66-3 | Repr. 2Acute Tox. 4 *STOT RE 2 * | H361f ***H302H373 ** | GHS08GHS07Wng | H361f ***H302H373 ** |
| 014-030-00-7 | [(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium | 422-060-0 | 137390-08-0 | Acute Tox. 2 * | H300 | GHS06Dgr | H300 |
| 014-031-00-2 | bis(1-methylethyl)-dimethoxysilane | 421-540-7 | 18230-61-0 | Flam. Liq. 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H226H315H317H412 | GHS02GHS07Wng | H226H315H317H412 |
| 014-032-00-8 | dicyclopentyldimethoxysilane | 404-370-8 | 126990-35-0 | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 015-001-00-1 | white phosphorus | 231-768-7 | 12185-10-3 | Pyr. Sol. 1Acute Tox. 2 *Acute Tox. 2 *Skin Corr. 1AAquatic Acute 1 | H250H330H300H314H400 | GHS02GHS06GHS05GHS09Dgr | H250H330H300H314H400 |
| 015-002-00-7 | red phosphorus | 231-768-7 | 7723-14-0 | Flam. Sol. 1Aquatic Chronic 3 | H228H412 | GHS02Dgr | H228H412 |
| 015-003-00-2 | calcium phosphide;tricalcium diphosphide | 215-142-0 | 1305-99-3 | Water-react. 1Acute Tox. 2 *Aquatic Acute 1 | H260H300H400 | GHS02GHS06GHS09Dgr | H260H300H400 | EUH029 | T |
| 015-004-00-8 | aluminium phosphide | 244-088-0 | 20859-73-8 | Water-react. 1Acute Tox. 2 *Aquatic Acute 1 | H260H300H400 | GHS02GHS06GHS09Dgr | H260H300H400 | EUH029EUH032 | T |
| 015-005-00-3 | magnesium phosphide;trimagnesium diphosphide | 235-023-7 | 12057-74-8 | Water-react. 1Acute Tox. 2 *Aquatic Acute 1 | H260H300H400 | GHS02GHS06GHS09Dgr | H260H300H400 | EUH029 | T |
| 015-006-00-9 | trizinc diphosphide;zinc phosphide | 215-244-5 | 1314-84-7 | Water-react. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H260H300H400H410 | GHS02GHS06GHS09Dgr | H260H300H410 | EUH029EUH032 | T |
| 015-007-00-4 | phosphorus trichloride | 231-749-3 | 7719-12-2 | Acute Tox. 2 *Acute Tox. 2 *STOT RE 2 *Skin Corr. 1A | H330H300H373 **H314 | GHS06GHS08GHS05Dgr | H330H300H373 **H314 | EUH014EUH029 |
| 015-008-00-X | phosphorus pentachloride | 233-060-3 | 10026-13-8 | Acute Tox. 2 *Acute Tox. 4 *STOT RE 2 *Skin Corr. 1B | H330H302H373 **H314 | GHS06GHS08GHS05Dgr | H330H302H373 **H314 | EUH014EUH029 |
| 015-009-00-5 | phosphoryl trichloride | 233-046-7 | 10025-87-3 | Acute Tox. 2 *STOT RE 1Acute Tox. 4 *Skin Corr. 1A | H330H372 **H302H314 | GHS06GHS08GHS05Dgr | H330H372 **H302H314 | EUH014EUH029 |
| 015-010-00-0 | phosphorus pentoxide | 215-236-1 | 1314-56-3 | Skin Corr. 1A | H314 | GHS05Dgr | H314 |
| 015-011-00-6 | phosphoric acid ... %, orthophosphoric acid ... % | 231-633-2 | 7664-38-2 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % | B |
| 015-012-00-1 | tetraphosphorus trisulphide;phosphorus sesquisulphid | 215-245-0 | 1314-85-8 | Flam. Sol. 2Water-react. 1Acute Tox. 4 *Aquatic Acute 1 | H228H260H302H400 | GHS02GHS07GHS09Dgr | H228H260H302H400 | T |
| 015-013-00-7 | triethyl phosphate | 201-114-5 | 78-40-0 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 015-014-00-2 | tributyl phosphate | 204-800-2 | 126-73-8 | Carc. 2Acute Tox. 4 *Skin Irrit. 2 | H351H302H315 | GHS08GHS07Wng | H351H302H315 |
| 015-015-00-8 | tricresyl phosphate (o—o—o-, o—o—m-, o—o—p-, o—m—m-, o—m—p-, o—p—p-);tritolyl phosphate (o—o—o-, o—o—m-, o—o—p-, o—m—m-, o—m—p-, o—p—p-); | 201-103-5 | 78-30-8 | STOT SE 1Aquatic Chronic 2 | H370 **H411 | GHS08GHS09Dgr | H370 **H411 | STOT SE 1; H370: C ≥ 1 %STOT SE 2; H371: 0,2 % ≤ C < 1 % | C |
| 015-016-00-3 | tricresyl phosphate (m—m—m-, m—m—p-, m—p—p-, p—p—p-);tritolyl phosphate (m—m—m-, m—m—p-, m—p—p-, p—p—p-); | 201-105-6 | 78-32-0 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H312H302H411 | GHS07GHS09Wng | H312H302H411 | * | C |
| 015-019-00-X | dichlorvos (ISO);2,2-dichlorovinyl dimethyl phosphate | 200-547-7 | 62-73-7 | Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1 | H330H311H301H317H400 | GHS06GHS09Dgr | H330H311H301H317H400 |
| 015-020-00-5 | mevinphos (ISO);2-methoxycarbonyl-1-methylvinyl dimethyl phosphate | 232-095-1 | 7786-34-7 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 | M=10000 |
| 015-021-00-0 | trichlorfon (ISO);dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate | 200-149-3 | 52-68-6 | Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H400H410 | M=1000 |
| 015-022-00-6 | phosphamidon (ISO);2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate | 236-116-5 | 13171-21-6 | Muta. 2Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H341H300H311H400H410 | GHS06GHS08GHS09Dgr | H341H300H311H410 |
| 015-023-00-1 | pyrazoxon;diethyl 3-methylpyrazol-5-yl phosphate | — | 108-34-9 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 * | H330H310H300 | GHS06Dgr | H330H310H300 |
| 015-024-00-7 | triamiphos (ISO);5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide | — | 1031-47-6 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-025-00-2 | TEPP (ISO);tetraethyl pyrophosphate | 203-495-3 | 107-49-3 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1 | H310H300H400 | GHS06GHS09Dgr | H310H300H400 |
| 015-026-00-8 | schradan (ISO);octamethylpyrophosphoramide | 205-801-0 | 152-16-9 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-027-00-3 | sulfotep (ISO);O,O,O,O-tetraethyl dithiopyrophosphate | 222-995-2 | 3689-24-5 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 | M=1000 |
| 015-028-00-9 | demeton-O (ISO);O,O-diethyl-O-2-ethylthioethyl phosphorothioate | 206-053-8 | 298-03-3 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1 | H310H300H400 | GHS06GHS09Dgr | H310H300H400 |
| 015-029-00-4 | demeton-S (ISO);diethyl-S-2-ethylthioethyl phosphorothioate | 204-801-8 | 126-75-0 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-030-00-X | demeton-O-methyl (ISO);O-2-ethylthioethyl O,O-dimethyl phosphorothioate | 212-758-1 | 867-27-6 | Acute Tox. 3 * | H301 | GHS06Dgr | H301 |
| 015-031-00-5 | demeton-S-methyl (ISO);S-2-ethylthioethyl dimethyl phosphorothioate | 213-052-6 | 919-86-8 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Chronic 2 | H311H301H411 | GHS06GHS09Dgr | H311H301H411 |
| 015-032-00-0 | prothoate (ISO);O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate | 218-893-2 | 2275-18-5 | Acute Tox. 1Acute Tox. 2 *Aquatic Chronic 3 | H310H300H412 | GHS06Dgr | H310H300H412 |
| 015-033-00-6 | phorate (ISO);O,O-diethyl ethylthiomethyl phosphorodithioate | 206-052-2 | 298-02-2 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 | M=1000 |
| 015-034-00-1 | parathion (ISO);O,O-diethyl O-4-nitrophenyl phosphorothioate | 200-271-7 | 56-38-2 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H330H300H311H372 **H400H410 | GHS06GHS08GHS09Dgr | H330H300H311H372 **H410 | M=100 |
| 015-035-00-7 | parathion — methyl (ISO);O,O-dimethyl O-4-nitrophenyl phosphorothioate | 206-050-1 | 298-00-0 | Flam. Liq. 3Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H226H330H300H311H373 **H400H410 | GHS02GHS06GHS08GHS09Dgr | H226H330H300H311H373 **H410 | M=100 |
| 015-036-00-2 | O-ethyl O-4-nitrophenyl phenylphosphonothioate;EPN | 218-276-8 | 2104-64-5 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-037-00-8 | phenkapton (ISO);S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate | 218-892-7 | 2275-14-1 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 |
| 015-038-00-3 | coumaphos (ISO);O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate | 200-285-3 | 56-72-4 | Acute Tox. 2 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H300H312H400H410 | GHS06GHS09Dgr | H300H312H410 |
| 015-039-00-9 | azinphos-methyl (ISO);O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate | 201-676-1 | 86-50-0 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H300H311H317H400H410 | GHS06GHS09Dgr | H330H300H311H317H410 |
| 015-040-00-4 | diazinon (ISO);O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate | 206-373-8 | 333-41-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H400H410 |
| 015-041-00-X | malathion (ISO);1,2-bis (ethoxycarbonyl) ethyl O,O-dimethyl phosphorodithioate | 204-497-7 | 121-75-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H400H410 | M=100 |
| 015-042-00-5 | chlorthionO-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate | 207-902-5 | 500-28-7 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | M=100 |
| 015-043-00-0 | phosnichlor (ISO);O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate | — | 5826-76-6 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H332H312H302 | GHS07Wng | H332H312H302 |
| 015-044-00-6 | carbophenothion (ISO);4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate | 212-324-1 | 786-19-6 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 |
| 015-045-00-1 | mecarbam (ISO);N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate | 219-993-9 | 2595-54-2 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H400H410 |
| 015-046-00-7 | oxydemeton-methyl;S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate | 206-110-7 | 301-12-2 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1 | H311H301H400 | GHS06GHS09Dgr | H311H301H400 |
| 015-047-00-2 | ethion (ISO);O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate);diethion | 209-242-3 | 563-12-2 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 | M=10000 |
| 015-048-00-8 | fenthion (ISO);O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate | 200-231-9 | 55-38-9 | Muta. 2Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H341H331H372 **H312H302H400H410 | GHS06GHS08GHS09Dgr | H341H331H372 **H312H302H410 |
| 015-049-00-3 | endothion (ISO);S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate | 220-472-3 | 2778-04-3 | Acute Tox. 3 *Acute Tox. 3 * | H311H301 | GHS06Dgr | H311H301 |
| 015-050-00-9 | thiometon (ISO);S-2-ethylthioethyl O,O-dimethyl phosphorodithioate | 211-362-6 | 640-15-3 | Acute Tox. 3 *Acute Tox. 4 * | H301H312 | GHS06Dgr | H301H312 |
| 015-051-00-4 | dimethoate (ISO);O,O-dimethyl methylcarbamoylmethyl phosphorodithioate | 200-480-3 | 60-51-5 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 015-052-00-X | fenchlorphos (ISO);O,O-dimethyl O—2,4,5-trichlorophenyl phosphorothioate | 206-082-6 | 299-84-3 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 015-053-00-5 | menazon (ISO);S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O, O-dimethyl phosphorodithioate | 201-123-4 | 78-57-9 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 015-054-00-0 | fenitrothion (ISO);O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate | 204-524-2 | 122-14-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 015-055-00-6 | naled (ISO);1,2-dibromo-2,2-dichloroethyl dimethyl phosphate | 206-098-3 | 300-76-5 | Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1 | H312H302H319H315H400 | GHS07GHS09Wng | H312H302H319H315H400 | M=1000 |
| 015-056-00-1 | azinphos-ethyl (ISO);O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate | 220-147-6 | 2642-71-9 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 015-057-00-7 | formothion (ISO);N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate | 219-818-6 | 2540-82-1 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 015-058-00-2 | morphothion (ISO);O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate | 205-628-0 | 144-41-2 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 |
| 015-059-00-8 | vamidothion (ISO);O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate | 218-894-8 | 2275-23-2 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1 | H301H312H400 | GHS06GHS09Dgr | H301H312H400 |
| 015-060-00-3 | disulfoton (ISO);O,O-diethyl 2-ethylthioethyl phosphorodithioate | 206-054-3 | 298-04-4 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-061-00-9 | dimefox (ISO);tetramethylphosphorodiamidic fluoride | 204-076-8 | 115-26-4 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-062-00-4 | mipafox (ISO);N,N'- di-isopropylphosphorodiamidic fluoride | 206-742-3 | 371-86-8 | STOT SE 1 | H370 ** | GHS08Dgr | H370 ** |
| 015-063-00-X | dioxathion (ISO);1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) | 201-107-7 | 78-34-2 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H330H300H311H400H410 | GHS06GHS09Dgr | H330H300H311H410 | M=1000 |
| 015-064-00-5 | bromophos-ethyl (ISO);O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate | 225-399-0 | 4824-78-6 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 |
| 015-065-00-0 | S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate | — | 2703-37-9 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Chronic 2 | H330H310H300H411 | GHS06GHS09Dgr | H330H310H300H411 |
| 015-066-00-6 | omethoate (ISO);O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate | 214-197-8 | 1113-02-6 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1 | H301H312H400 | GHS06GHS09Dgr | H301H312H400 |
| 015-067-00-1 | phosalone (ISO);S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate | 218-996-2 | 2310-17-0 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 |
| 015-068-00-7 | dichlofenthion (ISO);O—2,4-dichlorophenyl O,O-diethyl phosphorothioate | 202-564-5 | 97-17-6 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H400H410 |
| 015-069-00-2 | methidathion (ISO);2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate | 213-449-4 | 950-37-8 | Acute Tox. 2 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H300H312H400H410 | GHS06GHS09Dgr | H300H312H410 |
| 015-070-00-8 | cyanthoate (ISO);S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate | 223-099-4 | 3734-95-0 | Acute Tox. 2 *Acute Tox. 3 * | H300H311 | GHS06Dgr | H300H311 |
| 015-071-00-3 | chlorfenvinphos (ISO);2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate | 207-432-0 | 470-90-6 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 015-072-00-9 | monocrotophos (ISO);dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate | 230-042-7 | 6923-22-4 | Muta. 2Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H341H330H300H311H400H410 | GHS06GHS08GHS09Dgr | H341H330H300H311H410 |
| 015-073-00-4 | dicrotophos (ISO);(Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate | 205-494-3 | 141-66-2 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 015-074-00-X | crufomate (ISO);4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate | 206-083-1 | 299-86-5 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 015-075-00-5 | S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate | — | 2635-50-9 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 015-076-00-0 | potasan;O, O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate | — | 299-45-6 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 | M=1000 |
| 015-077-00-6 | 2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate | — | 7076-53-1 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 * | H331H311H301 | GHS06Dgr | H331H311H301 |
| 015-078-00-1 | demeton-S-methylsulphon (ISO);S-2-ethylsulphonylethyl dimethyl phosphorothioate | 241-109-5 | 17040-19-6 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Chronic 2 | H301H312H411 | GHS06GHS09Dgr | H301H312H411 |
| 015-079-00-7 | acephate (ISO);O,S-dimethyl acetylphosphoramidothioate | 250-241-2 | 30560-19-1 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 015-080-00-2 | amidithion (ISO);2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | — | 919-76-6 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 015-081-00-8 | O,O,O',O'-tetrapropyl dithiopyrophosphate | 221-817-0 | 3244-90-4 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 015-082-00-3 | azothoate (ISO);O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate | 227-419-3 | 5834-96-8 | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 |
| 015-083-00-9 | bensulide (ISO);O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate | 212-010-4 | 741-58-2 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 015-084-00-4 | chlorpyrifos (ISO);O,O-diethyl O—3,5,6-trichloro-2-pyridyl phosphorothioate | 220-864-4 | 2921-88-2 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H400H410 | M=10000 |
| 015-085-00-X | chlorphonium chloride (ISO);tributyl (2,4-dichlorobenzyl) phosphonium chloride | 204-105-4 | 115-78-6 | Acute Tox. 3 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H301H312H319H315 | GHS06Dgr | H301H312H319H315 |
| 015-086-00-5 | coumithoate (ISO);O,O-diethyl O—7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate | — | 572-48-5 | Acute Tox. 3 * | H301 | GHS06Dgr | H301 |
| 015-087-00-0 | cyanophos (ISO);O-4-cyanophenyl O,O-dimethyl phosphorothioate | 220-130-3 | 2636-26-2 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 015-088-00-6 | dialifos (ISO);2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate | 233-689-3 | 10311-84-9 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H400H410 |
| 015-089-00-1 | ethoate-methyl (ISO);ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | 204-121-1 | 116-01-8 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 015-090-00-7 | fensulfothion (ISO);O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate | 204-114-3 | 115-90-2 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-091-00-2 | fonofos (ISO);O-ethyl phenyl ethylphosphonodithioate | 213-408-0 | 944-22-9 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-092-00-8 | phosacetim (ISO);O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate | 223-874-7 | 4104-14-7 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-093-00-3 | leptophos (ISO);O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate | 244-472-8 | 21609-90-5 | Acute Tox. 3 *STOT SE 1Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H370 **H312H400H410 | GHS06GHS08GHS09Dgr | H301H370 **H312H410 |
| 015-094-00-9 | mephosfolan (ISO);diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate | 213-447-3 | 950-10-7 | Acute Tox. 1Acute Tox. 2 *Aquatic Chronic 2 | H310H300H411 | GHS06GHS09Dgr | H310H300H411 |
| 015-095-00-4 | methamidophos (ISO);O,S-dimethyl phosphoramidothioate | 233-606-0 | 10265-92-6 | Acute Tox. 2 *Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1 | H330H300H311H400 | GHS06GHS09Dgr | H330H300H311H400 |
| 015-096-00-X | oxydisulfoton (ISO);O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate | 219-679-1 | 2497-07-6 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 | M=10 |
| 015-097-00-5 | phenthoate (ISO);ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate | 219-997-0 | 2597-03-7 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 | M=100 |
| 015-098-00-0 | trichloronate (ISO);O-ethyl O—2,4,5-trichlorophenyl ethylphosphonothioate | 206-326-1 | 327-98-0 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 015-099-00-6 | pirimiphos-ethyl (ISO);O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate | 245-704-0 | 23505-41-1 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 |
| 015-100-00-X | phoxim (ISO);α-(diethoxyphosphinothioylimino) phenylacetonitrile | 238-887-3 | 14816-18-3 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 | M=1000 |
| 015-101-00-5 | phosmet (ISO);O,O-dimethyl phthalimidomethyl S-phosphorodithioate | 211-987-4 | 732-11-6 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 | M=100 |
| 015-102-00-0 | tris(2-chloroethyl) phosphate | 204-118-5 | 115-96-8 | Carc. 2Acute Tox. 4 *Aquatic Chronic 2 | H351H302H411 | GHS08GHS07GHS09Wng | H351H302H411 |
| 015-103-00-6 | phosphorus tribromide | 232-178-2 | 7789-60-8 | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | EUH014 |
| 015-104-00-1 | diphosphorus pentasulphide;phosphorus pentasulphide | 215-242-4 | 1314-80-3 | Flam. Sol. 1Water-react. 1Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1 | H228H260H332H302H400 | GHS02GHS07GHS09Dgr | H228H260H332H302H400 | EUH029 | T |
| 015-105-00-7 | triphenyl phosphite | 202-908-4 | 101-02-0 | Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H315H400H410 | GHS07GHS09Wng | H319H315H410 | Skin Irrit. 2; H315: C ≥ 5 %Eye Irrit. 2; H319: C ≥ 5 % |
| 015-106-00-2 | hexamethylphosphoric triamide;hexamethylphosphoramide | 211-653-8 | 680-31-9 | Carc. 1BMuta. 1B | H350H340 | GHS08Dgr | H350H340 | Carc. 1B; H350: C ≥ 0.01 % |
| 015-107-00-8 | ethoprophos (ISO);ethyl-S,S-dipropyl phosphorodithioate | 236-152-1 | 13194-48-4 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H310H301H317H400H410 | GHS06GHS09Dgr | H330H310H301H317H410 |
| 015-108-00-3 | bromophos (ISO);O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate | 218-277-3 | 2104-96-3 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 | M=100 |
| 015-109-00-9 | crotoxyphos (ISO);1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate | 231-720-5 | 7700-17-6 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 | M=10 |
| 015-110-00-4 | cyanofenphos (ISO);O-4-cyanophenyl O-ethyl phenylphosphonothioate | — | 13067-93-1 | Acute Tox. 3 *STOT SE 1Acute Tox. 4 *Eye Irrit. 2Aquatic Chronic 2 | H301H370 **H312H319H411 | GHS06GHS08GHS09Dgr | H301H370 **H312H319H411 |
| 015-111-00-X | phosfolan (ISO);diethyl 1,3-dithiolan-2-ylidenephosphoramidate | 213-423-2 | 947-02-4 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-112-00-5 | thionazin (ISO);O,O-diethyl O-pyrazin-2-yl phosphorothioate; | 206-049-6 | 297-97-2 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-114-00-6 | chlormephos (ISO);S-chloromethyl O,O-diethyl phosphorodithioate | 246-538-1 | 24934-91-6 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 015-115-00-1 | chlorthiophos (ISO) | 244-663-6 | 21923-23-9 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 015-116-00-7 | demephion-O (ISO);O,O-dimethyl O-2-methylthioethyl phosphorothioate | 211-666-9 | 682-80-4 | Acute Tox. 2 *Acute Tox. 3 * | H300H311 | GHS06Dgr | H300H311 |
| 015-117-00-2 | demephion-S (ISO);O,O-dimethyl S-2-methylthioethyl phosphorothioate | 219-971-9 | 2587-90-8 | Acute Tox. 2 *Acute Tox. 3 * | H300H311 | GHS06Dgr | H300H311 |
| 015-118-00-8 | demeton | — | 8065-48-3 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1 | H310H300H400 | GHS06GHS09Dgr | H310H300H400 |
| 015-119-00-3 | dimethyl 4-(methylthio)phenyl phosphate | — | 3254-63-5 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-120-00-9 | ditalimfos (ISO);O,O-diethyl phthalimidophosphonothioate | 225-875-8 | 5131-24-8 | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 015-121-00-4 | edifenphos (ISO);O-ethyl S,S-diphenyl phosphorodithioate | 241-178-1 | 17109-49-8 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H301H312H317H400H410 | GHS06GHS09Dgr | H331H301H312H317H410 |
| 015-122-00-X | etrimfos (ISO);O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate | 253-855-9 | 38260-54-7 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 | M=10 |
| 015-123-00-5 | fenamiphos (ISO);ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate | 244-848-1 | 22224-92-6 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 | M=100 |
| 015-124-00-0 | fosthietan (ISO);diethyl 1,3-dithietan-2-ylidenephosphoramidate | 244-437-7 | 21548-32-3 | Acute Tox. 1Acute Tox. 2 * | H310H300 | GHS06Dgr | H310H300 |
| 015-125-00-6 | glyphosine (ISO);N,N-bis(phosphonomethyl)glycine | 219-468-4 | 2439-99-8 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 015-126-00-1 | heptenophos (ISO);7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate | 245-737-0 | 23560-59-0 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 | M=100 |
| 015-127-00-7 | iprobenfos(ISO);S-benzyl diisopropyl phosphorothioate | 247-449-0 | 26087-47-8 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 015-128-00-2 | IPSP;S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate | — | 5827-05-4 | Acute Tox. 1Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H310H301H400H410 | GHS06GHS09Dgr | H310H301H410 | M=100 |
| 015-129-00-8 | isofenphos (ISO);O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate | 246-814-1 | 25311-71-1 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 | M=100 |
| 015-130-00-3 | isothioate (ISO);S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate; | — | 36614-38-7 | Acute Tox. 3 *Acute Tox. 3 * | H311H301 | GHS06Dgr | H311H301 |
| 015-131-00-9 | isoxathion (ISO);O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | 242-624-8 | 18854-01-8 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 |
| 015-132-00-4 | S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate;methylcarbophenothione | — | 953-17-3 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 | M=1000 |
| 015-133-00-X | piperophos (ISO);S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate | — | 24151-93-7 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 | M=10 |
| 015-134-00-5 | pirimiphos-methyl (ISO);O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate | 249-528-5 | 29232-93-7 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 015-135-00-0 | profenofos (ISO)O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate; | 255-255-2 | 41198-08-7 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | M=1000 |
| 015-136-00-6 | trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate;isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate;propetamphos (ISO) | 250-517-2 | 31218-83-4 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 | M=100 |
| 015-137-00-1 | pyrazophos (ISO);O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate | 236-656-1 | 13457-18-6 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H302H400H410 | GHS07GHS09Wng | H332H302H410 |
| 015-138-00-7 | quinalphos (ISO);O,O-diethyl-O-quinoxalin-2-yl phosphorothioate | 237-031-6 | 13593-03-8 | Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 | M=1000 |
| 015-139-00-2 | terbufos (ISO);S—tert-butylthiomethyl O, O-diethylphosphorodithioate; | 235-963-8 | 13071-79-9 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 | M=1000 |
| 015-140-00-8 | triazophos (ISO);O,O-diethyl-O-1-phenyl-1H,2,4-triazol-3-yl phosphorothioate | 245-986-5 | 24017-47-8 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H312H400H410 | GHS06GHS09Dgr | H331H301H312H410 |
| 015-141-00-3 | ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers | 400-520-1 | — | Skin Corr. 1BAcute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H314H302H400H410 | GHS05GHS07GHS09Dgr | H314H302H410 |
| 015-142-00-9 | butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate | 401-100-0 | — | Flam. Liq. 2Eye Irrit. 2Aquatic Chronic 2 | H225H319H411 | GHS02GHS07GHS09Dgr | H225H319H411 | T |
| 015-143-00-4 | reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate,reaction mass of isomers | 401-740-0 | — | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 015-144-00-X | reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate | 402-090-0 | 87025-52-3 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 015-145-00-5 | reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate | 401-520-4 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 015-146-00-0 | S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | 401-850-9 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 015-147-00-6 | reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) | 400-930-0 | — | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H315H318H317H411 | GHS05GHS07GHS09Dgr | H315H318H317H411 |
| 015-148-00-1 | 2-(diphosphonomethyl)succinic acid | 403-070-4 | 51395-42-7 | Skin Corr. 1BSkin Sens. 1 | H314H317 | GHS05GHS07Dgr | H314H317 |
| 015-149-00-7 | reaction mass of: hexyldioctylphosphineoxide;dihexyloctylphosphineoxide;trioctylphosphineoxide | 403-470-9 | — | Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 |
| 015-150-00-2 | (2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide | 404-940-6 | 86608-70-0 | Acute Tox. 4 *Eye Dam. 1STOT RE 2 *Aquatic Chronic 3 | H302H318H373 **H412 | GHS08GHS05GHS07Dgr | H302H318H373 **H412 |
| 015-151-00-8 | tris(isopropyl/tert-butylphenyl) phosphate | 405-010-2 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 015-152-00-3 | dioxabenzofos (ISO);2-methoxy-4H—1,3,2-benzodioxaphosphorin 2-sulphide | 223-292-3 | 3811-49-2 | Acute Tox. 3 *Acute Tox. 3 *STOT SE 1Aquatic Chronic 2 | H311H301H370 **H411 | GHS06GHS08GHS09Dgr | H311H301H370 **H411 |
| 015-153-00-9 | isazofos (ISO);O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate | 255-863-8 | 42509-80-8 | Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H311H301H373 **H317H400H410 | GHS06GHS08GHS09Dgr | H330H311H301H373 **H317H410 |
| 015-154-00-4 | 2-chloroethylphosphonic acid;ethephon | 240-718-3 | 16672-87-0 | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 3 | H332H312H314H412 | GHS05GHS07Dgr | H332H312H314H412 | STOT SE 3; H335: C ≥ 5 % |
| 015-155-00-X | ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate;glufosinate ammonium | 278-636-5 | 77182-82-2 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 015-156-00-5 | methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1]methacrifos (ISO);methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] | 250-366-9 [1][2] | 30864-28-9 [1]62610-77-9 [2] | Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 015-157-00-0 | phosphonic acid; [1]phosphorous acid [2] | 237-066-7 [1]233-663-1[2] | 13598-36-2 [1]10294-56-1 [2] | Acute Tox. 4 *Skin Corr. 1A | H302H314 | GHS05GHS07Dgr | H302H314 |
| 015-158-00-6 | (η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) | 402-340-9 | 32760-80-8 | Aquatic Chronic 3 | H412 | — | H412 |
| 015-159-00-1 | hydroxyphosphonoacetic acid | 405-710-8 | 23783-26-8 | Acute Tox. 4 *STOT RE 2 *Skin Corr. 1BSkin Sens. 1 | H302H373 **H314H317 | GHS08GHS05GHS07Dgr | H302H373 **H314H317 |
| 015-160-00-7 | vanadyl pyrophosphate | 406-260-5 | 58834-75-6 | Eye Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H319H317H412 | GHS07Wng | H319H317H412 |
| 015-161-00-2 | divanadyl pyrophosphate | 407-130-0 | 65232-89-5 | Acute Tox. 4 *Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 015-162-00-8 | vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped | 407-350-7 | — | Acute Tox. 4 *STOT RE 2 *Eye Dam. 1Aquatic Chronic 2 | H332H373 **H318H411 | GHS08GHS05GHS07GHS09Dgr | H332H373 **H318H411 |
| 015-163-00-3 | bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide | 412-010-6 | 145052-34-2 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 015-164-00-9 | calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate | 400-480-5 | 36669-85-9 | Aquatic Chronic 3 | H412 | — | H412 |
| 015-165-00-4 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate;diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate | 404-986-7 | — | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 015-166-00-X | 3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 410-290-4 | 80693-00-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 015-167-00-5 | 3-(hydroxyphenylphosphinyl)propanoic acid | 411-200-6 | 14657-64-8 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 015-168-00-0 | fosthiazate (ISO);(RS)-S—sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate | — | 98886-44-3 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H301H312H317H400H410 | GHS06GHS09Dgr | H331H301H312H317H410 | EUH070 |
| 015-169-00-6 | tributyltetradecylphosphonium tetrafluoroborate | 413-520-1 | — | Acute Tox. 4 *STOT RE 2 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H314H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H302H373 **H314H317H410 |
| 015-170-00-1 | reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate;1-octane-N,N,N-trimethylammonium di-octylphosphate;1-octane-N,N,N-trimethylammonium octylphosphate | 407-490-9 | — | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 015-171-00-7 | O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate | 406-940-1 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 015-172-00-2 | reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate;isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate | 406-240-6 | — | Flam. Liq. 3Skin Corr. 1BAquatic Chronic 2 | H226H314H411 | GHS02GHS05GHS09Dgr | H226H314H411 |
| 015-173-00-8 | methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate | 414-080-3 | 117291-73-3 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 015-174-00-3 | 1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine | 411-370-1 | 82857-68-9 | Acute Tox. 3 *Eye Dam. 1Aquatic Chronic 2 | H301H318H411 | GHS06GHS05GHS09Dgr | H301H318H411 |
| 015-175-00-9 | tert-butyl (triphenylphosphoranylidene) acetate | 412-880-7 | 35000-38-5 | Acute Tox. 3 *STOT RE 2 *Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H301H373 **H319H317H411 | GHS06GHS08GHS09Dgr | H301H373 **H319H317H411 |
| 015-176-00-4 | P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine | 413-430-2 | 116163-96-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 015-177-00-X | ((4-phenylbutyl)hydroxyphosphoryl)acetic acid | 412-170-7 | 83623-61-4 | STOT RE 2 *Eye Dam. 1Skin Sens. 1 | H373 **H318H317 | GHS08GHS05Dgr | H373 **H318H317 |
| 015-178-00-5 | (R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate | 418-570-8 | 25383-07-7 | Repr. 2Aquatic Chronic 2 | H361f ***H411 | GHS08GHS09Wng | H361f ***H411 |
| 015-179-00-0 | UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine | 422-720-8 | 166242-53-1 | Carc. 2Acute Tox. 4 *STOT RE 2 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H302H373 **H314H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H351H302H373 **H314H317H410 |
| 015-180-00-6 | [R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt | 415-820-8 | 137590-32-0 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 015-181-00-1 | phosphine | 232-260-8 | 7803-51-2 | Flam. Gas 1Press. GasAcute Tox. 2 *Skin Corr. 1BAquatic Acute 1 | H220H330H314H400 | GHS02GHS04GHS06GHS05GHS09Dgr | H220H330H314H400 | U |
| 015-184-00-8 | Salts of glyphosate, with the exception of those specified elsewhere in this Annex | — | — | Aquatic Chronic 2 | H411 | GHS09 | H411 | A |
| 015-186-00-9 | chlorpyrifos-methyl (ISO)O, O-dimethyl O—3,5,6-trichloro-2-pyridyl phosphorothioate | 227-011-5 | 5598-13-0 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 | M=10000 |
| 015-187-00-4 | reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide;trisodium ((tetrahydro-2-hydroxy-4H—1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide | 417-540-1 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 015-189-00-5 | phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 423-340-5 | 162881-26-7 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 016-001-00-4 | hydrogen sulphide | 231-977-3 | 7783-06-4 | Flam. Gas 1Press. GasAcute Tox. 2 *Aquatic Acute 1 | H220H330H400 | GHS02GHS04GHS06GHS09Dgr | H220H330H400 | U |
| 016-002-00-X | barium sulphide | 244-214-4 | 21109-95-5 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1 | H332H302H400 | GHS07GHS09Wng | H332H302H400 | EUH031 |
| 016-003-00-5 | barium polysulphides | 256-814-3 | 50864-67-0 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H319H335H315H400 | GHS07GHS09Wng | H319H335H315H400 | EUH031 |
| 016-004-00-0 | calcium sulphide | 243-873-5 | 20548-54-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H319H335H315H400 | GHS07GHS09Wng | H319H335H315H400 | EUH031 |
| 016-005-00-6 | calcium polysulphides | 215-709-2 | 1344-81-6 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H319H335H315H400 | GHS07GHS09Wng | H319H335H315H400 | EUH031 |
| 016-006-00-1 | dipotassium sulphide;potassium sulphide | 215-197-0 | 1312-73-8 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH031 |
| 016-007-00-7 | potassium polysulphides | 253-390-1 | 37199-66-9 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH031 |
| 016-008-00-2 | ammonium polysulphides | 232-989-1 | 9080-17-5 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH031 | EUH031: C ≥ 1 % |
| 016-009-00-8 | disodium sulphide;sodium sulphide | 215-211-5 | 1313-82-2 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH031 |
| 016-010-00-3 | sodium polysulphides | 215-686-9 | 1344-08-7 | Acute Tox. 3 *Skin Corr. 1BAquatic Acute 1 | H301H314H400 | GHS06GHS05GHS09Dgr | H301H314H400 | EUH031 |
| 016-011-00-9 | sulphur dioxide | 231-195-2 | 7446-09-5 | Press. GasAcute Tox. 3 *Skin Corr. 1B | H331H314 | GHS04GHS06GHS05Dgr | H331H314 | * | U5 |
| 016-012-00-4 | disulphur dichloride;sulfur monochloride | 233-036-2 | 10025-67-9 | Acute Tox. 3 *Acute Tox. 4 *Skin Corr. 1AAquatic Acute 1 | H301H332H314H400 | GHS06GHS05GHS09Dgr | H301H332H314H400 | EUH014EUH029 | STOT SE 3; H335: C ≥ 1 % |
| 016-013-00-X | sulphur dichloride | 234-129-0 | 10545-99-0 | Skin Corr. 1BSTOT SE 3Aquatic Acute 1 | H314H335H400 | GHS05GHS07GHS09Dgr | H314H335H400 | EUH014 | STOT SE 3; H335: C ≥ 5 % |
| 016-014-00-5 | sulphur tetrachloride | — | 13451-08-6 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH014 | STOT SE 3; H335: C ≥ 5 % |
| 016-015-00-0 | thionyl dichloride;thionyl chloride | 231-748-8 | 7719-09-7 | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1A | H332H302H314 | GHS05GHS07Dgr | H332H302H314 | EUH014EUH029 | STOT SE 3; H335: C ≥ 1 % |
| 016-016-00-6 | sulphuryl chloride | 232-245-6 | 7791-25-5 | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | EUH014 |
| 016-017-00-1 | chlorosulphonic acid | 232-234-6 | 7790-94-5 | Skin Corr. 1ASTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | EUH014 |
| 016-018-00-7 | fluorosulphonic acid | 232-149-4 | 7789-21-1 | Acute Tox. 4 *Skin Corr. 1A | H332H314 | GHS05GHS07Dgr | H332H314 |
| 016-019-00-2 | oleum ... % SO3 | — | — | Skin Corr. 1ASTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | EUH014 | B |
| 016-020-00-8 | sulphuric acid ... % | 231-639-5 | 7664-93-9 | Skin Corr. 1A | H314 | GHS05Dgr | H314 | Skin Corr. 1A; H314: C ≥ 15 %Skin Irrit. 2; H315: 5 % ≤ C < 15 %Eye Irrit. 2; H319: 5 % ≤ C < 15 % | B |
| 016-021-00-3 | methanethiol;methyl mercaptan | 200-822-1 | 74-93-1 | Flam. Gas. 1Press. GasAcute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H220H331H400H410 | GHS02GHS04GHS06GHS09Dgr | H220H331H410 | U |
| 016-022-00-9 | ethanethiol;ethyl mercaptan | 200-837-3 | 75-08-1 | Flam. Liq. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H225H332H400H410 | GHS02GHS07GHS09Dgr | H225H332H410 |
| 016-023-00-4 | dimethyl sulphate | 201-058-1 | 77-78-1 | Carc. 1BMuta. 2Acute Tox. 2 *Acute Tox. 3 *Skin Corr. 1BSkin Sens. 1 | H350H341H330H301H314H317 | GHS06GHS08GHS05Dgr | H350H341H330H301H314H317 | Carc. 1B; H350: C ≥ 0.01 %Muta. 2; H341: C ≥ 0.01 %STOT SE 3; H335: C ≥ 5 % |
| 016-024-00-X | dimexano(ISO);bis(methoxythiocarbonyl) disulphide | 215-993-8 | 1468-37-7 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 016-025-00-5 | disul (ISO);2-(2,4-dichlorophenoxy)ethyl hydrogensulphate;2,4-DES | 205-259-5 | 149-26-8 | Acute Tox. 4 *Skin Irrit. 2Eye Dam. 1 | H302H315H318 | GHS05GHS07Dgr | H302H315H318 |
| 016-026-00-0 | sulphamidic acid;sulphamic acid;sulfamic acid | 226-218-8 | 5329-14-6 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H319H315H412 | GHS07Wng | H319H315H412 |
| 016-027-00-6 | diethyl sulphate | 200-589-6 | 64-67-5 | Carc. 1BMuta. 1BAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H350H340H332H312H302H314 | GHS05GHS08GHS07Dgr | H350H340H332H312H302H314 |
| 016-028-00-1 | sodium dithionite;sodium hydrosulphite | 231-890-0 | 7775-14-6 | Self-heat. 1Acute Tox. 4 * | H251H302 | GHS02GHS07Dgr | H251H302 | EUH031 |
| 016-029-00-7 | p-toluenesulphonic acid, containing more than 5 % H2SO4 | — | — | Skin Corr. 1B | H314 | GHS05Dgr | H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
| 016-030-00-2 | p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) | 203-180-0 | 104-15-4 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | STOT SE 3; H335: C ≥ 20 % |
| 016-031-00-8 | tetrahydrothiophene-1,1-dioxide;sulpholane | 204-783-1 | 126-33-0 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 016-032-00-3 | 1,3-propanesultone;1,2-oxathiolane 2,2-dioxide | 214-317-9 | 1120-71-4 | Carc. 1BAcute Tox. 4 *Acute Tox. 4 * | H350H312H302 | GHS08GHS07Dgr | H350H312H302 | Carc. 1B; H350: C ≥ 0,01 % |
| 016-033-00-9 | dimethylsulfamoylchloride | 236-412-4 | 13360-57-1 | Carc. 1BAcute Tox. 2 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H350H330H312H302H314 | GHS06GHS05GHS08Dgr | H350H330H312H302H314 |
| 016-034-00-4 | tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) | 400-010-9 | 81898-60-4 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-035-00-X | pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate | 400-120-7 | — | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 016-036-00-5 | tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate | 400-130-1 | — | Resp. Sens. 1Aquatic Chronic 2 | H334H411 | GHS08GHS09Dgr | H334H411 |
| 016-037-00-0 | disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate | 400-350-8 | 85153-93-1 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 016-038-00-6 | disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate | 400-380-1 | 86393-35-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-039-00-1 | tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate | 400-430-2 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-040-00-7 | reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate | 400-570-4 | — | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 016-041-00-2 | calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate | 400-710-4 | — | Acute Tox. 4 * | H332 | GHS07Wng | H332 |
| 016-042-00-8 | tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate | 400-790-0 | 85665-97-0 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 |
| 016-043-00-3 | dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate | 401-010-1 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-044-00-9 | disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate | 401-320-7 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 016-045-00-4 | lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate | 401-560-2 | 108624-00-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-046-00-X | sodium hydrogensulphate | 231-665-7 | 7681-38-1 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 016-047-00-5 | hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate | 401-650-1 | 85665-96-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-048-00-0 | sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate | 401-870-8 | — | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 016-049-00-6 | calcium octadecylxylenesulphonate | 402-040-8 | — | Skin Corr. 1BAquatic Chronic 2 | H314H411 | GHS05GHS09Dgr | H314H411 |
| 016-050-00-1 | potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat | 402-150-6 | — | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 016-051-00-7 | trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate | 402-170-5 | 106359-91-5 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-052-00-2 | benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate | 402-240-5 | 102561-46-6 | Acute Tox. 4 *Aquatic Chronic 2 | H332H411 | GHS07GHS09Wng | H332H411 |
| 016-053-00-8 | (C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate | 402-460-1 | — | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 4 | H315H317H413 | GHS07Wng | H315H317H413 |
| 016-054-00-3 | sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate | 400-030-8 | — | Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Sens. 1 | H331H372 **H302H319H335H317 | GHS06GHS08Dgr | H331H372 **H302H319H335H317 |
| 016-055-00-9 | tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) | 400-510-7 | — | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 016-056-00-4 | potassium hydrogensulphate | 231-594-1 | 7646-93-7 | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 |
| 016-057-00-X | styrene-4-sulfonyl chloride | 404-770-2 | 2633-67-2 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H315H318H317 | GHS05GHS07Dgr | H315H318H317 |
| 016-058-00-5 | thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol and C12-14—tert-alkylamine | 404-820-3 | — | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H315H317H412 | GHS07Wng | H315H317H412 |
| 016-059-00-0 | N,N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride | 405-300-9 | 17339-60-5 | Acute Tox. 4 *Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H319H317H400H410 | GHS07GHS09Wng | H302H319H317H410 |
| 016-060-00-6 | diammonium peroxodisulphate;ammonium persulphate | 231-786-5 | 7727-54-0 | Ox. Sol. 3Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1 | H272H302H319H335H315H334H317 | GHS03GHS08GHS07Dgr | H272H302H319H335H315H334H317 |
| 016-061-00-1 | dipotassium peroxodisulphate;potassium persulphate | 231-781-8 | 7727-21-1 | Ox. Sol. 3Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1 | H272H302H319H335H315H334H317 | GHS03GHS08GHS07Dgr | H272H302H319H335H315H334H317 |
| 016-062-00-7 | bensultap (ISO);1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane | — | 17606-31-4 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 016-063-00-2 | sodium metabisulphite | 231-673-0 | 7681-57-4 | Acute Tox. 4 *Eye Dam. 1 | H302H318 | GHS05GHS07Dgr | H302H318 | EUH031 |
| 016-064-00-8 | sodium hydrogensulphite . . . %;sodium bisulphite . . . % | 231-548-0 | 7631-90-5 | Acute Tox. 4 * | H302 | GHS07Wng | H302 | EUH031 | B |
| 016-065-00-3 | sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate | 400-100-8 | 84057-97-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 016-066-00-9 | tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2- sulfonatobenzylidenehydrazino)benzoate]copper(II) | 404-070-7 | 116912-62-0 | Aquatic Chronic 3 | H412 | — | H412 |
| 016-067-00-4 | (4-methylphenyl)mesitylene sulfonate | 407-530-5 | 67811-06-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 016-068-00-X | sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate | 407-720-8 | 155160-86-4 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 016-069-00-5 | 3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid | 407-990-7 | 141915-64-2 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 016-070-00-0 | 4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone | 408-220-2 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 016-071-00-6 | trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate | 410-130-3 | 136248-03-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 016-072-00-1 | 3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide | 411-520-6 | 112195-27-4 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 016-073-00-7 | tetrakis(phenylmethyl)thioperoxydi(carbothioamide) | 404-310-0 | 10591-85-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 016-074-00-2 | 6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene | 405-410-7 | — | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H315H318H317H411 | GHS05GHS07GHS09Dgr | H315H318H317H411 |
| 016-075-00-8 | 2,2'-diallyl-4,4'-sulfonyldiphenol | 411-570-9 | 41481-66-7 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 016-076-00-3 | 2,3-bis((2-mercaptoethyl)thio)-1-propanethiol | 411-290-7 | 131538-00-6 | Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H400H410 | GHS08GHS07GHS09Wng | H302H373 **H410 |
| 016-077-00-9 | 2-chloro-p-toluenesulfochloride | 412-890-1 | 42413-03-6 | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H314H317H412 | GHS05GHS07Dgr | H314H317H412 |
| 016-078-00-4 | 4-methyl-N,N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide | 413-300-5 | 56187-04-3 | Aquatic Chronic 4 | H413 | — |
| 016-079-00-X | N,N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide | 412-920-3 | 16695-22-0 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 016-080-00-5 | sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate | 412-320-1 | 31361-99-6 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 016-081-00-0 | hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide | 418-350-1 | — | Muta. 2Acute Tox. 4 *Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H341H302H319H317H411 | GHS08GHS07GHS09Wng | H341H302H319H317H411 |
| 016-082-00-6 | ethoxysulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea | — | 126801-58-9 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 016-083-00-1 | acibenzolar-S-methyl;benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester | 420-050-0 | 135158-54-2 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H317H400H410 | GHS07GHS09Wng | H319H335H315H317H410 |
| 016-084-00-7 | prosulfuron;1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea | — | 94125-34-5 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 016-085-00-2 | flazasulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea | — | 104040-78-0 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 016-086-00-8 | tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | 402-590-9 | 109125-56-6 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 016-087-00-3 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate;diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate;propylene carbonate | 403-490-8 | 104558-95-4 | Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H319H317H400H410 | GHS07GHS09Wng | H319H317H410 |
| 016-088-00-9 | 4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid | 407-280-7 | 71297-11-5 | Aquatic Chronic 3 | H412 | — | H412 |
| 016-089-00-4 | reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene | 413-840-1 | — | Self-react. C ****Aquatic Chronic 4 | H242H413 | GHS02Dgr | H242H413 |
| 016-090-00-X | 4-methyl-N-(methylsulfonyl)benzenesulfonamide | 415-040-8 | 14653-91-9 | Acute Tox. 4 *STOT SE 3Eye Dam. 1 | H302H335H318 | GHS05GHS07Dgr | H302H335H318 |
| 016-091-00-5 | C12-14—tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate | 414-110-5 | — | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 016-093-00-6 | reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate);4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) | 414-770-4 | 140698-96-0 | Self-react. C****Carc. 2 | H242H351 | GHS02GHS08Dgr | H242H351 |
| 016-095-00-7 | reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2);Reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) | 417-980-4 | — | Self-react. C****Carc. 2 | H242H351 | GHS02GHS08Dgr | H242H351 |
| 016-096-00-2 | thifensulfuron-methyl (ISO);methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate | — | 79277-27-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 017-001-00-7 | chlorine | 231-959-5 | 7782-50-5 | Ox. Gas 1Press. GasAcute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H270H331H319H335H315H400 | GHS03GHS04GHS06GHS09Dgr | H270H331H319H335H315H400 | U |
| 017-002-00-2 | hydrogen chloride | 231-595-7 | 7647-01-0 | Press. GasAcute Tox. 3 *Skin Corr. 1A | H331H314 | GHS04GHS06GHS05Dgr | H331H314 | U5 |
| 017-002-01-X | hydrochloric acid ... % | 231-595-7 | — | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 %STOT SE 3; H335: C ≥ 10 % | B |
| 017-003-00-8 | barium chlorate | 236-760-7 | 13477-00-4 | Ox. Sol. 1Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H271H332H302H411 | GHS03GHS07GHS09Dgr | H271H332H302H411 |
| 017-004-00-3 | potassium chlorate | 223-289-7 | 3811-04-9 | Ox. Sol. 1Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H271H332H302H411 | GHS03GHS07GHS09Dgr | H271H332H302H411 |
| 017-005-00-9 | sodium chlorate | 231-887-4 | 7775-09-9 | Ox. Sol. 1Acute Tox. 4 *Aquatic Chronic 2 | H271H302H411 | GHS03GHS07GHS09Dgr | H271H302H411 |
| 017-006-00-4 | perchloric acid ... % | 231-512-4 | 7601-90-3 | Ox. Liq. 1Skin Corr. 1A | H271H314 | GHS03GHS05Dgr | H271H314 | Skin Corr. 1A; H314: C ≥ 50 %Skin Corr. 1B; H314: 10 % ≤ C < 50 %Skin Irrit. 2; H315: 1 % ≤ C < 10 %Eye Irrit. 2; H319: 1 % ≤ C < 10 %Ox. Liq. 1; H271: C > 50 %:Ox. Liq. 2; H272: C ≤ 50 %: | B |
| 017-007-00-X | barium perchlorate | 236-710-4 | 13465-95-7 | Ox. Sol. 1Acute Tox. 4 *Acute Tox. 4 * | H271H332H302 | GHS03GHS07Dgr | H271H332H302 |
| 017-008-00-5 | potassium perchlorate | 231-912-9 | 7778-74-7 | Ox. Sol. 1Acute Tox. 4 * | H271H302 | GHS03GHS07Dgr | H271H302 |
| 017-009-00-0 | ammonium perchlorate | 232-235-1 | 7790-98-9 | Expl. 1.1Ox. Sol. 1 | H201H271 | GHS01Dgr | H201H271 | EUH044 | T |
| 017-010-00-6 | sodium perchlorate | 231-511-9 | 7601-89-0 | Ox. Sol. 1Acute Tox. 4 * | H271H302 | GHS03GHS07Dgr | H271H302 |
| 017-011-00-1 | sodium hypochlorite, solution ... % Cl active | 231-668-3 | 7681-52-9 | Skin Corr. 1BAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 | EUH031 | EUH031: C ≥ 5 % | B |
| 017-012-00-7 | calcium hypochlorite | 231-908-7 | 7778-54-3 | Ox. Sol. 2Acute Tox. 4 *Skin Corr. 1BAquatic Acute 1 | H272H302H314H400 | GHS03GHS05GHS07GHS09Dgr | H272H302H314H400 | EUH031 | Skin Corr. 1B; H314: C ≥ 10 %Skin Irrit. 2; H315: 3 % ≤ C < 10 %Eye Dam. 1; H31: 3 % ≤ C < 10 %Eye Irrit. 2; H319: 0,5 % ≤ C < 3 %STOT SE 3; H335: C ≥ 3 % | T |
| 017-013-00-2 | calcium chloride | 233-140-8 | 10043-52-4 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 017-014-00-8 | ammonium chloride | 235-186-4 | 12125-02-9 | Acute Tox. 4 *Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 017-015-00-3 | (2-(aminomethyl)phenyl)acetylchloride hydrochloride | 417-410-4 | 61807-67-8 | Acute Tox. 4 *Skin Corr. 1ASkin Sens. 1 | H302H314H317 | GHS05GHS07Dgr | H302H314H317 |
| 017-016-00-9 | methyltriphenylphosphonium chloride | 418-400-2 | 1031-15-8 | Acute Tox. 4 *Acute Tox. 4 *Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H312H302H315H318H411 | GHS05GHS07GHS09Dgr | H312H302H315H318H411 |
| 017-017-00-4 | (Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride | 426-210-6 | 120086-58-0 | Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 |
| 017-018-00-X | N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride | 405-660-7 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 017-019-00-5 | (R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride | 415-110-8 | 54417-53-7 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 017-020-00-0 | ethyl propoxy aluminium chloride | 421-790-7 | 13014-29-4 | Water-react. 1Skin Corr. 1A | H260H314 | GHS02GHS05Dgr | H260H314 | EUH014 |
| 017-021-00-6 | behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride | 423-420-1 | 136920-10-0 | Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H318H317H400H410 | GHS05GHS07GHS09Dgr | H318H317H410 |
| 019-001-00-2 | potassium | 231-119-8 | 7440-09-7 | Water-react. 1Skin Corr. 1B | H260H314 | GHS02GHS05Dgr | H260H314 | EUH014 |
| 019-002-00-8 | potassium hydroxide;caustic potash | 215-181-3 | 1310-58-3 | Acute Tox. 4 *Skin Corr. 1A | H302H314 | GHS05GHS07Dgr | H302H314 | Skin Corr. 1A; H314: C ≥ 5 %Skin Corr. 1B; H314: 2 % ≤ C < 5 %Skin Irrit. 2; H315: 0,5 % ≤ C < 2 %Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
| 020-001-00-X | calcium | 231-179-5 | 7440-70-2 | Water-react. 2 | H261 | GHS02Dgr | H261 |
| 020-002-00-5 | calcium cyanide | 209-740-0 | 592-01-8 | Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H300H400H410 | GHS06GHS09Dgr | H300H410 | EUH032 |
| 020-003-00-0 | reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide;tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide;poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydroxide] | 420-470-4 | — | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 |
| 022-001-00-5 | titanium tetrachloride | 231-441-9 | 7550-45-0 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | EUH014 |
| 022-002-00-0 | titanium(4+) oxalate | 403-260-7 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 022-003-00-6 | bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium | 412-000-1 | 125051-32-3 | Flam. Sol. 1Repr. 2STOT RE 2 *Aquatic Chronic 2 | H228H361f ***H373 **H411 | GHS02GHS08GHS09Dgr | H228H361f ***H373 **H411 | T |
| 023-001-00-8 | divanadium pentaoxide;vanadium pentoxide | 215-239-8 | 1314-62-1 | Muta. 2Repr. 2STOT RE 1Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Aquatic Chronic 2 | H341H361d ***H372 **H332H302H335H411 | GHS08GHS07GHS09Dgr | H341H361d ***H372 **H332H302H335H411 |
| 024-001-00-0 | chromium (VI) trioxide | 215-607-8 | 1333-82-0 | Ox. Sol. 1Carc. 1AMuta. 1BRepr. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1Skin Corr. 1AResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H271H350H340H361f ***H330H311H301H372 **H314H334H317H400H410 | GHS03GHS06GHS08GHS05GHS09Dgr | H271H350H340H361f ***H330H311H301H372 **H314H334H317H410 | STOT SE 3; H335: C ≥ 1 % |
| 024-002-00-6 | potassium dichromate | 231-906-6 | 7778-50-9 | Ox. Sol. 2Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H272H350H340H360FDH330H301H372 **H312H314H334H317H400H410 | GHS03GHS06GHS08GHS05GHS09Dgr | H272H350H340H360FDH330H301H372 **H312H314H334H317H410 | STOT SE 3; H335: C ≥ 5 % | 3 |
| 024-003-00-1 | ammonium dichromate | 232-143-1 | 7789-09-5 | Ox. Sol. 2 ****Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H272H350H340H360FDH330H301H372 **H312H314H334H317H400H410 | GHS03GHS06GHS08GHS05GHS09Dgr | H272H350H340H360FDH330H301H372 **H312H314H334H317H410 | STOT SE 3; H335: C ≥ 5 %Resp. Sens.; H334: C ≥ 0,2 %Skin Sens.; H317: C ≥ 0,2 % | G3 |
| 024-004-00-7 | sodium dichromate anhydrate | 234-190-3 | 10588-01-9 | Ox. Sol. 2Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H272H350H340H360FDH330H301H372 **H312H314H334H317H400H410 | GHS03GHS06GHS08GHS05GHS09Dgr | H272H350H340H360FDH330H301H372 **H312H314H334H317H410 | STOT SE 3; H335: C ≥ 5 %Resp. Sens.; H334: C ≥ 0,2 %Skin Sens.; H317: C ≥ 0,2 % | 3 |
| 024-004-01-4 | sodium dichromate, dihydrate | 234-190-3 | 7789-12-0 | Ox. Sol. 2Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H272H350H340H360FDH330H301H372 **H312H314H334H317H400H410 | GHS03GHS06GHS08GHS05GHS09Dgr | H272H350H340H360FDH330H301H372 **H312H314H334H317H410 | STOT SE 3; H335: C ≥ 5 %Resp. Sens.; H334: C ≥ 0,2 %Skin Sens.; H317: C ≥ 0,2 % | 3 |
| 024-005-00-2 | chromyl dichloride;chromic oxychloride | 239-056-8 | 14977-61-8 | Ox. Liq. 1Carc. 1BMuta. 1BSkin Corr. 1ASkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H271H350iH340H314H317H400H410 | GHS03GHS08GHS05GHS07GHS09Dgr | H271H350iH340H314H317H410 | Skin Corr. 1A; H314: C ≥ 10 %Skin Corr. 1B; H314: 5 % ≤ C < 10 %Skin Irrit. 2; H315: 0,5 % ≤ C < 5 %Eye Irrit. 2; H319: 0,5 % ≤ C < 5 %STOT SE 3; H335: 0,5 % ≤ C < 5 %Skin Sens. 1; H317: C ≥ 0,5 % | T3 |
| 024-006-00-8 | potassium chromate | 232-140-5 | 7789-00-6 | Carc. 1BMuta. 1BEye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350iH340H319H335H315H317H400H410 | GHS08GHS07GHS09Dgr | H350iH340H319H335H315H317H410 | Skin Sens. 1; H317: C ≥ 0.5 % | 3 |
| 024-007-00-3 | zinc chromates including zinc potassium chromate | — | — | Carc. 1AAcute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H302H317H400H410 | GHS08GHS07GHS09Dgr | H350H302H317H410 | A |
| 024-008-00-9 | calcium chromate | 237-366-8 | 13765-19-0 | Carc. 1BAcute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 |
| 024-009-00-4 | strontium chromate | 232-142-6 | 7789-06-2 | Carc. 1BAcute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H400H410 |
| 024-010-00-X | dichromium tris(chromate);chromium III chromate;chromic chromate | 246-356-2 | 24613-89-6 | Ox. Sol. 1Carc. 1BSkin Corr. 1ASkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H271H350H314H317H400H410 | GHS03GHS08GHS05GHS07GHS09Dgr | H271H350H314H317H410 | T |
| 024-011-00-5 | ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) | 400-110-2 | 109125-51-1 | Self-react. C ****Aquatic Acute 1Aquatic Chronic 1 | H242H400H410 | GHS02GHS09Dgr | H242H410 |
| 024-012-00-0 | trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) | 400-810-8 | — | Muta. 2 | H341 | GHS08Wng | H341 |
| 024-013-00-6 | trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) | 402-500-8 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 024-014-00-1 | trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) | 402-870-0 | 93952-24-0 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 024-015-00-7 | disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) | 404-930-1 | — | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H332H318H411 | GHS05GHS07GHS09Dgr | H332H318H411 |
| 024-016-00-2 | tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) | 405-110-6 | 88377-66-6 | STOT RE 2 *Aquatic Chronic 4 | H373 **H413 | GHS08Wng | H373 **H413 |
| 024-017-00-8 | Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex | — | — | Carc. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350iH317H400H410 | GHS08GHS07GHS09Dgr | H350iH317H410 | A |
| 024-018-00-3 | sodium chromate | 231-889-5 | 7775-11-3 | Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H340H360FDH330H301H372 **H312H314H334H317H400H410 | GHS06GHS08GHS05GHS09Dgr | H350H340H360FDH330H301H372 **H312H314H334H317H410 | Resp. Sens.; H334: C ≥ 0,2 %Skin Sens.; H317: C ≥ 0,2 % | 3 |
| 024-019-00-9 | Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}-{6''-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfamoyl)-3''-sulfonatonaphthalene-2''-azobenzene-1'',2'''-diolato}chromate (III);by-product 1: acetoacetic acid anilide/acetoacetic acid anilide (ATAN-ATAN): trisodium bis{6-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfonyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}chromate (III);by-product 2: 3-amino-1-hydroxybenzene/3-amino-1-hydroxybenzene (MAP-MAP): trisodium bis{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato} chromate (III) | 419-230-1 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 024-020-00-4 | trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate(III) | 418-220-4 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 025-001-00-3 | manganese dioxide | 215-202-6 | 1313-13-9 | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 |
| 025-002-00-9 | potassium permanganate | 231-760-3 | 7722-64-7 | Ox. Sol. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H272H302H400H410 | GHS03GHS07GHS09Dgr | H272H302H410 |
| 025-003-00-4 | manganese sulphate | 232-089-9 | 7785-87-7 | STOT RE 2 *Aquatic Chronic 2 | H373 **H411 | GHS08GHS09Wng | H373 **H411 |
| 025-004-00-X | bis(N,N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate | 411-760-1 | 116633-53-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 025-005-00-5 | reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-);tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-);pentasodium [29H,31H-phthalocyanine-C,C,C,C,C-pentasulfonato (6-)-N29,N30,N31,N32] manganate (3-) | 417-660-4 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 026-001-00-6 | (η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate | 407-840-0 | 100011-37-8 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 026-002-00-1 | (η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate | 407-880-9 | 117549-13-0 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 027-001-00-9 | cobalt | 231-158-0 | 7440-48-4 | Resp. Sens. 1Skin Sens. 1Aquatic Chronic 4 | H334H317H413 | GHS08Dgr | H334H317H413 |
| 027-002-00-4 | cobalt oxide | 215-154-6 | 1307-96-6 | Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 027-003-00-X | cobalt sulphide | 215-273-3 | 1317-42-6 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 027-004-00-5 | cobalt dichloride | 231-589-4 | 7646-79-9 | Carc. 1BAcute Tox. 4 *Resp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350iH302H334H317H400H410 | GHS08GHS07GHS09Dgr | H350iH302H334H317H410 | Carc. 1B; H350i: C ≥ 0,01 %* | 1 |
| 027-005-00-0 | cobalt sulphate | 233-334-2 | 10124-43-3 | Carc. 1BAcute Tox. 4 *Resp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350iH302H334H317H400H410 | GHS08GHS07GHS09Dgr | H350iH302H334H317H410 | Carc. 1B; H350i: C ≥ 0,01 % | 1 |
| 028-001-00-1 | tetracarbonylnickel;nickel tetracarbonyl | 236-669-2 | 13463-39-3 | Flam. Liq. 2Carc. 2Repr. 1BAcute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H225H351H360D ***H330H400H410 | GHS02GHS06GHS08GHS09Dgr | H225H351H360D ***H330H410 |
| 028-002-00-7 | nickel | 231-111-4 | 7440-02-0 | Carc. 2Skin Sens. 1 | H351H317 | GHS08GHS07Wng | H351H317 |
| 028-003-00-2 | nickel monoxide | 215-215-7 | 1313-99-1 | Carc. 1AiSkin Sens. 1Aquatic Chronic 4 | H350iH317H413 | GHS08GHS07Dgr | H350iH317H413 |
| 028-004-00-8 | nickel dioxide | 234-823-3 | 12035-36-8 | Carc. 1AiSkin Sens. 1Aquatic Chronic 4 | H350iH317H413 | GHS08GHS07Dgr | H350iH317H413 |
| 028-005-00-3 | dinickel trioxide | 215-217-8 | 1314-06-3 | Carc. 1AiSkin Sens. 1Aquatic Chronic 4 | H350iH317H413 | GHS08GHS07Dgr | H350iH317H413 |
| 028-006-00-9 | nickel sulphide | 240-841-2 | 16812-54-7 | Carc. 1AiSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350iH317H400H410 | GHS08GHS07GHS07GHS09Dgr | H350iH317H410 |
| 028-007-00-4 | nickel subsulphide;trinickel disulphide | 234-829-6 | 12035-72-2 | Carc. 1AiSkin Sens. 1Aquatic Chronic 2 | H350iH317H411 | GHS08GHS07GHS09Dgr | H350iH317H411 |
| 028-008-00-X | nickel dihydroxide | 235-008-5 | 12054-48-7 | Carc. 2Acute Tox. 4 *Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H332H302H317H400H410 | GHS08GHS07GHS09Wng | H351H332H302H317H410 |
| 028-009-00-5 | nickel sulphate | 232-104-9 | 7786-81-4 | Carc. 2Acute Tox. 4 *Resp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H302H334H317H400H410 | GHS08GHS07GHS09Dgr | H351H302H334H317H410 |
| 028-010-00-0 | nickel carbonate | 222-068-2 | 3333-67-3 | Carc. 2Acute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H302H317H400H410 | GHS08GHS07GHS09Wng | H351H302H317H410 |
| 029-001-00-4 | copper chloride;copper (I) chloride;cuprous chloride | 231-842-9 | 7758-89-6 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H400H410 |
| 029-002-00-X | dicopper oxide;copper (I) oxide | 215-270-7 | 1317-39-1 | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 029-003-00-5 | Naphthenic acids, copper salts;copper naphthenate | 215-657-0 | 1338-02-9 | Flam. Liq. 3Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H226H302H400H410 | GHS02GHS07GHS09Wng | H226H302H410 |
| 029-004-00-0 | copper sulphate | 231-847-6 | 7758-98-7 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H315H400H410 | GHS07GHS09Wng | H302H319H315H410 |
| 029-005-00-6 | (tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid | 401-260-1 | — | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 029-006-00-1 | tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) | 403-210-4 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 029-007-00-7 | (trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide | 404-670-9 | 89797-01-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 | G |
| 029-008-00-2 | copper(II) methanesulfonate | 405-400-2 | 54253-62-2 | Acute Tox. 4 *Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H318H400H410 | GHS05GHS07GHS09Dgr | H302H318H410 |
| 029-009-00-8 | phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex | 413-650-9 | 93971-95-0 | Aquatic Chronic 3 | H412 | — | H412 |
| 029-010-00-3 | reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II) to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) | 407-700-9 | 101408-30-4 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 029-011-00-9 | sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex | 412-730-0 | 150522-10-4 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 029-012-00-4 | sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) | 407-340-2 | 124719-24-0 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 029-013-00-X | trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) | 407-580-8 | 130201-51-3 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 030-001-00-1 | zinc powder — zinc dust (pyrophoric) | 231-175-3 | 7440-66-6 | Water-react. 1Pyr. Sol. 1Aquatic Acute 1Aquatic Chronic 1 | H260H250H400H410 | GHS02GHS09Dgr | H260H250H410 | T |
| 030-001-01-9 | zinc powder — zinc dust (stabilised) | 231-175-3 | 7440-66-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 030-003-00-2 | zinc chloride | 231-592-0 | 7646-85-7 | Acute Tox. 4 *Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H302H314H400H410 | GHS05GHS07GHS09Dgr | H302H314H410 | STOT SE 3; H335: C ≥ 5 % |
| 030-004-00-8 | dimethylzinc; [1]diethylzinc [2] | 208-884-1 [1]209-161-3 [2] | 544-97-8 [1]557-20-0 [2] | Pyr. Liq. 1Water-react. 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H250H260H314H400H410 | GHS02GHS05GHS09Dgr | H250H260H314H410 | EUH014 |
| 030-005-00-3 | diamminediisocyanatozinc | 401-610-3 | — | Acute Tox. 4 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1Aquatic Acute 1 | H302H318H334H317H400 | GHS05GHS08GHS07GHS09Dgr | H302H318H334H317H400 |
| 030-006-00-9 | zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate); [1]zinc sulphate (anhydrous) [2] | 231-793-3 [1]231-793-3 [2] | 7446-19-7 [1]7733-02-0 [2] | Acute Tox. 4 *Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H318H400H410 | GHS05GHS07GHS09Dgr | H302H318H410 |
| 030-007-00-4 | bis(3,5-di-tert-butylsalicylato-O1,O2)zinc | 403-360-0 | 42405-40-3 | Flam. Sol. 1Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H228H302H400H410 | GHS02GHS07GHS09Dgr | H228H302H410 | T |
| 030-008-00-X | hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) | 403-750-0 | 113036-91-2 | Acute Tox. 4 *Aquatic Chronic 2 | H332H411 | GHS07GHS09Wng | H332H411 |
| 030-011-00-6 | trizinc bis(orthophosphate) | 231-944-3 | 7779-90-0 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 030-013-00-7 | zinc oxide | 215-222-5 | 1314-13-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 033-001-00-X | arsenic | 231-148-6 | 7440-38-2 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 |
| 033-002-00-5 | arsenic compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 | * | A1 |
| 033-003-00-0 | diarsenic trioxide;arsenic trioxide | 215-481-4 | 1327-53-3 | Carc. 1AAcute Tox. 2 *Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H350H300H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H350H300H314H410 |
| 033-004-00-6 | diarsenic pentaoxide;arsenic pentoxide;arsenic oxide | 215-116-9 | 1303-28-2 | Carc. 1AAcute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H350H331H301H400H410 | GHS06GHS08GHS09Dgr | H350H331H301H410 |
| 033-005-00-1 | arsenic acid and its salts | — | — | Carc. 1AAcute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H350H331H301H400H410 | GHS06GHS08GHS09Dgr | H350H331H301H410 | A |
| 033-006-00-7 | arsine | 232-066-3 | 7784-42-1 | Flam. Gas 1Press. GasAcute Tox. 2 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H220H330H373 **H400H410 | GHS02GHS04GHS06GHS08GHS09Dgr | H220H330H373 **H410 | U |
| 033-007-00-2 | tert-butylarsine | 423-320-6 | 4262-43-5 | Pyr. Liq. 1Acute Tox. 2 * | H250H330 | GHS02GHS06Dgr | H250H330 |
| 034-001-00-2 | selenium | 231-957-4 | 7782-49-2 | Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Chronic 4 | H331H301H373 **H413 | GHS06GHS08Dgr | H331H301H373 **H413 |
| 034-002-00-8 | selenium compounds except cadmium sulphoselenide | — | — | Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H373 **H400H410 | GHS06GHS08GHS09Dgr | H331H301H373 **H410 | A |
| 034-003-00-3 | sodium selenite | 233-267-9 | 10102-18-8 | Acute Tox. 2 *Acute Tox. 3 *Skin Sens. 1Aquatic Chronic 2 | H300H331H317H411 | GHS06GHS09Dgr | H300H331H317H411 | EUH031 |
| 035-001-00-5 | bromine | 231-778-1 | 7726-95-6 | Acute Tox. 2 *Skin Corr. 1AAquatic Acute 1 | H330H314H400 | GHS06GHS05GHS09Dgr | H330H314H400 |
| 035-002-00-0 | hydrogen bromide | 233-113-0 | 10035-10-6 | Press. GasSkin Corr. 1ASTOT SE 3 | H314H335 | GHS04GHS05GHS07Dgr | H314H335 | U |
| 035-002-01-8 | hydrobromic acid ... % | — | — | Skin Corr. 1BSTOT SE 3 | H314H335 | GHS05GHS07Dgr | H314H335 | Skin Corr. 1B; H314: C ≥ 40 %Skin Irrit. 2; H315: 10 % ≤ C < 40 %Eye Irrit. 2; H319: 10 % ≤ C < 40 %STOT SE 3; H335: C ≥ 10 % | B |
| 035-003-00-6 | potassium bromate | 231-829-8 | 7758-01-2 | Ox. Sol. 1Carc. 1BAcute Tox. 3 * | H271H350H301 | GHS03GHS06GHS08Dgr | H271H350H301 |
| 035-004-00-1 | 2-hydroxyethylammonium perbromide | 407-440-6 | — | Ox. Sol. 2 ****Acute Tox. 4 *Skin Corr. 1ASkin Sens. 1Aquatic Acute 1 | H272H302H314H317H400 | GHS03GHS05GHS07GHS09Dgr | H272H302H314H317H400 |
| 040-001-00-3 | zirconium powder (pyrophoric) | 231-176-9 | 7440-67-7 | Water-react. 1Pyr. Sol. 1 | H260H250 | GHS02Dgr | H260H250 | T |
| 040-002-00-9 | zirconium powder, dry (non pyrophoric) | — | — | Self-heat. 1 | H251 | GHS02Dgr | H251 | T |
| 042-001-00-9 | molybdenum trioxide | 215-204-7 | 1313-27-5 | STOT RE 2 *Eye Irrit. 2STOT SE 3 | H373 **H319H335 | GHS08GHS07Wng | H373 **H319H335 |
| 042-002-00-4 | tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) | 404-760-8 | 117342-25-3 | Acute Tox. 3 *Eye Dam. 1Aquatic Chronic 4 | H331H318H413 | GHS06GHS05Dgr | H331H318H413 |
| 042-003-00-X | tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) | 404-860-1 | 116810-46-9 | Flam. Sol. 1Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H228H318H400H410 | GHS02GHS05GHS09Dgr | H228H318H410 | T |
| 042-004-00-5 | Reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) | 412-780-3 | — | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H315H317H411 | GHS07GHS09Wng | H315H317H411 |
| 047-001-00-2 | silver nitrate | 231-853-9 | 7761-88-8 | Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 |
| 048-001-00-5 | cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe),reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex | — | — | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | * | A1 |
| 048-002-00-0 | cadmium (non-pyrophoric); [1]cadmium oxide (non-pyrophoric) [2] | 231-152-8 [1]215-146-2 [2] | 7440-43-9 [1]1306-19-0 [2] | Carc. 1BMuta. 2Repr. 2Acute Tox. 2 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H350H341H361fdH330H372 **H400H410 | GHS06GHS08GHS09Dgr | H350H341H361fdH330H372 **H410 |
| 048-003-00-6 | cadmium diformate;cadmiumformate | 224-729-0 | 4464-23-7 | Acute Tox. 3 *Acute Tox. 3 *Carc. 2STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H351H373 **H400H410 | GHS06GHS08GHS09Dgr | H331H301H351H373 **H410 | *STOT RE 2; H373: C ≥ 0,25 % |
| 048-004-00-1 | cadmium cyanide | 208-829-1 | 542-83-6 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Carc. 2STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H351H373 **H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H351H373 **H410 | EUH032 | STOT RE 2; H373: C ≥ 0,1 %EUH032: C ≥ 1 % |
| 048-005-00-7 | cadmiumhexafluorosilicate(2-);cadmium fluorosilica | 241-084-0 | 17010-21-8 | Acute Tox. 3 *Acute Tox. 3 *Carc. 2STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H351H373 **H400H410 | GHS06GHS08GHS09Dgr | H331H301H351H373 **H410 | *STOT RE 2; H373: C ≥ 0,1 % |
| 048-006-00-2 | cadmium fluoride | 232-222-0 | 7790-79-6 | Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H350H340H360FDH330H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H350H340H360FDH330H301H372 **H410 | Carc. 1B; H350: C ≥ 0,01 %* oralSTOT RE 1; H372: C ≥ 7 %STOT RE 2: 0,1 % ≤ C < 7 % |
| 048-007-00-8 | cadmium iodide | 232-223-6 | 7790-80-9 | Acute Tox. 3 *Acute Tox. 3 *Carc. 2STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H331H301H351H373 **H400H410 | GHS06GHS08GHS09Dgr | H331H301H351H373 **H410 | *STOT RE 2; H373: C ≥ 0,1 % |
| 048-008-00-3 | cadmium chloride | 233-296-7 | 10108-64-2 | Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H350H340H360FDH330H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H350H340H360FDH330H301H372 **H410 | Carc. 1B; H350: C ≥ 0,01 %* oralSTOT RE 1; H372: C ≥ 7 %STOT RE 2; H373: 0,1 % ≤ C < 7 % |
| 048-009-00-9 | cadmium sulphate | 233-331-6 | 10124-36-4 | Carc. 1BMuta. 1BRepr. 1BAcute Tox. 2 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H350H340H360FDH330H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H350H340H360FDH330H301H372 **H410 | Carc. 1B; H350: C ≥ 0,01 %* oralSTOT RE 1; H372: C ≥ 7 %STOT RE 2; H373: 0,1 % ≤ C < 7 % |
| 048-010-00-4 | cadmium sulphide | 215-147-8 | 1306-23-6 | Carc. 1BMuta. 2Repr. 2STOT RE 1Acute Tox. 4 *Aquatic Chronic 4 | H350H341H361fdH372 **H302H413 | GHS08GHS07Dgr | H350H341H361fdH372 **H302H413 | *STOT RE 1; H372: C ≥ 10 %STOT RE 2; H373: 0,1 % ≤ C < 10 % | 1 |
| 048-011-00-X | cadmium (pyrophoric) | 231-152-8 | 7440-43-9 | Pyr. Sol. 1Carc. 1BMuta. 2Repr. 2Acute Tox. 2 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H250H350H341H361fdH330H372 **H400H410 | GHS02GHS06GHS08GHS09Dgr | H250H350H341H361fdH330H372 **H410 |
| 050-001-00-5 | tin tetrachloride;stannic chloride | 231-588-9 | 7646-78-8 | Skin Corr. 1BAquatic Chronic 3 | H314H412 | GHS05Dgr | H314H412 | STOT SE 3; H335: C ≥ 5 % |
| 050-002-00-0 | cyhexatin (ISO);hydroxytricyclohexylstannane;tri(cyclohexyl)tin hydroxide | 236-049-1 | 13121-70-5 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 |
| 050-003-00-6 | fentin acetate (ISO);triphenyltin acetate | 212-984-0 | 900-95-8 | Carc. 2Repr. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H351H361d ***H330H311H301H372 **H335H315H318H400H410 | GHS06GHS08GHS05GHS09Dgr | H351H361d ***H330H311H301H372 **H335H315H318H410 |
| 050-004-00-1 | fentin hydroxide (ISO);triphenyltin hydroxide | 200-990-6 | 76-87-9 | Carc. 2Repr. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H351H361d ***H330H311H301H372 **H335H315H318H400H410 | GHS06GHS08GHS05GHS09Dgr | H351H361d ***H330H311H301H372 **H335H315H318H410 |
| 050-005-00-7 | trimethyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 | * | A1 |
| 050-006-00-2 | triethyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 | * | A1 |
| 050-007-00-8 | tripropyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 | * | A1 |
| 050-008-00-3 | tributyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *STOT RE 1Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H301H372 **H312H319H315H400H410 | GHS06GHS08GHS09Dgr | H301H372 **H312H319H315H410 | * oralSTOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0,25 % ≤ C < 1 %* dermalEye Irrit. 2; H319: C ≥ 1 %Skin Irrit. 2; H315: C ≥ 1 % | A1 |
| 050-009-00-9 | fluorotripentylstannane; [1]hexapentyldistannoxane [2] | 243-546-7 [1]247-143-7 [2] | 20153-49-5 [1]25637-27-8 [2] | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | * | 1 |
| 050-010-00-4 | fluorotrihexylstannane | 243-547-2 | 20153-50-8 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | * | 1 |
| 050-011-00-X | triphenyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 | * | A1 |
| 050-012-00-5 | tetracyclohexylstannane; [1]chlorotricyclohexylstannane; [2]butyltricyclohexylstannane [3] | 215-910-5 [1]221-437-5 [2]230-358-5 [3] | 1449-55-4 [1]3091-32-5 [2]7067-44-9 [3] | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | * | A1 |
| 050-013-00-0 | trioctyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 4 | H319H335H315H413 | GHS07Wng | H319H335H315H413 | Skin Irrit. 2; H315: C ≥ 1 %Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % | A1 |
| 050-017-00-2 | fenbutatin oxide (ISO);bis(tris(2-methyl-2-phenylpropyl)tin)oxide | 236-407-7 | 13356-08-6 | Acute Tox. 2 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H330H319H315H400H410 | GHS06GHS09Dgr | H330H319H315H410 |
| 050-018-00-8 | tin(II) methanesulphonate | 401-640-7 | 53408-94-9 | Skin Corr. 1BAcute Tox. 4 *Skin Sens. 1 | H314H302H317 | GHS05GHS07Dgr | H314H302H317 |
| 050-019-00-3 | azocyclotin (ISO);1-(tricyclohexylstannyl)-1H—1,2,4-triazole | 255-209-1 | 41083-11-8 | Acute Tox. 2 *Acute Tox. 3 *STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H330H301H335H315H318H400H410 | GHS06GHS05GHS09Dgr | H330H301H335H315H318H410 |
| 050-020-00-9 | trioctylstannane | 413-320-4 | 869-59-0 | STOT RE 1Skin Irrit. 2Aquatic Chronic 4 | H372 **H315H413 | GHS08GHS07Dgr | H372 **H315H413 |
| 051-001-00-8 | antimony trichloride | 233-047-2 | 10025-91-9 | Skin Corr. 1BAquatic Chronic 2 | H314H411 | GHS05GHS09Dgr | H314H411 | STOT SE 3; H335: C ≥ 5 % |
| 051-002-00-3 | antimony pentachloride | 231-601-8 | 7647-18-9 | Skin Corr. 1BAquatic Chronic 2 | H314H411 | GHS05GHS09Dgr | H314H411 | STOT SE 3; H335: C ≥ 5 % |
| 051-003-00-9 | antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex | — | — | Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H332H302H411 | GHS07GHS09Wng | H332H302H411 | * | A1 |
| 051-004-00-4 | antimony trifluoride | 232-009-2 | 7783-56-4 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Aquatic Chronic 2 | H331H311H301H411 | GHS06GHS09Dgr | H331H311H301H411 |
| 051-005-00-X | antimony trioxide | 215-175-0 | 1309-64-4 | Carc. 2 | H351 | GHS08Wng | H351 |
| 051-006-00-5 | diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate | 403-500-0 | — | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 051-007-00-0 | bis(4-dodecylphenyl)iodonium hexafluoroantimonate | 404-420-9 | 71786-70-4 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 053-001-00-3 | iodine | 231-442-4 | 7553-56-2 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1 | H332H312H400 | GHS07GHS09Wng | H332H312H400 |
| 053-002-00-9 | hydrogen iodide | 233-109-9 | 10034-85-2 | Press. GasSkin Corr. 1A | H314 | GHS04GHS05Dgr | H314 | Skin Corr. 1A; H314: C ≥ 10 %Skin Corr. 1B; H314: 0,2 % ≤ C < 10 %Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 %Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 %STOT SE 3; H335: C ≥ 0,02 % | U5 |
| 053-002-01-6 | hydriodic acid ... % | — | — | Skin Corr. 1B | H314 | GHS05Dgr | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % | B |
| 053-005-00-5 | (4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate (1-) | 422-960-3 | 178233-72-2 | Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H312H302H373 **H400H410 | GHS08GHS07GHS09Wng | H312H302H373 **H410 |
| 056-001-00-1 | barium peroxide | 215-128-4 | 1304-29-6 | Ox. Sol. 2Acute Tox. 4 *Acute Tox. 4 * | H272H332H302 | GHS03GHS07Dgr | H272H332H302 |
| 056-002-00-7 | barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex | — | — | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 | * | A1 |
| 056-003-00-2 | barium carbonate | 208-167-3 | 513-77-9 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 056-004-00-8 | barium chloride | 233-788-1 | 10361-37-2 | Acute Tox. 3 *Acute Tox. 4 * | H301H332 | GHS06Dgr | H301H332 |
| 072-001-00-4 | hafnium tetra-n-butoxide | 411-740-2 | 22411-22-9 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 074-001-00-X | hexasodium tungstate hydrate | 412-770-9 | 12141-67-2 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 074-002-00-5 | Reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione | 408-250-6 | — | Flam. Liq. 2Acute Tox. 4 *Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H225H332H314H317H400H410 | GHS02GHS05GHS07GHS09Dgr | H225H332H314H317H410 |
| 076-001-00-5 | osmium tetraoxide;osmic acid | 244-058-7 | 20816-12-0 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Skin Corr. 1B | H330H310H300H314 | GHS06GHS05Dgr | H330H310H300H314 |
| 078-001-00-0 | tetrachloroplatinates with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H318H334H317 | GHS06GHS05GHS08Dgr | H301H318H334H317 | A |
| 078-002-00-6 | diammonium tetrachloroplatinate | 237-499-1 | 13820-41-2 | Acute Tox. 3 *Skin Irrit. 2Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H315H318H334H317 | GHS06GHS05GHS08Dgr | H301H315H318H334H317 |
| 078-003-00-1 | disodium tetrachloroplatinate | 233-051-4 | 10026-00-3 | Acute Tox. 3 *Skin Irrit. 2Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H315H318H334H317 | GHS06GHS05GHS08Dgr | H301H315H318H334H317 |
| 078-004-00-7 | dipotassium tetrachloroplatinate | 233-050-9 | 10025-99-7 | Acute Tox. 3 *Skin Irrit. 2Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H315H318H334H317 | GHS06GHS05GHS08Dgr | H301H315H318H334H317 |
| 078-005-00-2 | hexachloroplatinates with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H318H334H317 | GHS06GHS05GHS08Dgr | H301H318H334H317 | A |
| 078-006-00-8 | disodium hexachloroplatinate | 240-983-5 | 16923-58-3 | Acute Tox. 3 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H318H334H317 | GHS06GHS05GHS08Dgr | H301H318H334H317 |
| 078-007-00-3 | dipotassium hexachloroplatinate | 240-979-3 | 16921-30-5 | Acute Tox. 3 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H318H334H317 | GHS06GHS05GHS08Dgr | H301H318H334H317 |
| 078-008-00-9 | diammonium hexachloroplatinate | 240-973-0 | 16919-58-7 | Acute Tox. 3 *Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H301H318H334H317 | GHS06GHS05GHS08Dgr | H301H318H334H317 |
| 078-009-00-4 | hexachloroplatinic acid | 241-010-7 | 16941-12-1 | Acute Tox. 3 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1 | H301H314H334H317 | GHS06GHS05GHS08Dgr | H301H314H334H317 |
| 080-001-00-0 | mercury | 231-106-7 | 7439-97-6 | Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H331H373 **H400H410 | GHS06GHS08GHS09Dgr | H331H373 **H410 |
| 080-002-00-6 | inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex | — | — | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H373 **H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H373 **H410 | *STOT RE 2; H373: C ≥ 0,1 % | A1 |
| 080-003-00-1 | dimercury dichloride;mercurous chloride;calomel | 233-307-5 | 10112-91-1 | Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H315H400H410 | GHS07GHS09Wng | H302H319H335H315H410 |
| 080-004-00-7 | organic compounds of mercury with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H373 **H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H373 **H410 | *STOT RE 2; H373: C ≥ 0,1 % | A1 |
| 080-005-00-2 | mercury difulminate;mercuric fulminate;fulminate of mercury | 211-057-8 | 628-86-4 | Unst. Expl.Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H200H331H311H301H373 **H400H410 | GHS01GHS06GHS08GHS09Dgr | H200H331H311H301H373 **H400H410 |
| 080-005-01-X | mercury difulminate;mercuric fulminate;fulminate of mercury [> 20 % phlegmatiser] | 211-057-8 | 628-86-4 | Expl. 1.1Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H201H331H311H301H373 **H400H410 | GHS01GHS06GHS08GHS09Dgr | H201H331H311H301H373 **H400H410 |
| 080-006-00-8 | dimercury dicyanide oxide;mercuric oxycyanide | 215-629-8 | 1335-31-5 | Expl. 1.1Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H201H331H311H301H373 **H400H410 | GHS01GHS06GHS08GHS09Dgr | H201H331H311H301H373 **H410 | T |
| 080-007-00-3 | dimethylmercury; [1]diethylmercury [2] | 209-805-3 [1]211-000-7 [2] | 593-74-8 [1]627-44-1 [2] | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H373 **H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H373 **H410 | *STOT RE 2; H373: C ≥ 0,05 % | 1 |
| 080-008-00-9 | phenylmercury nitrate; [1]phenylmercury hydroxide; [2]basic phenylmercury nitrate [3] | 200-242-9 [1]202-866-7 [2][3] | 55-68-5 [1]100-57-2 [2]8003-05-2 [3] | Acute Tox. 3 *STOT RE 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H301H372 **H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H301H372 **H314H410 |
| 080-009-00-4 | 2-methoxyethylmercury chloride | 204-659-7 | 123-88-6 | Acute Tox. 3 *STOT RE 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H301H372 **H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H301H372 **H314H410 |
| 080-010-00-X | mercury dichloride;mercuric chloride | 231-299-8 | 7487-94-7 | Acute Tox. 2 *STOT RE 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H300H372 **H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H300H372 **H314H410 |
| 080-011-00-5 | phenylmercury acetate | 200-532-5 | 62-38-4 | Acute Tox. 3 *STOT RE 1Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H301H372 **H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H301H372 **H314H410 |
| 081-001-00-3 | thallium | 231-138-1 | 7440-28-0 | Acute Tox. 2 *Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 4 | H330H300H373 **H413 | GHS06GHS08Dgr | H330H300H373 **H413 |
| 081-002-00-9 | thallium compounds, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 2 *Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 2 | H330H300H373 **H411 | GHS06GHS08GHS09Dgr | H330H300H373 **H411 | A |
| 081-003-00-4 | dithallium sulphate;thallic sulphate | 231-201-3 | 7446-18-6 | Acute Tox. 2 *STOT RE 1Skin Irrit. 2Aquatic Chronic 2 | H300H372 **H315H411 | GHS06GHS08GHS09Dgr | H300H372 **H315H411 |
| 082-001-00-6 | lead compounds with the exception of those specified elsewhere in this Annex | — | — | Repr. 1AAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH332H302H373 **H400H410 | GHS08GHS07GHS09Dgr | H360DfH332H302H373 **H410 | Repr. 2; H361f: C ≥ 2,5 %*STOT RE 2; H373: C ≥ 0,5 % | A1 |
| 082-002-00-1 | lead alkyls | — | — | Repr. 1AAcute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH330H310H300H373 **H400H410 | GHS06GHS08GHS09Dgr | H360DfH330H310H300H373 **H410 | Repr. 1A; H360D: C ≥ 0,1 %*STOT RE 2; H373: C ≥ 0,05 % | A1 |
| 082-003-00-7 | lead diazide;lead azide | 236-542-1 | 13424-46-9 | Unst. Expl.Repr. 1AAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H200H360DfH332H302H373 **H400H410 | GHS01GHS08GHS07GHS09Dgr | H200H360DfH332H302H373 **H410 | 1 |
| 082-003-01-4 | lead diazide;lead azide [> 20 % phlegmatiser] | 236-542-1 | 13424-46-9 | Expl. 1.1Repr. 1AAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H201H360DfH332H302H373 **H400H410 | GHS01GHS08GHS07GHS09Dgr | H201H360DfH332H302H373 **H410 | 1 |
| 082-004-00-2 | lead chromate | 231-846-0 | 7758-97-6 | Carc. 2Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H360DfH373 **H400H410 | GHS08GHS09Dgr | H351H360DfH373 **H410 | 1 |
| 082-005-00-8 | lead di(acetate) | 206-104-4 | 301-04-2 | Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH373 **H400H410 | GHS08GHS09Dgr | H360DfH373 **H410 | 1 |
| 082-006-00-3 | trilead bis(orthophosphate) | 231-205-5 | 7446-27-7 | Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H360DfH373 **H400H410 | GHS08GHS09Dgr | H360DfH373 **H410 | 1 |
| 082-007-00-9 | lead acetate, basic | 215-630-3 | 1335-32-6 | Carc. 2Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H360DfH373 **H400H410 | GHS08GHS09Dgr | H351H360DfH373 **H410 | 1 |
| 082-008-00-4 | lead(II) methanesulphonate | 401-750-5 | 17570-76-2 | Repr. 1AAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Eye Dam. 1 | H360DfH332H302H373 **H315H318 | GHS08GHS05GHS07Dgr | H360DfH332H302H373 **H315H318 | 1 |
| 082-009-00-X | Lead sulfochromate yellow;C.I. Pigment Yellow 34;[This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] | 215-693-7 | 1344-37-2 | Carc. 2Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H360DfH373 **H400H410 | GHS08GHS09Dgr | H351H360DfH373 **H410 | 1 |
| 082-010-00-5 | Lead chromate molybdate sulfate red;C.I. Pigment Red 104;[This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] | 235-759-9 | 12656-85-8 | Carc. 2Repr. 1ASTOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H360DfH373 **H400H410 | GHS08GHS09Dgr | H351H360DfH373 **H410 | 1 |
| 082-011-00-0 | lead hydrogen arsenate | 232-064-2 | 7784-40-9 | Carc. 1ARepr. 1AAcute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H350H360DfH331H301H373 **H400H410 | GHS06GHS08GHS09Dgr | H350H360DfH331H301H373 **H410 | 1 |
| 092-001-00-8 | uranium | 231-170-6 | 7440-61-1 | Acute Tox. 2 *Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 4 | H330H300H373 **H413 | GHS06GHS08Dgr | H330H300H373 **H413 |
| 092-002-00-3 | uranium compounds | — | — | Acute Tox. 2 *Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 2 | H330H300H373 **H411 | GHS06GHS08GHS09Dgr | H330H300H373 **H411 | A |
| 601-001-00-4 | methane | 200-812-7 | 74-82-8 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 601-002-00-X | ethane | 200-814-8 | 74-84-0 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 601-003-00-5 | propane | 200-827-9 | 74-98-6 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 601-004-00-0 | butane; [1]and isobutane [2] | 203-448-7 [1]200-857-2 [2] | 106-97-8 [1]75-28-5 [2] | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | C U |
| 601-004-01-8 | butane (containing ≥ 0.1 % butadiene (203-450-8)); [1]isobutane (containing ≥ 0.1 % butadiene (203-450-8)) [2] | 203-448-7 [1]200-857-2 [2] | 106-97-8 [1]75-28-5 [2] | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | C S U |
| 601-005-00-6 | 2,2-dimethylpropane;neopentane | 207-343-7 | 463-82-1 | Flam. Gas 1Press. GasAquatic Chronic 2 | H220H411 | GHS02GHS04GHS09Dgr | H220H411 | U |
| 601-006-00-1 | pentane | 203-692-4 | 109-66-0 | Flam. Liq. 2Asp. Tox. 1STOT SE 3Aquatic Chronic 2 | H225H304H336H411 | GHS02GHS08GHS07GHS09Dgr | H225H304H336H411 | EUH066 | C |
| 601-007-00-7 | hexane, reaction mass of isomers (containing < 5 % n-hexane (203-777-6)) | — | — | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Chronic 2 | H225H304H315H336H411 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H411 | C |
| 601-008-00-2 | heptane [and isomers] [1] | 205-563-8 [1]203-548-0 [2]207-346-3 [3]209-230-8 [4]209-280-0 [5]209-643-3 [6]209-680-5 [7]209-730-6 [8]210-529-0 [9]250-610-8 [10] | 142-82-5 [1]108-08-7 [2]464-06-2 [3]562-49-2 [4]565-59-3 [5]589-34-4 [6]590-35-2 [7]591-76-4 [8]617-78-7 [9]31394-54-4 [10] | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H225H304H315H336H400H410 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H410 | C |
| 601-009-00-8 | octane [and isomers] [1] | 203-892-1 [1]208-759-1 [2]209-207-2 [3]209-243-9 [4]209-266-4 [5]209-292-6 [6]209-504-7 [7]209-547-1 [8]209-649-6 [9]209-650-1 [10]209-660-6 [11]209-689-4 [12]209-745-8 [13]209-747-9 [14]209-855-6 [15]210-187-2 [16]210-621-0 [17]213-923-0 [18]247-861-0 [19] | 111-65-9 [1]540-84-1 [2]560-21-4 [3]563-16-6 [4]564-02-3 [5]565-75-3 [6]583-48-2 [7]584-94-1 [8]589-43-5 [9]589-53-7 [10]589-81-1 [11]590-73-8 [12]592-13-2 [13]592-27-8 [14]594-82-1 [15]609-26-7 [16]619-99-8 [17]1067-08-9 [18]26635-64-3 [19] | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H225H304H315H336H400H410 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H410 | C |
| 601-010-00-3 | ethylene | 200-815-3 | 74-85-1 | Flam. Gas 1Press. GasSTOT SE 3 | H220H336 | GHS02GHS04GHS07Dgr | H220H336 | U |
| 601-011-00-9 | propene;propylene | 204-062-1 | 115-07-1 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 601-012-00-4 | but-1-ene; [1]butene, mixed-1-and-2-isomers; [2]2-methylpropene; [3](Z)-but-2-ene; [4](E)-but-2-ene [5] | 203-449-2 [1]203-452-9 [2]204-066-3 [3]209-673-7 [4]210-855-3 [5] | 106-98-9 [1]107-01-7 [2]115-11-7 [3]590-18-1 [4]624-64-6 [5] | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | C U |
| 601-013-00-X | 1,3-butadiene;buta-1,3-diene | 203-450-8 | 106-99-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | D U |
| 601-014-00-5 | isoprene (stabilised)2-methyl-1,3-butadiene | 201-143-3 | 78-79-5 | Flam. Liq. 1Carc. 1BMuta. 2Aquatic Chronic 3 | H224H350H341H412 | GHS02GHS08Dgr | H224H350H341H412 | D |
| 601-015-00-0 | acetylene;ethyne | 200-816-9 | 74-86-2 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | EUH006 | U |
| 601-016-00-6 | cyclopropane | 200-847-8 | 75-19-4 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 601-017-00-1 | cyclohexane | 203-806-2 | 110-82-7 | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H225H304H315H336H400H410 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H410 |
| 601-018-00-7 | methylcyclohexane | 203-624-3 | 108-87-2 | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Chronic 2 | H225H304H315H336H411 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H411 |
| 601-019-00-2 | 1,4-dimethylcyclohexane | 209-663-2 | 589-90-2 | Flam. Liq. 2Asp. Tox. 1Skin Irrit. 2STOT SE 3Aquatic Chronic 2 | H225H304H315H336H411 | GHS02GHS08GHS07GHS09Dgr | H225H304H315H336H411 |
| 601-020-00-8 | benzene | 200-753-7 | 71-43-2 | Flam. Liq. 2Carc. 1AMuta. 1BSTOT RE 1Asp. Tox. 1Eye Irrit. 2Skin Irrit. 2 | H225H350H340H372 **H304H319H315 | GHS02GHS08GHS07Dgr | H225H350H340H372 **H304H319H315 | E |
| 601-021-00-3 | toluene | 203-625-9 | 108-88-3 | Flam. Liq. 2Repr. 2Asp. Tox. 1STOT RE 2 *Skin Irrit. 2STOT SE 3 | H225H361d ***H304H373 **H315H336 | GHS02GHS08GHS07Dgr | H225H361d ***H304H373 **H315H336 |
| 601-022-00-9 | o-xylene; [1]p-xylene; [2]m-xylene; [3]xylene [4] | 202-422-2 [1]203-396-5 [2]203-576-3 [3]215-535-7 [4] | 95-47-6 [1]106-42-3 [2]108-38-3 [3]1330-20-7 [4] | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Skin Irrit. 2 | H226H332H312H315 | GHS02GHS07Wng | H226H332H312H315 | * | C |
| 601-023-00-4 | ethylbenzene | 202-849-4 | 100-41-4 | Flam. Liq. 2Acute Tox. 4 * | H225H332 | GHS02GHS07Dgr | H225H332 |
| 601-024-00-X | cumene; [1]propylbenzene [2] | 202-704-5 [1]203-132-9 [2] | 98-82-8 [1]103-65-1 [2] | Flam. Liq. 3Asp. Tox. 1STOT SE 3Aquatic Chronic 2 | H226H304H335H411 | GHS02GHS08GHS07GHS09Dgr | H226H304H335H411 | C |
| 601-025-00-5 | mesitylene;1,3,5-trimethylbenzene | 203-604-4 | 108-67-8 | Flam. Liq. 3STOT SE 3Aquatic Chronic 2 | H226H335H411 | GHS02GHS07GHS09Wng | H226H335H411 | STOT SE 3; H335: C ≥ 25 % |
| 601-026-00-0 | styrene | 202-851-5 | 100-42-5 | Flam. Liq. 3Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H226H332H319H315 | GHS02GHS07Wng | H226H332H319H315 | * | D |
| 601-027-00-6 | 2-phenylpropene;α-methylstyrene | 202-705-0 | 98-83-9 | Flam. Liq. 3Eye Irrit. 2STOT SE 3Aquatic Chronic 2 | H226H319H335H411 | GHS02GHS07GHS09Wng | H226H319H335H411 | STOT SE 3; H335: C ≥ 25 % |
| 601-028-00-1 | 2-methylstyrene;2-vinyltoluene | 210-256-7 | 611-15-4 | Acute Tox. 4 *Aquatic Chronic 2 | H332H411 | GHS07GHS09Wng | H332H411 |
| 601-029-00-7 | dipentene;limonene; [1](R)-p-mentha-1,8-diene;d-limonene; [2](S)-p-mentha-1,8-diene;l-limonene; [3]trans-1-methyl-4-(1-methylvinyl)cyclohexene; [4](±)-1-methyl-4-(1-methylvinyl)cyclohexene [5] | 205-341-0 [1]227-813-5 [2]227-815-6 [3]229-977-3 [4]231-732-0 [5] | 138-86-3 [1]5989-27-5 [2]5989-54-8 [3]6876-12-6 [4]7705-14-8 [5] | Flam. Liq. 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H226H315H317H400H410 | GHS02GHS07GHS09Wng | H226H315H317H410 | C |
| 601-030-00-2 | cyclopentane | 206-016-6 | 287-92-3 | Flam. Liq. 2Aquatic Chronic 3 | H225H412 | GHS02Dgr | H225H412 |
| 601-031-00-8 | 2,4,4-trimethylpent-1-ene | 203-486-4 | 107-39-1 | Flam. Liq. 2Aquatic Chronic 2 | H225H411 | GHS02GHS09Dgr | H225H411 |
| 601-032-00-3 | benzo[a]pyrene;benzo[def]chrysene | 200-028-5 | 50-32-8 | Carc. 1BMuta. 1BRepr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H340H360FDH317H400H410 | GHS08GHS07GHS09Dgr | H350H340H360FDH317H410 | Carc. 1B; H350: C ≥ 0,01 % |
| 601-033-00-9 | benz[a]anthracene | 200-280-6 | 56-55-3 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 601-034-00-4 | benz[e]acephenanthrylene | 205-911-9 | 205-99-2 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 601-035-00-X | benzo[j]fluoranthene | 205-910-3 | 205-82-3 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 601-036-00-5 | benzo[k]fluoranthene | 205-916-6 | 207-08-9 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 601-037-00-0 | n-hexane | 203-777-6 | 110-54-3 | Flam. Liq. 2Repr. 2Asp. Tox. 1STOT RE 2 *Skin Irrit. 2STOT SE 3Aquatic Chronic 2 | H225H361f ***H304H373 **H315H336H411 | GHS02GHS08GHS07GHS09Dgr | H225H361f ***H304H373 **H315H336H411 | STOT RE 2; H373: C ≥ 5 % |
| 601-041-00-2 | dibenz[a,h]anthracene | 200-181-8 | 53-70-3 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 | Carc. 1B; H350: C ≥ 0,01 % |
| 601-042-00-8 | biphenyl;diphenyl | 202-163-5 | 92-52-4 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H400H410 | GHS07GHS09Wng | H319H335H315H410 |
| 601-043-00-3 | 1,2,4-trimethylbenzene | 202-436-9 | 95-63-6 | Flam. Liq. 3Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H226H332H319H335H315H411 | GHS02GHS07GHS09Wng | H226H332H319H335H315H411 |
| 601-044-00-9 | 3a,4,7,7a-tetrahydro-4,7-methanoindene | 201-052-9 | 77-73-6 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H225H332H302H319H335H315H411 | GHS02GHS07GHS09Dgr | H225H332H302H319H335H315H411 |
| 601-045-00-4 | 1,2,3,4-tetrahydronaphthalene | 204-340-2 | 119-64-2 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H319H315H411 | GHS07GHS09Wng | H319H315H411 | EUH019 |
| 601-046-00-X | 7-methylocta-1,6-diene | 404-210-7 | 42152-47-6 | Flam. Liq. 3Aquatic Acute 1Aquatic Chronic 1 | H226H400H410 | GHS02GHS09Wng | H226H410 |
| 601-047-00-5 | m-mentha-1,3(8)-diene | 404-150-1 | 17092-80-7 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 601-048-00-0 | chrysene | 205-923-4 | 218-01-9 | Carc. 1BMuta. 2Aquatic Acute 1Aquatic Chronic 1 | H350H341H400H410 | GHS08GHS09Dgr | H350H341H410 |
| 601-049-00-6 | benzo[e]pyrene | 205-892-7 | 192-97-2 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 601-051-00-7 | 4-phenylbut-1-ene | 405-980-7 | 768-56-9 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 601-052-00-2 | naphthalene | 202-049-5 | 91-20-3 | Carc. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H302H400H410 | GHS07GHS08GHS09Wng | H351H302H410 |
| 601-053-00-8 | nonylphenol; [1]4-nonylphenol, branched [2] | 246-672-0 [1]284-325-5 [2] | 25154-52-3 [1]84852-15-3 [2] | Repr. 2Acute Tox. 4 *Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H361fdH302H314H400H410 | GHS08GHS05GHS07GHS09Dgr | H361fdH302H314H410 |
| 601-054-00-3 | reaction mass of isomers of: dibenzylbenzene;dibenzyl(methyl)benzene;dibenzyl(dimethyl)benzene;dibenzyl(trimethyl)benzene | 405-570-8 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 601-055-00-9 | reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes;di-(2-tetradecyl)naphthalenes;tri-(2-tetradecyl)naphthalenes | 410-190-0 | 132983-41-6 | Eye Irrit. 2Aquatic Chronic 4 | H319H413 | GHS07Wng | H319H413 |
| 601-056-00-4 | reaction mass of isomers of: methyldiphenylmethane;dimethyldiphenylmethane | 405-470-4 | 73807-39-3 | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 601-057-00-X | N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate | 421-130-8 | 156679-41-3 | Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H318H317H400H410 | GHS05GHS07GHS09Dgr | H318H317H410 |
| 601-058-00-5 | di-L-para-menthene | 417-870-6 | 83648-84-4 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 601-059-00-0 | methyl 2-benzylidene-3-oxobutyrate | 420-940-9 | 15768-07-7 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H319H315H411 | GHS07GHS09Wng | H319H315H411 |
| 601-060-00-6 | 1,2-bis[4-fluoro-6-{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y = 0,245 | 417-610-1 | 155522-09-1 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 601-061-00-1 | (ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) | 418-960-8 | — | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H314H317H411 | GHS05GHS07GHS09Dgr | H314H317H411 |
| 601-062-00-7 | reaction mass of: branched triacontane;branched dotriacontane;branched tetratriacontane;branched hexatriacontane | 417-030-9 | 151006-59-6 | Aquatic Chronic 4 | H413 | — | H413 |
| 601-063-00-2 | reaction mass of isomers of branched tetracosane | 417-060-2 | 151006-61-0 | Acute Tox. 4 *Aquatic Chronic 4 | H332H413 | GHS07Wng | H332H413 |
| 601-064-00-8 | branched hexatriacontane | 417-070-7 | 151006-62-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 601-065-00-3 | reaction mass of: (1'-α,3'-α,6'-α-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane);(1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) | 416-930-9 | — | STOT RE 2 *Eye Dam. 1Aquatic Chronic 2 | H373 **H318H411 | GHS08GHS05GHS09Dgr | H373 **H318H411 |
| 601-066-00-9 | 1-(4-(trans-4-heptylcyclohexyl)phenyl) ethanone | 426-820-2 | 78531-60-9 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 601-067-00-4 | triethyl arsenate | 427-700-2 | 15606-95-8 | Carc. 1AAcute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H350H331H301H400H410 | GHS06GHS08GHS09Dgr | H350H331H301H410 |
| 601-068-00-X | 1,2-diacetoxybut-3-ene | 421-720-5 | 18085-02-4 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 601-069-00-5 | 2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide | 422-680-1 | 287933-44-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 601-071-00-6 | 1-dimethoxymethyl-2-nitro-benzene | 423-830-9 | 20627-73-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 601-073-00-7 | 1-bromo-3,5-difluorobenzene | 416-710-2 | 461-96-1 | Flam. Liq. 3Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H226H302H373 **H315H317H400H410 | GHS02GHS08GHS07GHS09Wng | H226H302H373 **H315H317H410 |
| 601-074-00-2 | reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane;1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane;spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan];spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] | 422-040-1 | — | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H319H315H411 | GHS07GHS09Wng | H319H315H411 |
| 601-085-00-2 | isopentane;2-methylbutane | 201-142-8 | 78-78-4 | Flam. Liq. 1Asp. Tox. 1STOT SE 3Aquatic Chronic 2 | H224H304H336H411 | GHS02GHS08GHS07GHS09Dgr | H224H304H336H411 | EUH066 |
| 602-001-00-7 | chloromethane;methyl chloride | 200-817-4 | 74-87-3 | Flam. Gas 1Press. GasCarc. 2STOT RE 2 * | H220H351H373 ** | GHS02GHS04GHS08Dgr | H220H351H373 ** | U |
| 602-002-00-2 | bromomethane;methylbromide | 200-813-2 | 74-83-9 | Press. GasMuta. 2Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Ozone | H341H331H301H373 **H319H335H315H400EUH059 | GHS04GHS06GHS08GHS09Dgr | H341H331H301H373 **H319H335H315H400 | EUH059 | U |
| 602-003-00-8 | dibromomethane | 200-824-2 | 74-95-3 | Acute Tox. 4 *Aquatic Chronic 3 | H332H412 | GHS07Wng | H332H412 | * |
| 602-004-00-3 | dichloromethane;methylene chloride | 200-838-9 | 75-09-2 | Carc. 2 | H351 | GHS08Wng | H351 |
| 602-005-00-9 | methyl iodide;iodomethane | 200-819-5 | 74-88-4 | Carc. 2Acute Tox. 4 *Acute Tox. 3 *Acute Tox. 3 *STOT SE 3Skin Irrit. 2 | H351H312H331H301H335H315 | GHS06GHS08Dgr | H351H312H331H301H335H315 |
| 602-006-00-4 | trichloromethane;chloroform | 200-663-8 | 67-66-3 | Carc. 2Acute Tox. 4 *STOT RE 2 *STOT RE 2 *Skin Irrit. 2 | H351H302H373 **H373 **H315 | GHS07GHS08Wng | H351H302H373 **H373 **H315 | *STOT RE 2; H373: C ≥ 5 % |
| 602-007-00-X | bromoform;tribromomethane | 200-854-6 | 75-25-2 | Acute Tox. 3 *Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H331H319H315H411 | GHS06GHS09Dgr | H331H319H315H411 |
| 602-008-00-5 | carbon tetrachloride;tetrachloromethane | 200-262-8 | 56-23-5 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1Aquatic Chronic 3Ozone | H351H331H311H301H372 **H412EUH059 | GHS06GHS08Dgr | H351H331H311H301H372 **H412 | EUH059 | *STOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0,2 % ≤ C < 1 % |
| 602-009-00-0 | chloroethane | 200-830-5 | 75-00-3 | Flam. Gas 1Press. GasCarc. 2Aquatic Chronic 3 | H220H351H412 | GHS02GHS04GHS08Dgr | H220H351H412 | U |
| 602-010-00-6 | 1,2-dibromoethane | 203-444-5 | 106-93-4 | Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H350H331H311H301H319H335H315H411 | GHS06GHS08GHS09Dgr | H350H331H311H301H319H335H315H411 | * |
| 602-011-00-1 | 1,1-dichloroethane | 200-863-5 | 75-34-3 | Flam. Liq. 2Acute Tox. 4 *Eye Irrit. 2STOT SE 3Aquatic Chronic 3 | H225H302H319H335H412 | GHS02GHS07Dgr | H225H302H319H335H412 | * |
| 602-012-00-7 | 1,2-dichloroethane;ethylene dichloride | 203-458-1 | 107-06-2 | Flam. Liq. 2Carc. 1BAcute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H225H350H302H319H335H315 | GHS02GHS08GHS07Dgr | H225H350H302H319H335H315 |
| 602-013-00-2 | 1,1,1-trichloroethane;methyl chloroform | 200-756-3 | 71-55-6 | Acute Tox. 4 *Ozone | H332EUH059 | GHS07Wng | H332 | EUH059 | F |
| 602-014-00-8 | 1,1,2-trichloroethane | 201-166-9 | 79-00-5 | Carc. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H351H332H312H302 | GHS08GHS07Wng | H351H332H312H302 | EUH066 | * |
| 602-015-00-3 | 1,1,2,2-tetrachloroethane | 201-197-8 | 79-34-5 | Acute Tox. 2 *Acute Tox. 1Aquatic Chronic 2 | H330H310H411 | GHS06GHS09Dgr | H330H310H411 |
| 602-016-00-9 | 1,1,2,2-tetrabromoethane | 201-191-5 | 79-27-6 | Acute Tox. 2 *Eye Irrit. 2Aquatic Chronic 3 | H330H319H412 | GHS06Dgr | H330H319H412 |
| 602-017-00-4 | pentachloroethane | 200-925-1 | 76-01-7 | Carc. 2STOT RE 1Aquatic Chronic 2 | H351H372 **H411 | GHS08GHS09Dgr | H351H372 **H411 | STOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0,2 % ≤ C < 1 % |
| 602-018-00-X | 1-chloropropane; [1]2-chloropropane [2] | 208-749-7 [1]200-858-8 [2] | 540-54-5 [1]75-29-6 [2] | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H225H332H312H302 | GHS02GHS07Dgr | H225H332H312H302 | C |
| 602-019-00-5 | 1-bromopropane;n-propyl bromide | 203-445-0 | 106-94-5 | Flam. Liq. 2Repr. 1BSTOT RE 2 *Eye Irrit. 2STOT SE 3Skin Irrit. 2STOT SE 3 | H225H360FDH373 **H319H335H315H336 | GHS02GHS08GHS07Dgr | H225H360FDH373 **H319H335H315H336 |
| 602-020-00-0 | 1,2-dichloropropane;propylene dichloride | 201-152-2 | 78-87-5 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 * | H225H332H302 | GHS02GHS07Dgr | H225H332H302 |
| 602-021-00-6 | 1,2-dibromo-3-chloropropane | 202-479-3 | 96-12-8 | Carc. 1BMuta. 1BRepr. 1AAcute Tox. 3 *STOT RE 2 *Aquatic Chronic 3 | H350H340H360F ***H301H373 **H412 | GHS06GHS08Dgr | H350H340H360F ***H301H373 **H412 |
| 602-022-00-1 | 1-chloropentane; [1]2-chloropentane; [2]3-chloropentane [3] | 208-846-4 [1]210-885-7 [2]210-467-4 [3] | 543-59-9 [1]625-29-6 [2]616-20-6 [3] | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H225H332H312H302 | GHS02GHS07Dgr | H225H332H312H302 | C |
| 602-023-00-7 | vinyl chloride;chloroethylene | 200-831-0 | 75-01-4 | Press. GasFlam. Gas 1Carc. 1A | H220H350 | GHS02GHS08Dgr | H220H350 | D U |
| 602-024-00-2 | bromoethylene | 209-800-6 | 593-60-2 | Press. GasFlam. Gas 1Carc. 1B | H220H350 | GHS02GHS08Dgr | H220H350 | U |
| 602-025-00-8 | 1,1-dichloroethylene;vinylidene chloride | 200-864-0 | 75-35-4 | Flam. Liq. 1Carc. 2Acute Tox. 4 * | H224H351H332 | GHS02GHS08GHS07Dgr | H224H351H332 | * | D |
| 602-026-00-3 | 1,2-dichloroethylene; [1]cis-dichloroethylene; [2]trans-dichloroethylene [3] | 208-750-2 [1]205-859-7 [2]205-860-2 [3] | 540-59-0 [1]156-59-2 [2]156-60-5 [3] | Flam. Liq. 2Acute Tox. 4 *Aquatic Chronic 3 | H225H332H412 | GHS02GHS07Dgr | H225H332H412 | * | C |
| 602-027-00-9 | trichloroethylene;trichloroethene | 201-167-4 | 79-01-6 | Carc. 1BMuta. 2Eye Irrit. 2Skin Irrit. 2STOT SE 3Aquatic Chronic 3 | H350H341H319H315H336H412 | GHS08GHS07Dgr | H350H341H319H315H336H412 |
| 602-028-00-4 | tetrachloroethylene | 204-825-9 | 127-18-4 | Carc. 2Aquatic Chronic 2 | H351H411 | GHS08GHS09Wng | H351H411 |
| 602-029-00-X | 3-chloropropene;allyl chloride | 203-457-6 | 107-05-1 | Flam. Liq. 2Carc. 2Muta. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H225H351H341H332H312H302H373 **H319H335H315H400 | GHS02GHS08GHS07GHS09Dgr | H225H351H341H332H312H302H373 **H319H335H315H400 | D |
| 602-030-00-5 | 1,3-dichloropropene; [1](Z)-1,3-dichloropropene [2] | 208-826-5 [1]233-195-8 [2] | 542-75-6 [1]10061-01-5 [2] | Flam. Liq. 3Acute Tox. 3 *Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H226H301H332H312H319H335H315H317H400H410 | GHS02GHS06GHS09Dgr | H226H301H332H312H319H335H315H317H410 | C D |
| 602-031-00-0 | 1,1-dichloropropene | 209-253-3 | 563-58-6 | Flam. Liq. 2Acute Tox. 3 *Aquatic Chronic 3 | H225H301H412 | GHS02GHS06Dgr | H225H301H412 |
| 602-032-00-6 | 3-chloro-2-methylpropene | 209-251-2 | 563-47-3 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H225H332H302H314H317H411 | GHS02GHS05GHS07GHS09Dgr | H225H332H302H314H317H411 |
| 602-033-00-1 | chlorobenzene | 203-628-5 | 108-90-7 | Flam. Liq. 3Acute Tox. 4 *Aquatic Chronic 2 | H226H332H411 | GHS02GHS07GHS09Wng | H226H332H411 | * |
| 602-034-00-7 | 1,2-dichlorobenzene;o-dichlorobenzene | 202-425-9 | 95-50-1 | Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H315H400H410 | GHS07GHS09Wng | H302H319H335H315H410 | * |
| 602-035-00-2 | 1,4-dichlorobenzene;p-dichlorobenzene | 203-400-5 | 106-46-7 | Carc. 2Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H319H400H410 | GHS08GHS09Wng | H351H319H410 |
| 602-036-00-8 | chloroprene (stabilised);2-chlorobuta-1,3-diene (stabilised) | 204-818-0 | 126-99-8 | Flam. Liq. 2Carc. 1BAcute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H225H350H332H302H373 **H319H335H315 | GHS02GHS08GHS07Dgr | H225H350H332H302H373 **H319H335H315 | D |
| 602-037-00-3 | α-chlorotoluene;benzyl chloride | 202-853-6 | 100-44-7 | Carc. 1BAcute Tox. 3 *Acute Tox. 4 *STOT RE 2 *STOT SE 3Skin Irrit. 2Eye Dam. 1 | H350H331H302H373 **H335H315H318 | GHS06GHS08GHS05Dgr | H350H331H302H373 **H335H315H318 |
| 602-038-00-9 | α, α,α-trichlorotoluene;benzotrichloride | 202-634-5 | 98-07-7 | Carc. 1BAcute Tox. 3 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1 | H350H331H302H335H315H318 | GHS06GHS08GHS05Dgr | H350H331H302H335H315H318 |
| 602-039-00-4 | polychlorobiphenyls;PCB | 215-648-1 | 1336-36-3 | STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H373 **H400H410 | GHS08GHS09Wng | H373 **H410 | STOT RE 2; H373: C ≥ 0,005 % | C |
| 602-040-00-X | 2-chlorotoluene; [1]3-chlorotoluene; [2]4-chlorotoluene; [3]chlorotoluene [4] | 202-424-3 [1]203-580-5 [2]203-397-0 [3]246-698-2 [4] | 95-49-8 [1]108-41-8 [2]106-43-4 [3]25168-05-2 [4] | Acute Tox. 4 *Aquatic Chronic 2 | H332H411 | GHS07GHS09Wng | H332H411 | C |
| 602-041-00-5 | penthachloronaphthalene | 215-320-8 | 1321-64-8 | Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H312H302H319H315H400H410 | GHS07GHS09Wng | H312H302H319H315H410 | C |
| 602-042-00-0 | 1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex | — | — | Carc. 2Acute Tox. 3 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H301H312H400H410 | GHS06GHS08GHS09Dgr | H351H301H312H410 | A C |
| 602-043-00-6 | lindane (ISO);γ-HCH or γ-BHC;γ-1,2,3,4,5,6-hexachlorocyclohexane | 200-401-2 | 58-89-9 | Acute Tox. 3 *Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Lact.Aquatic Acute 1Aquatic Chronic 1 | H301H332H312H373 **H362H400H410 | GHS06GHS08GHS09Dgr | H301H332H312H373 **H362H410 | M=10 |
| 602-044-00-1 | camphechlor (ISO);toxaphene; | 232-283-3 | 8001-35-2 | Carc. 2Acute Tox. 3 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H301H312H335H315H400H410 | GHS06GHS08GHS09Dgr | H351H301H312H335H315H410 |
| 602-045-00-7 | DDT (ISO);clofenotane (INN);dicophane;1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane;dichlorodiphenyltrichloroethane | 200-024-3 | 50-29-3 | Carc. 2Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H351H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H351H301H372 **H410 |
| 602-046-00-2 | heptachlor (ISO);1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene | 200-962-3 | 76-44-8 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H311H301H373 **H400H410 | GHS06GHS08GHS09Dgr | H351H311H301H373 **H410 |
| 602-047-00-8 | chlordane (ISO);1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan | 200-349-0 | 57-74-9 | Carc. 2Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H312H302H400H410 | GHS08GHS07GHS09Wng | H351H312H302H410 |
| 602-048-00-3 | aldrin (ISO) | 206-215-8 | 309-00-2 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H351H311H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H351H311H301H372 **H410 |
| 602-049-00-9 | dieldrin (ISO) | 200-484-5 | 60-57-1 | Carc. 2Acute Tox. 1Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H351H310H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H351H310H301H372 **H410 |
| 602-050-00-4 | (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphfthalene;isodrin | 207-366-2 | 465-73-6 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 |
| 602-051-00-X | endrin (ISO);1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene | 200-775-7 | 72-20-8 | Acute Tox. 2 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H300H311H400H410 | GHS06GHS09Dgr | H300H311H410 |
| 602-052-00-5 | endosulfan (ISO);1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethyl sulphite | 204-079-4 | 115-29-7 | Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H311H301H319H400H410 | GHS06GHS09Dgr | H311H301H319H410 |
| 602-053-00-0 | isobenzan (ISO);1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran | 206-045-4 | 297-78-9 | Acute Tox. 1Acute Tox. 2 *Aquatic Acute 1 | H310H300H400 | GHS06GHS09Dgr | H310H300H400 |
| 602-054-00-6 | 3-iodpropene;allyl iodide | 209-130-4 | 556-56-9 | Flam. Liq. 2Skin Corr. 1B | H226H314 | GHS02GHS05Dgr | H226H314 |
| 602-055-00-1 | bromoethane;ethyl bromide | 200-825-8 | 74-96-4 | Flam. Liq. 2Carc. 2Acute Tox. 4 *Acute Tox. 4 * | H225H351H332H302 | GHS02GHS08GHS07Dgr | H225H351H332H302 |
| 602-056-00-7 | α, α,α-trifluorotoluene;benzotrifluoride | 202-635-0 | 98-08-8 | Flam. Liq. 2Aquatic Chronic 2 | H225H411 | GHS02GHS09Dgr | H225H411 |
| 602-057-00-2 | α-bromotoluene;benzyl bromide | 202-847-3 | 100-39-0 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 |
| 602-058-00-8 | α, α-dichlorotoluene;benzylidene chloride;benzal chloride | 202-709-2 | 98-87-3 | Carc. 2Acute Tox. 3 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1 | H351H331H302H335H315H318 | GHS06GHS08GHS05Dgr | H351H331H302H335H315H318 |
| 602-059-00-3 | 1-chlorobutane;butyl chloride | 203-696-6 | 109-69-3 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 602-060-00-9 | bromobenzene | 203-623-8 | 108-86-1 | Flam. Liq. 3Skin Irrit. 2Aquatic Chronic 2 | H226H315H411 | GHS02GHS07GHS09Wng | H226H315H411 |
| 602-061-00-4 | hexafluoropropene;hexafluoropropylene | 204-127-4 | 116-15-4 | Press. GasAcute Tox. 4 *STOT SE 3 | H332H335 | GHS07Wng | H332H335 | U |
| 602-062-00-X | 1,2,3-trichloropropane | 202-486-1 | 96-18-4 | Carc. 1BRepr. 1BAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H350H360F ***H332H312H302 | GHS08GHS07Dgr | H350H360F ***H332H312H302 | D |
| 602-063-00-5 | heptachlor epoxide;2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane | 213-831-0 | 1024-57-3 | Carc. 2Acute Tox. 3 *STOT RE 2 *Aquatic Acute 1Aquatic Chronic 1 | H351H301H373 **H400H410 | GHS06GHS08GHS09Dgr | H351H301H373 **H410 |
| 602-064-00-0 | 1,3-dichloro-2-propanol | 202-491-9 | 96-23-1 | Carc. 1BAcute Tox. 3 *Acute Tox. 4 * | H350H301H312 | GHS06GHS08Dgr | H350H301H312 |
| 602-065-00-6 | hexachlorobenzene | 204-273-9 | 118-74-1 | Carc. 1BSTOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H350H372 **H400H410 | GHS08GHS09Dgr | H350H372 **H410 |
| 602-066-00-1 | tetrachloro-p-benzoquinone | 204-274-4 | 118-75-2 | Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H315H400H410 | GHS07GHS09Wng | H319H315H410 |
| 602-067-00-7 | 1,3-dichlorbenzene | 208-792-1 | 541-73-1 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 602-068-00-2 | ethylene bis(trichloroacetate) | 219-732-9 | 2514-53-6 | Skin Irrit. 2 | H315 | GHS07Wng | H315 |
| 602-069-00-8 | dichloroacetylene | — | 7572-29-4 | Unst. Expl.Carc. 2STOT RE 2 * | H200H351H373 ** | GHS01GHS08Wng | H200H351H373 ** |
| 602-070-00-3 | 3-chloro-4,5,α, α,α-pentafluorotoluene | 401-930-3 | 77227-99-7 | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1 | H226H332H302H400 | GHS02GHS07GHS09Wng | H226H332H302H400 |
| 602-071-00-9 | bromobenzylbromotoluene, reaction mass of isomers | 402-210-1 | 99688-47-8 | STOT RE 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 **H317H400H410 | GHS08GHS07GHS09Wng | H373 **H317H410 |
| 602-072-00-4 | dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers;(dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) | 278-404-3 | 76253-60-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 602-073-00-X | 1,4-dichlorobut-2-ene | 212-121-8 | 764-41-0 | Carc. 1BAcute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H350H330H311H301H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H350H330H311H301H314H410 | Carc. 1B; H350: C ≥ 0,01 %STOT SE 3; H335: C ≥ 5 % |
| 602-074-00-5 | pentachlorobenzene | 210-172-0 | 608-93-5 | Flam. Sol. 1Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H228H302H400H410 | GHS02GHS07GHS09Dgr | H228H302H410 | T |
| 602-075-00-0 | 4,4,5,5-tetrachloro-1,3-dioxolan-2-one | 404-060-2 | 22432-68-4 | Acute Tox. 2 *Acute Tox. 4 *Skin Corr. 1B | H330H302H314 | GHS06GHS05Dgr | H330H302H314 |
| 602-076-00-6 | 2,3,4-trichlorobut-1-ene | 219-397-9 | 2431-50-7 | Carc. 2Acute Tox. 3 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H331H302H319H335H315H400H410 | GHS06GHS08GHS09Dgr | H351H331H302H319H335H315H410 | Carc. 2; H351: C ≥ 0,1 % |
| 602-077-00-1 | dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane;mirex | 219-196-6 | 2385-85-5 | Carc. 2Repr. 2Lact.Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H361fdH362H312H302H400H410 | GHS08GHS07GHS09Wng | H351H361fdH362H312H302H410 |
| 602-078-00-7 | hexachlorocyclopentadiene | 201-029-3 | 77-47-4 | Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 4 *Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H330H311H302H314H400H410 | GHS06GHS05GHS09Dgr | H330H311H302H314H410 |
| 602-079-00-2 | 2,3-dichloropropene;2,3-dichloropropylene | 201-153-8 | 78-88-6 | Flam. Liq. 2Muta. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H225H341H332H312H302H335H315H318H412 | GHS02GHS08GHS05GHS07Dgr | H225H341H332H312H302H335H315H318H412 |
| 602-080-00-8 | alkanes, C10-13, chloro | 287-476-5 | 85535-84-8 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 602-081-00-3 | 2-chloro-4,5-difluorobenzoic acid | 405-380-5 | — | Acute Tox. 4 *Acute Tox. 4 *Eye Dam. 1Skin Sens. 1 | H312H302H318H317 | GHS05GHS07Dgr | H312H302H318H317 |
| 602-082-00-9 | 2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol | 408-020-5 | 109678-33-3 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 602-083-00-4 | diphenyl ether, pentabromo derivative pentabromodiphenyl ether | 251-084-2 | 32534-81-9 | STOT RE 2 *Lact.Aquatic Acute 1Aquatic Chronic 1 | H373 **H362H400H410 | GHS08GHS09Wng | H373 **H362H410 |
| 602-084-00-X | 1,1-dichloro-1-fluoroethane | 404-080-1 | 1717-00-6 | Aquatic Chronic 3Ozone | H412EUH059 | — | H412 | EUH059 |
| 602-085-00-5 | 2-bromopropane | 200-855-1 | 75-26-3 | Flam. Liq. 2Repr. 1ASTOT RE 2 * | H225H360F ***H373 ** | GHS02GHS08Dgr | H225H360F ***H373 ** | EUH066 |
| 602-086-00-0 | trifluoroiodomethane;trifluoromethyl iodide | 219-014-5 | 2314-97-8 | Muta. 2 | H341 | GHS08Wng | H341 |
| 602-087-00-6 | 1,2,4-trichlorobenzene | 204-428-0 | 120-82-1 | Acute Tox. 4 *Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H315H400H410 | GHS07GHS09Wng | H302H315H410 |
| 602-088-00-1 | 2,3-dibromopropan-1-ol;2,3-dibromo-1-propanol | 202-480-9 | 96-13-9 | Carc. 1BRepr. 2Acute Tox. 3 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 3 | H350H361f ***H311H332H302H412 | GHS08GHS07Dgr | H350H361f ***H311H332H302H412 |
| 602-089-00-7 | 4-bromo-2-chlorofluorobenzene | 405-580-2 | 60811-21-4 | Acute Tox. 4 *Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H315H400H410 | GHS07GHS09Wng | H302H315H410 |
| 602-090-00-2 | 1-allyl-3-chloro-4-fluorobenzene | 406-630-6 | 121626-73-1 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 602-091-00-8 | 1,3-dichloro-4-fluorobenzene | 406-160-1 | 1435-48-9 | Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2 | H302H373 **H315H411 | GHS08GHS07Wng | H302H373 **H315H411 |
| 602-092-00-3 | 1-bromo-3,4,5-trifluorobenzene | 418-480-9 | 138526-69-9 | Flam. Liq. 3Carc. 2Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H226H351H315H318H411 | GHS02GHS08GHS05GHS09Dgr | H226H351H315H318H411 |
| 602-093-00-9 | α, α,α,4-tetrachlorotoluene;p-chlorobenzotrichloride | 226-009-1 | 5216-25-1 | Carc. 1BRepr. 2STOT RE 1Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2 | H350H361f ***H372 **H312H302H335H315 | GHS08GHS07Dgr | H350H361f ***H372 **H312H302H335H315 |
| 602-094-00-4 | diphenylether; octabromo derivate | 251-087-9 | 32536-52-0 | Repr. 1B | H360Df | GHS08Dgr | H360Df |
| 602-096-00-5 | malachite green hydrochloride; [1]malachite green oxalate [2] | 209-322-8 [1]219-441-7 [2] | 569-64-2 [1]2437-29-8 [2] | Repr. 2Acute Tox. 4 *Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H361d ***H302H318H400H410 | GHS08GHS05GHS07GHS09Dgr | H361d ***H302H318H410 |
| 602-097-00-0 | 1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane | 422-850-5 | 148757-89-5 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 603-001-00-X | methanol | 200-659-6 | 67-56-1 | Flam. Liq. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT SE 1 | H225H331H311H301H370 ** | GHS02GHS06GHS08Dgr | H225H331H311H301H370 ** | *STOT SE 1; H370: C ≥ 10 %STOT SE 2; H371: 3 % ≤ C < 10 % |
| 603-002-00-5 | ethanol;ethyl alcohol | 200-578-6 | 64-17-5 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 603-003-00-0 | propan-1-ol;n-propanol | 200-746-9 | 71-23-8 | Flam. Liq. 2Eye Dam. 1STOT SE 3 | H225H318H336 | GHS02GHS05GHS07Dgr | H225H318H336 |
| 603-004-00-6 | butan-1-ol;n-butanol | 200-751-6 | 71-36-3 | Flam. Liq. 3Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1STOT SE 3 | H226H302H335H315H318H336 | GHS02GHS05GHS07Dgr | H226H302H335H315H318H336 |
| 603-005-00-1 | 2-methylpropan-2-ol;tert-butyl alcohol | 200-889-7 | 75-65-0 | Flam. Liq. 2Acute Tox. 4 * | H225H332 | GHS02GHS07Dgr | H225H332 |
| 603-006-00-7 | pentanol isomers, with the exception fo those specified elsewhere in this Annex | 250-378-8 | Flam. Liq. 3Acute Tox. 4 *STOT SE 3 | H226H332H335 | GHS02GHS07Wng | H226H332H335 | EUH066 | C |
| 603-007-00-2 | 2-methylbutan-2-ol;tert-pentanol | 200-908-9 | 75-85-4 | Flam. Liq. 2Acute Tox. 4 *STOT SE 3Skin Irrit. 2 | H225H332H335H315 | GHS02GHS07Dgr | H225H332H335H315 |
| 603-008-00-8 | 4-methylpentan-2-ol;methyl isobutyl carbinol | 203-551-7 | 108-11-2 | Flam. Liq. 3STOT SE 3 | H226H335 | GHS02GHS07Wng | H226H335 | STOT SE 3; H335: C ≥ 25 % |
| 603-009-00-3 | cyclohexanol | 203-630-6 | 108-93-0 | Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2 | H332H302H335H315 | GHS07Wng | H332H302H335H315 |
| 603-010-00-9 | 2-methylcyclohexanol, mixed isomers; [1]cis-2-methylcyclohexanol; [2]trans-2-methylcyclohexanol [3] | 209-512-0 [1]231-187-9 [2]231-186-3 [3] | 583-59-5 [1]7443-70-1 [2]7443-52-9 [3] | Acute Tox. 4 * | H332 | GHS07Wng | H332 | C |
| 603-011-00-4 | 2-methoxyethanol;ethylene glycol monomethyl ether | 203-713-7 | 109-86-4 | Flam. Liq. 3Repr. 1BAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H226H360FDH332H312H302 | GHS02GHS08GHS07Dgr | H226H360FDH332H312H302 |
| 603-012-00-X | 2-ethoxyethanol;ethylene glycol monoethyl ether | 203-804-1 | 110-80-5 | Flam. Liq. 3Repr. 1BAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H226H360FDH332H312H302 | GHS02GHS08GHS07Dgr | H226H360FDH332H312H302 |
| 603-013-00-5 | 2-isopropoxyethanol;ethylene glycol monoisopropyl ether | 203-685-6 | 109-59-1 | Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2 | H332H312H319 | GHS07Wng | H332H312H319 |
| 603-014-00-0 | 2-butoxyethanol;ethylene glycol monobutyl ether;butyl cellosolve | 203-905-0 | 111-76-2 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H332H312H302H319H315 | GHS07Wng | H332H312H302H319H315 |
| 603-015-00-6 | allyl alcohol | 203-470-7 | 107-18-6 | Flam. Liq. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H225H331H311H301H319H335H315H400 | GHS02GHS06GHS09Dgr | H225H331H311H301H319H335H315H400 |
| 603-016-00-1 | 4-hydroxy-4-methylpentan-2-one;diacetone alcohol | 204-626-7 | 123-42-2 | Eye Irrit. 2 | H319 | GHS07Wng | H319 | Eye Irrit. 2; H319: C ≥ 10 % |
| 603-018-00-2 | furfuryl alcohol | 202-626-1 | 98-00-0 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H332H312H302 | GHS07Wng | H332H312H302 | * |
| 603-019-00-8 | dimethyl ether | 204-065-8 | 115-10-6 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 603-020-00-3 | ethyl methyl ether | — | 540-67-0 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | U |
| 603-021-00-9 | methyl vinyl ether | 203-475-4 | 107-25-5 | Flam. Gas 1Press. Gas | H220 | GHS02GHS04Dgr | H220 | D U |
| 603-022-00-4 | diethyl ether;ether | 200-467-2 | 60-29-7 | Flam. Liq. 1Acute Tox. 4 *STOT SE 3 | H224H302H336 | GHS02GHS07Dgr | H224H302H336 | EUH019EUH066 |
| 603-023-00-X | ethylene oxide;oxirane | 200-849-9 | 75-21-8 | Flam. Gas 1Press. GasCarc. 1BMuta. 1BAcute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H220H350H340H331H319H335H315 | GHS02GHS04GHS06GHS08Dgr | H220H350H340H331H319H335H315 | U |
| 603-024-00-5 | 1,4-dioxane | 204-661-8 | 123-91-1 | Flam. Liq. 2Carc. 2Eye Irrit. 2STOT SE 3 | H225H351H319H335 | GHS02GHS08GHS07Dgr | H225H351H319H335 | EUH019EUH066 | D |
| 603-025-00-0 | tetrahydrofuran | 203-726-8 | 109-99-9 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H335 | GHS02GHS07Dgr | H225H319H335 | EUH019 | Eye Irrit. 2; H319: C ≥ 25 %STOT SE 3; H335: C ≥ 25 % |
| 603-026-00-6 | 1-chloro-2,3-epoxypropane;epichlorhydrin | 203-439-8 | 106-89-8 | Flam. Liq. 3Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BSkin Sens. 1 | H226H350H331H311H301H314H317 | GHS02GHS06GHS08GHS05Dgr | H226H350H331H311H301H314H317 | * |
| 603-027-00-1 | ethanediol;ethylene glycol | 203-473-3 | 107-21-1 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 603-028-00-7 | 2-chloroethanol;ethylene chlorohydrin | 203-459-7 | 107-07-3 | Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 * | H330H310H300 | GHS06Dgr | H330H310H300 |
| 603-029-00-2 | bis(2-chloroethyl) ether | 203-870-1 | 111-44-4 | Carc. 2Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 * | H351H330H310H300 | GHS06GHS08Dgr | H351H330H310H300 |
| 603-030-00-8 | 2-aminoethanol;ethanolamine | 205-483-3 | 141-43-5 | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H332H312H302H314 | GHS05GHS07Dgr | H332H312H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 603-031-00-3 | 1,2-dimethoxyethane;ethylene glycol dimethyl ether;EGDME | 203-794-9 | 110-71-4 | Flam. Liq. 2Repr. 1BAcute Tox. 4 * | H225H360FDH332 | GHS02GHS08GHS07Dgr | H225H360FDH332 | EUH019 |
| 603-032-00-9 | ethylene dinitrate;ethylene glycol dinitrate | 211-063-0 | 628-96-6 | Unst. Expl.Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 * | H200H330H310H300H373 ** | GHS01GHS06GHS08Dgr | H200H330H310H300H373 ** |
| 603-033-00-4 | oxydiethylene dinitrate;diethylene glycol dinitrate;digol dinitrate | 211-745-8 | 693-21-0 | Unst. ExplAcute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 3 | H200H330H310H300H373 **H412 | GHS01GHS06GHS08Dgr | H200H330H310H300H373 **H412 |
| 603-033-01-1 | oxydiethylene dinitrate;diethylene glycol dinitrate;digol dinitrate;[>25 % phlegmatiser] | 211-745-8 | 693-21-0 | Expl. 1.1Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 3 | H201H330H310H300H373 **H412 | GHS01GHS06GHS08Dgr | H201H330H310H300H373 **H412 |
| 603-034-00-X | glycerol trinitrate;nitroglycerine | 200-240-8 | 55-63-0 | Unst. Expl.Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 2 | H200H330H310H300H373 **H411 | GHS01GHS06GHS08GHS09Dgr | H200H330H310H300H373 **H411 |
| 603-034-01-7 | glycerol trinitrate;nitroglycerine;[>40 % phlegmatiser] | 200-240-8 | 55-63-0 | Expl. 1.1Acute Tox. 2 *Acute Tox. 1Acute Tox. 2 *STOT RE 2 *Aquatic Chronic 2 | H201H330H310H300H373 **H411 | GHS01GHS06GHS08GHS09Dgr | H201H330H310H300H373 **H411 |
| 603-035-00-5 | pentaerythritol tetranitrate; pentaerythrite tetranitrate;P.E.T.N. | 201-084-3 | 78-11-5 | Unst. Expl. | H200 | GHS01Dgr | H200 |
| 603-035-01-2 | pentaerythritol tetranitrate; pentaerythrite tetranitrate;P.E.T.N.;[>20 % phlegmatiser] | 201-084-3 | 78-11-5 | Expl. 1.1 | H201 | GHS01Dgr | H201 | T |
| 603-036-00-0 | mannitol hexanitrate;nitromannite | 239-924-6 | 15825-70-4 | Unst. Expl. | H200 | GHS01Dgr | H200 |
| 603-036-01-8 | mannitol hexanitrate;nitromannite;[>40 % phlegmatiser] | 239-924-6 | 15825-70-4 | Expl. 1.1 | H201 | GHS01Dgr | H201 |
| 603-037-00-6 | cellulose nitrate; | — | — | Expl. 1.1 | H201 | GHS01Dgr | H201 | EUH001 | T |
| 603-038-00-1 | allyl glycidyl ether;allyl 2,3-epoxypropyl ether;prop-2-en-1-yl 2,3-epoxypropyl ether | 203-442-4 | 106-92-3 | Flam. Liq. 3Carc. 2Muta. 2Repr. 2Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H226H351H341H361f ***H332H302H335H315H318H317H412 | GHS02GHS08GHS05GHS07Dgr | H226H351H341H361f ***H332H302H335H315H318H317H412 |
| 603-039-00-7 | butyl glycidyl ether;butyl 2,3-epoxypropyl ether | 219-376-4 | 2426-08-6 | Flam. Liq. 3Carc. 2Muta. 2Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Sens. 1Aquatic Chronic 3 | H226H351H341H332H302H335H317H412 | GHS02GHS08GHS07Wng | H226H351H341H332H302H335H317H412 |
| 603-040-00-2 | sodium methanolate;sodium methoxide; [1]potassium methanolate;potassium methoxide; [2]lithium methanolate;lithium methoxide [3] | 204-699-5 [1]212-736-1 [2]212-737-7 [3] | 124-41-4 [1]865-33-8 [2]865-34-9 [3] | Self-heat 1Skin Corr. 1B | H251H314 | GHS02GHS05Dgr | H251H314 | EUH014 | T |
| 603-041-00-8 | potassium ethanolate;potassium ethoxide; [1]sodium ethanolate;sodium ethoxide [2] | 213-029-0 [1]205-487-5 [2] | 917-58-8 [1]141-52-6 [2] | Self-heat 1Skin Corr. 1B | H251H314 | GHS02GHS05Dgr | H251H314 | EUH014 | T |
| 603-042-00-3 | aluminium-tri-isopropoxide | 209-090-8 | 555-31-7 | Flam. Sol. 1 | H228 | GHS02Dgr | H228 | T |
| 603-043-00-9 | triarimol (ISO);2,4-dichloro-α-(pyrimidin-5-yl) benzhydryl alcohol | — | 26766-27-8 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 603-044-00-4 | dicofol (ISO);2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol | 204-082-0 | 115-32-2 | Acute Tox. 4 *Acute Tox. 4 *Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H315H317H400H410 | GHS07GHS09Wng | H312H302H315H317H410 |
| 603-045-00-X | diisopropyl ether; [1]dipropyl ether [2] | 203-560-6 [1]203-869-6 [2] | 108-20-3 [1]111-43-3 [2] | Flam. Liq. 2STOT SE 3 | H225H336 | GHS02GHS07Dgr | H225H336 | EUH019EUH066 | C |
| 603-046-00-5 | bis (chloromethyl) ether;oxybis(chloromethane) | 208-832-8 | 542-88-1 | Flam. Liq. 2Carc. 1AAcute Tox. 2 *Acute Tox. 3 *Acute Tox. 4 * | H225H350H330H311H302 | GHS02GHS06GHS08Dgr | H225H350H330H311H302 | Carc. 1A; H350: C ≥ 0,001 % |
| 603-047-00-0 | 2-dimethylaminoethanol;N,N-dimethylethanolamine | 203-542-8 | 108-01-0 | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H226H332H312H302H314 | GHS02GHS05GHS07Dgr | H226H332H312H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 603-048-00-6 | 2-diethylaminoethanol;N,N-diethylethanolamine | 202-845-2 | 100-37-8 | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H226H332H312H302H314 | GHS02GHS05GHS07 GHS09Dgr | H226H332H312H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 603-049-00-1 | chlorfenethol (ISO);1,1-bis (4-chlorophenyl) ethanol | 201-246-3 | 80-06-8 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 603-050-00-7 | 1-(2-butoxypropoxy)propan-2-ol | 246-011-6 | 24083-03-2 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 603-051-00-2 | 2-ethylbutan-1-ol | 202-621-4 | 97-95-0 | Acute Tox. 4 *Acute Tox. 4 * | H312H302 | GHS07Wng | H312H302 |
| 603-052-00-8 | 3-butoxypropan-2-ol;propylene glycol monobutyl ether | 225-878-4 | 5131-66-8 | Eye Irrit. 2Skin Irrit. 2 | H319H315 | GHS07Wng | H319H315 |
| 603-053-00-3 | 2-methylpentane-2,4-diol | 203-489-0 | 107-41-5 | Eye Irrit. 2Skin Irrit. 2 | H319H315 | GHS07Wng | H319H315 |
| 603-054-00-9 | di-n-butyl ether;dibutyl ether | 205-575-3 | 142-96-1 | Flam. Liq. 3Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 3 | H226H319H335H315H412 | GHS02GHS07Wng | H226H319H335H315H412 | STOT SE 3; H335: C ≥ 10 % |
| 603-055-00-4 | propylene oxide;1,2-epoxypropane;methyloxirane | 200-879-2 | 75-56-9 | Flam. Liq. 1Carc. 1BMuta. 1BAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H224H350H340H332H312H302H319H335H315 | GHS02GHS08GHS07Dgr | H224H350H340H332H312H302H319H335H315 |
| 603-056-00-X | [(p-tolyloxy)methyl]oxirane; [1][(m-tolyloxy)methyl]oxirane; [2]2,3-epoxypropyl o-tolyl ether; [3][(tolyloxy)methyl]oxirane;cresyl glycidyl ether [4] | 218-574-8 [1]218-575-3 [2]218-645-3 [3]247-711-4 [4] | 2186-24-5 [1]2186-25-6 [2]2210-79-9 [3]26447-14-3 [4] | Muta. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H341H315H317H411 | GHS08GHS07GHS09Wng | H341H315H317H411 | C |
| 603-057-00-5 | benzyl alcohol | 202-859-9 | 100-51-6 | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 |
| 603-058-00-0 | 1,3-propylene oxide | 207-964-3 | 503-30-0 | Flam. Liq. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H225H332H312H302 | GHS02GHS07Dgr | H225H332H312H302 |
| 603-059-00-6 | hexan-1-ol | 203-852-3 | 111-27-3 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 603-060-00-1 | 2,2'-bioxirane;1,2:3,4-diepoxybutane | 215-979-1 | 1464-53-5 | Carc. 1BMuta. 1BAcute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1B | H350H340H330H311H301H314 | GHS06GHS08GHS05Dgr | H350H340H330H311H301H314 |
| 603-061-00-7 | tetrahydro-2-furylmethanol;tetrahydrofurfuryl alcohol | 202-625-6 | 97-99-4 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-062-00-2 | tetrahydrofuran-2,5-diyldimethanol | 203-239-0 | 104-80-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | STOT SE 3; H335: C ≥ 10 % |
| 603-063-00-8 | 2,3-epoxypropan-1-ol;glycidol;oxiranemethanol | 209-128-3 | 556-52-5 | Carc. 1BMuta. 2Repr. 1BAcute Tox. 3 *Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H350H341H360F ***H331H312H302H319H335H315 | GHS06GHS08Dgr | H350H341H360F ***H331H312H302H319H335H315 |
| 603-064-00-3 | 1-methoxy-2-propanol;monopropylene glycol methyl ether | 203-539-1 | 107-98-2 | Flam. Liq. 3 | H226 | GHS02Wng | H226 |
| 603-065-00-9 | resorcinol diglycidyl ether;1,3-bis(2,3-epoxypropoxy)benzene | 202-987-5 | 101-90-6 | Carc. 2Muta. 2Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H351H341H312H302H319H315H317H412 | GHS08GHS07Wng | H351H341H312H302H319H315H317H412 |
| 603-066-00-4 | 1,2-epoxy-4-epoxyethylcyclohexane;vinylcyclohexane diepoxide | 203-437-7 | 106-87-6 | Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Carc. 2 | H331H311H301H351 | GHS06GHS08Dgr | H331H311H301H351 | * |
| 603-067-00-X | phenyl glycidyl ether;2,3-epoxypropyl phenyl ether;1,2-epoxy-3-phenoxypropane | 204-557-2 | 122-60-1 | Carc. 1BMuta. 2Acute Tox. 4 *STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H350H341H332H335H315H317H412 | GHS08GHS07Dgr | H350H341H332H335H315H317H412 |
| 603-068-00-5 | 2,3-epoxypropyl-2-ethylcyclohexyl ether;ethylcyclohexylglycidyl ether | — | 130014-35-6 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 |
| 603-069-00-0 | 2,4,6-tris(dimethylaminomethyl)phenol | 202-013-9 | 90-72-2 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H302H319H315 | GHS07Wng | H302H319H315 |
| 603-070-00-6 | 2-amino-2-methylpropanol | 204-709-8 | 124-68-5 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H319H315H412 | GHS07Wng | H319H315H412 |
| 603-071-00-1 | 2,2'-iminodiethanol;diethanolamine | 203-868-0 | 111-42-2 | Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Eye Dam. 1 | H302H373 **H315H318 | GHS08GHS05GHS07Dgr | H302H373 **H315H318 |
| 603-072-00-7 | 1,4-bis(2,3 epoxypropoxy)butane;butanedioldiglycidyl ether | 219-371-7 | 2425-79-8 | Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H332H312H319H315H317 | GHS07Wng | H332H312H319H315H317 |
| 603-073-00-2 | bis-[4-(2,3-epoxipropoxi)phenyl]propane | 216-823-5 | 1675-54-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | Eye Irrit. 2; H319: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 % |
| 603-074-00-8 | reaction product: bisphenol-A-(epichlorhydrin);epoxy resin (number average molecular weight ≤ 700) | 500-033-5 | 25068-38-6 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H315H317H411 | GHS07GHS09Wng | H319H315H317H411 | Eye Irrit. 2; H319: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 % |
| 603-075-00-3 | chlormethyl methyl ether;chlorodimethyl ether | 203-480-1 | 107-30-2 | Flam. Liq. 2Carc. 1AAcute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H225H350H332H312H302 | GHS02GHS08GHS07Dgr | H225H350H332H312H302 |
| 603-076-00-9 | but-2-yne-1,4-diol;2-butyne-1,4-diol | 203-788-6 | 110-65-6 | Skin Corr. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *STOT RE 2 *Skin Sens. 1 | H314H331H301H312H373 **H317 | GHS06GHS05GHS08Dgr | H314H331H301H312H373 **H317 | Skin Corr. 1B; H314: C ≥ 50 %Skin Irrit. 2; H315: 25 % ≤ C < 50 %Eye Irrit. 2; H319: 25 % ≤ C < 50 % | D |
| 603-077-00-4 | 1-dimethylaminopropan-2-ol;dimepranol (INN) | 203-556-4 | 108-16-7 | Flam. Liq. 3Acute Tox. 4 *Skin Corr. 1B | H226H302H314 | GHS02GHS05GHS07Dgr | H226H302H314 |
| 603-078-00-X | prop-2-yn-1-ol;propargyl alcohol | 203-471-2 | 107-19-7 | Flam. Liq. 3Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Chronic 2 | H226H331H311H301H314H411 | GHS02GHS06GHS05GHS09Dgr | H226H331H311H301H314H411 |
| 603-079-00-5 | 2,2'-(methylimino)diethanol;N-methyldiethanolamine | 203-312-7 | 105-59-9 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-080-00-0 | 2-methylaminoethanol;N-methylethanolamine;N-methyl-2-ethanolamine;N-methyl-2-amino ethanol;2-(methylamino)ethanol | 203-710-0 | 109-83-1 | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H312H302H314 | GHS05 GHS07Dgr | H312H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 603-081-00-6 | 2,2'-thiodiethanol;thiodiglycol | 203-874-3 | 111-48-8 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-082-00-1 | 1-aminopropan-2-ol;isopropanolamine | 201-162-7 | 78-96-6 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 603-083-00-7 | 1,1'-iminodipropan-2-ol;di-isopropanolamine | 203-820-9 | 110-97-4 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-084-00-2 | styrene oxide;(epoxyethyl)benzene;phenyloxirane | 202-476-7 | 96-09-3 | Carc. 1BAcute Tox. 4 *Eye Irrit. 2 | H350H312H319 | GHS08GHS07Dgr | H350H312H319 |
| 603-085-00-8 | bronopol (INN);2-bromo-2-nitropropane-1,3-diol | 200-143-0 | 52-51-7 | Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1 | H312H302H335H315H318H400 | GHS05GHS07GHS09Dgr | H312H302H335H315H318H400 |
| 603-086-00-3 | ethirimol (ISO);5-butyl-2-ethylamino-6-methylpyrimidin-4-ol | 245-949-3 | 23947-60-6 | Acute Tox. 4 * | H312 | GHS07Wng | H312 |
| 603-087-00-9 | 2-ethylhexane-1,3-diol;octylene glycol;ethoexadiol | 202-377-9 | 94-96-2 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 603-088-00-4 | 2-(octylthio)ethanol;2-hydroxyethyl octyl sulphide | 222-598-4 | 3547-33-9 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 603-089-00-X | 7,7-dimethyl-3-oxa-6-azaoctan-1-ol | 400-390-6 | — | Skin Corr. 1AAcute Tox. 4 * | H314H302 | GHS05GHS07Dgr | H314H302 |
| 603-090-00-5 | 2-(2-bromoethoxy)anisole | 402-010-4 | 4463-59-6 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 603-091-00-0 | exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol | 402-470-6 | 87172-89-2 | Acute Tox. 4 *Eye Dam. 1 | H302H318 | GHS05GHS07Dgr | H302H318 |
| 603-092-00-6 | 2-methyl-4-phenylpentanol | 402-770-7 | 92585-24-5 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 603-093-00-1 | cinmethylin (ISO);exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane | 402-410-9 | 87818-31-3 | Acute Tox. 4 *Aquatic Chronic 2 | H332H411 | GHS07GHS09Dgr | H332H411 |
| 603-094-00-7 | 1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane | 241-536-7 | 17557-23-2 | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 603-095-00-2 | 2-(propyloxy)ethanol;EGPE | 220-548-6 | 2807-30-9 | Acute Tox. 4 *Eye Irrit. 2 | H312H319 | GHS07Wng | H312H319 |
| 603-096-00-8 | 2-(2-butoxyethoxy)ethanol;diethylene glycol monobutyl ether | 203-961-6 | 112-34-5 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-097-00-3 | 1,1',1''-nitrilotripropan-2-ol;triisopropanolamine | 204-528-4 | 122-20-3 | Eye Irrit. 2Aquatic Chronic 3 | H319H412 | GHS07Wng | H319H412 |
| 603-098-00-9 | 2-phenoxyethanol | 204-589-7 | 122-99-6 | Acute Tox. 4 *Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 603-099-00-4 | 3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride | 403-440-5 | 93633-79-5 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 603-100-00-8 | 1,2-dimethoxypropane | 404-630-0 | 7778-85-0 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 | EUH019 |
| 603-101-00-3 | tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) | 405-040-6 | — | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 603-102-00-9 | 1,2-epoxybutane | 203-438-2 | 106-88-7 | Flam. Liq. 2Carc. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 3 | H225H351H332H312H302H319H335H315H412 | GHS02GHS08GHS07Dgr | H225H351H332H312H302H319H335H315H412 |
| 603-103-00-4 | oxirane, mono[(C12-14-alkyloxy)methyl] derivs. | 271-846-8 | 68609-97-2 | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 603-104-00-X | fenarimol (ISO);2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol | 262-095-7 | 60168-88-9 | Repr. 2Lact.Aquatic Chronic 2 | H361fdH362H411 | GHS08 GHS09Wng | H361fdH362H411 |
| 603-105-00-5 | furan | 203-727-3 | 110-00-9 | Flam. Liq. 1Carc. 1BMuta. 2Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Aquatic Chronic 3 | H224H350H341H332H302H373 **H315H412 | GHS02GHS08GHS07Dgr | H224H350H341H332H302H373 **H315H412 | EUH019 |
| 603-106-00-0 | 2-methoxypropanol | 216-455-5 | 1589-47-5 | Flam. Liq. 3Repr. 1BSTOT SE 3Skin Irrit. 2Eye Dam. 1 | H226H360D ***H335H315H318 | GHS02GHS08GHS05GHS07Dgr | H226H360D ***H335H315H318 |
| 603-107-00-6 | 2-(2-methoxyethoxy)ethanol;diethylene glycol monomethyl ether | 203-906-6 | 111-77-3 | Repr. 2 | H361d *** | GHS08Wng | H361d *** |
| 603-108-00-1 | 2-methylpropan-1-ol;iso-butanol | 201-148-0 | 78-83-1 | Flam. Liq. 3STOT SE 3Skin Irrit. 2Eye Dam. 1STOT SE 3 | H226H335H315H318H336 | GHS02GHS05GHS07Dgr | H226H335H315H318H336 |
| 603-117-00-0 | propan-2-ol;isopropyl alcohol;isopropanol | 200-661-7 | 67-63-0 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 |
| 603-118-00-6 | 6-dimethylaminohexan-1-ol | 404-680-3 | 1862-07-3 | Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 3 | H302H314H412 | GHS05GHS07Dgr | H302H314H412 |
| 603-119-00-1 | 1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) | 405-840-5 | — | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 603-120-00-7 | 2-methyl-5-phenylpentanol | 405-890-8 | 25634-93-9 | Eye Irrit. 2Skin Irrit. 2 | H319H315 | GHS07Wng | H319H315 |
| 603-121-00-2 | 4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone | 406-057-1 | 114565-66-1 | Carc. 2Skin Sens. 1Aquatic Chronic 4 | H351H317H413 | GHS08GHS07Wng | H351H317H413 |
| 603-122-00-8 | sodium 2-ethylhexanolate | 406-150-7 | 38411-13-1 | Flam. Sol. 1Skin Corr. 1BAquatic Chronic 3 | H228H314H412 | GHS02GHS05Dgr | H228H314H412 | T |
| 603-123-00-3 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol | 406-330-5 | 122760-84-3 | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H315H317H411 | GHS07GHS09Wng | H315H317H411 |
| 603-124-00-9 | 1,4-bis[2-(vinyloxy)ethoxy]benzene | 406-900-3 | 84563-49-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 603-125-00-4 | 2-(2,4-dichlorophenyl)-1-(1H—1,2,4-triazol-1-yl)pent-4-en-2-ol | 407-850-5 | 89544-40-1 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 603-126-00-X | 2-((4-methyl-2-nitrophenyl)amino)ethanol | 408-090-7 | 100418-33-5 | Acute Tox. 4 *Skin Sens. 1Aquatic Chronic 3 | H302H317H412 | GHS07Wng | H302H317H412 |
| 603-127-00-5 | butan-2-ol; [1](S)-butan-2-ol; [2](R)-butan-2-ol; [3](±)-butan-2-ol [4] | 201-158-5 [1]224-168-1 [2]238-967-8 [3]240-029-8 [4] | 78-92-2 [1]4221-99-2 [2]14898-79-4 [3]15892-23-6 [4] | Flam. Liq. 3Eye Irrit. 2STOT SE 3STOT SE 3 | H226H319H335H336 | GHS02GHS07Wng | H226H319H335H336 | C |
| 603-128-00-0 | 2-(phenylmethoxy)naphthalene | 405-490-3 | 613-62-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 603-129-00-6 | 1-tert-butoxypropan-2-ol | 406-180-0 | 57018-52-7 | Flam. Liq. 3Eye Dam. 1 | H226H318 | GHS02GHS05Dgr | H226H318 |
| 603-130-00-1 | reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) | 406-325-8 | — | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 603-131-00-7 | reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol;1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) | 407-290-1 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 603-132-00-2 | 2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane | 408-200-3 | 63187-91-7 | Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H315H318H412 | GHS05Dgr | H315H318H412 |
| 603-133-00-8 | reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol;3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) | 408-240-1 | — | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 603-134-00-3 | reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produced by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6. Linear C12 and C14, 50/50 used. | 410-450-3 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 603-135-00-9 | bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium | 410-500-4 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 603-136-00-4 | 3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol | 410-910-3 | 104226-19-9 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 603-137-00-X | reaction mass of: 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol;1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol | 411-130-6 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 603-138-00-5 | 3-(2,2-dimethyl-3-hydroxypropyl)toluene;(alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol | 403-140-4 | 103694-68-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 603-139-00-0 | bis(2-methoxyethyl) ether | 203-924-4 | 111-96-6 | Flam. Liq. 3Repr. 1B | H226H360FD | GHS02GHS08Dgr | H226H360FD | EUH019 |
| 603-140-00-6 | 2,2' -oxybisethanol;diethylene glycol | 203-872-2 | 111-46-6 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 603-141-00-1 | reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane;dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane | 413-780-6 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 603-142-00-7 | 2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane | 407-360-1 | 116230-20-7 | Acute Tox. 4 *Acute Tox. 4 *STOT RE 2 *Skin Irrit. 2Eye Dam. 1 | H312H302H373 **H315H318 | GHS06GHS08GHS05Dgr | H312H302H373 **H315H318 |
| 603-143-00-2 | R—2,3-epoxy-1-propanol | 404-660-4 | 57044-25-4 | Self-react. C ****Carc. 1BMuta. 2Repr. 1BAcute Tox. 3 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H242H350H341H360F ***H331H312H302H314 | GHS02GHS06GHS08GHS05Dgr | H242H350H341H360F ***H331H312H302H314 |
| 603-144-00-8 | reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol;6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol | 413-530-6 | 111850-00-1 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 603-145-00-3 | 2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane | 406-970-5 | 129228-11-1 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 603-146-00-9 | 2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol | 406-080-7 | 83016-70-0 | Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 3 | H302H314H412 | GHS05GHS07Dgr | H302H314H412 |
| 603-147-00-4 | (-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | 406-030-4 | 105812-81-5 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 603-148-00-X | 1,4-bis[(vinyloxy)methyl]cyclohexane | 413-370-7 | 17351-75-6 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07 GHS09Wng | H317H411 |
| 603-149-00-5 | reaction mass of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane | 407-640-3 | 63767-86-2 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H319H315H411 | GHS07 GHS09Wng | H319H315H411 |
| 603-150-00-0 | (±) trans—3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol | 411-580-3 | 107898-54-4 | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 603-151-00-6 | (±)-2-(2,4-dichlorophenyl)-3-(1H—1,2,4-triazol-1-yl)propan-1-ol | 413-570-4 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 603-152-00-1 | 2-(4-tert-butylphenyl)ethanol | 410-020-5 | 5406-86-0 | Repr. 2STOT RE 2 *Eye Dam. 1Aquatic Chronic 2 | H361f ***H373 **H318H411 | GHS08GHS05GHS09Dgr | H361f ***H373 **H318H411 |
| 603-153-00-7 | 3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol | 410-010-0 | 104333-00-8 | Acute Tox. 4 *Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 603-154-00-2 | 1-[(2-tert-butyl)cyclohexyloxy]-2-butanol | 412-300-2 | 139504-68-0 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 603-155-00-8 | Reaction products of 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-hydroxyphenol with ((C10-16, rich in C12-13 alkyloxy)methyl)oxyrane | 410-560-1 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 603-156-00-3 | 2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane | 411-210-0 | 89544-48-9 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 603-157-00-9 | 6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol | 411-450-6 | 143747-72-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 603-158-00-4 | reaction mass of 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene | 412-460-3 | — | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07 GHS09Wng | H315H411 |
| 603-159-00-X | 2-cyclododecylpropan-1-ol | 411-410-8 | 118562-73-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 603-160-00-5 | 1,2-diethoxypropane | 412-180-1 | 10221-57-5 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 | EUH019 |
| 603-161-00-0 | 1,3-diethoxypropane | 413-140-6 | 3459-83-4 | Flam. Liq. 3 | H226 | GHS02Wng | H226 |
| 603-162-00-6 | α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]- ω nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] | 413-420-8 | 144736-29-8 | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H314H317H411 | GHS05GHS07GHS09Dgr | H314H317H411 |
| 603-163-00-1 | 2-phenyl-1,3-propanediol | 411-810-2 | 1570-95-2 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 603-164-00-7 | 2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole | 412-420-5 | 133909-99-6 | Aquatic Chronic 4 | H413 | — | H413 |
| 603-165-00-2 | reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol;4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol;4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol;4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol | 417-470-1 | — | Muta. 2Skin Sens. 1 | H341H317 | GHS08GHS07Wng | H341H317 |
| 603-166-00-8 | R-1-chloro-2,3-epoxypropane | 424-280-2 | 51594-55-9 | Flam. Liq. 3Carc. 1BAcute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BSkin Sens. 1 | H226H350H331H311H301H314H317 | GHS02GHS06GHS08GHS05Dgr | H226H350H331H311H301H314H317 |
| 603-167-00-3 | 3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol | 407-920-5 | 6390-69-8 | Aquatic Chronic 4 | H413 | GHS05Dgr | H413 |
| 603-168-00-9 | 3-(2-ethylhexyloxy)propane-1,2-diol | 408-080-2 | 70445-33-9 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 603-169-00-4 | (±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | 415-550-0 | 109887-53-8 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 603-170-00-X | reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol;2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol;2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol | 415-990-3 | 67739-11-1 | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 603-171-00-5 | 5-thiazolylmethanol | 414-780-9 | 38585-74-9 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 603-172-00-0 | mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate | 415-180-1 | 773058-82-5 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 603-173-00-6 | 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane | 421-750-9 | 57280-22-5 | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 603-174-00-1 | 4-cyclohexyl-2-methyl-2-butanol | 420-630-3 | 83926-73-2 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 603-175-00-7 | 2-(2-hexyloxyethoxy)ethanol;DEGHE;diethylene glycol monohexyl ether;3,6-dioxa-1-dodecanol;hexyl carbitol;3,6-dioxadodecan-1-ol | 203-988-3 | 112-59-4 | Acute Tox. 4 *Eye Dam. 1 | H312H318 | GHS05GHS07Dgr | H312H318 |
| 603-176-00-2 | 1,2-bis(2-methoxyethoxy)ethane;TEGDME;triethylene glycol dimethyl ether;triglyme | 203-977-3 | 112-49-2 | Repr. 1B | H360Df | GHS08Dgr | H360Df | EUH019 |
| 603-177-00-8 | 1-ethoxypropan-2-ol;2PG1EE;1-ethoxy-2-propanol;propylene glycol monoethyl ether; [1]2-ethoxy-1-methylethyl acetate;2PG1EEA [2] | 216-374-5 [1]259-370-9 [2] | 1569-02-4 [1]54839-24-6 [2] | Flam. Liq. 3STOT SE 3 | H226H336 | GHS02GHS07Wng | H226H336 |
| 603-178-00-3 | 2-hexyloxyethanol;ethylene glycol monohexyl ether;n-hexylglycol | 203-951-1 | 112-25-4 | Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1B | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 603-179-00-9 | ergocalciferol (ISO);Vitamin D2 | 200-014-9 | 50-14-6 | Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1 | H330H311H301H372 ** | GHS06GHS08Dgr | H330H311H301H372 ** |
| 603-180-00-4 | colecalciferol;Vitamin D3 | 200-673-2 | 67-97-0 | Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 1 | H330H311H301H372 ** | GHS06GHS08Dgr | H330H311H301H372 ** |
| 603-181-00-X | tert-butyl methyl ether;MTBE;2-methoxy-2-methylpropane | 216-653-1 | 1634-04-4 | Flam. Liq. 2Skin Irrit. 2 | H225H315 | GHS02GHS07Dgr | H225H315 |
| 603-183-00-0 | 2-[2-(2-butoxyethoxy)ethoxy]ethanol;TEGBE;triethylene glycol monobutyl ether;butoxytriethylene glycol | 205-592-6 | 143-22-6 | Eye Dam. 1 | H318 | GHS05Dgr | H318 | Eye Dam. 1; H318: C ≥ 30 %Eye Irrit. 2; H319: 20 % ≤ C < 30 % |
| 603-184-00-6 | 2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol | 416-380-1 | 146925-83-9 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 603-185-00-1 | 2,4-dichloro-3-ethyl-6-nitrophenol | 420-740-1 | 99817-36-4 | Acute Tox. 3 *Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H301H318H317H400H410 | GHS06GHS05GHS09Dgr | H301H318H317H410 |
| 603-186-00-7 | trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol | 419-050-3 | 79944-37-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 603-187-00-2 | 2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride | 419-360-9 | 163661-77-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 603-189-00-3 | reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol | 405-250-8 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 603-191-00-4 | 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol | 419-740-4 | 137658-79-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 603-195-00-6 | 2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol | 430-810-3 | 154825-62-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 603-196-00-1 | 2-(7-ethyl-1H-indol-3-yl)ethanol | 431-020-1 | 41340-36-7 | Acute Tox. 4 *STOT RE 2 *Aquatic Chronic 2 | H302H373 **H411 | GHS08GHS07GHS09Wng | H302H373 **H411 |
| 603-197-00-7 | tebuconazole (ISO);1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol | 403-640-2 | 107534-96-3 | Repr. 2Acute Tox. 4 *Aquatic Chronic 2 | H361d ***H302H411 | GHS08GHS07GHS09Wng | H361d ***H302H411 |
| 603-199-00-8 | etoxazol (ISO);(RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole | — | 153233-91-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 | M=100 |
| 604-001-00-2 | phenol;carbolic acid;monohydroxybenzene;phenylalcohol | 203-632-7 | 108-95-2 | Muta. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *Skin Corr. 1B | H341H331H311H301H373 **H314 | GHS06GHS08 GHS05Dgr | H341H331H311H301H373 **H314 | *Skin Corr. 1B; H314: C ≥ 3 %Skin Irrit. 2; H315: 1 % ≤ C < 3 %Eye Irrit. 2; H319: 1 % ≤ C < 3 % |
| 604-002-00-8 | pentachlorophenol | 201-778-6 | 87-86-5 | Carc. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H330H311H301H319H335H315H400H410 | GHS06GHS08GHS09Dgr | H351H330H311H301H319H335H315H410 |
| 604-003-00-3 | sodium pentachlorophenolate; [1]potassium pentachlorophenolate [2] | 205-025-2 [1]231-911-3 [2] | 131-52-2 [1]7778-73-6 [2] | Carc. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H330H311H301H319H335H315H400H410 | GHS06GHS08GHS09Dgr | H351H330H311H301H319H335H315H410 |
| 604-004-00-9 | m-cresol; [1]o-cresol; [2]p-cresol; [3]mix-cresol [4] | 203-577-9 [1]202-423-8 [2]203-398-6 [3]215-293-2 [4] | 108-39-4 [1]95-48-7 [2]106-44-5 [3]1319-77-3 [4] | Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1B | H311H301H314 | GHS06GHS05Dgr | H311H301H314 | * | C |
| 604-005-00-4 | 1,4-dihydroxybenzene;hydroquinone;quinol | 204-617-8 | 123-31-9 | Carc. 2Muta. 2Acute Tox. 4 *Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H351H341H302H318H317H400 | GHS08GHS05GHS07GHS09Dgr | H351H341H302H318H317H400 |
| 604-006-00-X | 3,4-xylenol; [1]2,5-xylenol; [2]2,4-xylenol; [3]2,3-xylenol; [4]2,6-xylenol; [5]xylenol; [6]2,4(or 2,5)-xylenol [7] | 202-439-5 [1]202-461-5 [2]203-321-6 [3]208-395-3 [4]209-400-1 [5]215-089-3 [6]276-245-4 [7] | 95-65-8 [1]95-87-4 [2]105-67-9 [3]526-75-0 [4]576-26-1 [5]1300-71-6 [6]71975-58-1 [7] | Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Chronic 2 | H311H301H314H411 | GHS06GHS05GHS09Dgr | H311H301H314H411 | C |
| 604-007-00-5 | 2-naphthol | 205-182-7 | 135-19-3 | Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1 | H332H302H400 | GHS07GHS09Wng | H332H302H400 |
| 604-008-00-0 | 2-chlorophenol; [1]4-chlorophenol; [2]3-chlorophenol; [3]chlorophenol [4] | 202-433-2 [1]203-402-6 [2]203-582-6 [3]246-691-4 [4] | 95-57-8 [1]106-48-9 [2]108-43-0 [3]25167-80-0 [4] | Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 2 | H332H312H302H411 | GHS07 GHS09Wng | H332H312H302H411 | C |
| 604-009-00-6 | pyrogallol;1,2,3-trihydroxybenzene | 201-762-9 | 87-66-1 | Muta. 2Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Aquatic Chronic 3 | H341H332H312H302H412 | GHS08GHS07Wng | H341H332H312H302H412 | * |
| 604-010-00-1 | resorcinol;1,3-benzenediol | 203-585-2 | 108-46-3 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1 | H302H319H315H400 | GHS07GHS09Wng | H302H319H315H400 | * |
| 604-011-00-7 | 2,4-dichlorophenol | 204-429-6 | 120-83-2 | Acute Tox. 3 *Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 2 | H311H302H314H411 | GHS06GHS05GHS09Dgr | H311H302H314H411 |
| 604-012-00-2 | 4-chloro-o-cresol;4-chloro-2-methyl phenol | 216-381-3 | 1570-64-5 | Acute Tox. 3 *Skin Corr. 1AAquatic Acute 1 | H331H314H400 | GHS06GHS05GHS09Dgr | H331H314H400 | STOT SE 3; H335: C ≥ 1 % |
| 604-013-00-8 | 2,3,4,6-tetrachlorophenol | 200-402-8 | 58-90-2 | Acute Tox. 3 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H301H319H315H400H410 | GHS06GHS09Dgr | H301H319H315H410 | *Eye Irrit. 2; H319: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 % |
| 604-014-00-3 | chlorocresol;4-chloro-m-cresol;4-chloro-3-methylphenol | 200-431-6 | 59-50-7 | Acute Tox. 4 *Acute Tox. 4 *Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H312H302H318H317H400 | GHS05GHS07GHS09Dgr | H312H302H318H317H400 | * |
| 604-015-00-9 | 2,2'-methylenebis-(3,4,6-trichlorophenol);hexachlorophene | 200-733-8 | 70-30-4 | Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H311H301H400H410 | GHS06GHS09Dgr | H311H301H410 | * |
| 604-016-00-4 | 1,2-dihydroxybenzene;pyrocatechol | 204-427-5 | 120-80-9 | Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H312H302H319H315 | GHS07Wng | H312H302H319H315 |
| 604-017-00-X | 2,4,5-trichlorophenol | 202-467-8 | 95-95-4 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H315H400H410 | GHS07GHS09Wng | H302H319H315H410 | *Eye Irrit. 2; H319: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 % |
| 604-018-00-5 | 2,4,6-trichlorophenol | 201-795-9 | 88-06-2 | Carc. 2Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H351H302H319H315H400H410 | GHS08GHS07GHS09Wng | H351H302H319H315H410 |
| 604-019-00-0 | dichlorophen (ISO) | 202-567-1 | 97-23-4 | Acute Tox. 4 *Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H400H410 | GHS07GHS09Wng | H302H319H410 |
| 604-020-00-6 | 2-phenylphenol (ISO)biphenyl-2-ol;2-hydroxybiphenyl; | 201-993-5 | 90-43-7 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H319H335H315H400 | GHS07GHS09Wng | H319H335H315H400 |
| 604-021-00-1 | sodium 2-biphenylate;2-phenylphenol, sodium salt | 205-055-6 | 132-27-4 | Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1 | H302H335H315H318H400 | GHS05GHS07GHS09Wng | H302H335H315H318H400 |
| 604-022-00-7 | 2,2-dimethyl-1,3-benzodioxol-4-ol | 400-900-7 | 22961-82-6 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 604-023-00-2 | 2,4-dichloro-3-ethylphenol | 401-060-4 | — | Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 |
| 604-024-00-8 | 4,4-isobutylethylidenediphenol | 401-720-1 | 6807-17-6 | Repr. 1BEye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H360F ***H319H400H410 | GHS08GHS09Dgr | H360F ***H319H410 |
| 604-025-00-3 | 2,5-bis(1,1-dimethylbutyl)hydroquinone | 400-220-0 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-026-00-9 | 2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) | 400-270-3 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-027-00-4 | 2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone | 400-530-6 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 604-028-00-X | 4-amino-3-fluorophenol | 402-230-0 | 399-95-1 | Carc. 1BAcute Tox. 4 *Skin Sens. 1Aquatic Chronic 2 | H350H302H317H411 | GHS08GHS07GHS09Dgr | H350H302H317H411 |
| 604-029-00-5 | 1-naphtol | 201-969-4 | 90-15-3 | Acute Tox. 4 *Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1 | H312H302H335H315H318 | GHS05GHS07Dgr | H312H302H335H315H318 |
| 604-030-00-0 | bisphenol A;4,4'-isopropylidenediphenol | 201-245-8 | 80-05-7 | Repr. 2STOT SE 3Eye Dam. 1Skin Sens. 1 | H361f ***H335H318H317 | GHS08GHS05 GHS07Dgr | H361f ***H335H318H317 |
| 604-031-00-6 | guaiacol | 201-964-7 | 90-05-1 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2 | H302H319H315 | GHS07Wng | H302H319H315 |
| 604-032-00-1 | thymol | 201-944-8 | 89-83-8 | Acute Tox. 4 *Skin Corr. 1BAquatic Chronic 2 | H302H314H411 | GHS05GHS07GHS09Dgr | H302H314H411 |
| 604-033-00-7 | isobutyl but-3-enoate | 401-170-2 | 24342-03-8 | Flam. Liq. 3 | H226 | GHS02Wng | H226 |
| 604-034-00-2 | 4,4'-thiodi-o-cresol | 403-330-7 | 24197-34-0 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 604-035-00-8 | 4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol | 404-160-6 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 604-036-00-3 | 4,4'-oxybis(ethylenethio)diphenol | 404-590-4 | 90884-29-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 604-037-00-9 | 3,5-xylenol;3,5-dimethylphenol | 203-606-5 | 108-68-9 | Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1B | H311H301H314 | GHS06GHS05Dgr | H311H301H314 |
| 604-038-00-4 | 4-chloro-3,5-dimethylphenol; [1]chloroxylenol [2] | 201-793-8 [1]215-316-6 [2] | 88-04-0 [1]1321-23-9 [2] | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H302H319H315H317 | GHS07Wng | H302H319H315H317 |
| 604-039-00-X | ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate;fenoxaprop-ethyl | 266-362-9 | 66441-23-4 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 604-040-00-5 | fomesafen (ISO);5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide | 276-439-9 | 72178-02-0 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 604-041-00-0 | acifluorfen (ISO);5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid [1]sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate;acifluorfen-sodium [2] | 256-634-5 [1]263-560-7 [2] | 50594-66-6 [1]62476-59-9 [2] | Acute Tox. 4 *Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H315H318H400H410 | GHS05GHS07GHS09Dgr | H302H315H318H410 |
| 604-042-00-6 | 4-nitrosophenol | 203-251-6 | 104-91-6 | Muta. 2Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H341H302H318H411 | GHS08GHS05GHS07GHS09Dgr | H341H302H318H411 |
| 604-043-00-1 | monobenzone;4-hydroxyphenyl benzyl ether;hydroquinone monobenzyl ether | 203-083-3 | 103-16-2 | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 604-044-00-7 | mequinol;4-methoxyphenol;hydroquinone monomethyl ether | 205-769-8 | 150-76-5 | Acute Tox. 4 *Eye Irrit. 2Skin Sens. 1 | H302H319H317 | GHS07Wng | H302H319H317 |
| 604-045-00-2 | 2,3,5-trimethylhydroquinone | 211-838-3 | 700-13-0 | Acute Tox. 4 *STOT SE 3Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H335H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H332H335H315H318H317H410 |
| 604-046-00-8 | 4-(4-isopropoxyphenylsulfonyl)phenol | 405-520-5 | 95235-30-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-047-00-3 | 4-(4-tolyloxy)biphenyl | 405-730-7 | 51601-57-1 | STOT RE 2 *Aquatic Chronic 4 | H373 **H413 | GHS08Wng | H373 **H413 |
| 604-048-00-9 | 4,4',4''-(ethan-1,1,1-triyl)triphenol | 405-800-7 | 27955-94-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-049-00-4 | 4-4'-methylenebis(oxyethylenethio)diphenol | 407-480-4 | 93589-69-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-051-00-5 | 3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol | 401-110-5 | 87113-78-8 | Aquatic Chronic 3 | H412 | — | H412 |
| 604-052-00-0 | 2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) | 403-800-1 | 103597-45-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 604-053-00-6 | 2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol | 410-760-9 | 157661-93-3 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 604-054-00-1 | reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol;4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol | 412-020-0 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 604-055-00-7 | 2,2'-((3,3',5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane | 413-900-7 | 85954-11-6 | Muta. 2 | H341 | GHS08Wng | H341 |
| 604-056-00-2 | 2-(2-hydroxy-3,5-dinitroanilino)ethanol | 412-520-9 | 99610-72-7 | Flam. Sol. 2Repr. 2Acute Tox. 4 * | H228H361f ***H302 | GHS02GHS07GHS08Dgr | H228H361f ***H302 |
| 604-057-00-8 | reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol;isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol;isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n=5 or 6 | 401-680-5 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-058-00-3 | 1,2-bis(3-methylphenoxy)ethane | 402-730-9 | 54914-85-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 604-059-00-9 | 2-n-hexadecylhydroquinone | 406-400-5 | — | STOT RE 2 *Skin Irrit. 2Skin Sens. 1Aquatic Chronic 4 | H373 **H315H317H413 | GHS08GHS07Wng | H373 **H315H317H413 |
| 604-060-00-4 | 9,9-bis(4-hydroxyphenyl)fluorene | 406-950-6 | 3236-71-3 | Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H315H400H410 | GHS07GHS09Wng | H319H315H410 |
| 604-061-00-X | reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl= 1-methyltridecyl;1-ethyldodecyl;1-propylundecyl;1-butyldecyl;1-pentylnonyl;1-hexyloctyl | 407-740-7 | — | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H315H317H412 | GHS07Wng | H315H317H412 |
| 604-062-00-5 | 2,4-dimethyl-6-(1-methyl-pentadecyl)phenol | 411-220-5 | — | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 604-063-00-0 | 5,6-dihydroxyindole | 412-130-9 | 3131-52-0 | Acute Tox. 4 *Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05 GHS07GHS09Dgr | H302H318H411 |
| 604-064-00-6 | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol | 411-380-6 | 147315-50-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 604-065-00-1 | 4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) | 407-460-5 | 111850-25-0 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 604-066-00-7 | reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-compound);2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol and 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol;2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol and 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol | 414-550-8 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 604-067-00-2 | reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol];formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2);formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) | 414-520-4 | — | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 604-068-00-8 | (±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride | 415-170-5 | 90274-24-1 | Acute Tox. 4 *Acute Tox. 4 *Skin Sens. 1 | H332H302H317 | GHS07Wng | H332H302H317 |
| 604-069-00-3 | 2-(1-methylpropyl)-4-tert-butylphenol | 421-740-4 | 51390-14-8 | Skin Corr. 1BAquatic Chronic 2 | H314H411 | GHS05GHS09Dgr | H314H411 |
| 604-070-00-9 | triclosan;2,4,4'-trichloro-2'-hydroxy-diphenyl-ether;5-chloro-2-(2,4-dichlorophenoxy)phenol | 222-182-2 | 3380-34-5 | Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H315H400H410 | GHS07GHS09Wng | H319H315H410 | M=100 |
| 605-001-00-5 | formaldehyde ...% | 200-001-8 | 50-00-0 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BSkin Sens. 1 | H351H331H311H301H314H317 | GHS06GHS08GHS05Dgr | H351H331H311H301H314H317 | *Skin Corr. 1B; H314: C ≥25 %Skin Irrit. 2; H315: 5 % ≤ C < 25 %Eye Irrit. 2; H319: 5 % ≤ C < 25 %STOT SE 3; H335: C ≥ 5 %Skin Sens. 1; H317: C ≥ 0,2 % | B D |
| 605-002-00-0 | 1,3,5-trioxan;trioxymethylene | 203-812-5 | 110-88-3 | Flam. Sol. 1Repr. 2STOT SE 3 | H228H361d ***H335 | GHS02GHS08GHS07Dgr | H228H361d ***H335 | T |
| 605-003-00-6 | acetaldehyde;ethanal | 200-836-8 | 75-07-0 | Flam. Liq. 1Carc. 2Eye Irrit. 2STOT SE 3 | H224H351H319H335 | GHS02GHS08GHS07Dgr | H224H351H319H335 |
| 605-004-00-1 | 2,4,6-trimethyl-1,3,5-trioxan;paraldehyde | 204-639-8 | 123-63-7 | Flam. Liq. 3 | H226 | GHS02Dgr | H226 |
| 605-005-00-7 | 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane;metaldehyde | 203-600-2 | 108-62-3 | Flam. Sol. 2Acute Tox. 4 * | H228H302 | GHS02GHS07Wng | H228H302 |
| 605-006-00-2 | butyraldehyde | 204-646-6 | 123-72-8 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 605-007-00-8 | 1,1-dimethoxyethane;dimethyl acetal | 208-589-8 | 534-15-6 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 605-008-00-3 | acrylaldehyde;acrolein;prop-2-enal | 203-453-4 | 107-02-8 | Flam. Liq. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Acute 1 | H225H330H311H301H314H400 | GHS02GHS06GHS05GHS09Dgr | H225H330H311H301H314H400 | D |
| 605-009-00-9 | crotonaldehyde;2-butenal; [1](E)-2-butenal;(E)-crotonaldehyde [2] | 224-030-0 [1]204-647-1 [2] | 4170-30-3 [1]123-73-9 [2] | Flam. Liq. 2Muta. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *STOT RE 2 *STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1 | H225H341H330H311H301H373 **H335H315H318H400 | GHS02GHS06GHS08GHS05GHS09Dgr | H225H341H330H311H301H373 **H335H315H318H400 |
| 605-010-00-4 | 2-furaldehyde | 202-627-7 | 98-01-1 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3 | H351H331H301H312H319H335 | GHS06GHS08Dgr | H351H331H301H312H319H335 | * |
| 605-011-00-X | 2-chlorobenzaldehyde;o-chlorobenzaldehyde | 201-956-3 | 89-98-5 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 605-012-00-5 | benzaldehyde | 202-860-4 | 100-52-7 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 605-013-00-0 | chloralose (INN);(R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose;glucochloralose;anhydroglucochloral | 240-016-7 | 15879-93-3 | Acute Tox. 4 *Acute Tox. 4 * | H332H302 | GHS07Wng | H332H302 |
| 605-014-00-6 | chloral hydrate;2,2,2-trichloroethane-1,1-diol | 206-117-5 | 302-17-0 | Acute Tox. 3 *Eye Irrit. 2Skin Irrit. 2 | H301H319H315 | GHS06Dgr | H301H319H315 |
| 605-015-00-1 | 1,1-diethoxyethane;acetal | 203-310-6 | 105-57-7 | Flam. Liq. 2Eye Irrit. 2Skin Irrit. 2 | H225H319H315 | GHS02GHS07Dgr | H225H319H315 |
| 605-016-00-7 | glyoxal...%;ethandial...% | 203-474-9 | 107-22-2 | Muta. 2Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H341H332H319H315H317 | GHS07GHS08Wng | H341H332H319H315H317 | * | B |
| 605-017-00-2 | 1,3-dioxolane | 211-463-5 | 646-06-0 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 605-018-00-8 | propanal;propionaldehyde | 204-623-0 | 123-38-6 | Flam. Liq. 2Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H225H319H335H315 | GHS02GHS07Dgr | H225H319H335H315 |
| 605-019-00-3 | citral | 226-394-6 | 5392-40-5 | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 605-020-00-9 | safrole;5-allyl-1,3-benzodioxole | 202-345-4 | 94-59-7 | Carc. 1BMuta. 2Acute Tox. 4 * | H350H341H302 | GHS08GHS07Dgr | H350H341H302 |
| 605-021-00-4 | formaldehyde, reaction products with butylphenol | 294-145-9 | 91673-30-2 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 605-022-00-X | glutaral;glutaraldehyde;1,5-pentanedial | 203-856-5 | 111-30-8 | Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Acute 1 | H331H301H314H334H317H400 | GHS06GHS08GHS05GHS09Dgr | H331H301H314H334H317H400 | *Skin Corr. 1B; H314: C ≥ 10 %Skin Irrit. 2; H315: 0,5 % ≤ C < 10 %Eye Dam. ; H318: 2 % ≤ C < 10 %Eye Irrit. 2; H319: 0,5 % ≤ C < 2 %STOT SE; H335: C ≥ 0,5 %Skin Sens. 1; H317: C ≥ 0,5 % |
| 605-025-00-6 | chloroacetaldehyde | 203-472-8 | 107-20-0 | Carc. 2Acute Tox. 2 *Acute Tox. 3 *Acute Tox. 3 *Skin Corr. 1BAquatic Acute 1 | H351H330H311H301H314H400 | GHS06GHS08GHS05GHS09Dgr | H351H330H311H301H314H400 | STOT SE 3; H335: C ≥ 5 % |
| 605-026-00-1 | 2,5,7,7-tetramethyloctanal | 405-690-0 | 114119-97-0 | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H315H317H411 | GHS07 GHS09Wng | H315H317H411 |
| 605-027-00-7 | reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde;3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde | 410-480-7 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 605-028-00-2 | β-methyl-3-(1-methylethyl)-benzenepropanal | 412-050-4 | 125109-85-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 605-029-00-8 | 2-cyclohexylpropanal | 412-270-0 | 2109-22-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 605-030-00-3 | 1-(p-methoxyphenyl)acetaldehyde oxime | 411-510-1 | 3353-51-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 605-031-00-9 | reaction mass of: 2,2-dimethoxyethanal [this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70.4 % hydrate;water(Including free water and water in hydrated 2,2-dimethoxyethanal)] | 421-890-0 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 606-001-00-8 | acetone;propan-2-one;propanone | 200-662-2 | 67-64-1 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 | EUH066 |
| 606-002-00-3 | butanone;ethyl methyl ketone | 201-159-0 | 78-93-3 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 | EUH066 |
| 606-003-00-9 | heptan-3-one;butyl ethyl ketone | 203-388-1 | 106-35-4 | Flam. Liq. 3Acute Tox. 4 *Eye Irrit. 2 | H226H332H319 | GHS02GHS07Wng | H226H332H319 |
| 606-004-00-4 | 4-methylpentan-2-one;isobutyl methyl ketone | 203-550-1 | 108-10-1 | Flam. Liq. 2Acute Tox. 4 *Eye Irrit. 2STOT SE 3 | H225H332H319H335 | GHS02GHS07Dgr | H225H332H319H335 | EUH066 |
| 606-005-00-X | 2,6-dimethylheptan-4-one;di-isobutyl ketone | 203-620-1 | 108-83-8 | Flam. Liq. 3STOT SE 3 | H226H335 | GHS02GHS07Wng | H226H335 | STOT SE 3; H335: C ≥ 10 % |
| 606-006-00-5 | pentan-3-one;diethyl ketone | 202-490-3 | 96-22-0 | Flam. Liq. 2STOT SE 3STOT SE 3 | H225H335H336 | GHS02GHS07Dgr | H225H335H336 | EUH066 |
| 606-007-00-0 | 3-methylbutan-2-one;methyl isopropyl ketone | 209-264-3 | 563-80-4 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 606-009-00-1 | 4-methylpent-3-en-2-one;mesityl oxide | 205-502-5 | 141-79-7 | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 * | H226H332H312H302 | GHS02GHS07Wng | H226H332H312H302 | * |
| 606-010-00-7 | cyclohexanone | 203-631-1 | 108-94-1 | Flam. Liq. 3Acute Tox. 4 * | H226H332 | GHS02GHS07Wng | H226H332 |
| 606-011-00-2 | 2-methylcyclohexanone | 209-513-6 | 583-60-8 | Flam. Liq. 3Acute Tox. 4 * | H226H332 | GHS02GHS07Wng | H226H332 |
| 606-012-00-8 | 3,5,5-trimethylcyclohex-2-enone;isophorone | 201-126-0 | 78-59-1 | Carc. 2Acute Tox. 4 *Acute Tox. 4 *Eye Irrit. 2STOT SE 3 | H351H312H302H319H335 | GHS08GHS07Wng | H351H312H302H319H335 | STOT SE 3; H335: C ≥ 10 % |
| 606-013-00-3 | p-benzoquinone;quinone | 203-405-2 | 106-51-4 | Acute Tox. 3 *Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1 | H331H301H319H335H315H400 | GHS06GHS09Dgr | H331H301H319H335H315H400 |
| 606-014-00-9 | chlorophacinone (ISO);2-(2-(4-chlorophenyl)phenylacetyl)indan-1,3-dione | 223-003-0 | 3691-35-8 | Acute Tox. 1Acute Tox. 2 *Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H310H300H331H372 **H400H410 | GHS06GHS08GHS09Dgr | H310H300H331H372 **H410 |
| 606-016-00-X | pindone (ISO);2-pivaloylindan-1,3-dione | 201-462-8 | 83-26-1 | Acute Tox. 3 *STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H301H372 **H400H410 | GHS06GHS08GHS09Dgr | H301H372 **H410 |
| 606-017-00-5 | diketene;diketen | 211-617-1 | 674-82-8 | Flam. Liq. 3Acute Tox. 4 * | H226H332 | GHS02GHS07Wng | H226H332 | D |
| 606-018-00-0 | dichlone (ISO);2,3-dichloro-1,4-naphthoquinone | 204-210-5 | 117-80-6 | Acute Tox. 4 *Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H315H400H410 | GHS07GHS09Wng | H302H319H315H410 |
| 606-019-00-6 | chlordecone (ISO);perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one;decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one | 205-601-3 | 143-50-0 | Carc. 2Acute Tox. 3 *Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H351H311H301H400H410 | GHS06GHS08GHS09Dgr | H351H311H301H410 |
| 606-020-00-1 | 5-methylheptan-3-one | 208-793-7 | 541-85-5 | Flam. Liq. 3Eye Irrit. 2STOT SE 3 | H226H319H335 | GHS02GHS07Wng | H226H319H335 | STOT SE 3; H335: C ≥ 10 % |
| 606-021-00-7 | N-methyl-2-pyrrolidone | 212-828-1 | 872-50-4 | Eye Irrit. 2Skin Irrit. 2 | H319H315 | GHS07Wng | H319H315 |
| 606-022-00-2 | 1-phenyl-3-pyrazolidone | 202-155-1 | 92-43-3 | Acute Tox. 4 *Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 606-023-00-8 | 4-methoxy-4-methylpentan-2-one | 203-512-4 | 107-70-0 | Flam. Liq. 3Acute Tox. 4 ((*)) | H226H332 | GHS02GHS07Wng | H226H332 |
| 606-024-00-3 | heptan-2-one;methyl amyl ketone | 203-767-1 | 110-43-0 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*) | H226H332H302 | GHS02GHS07Wng | H226H332H302 |
| 606-025-00-9 | cyclopentanone | 204-435-9 | 120-92-3 | Flam. Liq. 3Eye Irrit. 2Skin Irrit. 2 | H226H319H315 | GHS02GHS07Wng | H226H319H315 |
| 606-026-00-4 | 5-methylhexan-2-one;isoamyl methyl ketone | 203-737-8 | 110-12-3 | Flam. Liq. 3Acute Tox. 4 (*) | H226H332 | GHS02GHS07Wng | H226H332 |
| 606-027-00-X | heptan-4-one;di-n-propyl ketone | 204-608-9 | 123-19-3 | Flam. Liq. 3Acute Tox. 4 (*) | H226H332 | GHS02GHS07Wng | H226H332 |
| 606-028-00-5 | 2,4-dimethylpentan-3-one;di-isopropyl ketone | 209-294-7 | 565-80-0 | Flam. Liq. 2Acute Tox. 4 (*) | H225H332 | GHS02GHS07Dgr | H225H332 |
| 606-029-00-0 | pentane-2,4-dione;acetylacetone | 204-634-0 | 123-54-6 | Flam. Liq. 3Acute Tox. 4 (*) | H226H302 | GHS02GHS07Wng | H226H302 |
| 606-030-00-6 | hexan-2-one;methyl butyl ketone;butyl methyl ketone;methyl-n-butyl ketone | 209-731-1 | 591-78-6 | Flam. Liq. 3Repr. 2STOT RE 1STOT SE 3 | H226H361f (*)(*)(*)H372 (*)(*)H336 | GHS02GHS08GHS07Dgr | H226H361f (*)(*)(*)H372 (*)(*)H336 |
| 606-031-00-1 | 3-propanolide;1,3-propiolactone | 200-340-1 | 57-57-8 | Carc. 1BAcute Tox. 2 (*)Eye Irrit. 2Skin Irrit. 2 | H350H330H319H315 | GHS06GHS08Dgr | H350H330H319H315 |
| 606-032-00-7 | hexachloroacetone | 204-129-5 | 116-16-5 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 606-033-00-2 | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione;methazole | 243-761-6 | 20354-26-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H312H302H319H315H411 | GHS07GHS09Wng | H312H302H319H315H411 |
| 606-034-00-8 | metribuzin (ISO);4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one;4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one | 244-209-7 | 21087-64-9 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 606-035-00-3 | chloridazon (ISO);5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one;pyrazon | 216-920-2 | 1698-60-8 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 606-036-00-9 | quinomethionate;chinomethionat (ISO);6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one | 219-455-3 | 2439-01-2 | Repr. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361f (*)(*)(*)H332H312H302H373 (*)(*)H319H317H400H410 | GHS08GHS07GHS09Wng | H361f (*)(*)(*)H332H312H302H373 (*)(*)H319H317H410 |
| 606-037-00-4 | triadimefon (ISO);1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone | 256-103-8 | 43121-43-3 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 606-038-00-X | diphacinone (ISO);2-diphenylacetylindan-1,3-dione | 201-434-5 | 82-66-6 | Acute Tox. 2 (*)STOT RE 1 | H300H372 (*)(*) | GHS06GHS08Dgr | H300H372 (*)(*) |
| 606-039-00-5 | 5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one | 400-680-2 | — | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H400H410 | GHS07GHS09Wng | H332H410 |
| 606-040-00-0 | (N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride | 401-840-4 | 55845-90-4 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 606-041-00-6 | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 400-600-6 | 71868-10-5 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 606-042-00-1 | acetophenone | 202-708-7 | 98-86-2 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 606-043-00-7 | 2,4-di-tert-butylcyclohexanone | 405-340-7 | 13019-04-0 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 606-044-00-2 | 2,4,6-trimethylbenzophenone | 403-150-9 | 954-16-5 | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H400H410 | GHS07GHS09Wng | H302H319H410 |
| 606-045-00-8 | oxadiazon (ISO);3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | 243-215-7 | 19666-30-9 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-046-00-3 | reaction mass of cis- and trans-cyclohexadec-8-en-1-one | 401-700-2 | 3100-36-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-047-00-9 | 2-benzyl-2-dimethylamino-4-morpholinobutyrophenone | 404-360-3 | 119313-12-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-048-00-4 | 2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one | 406-480-1 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 606-049-00-X | 4-(trans-4-propylcyclohexyl)acetophenone | 406-700-6 | 78531-61-0 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 606-050-00-5 | 6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione | 412-480-2 | 72453-58-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-051-00-0 | 4-pentylcyclohexanone | 406-670-4 | 61203-83-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-052-00-6 | 4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone | 410-410-5 | 54574-82-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 606-053-00-1 | flurtamone (ISO);(RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one | — | 96525-23-4 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-054-00-7 | isoxaflutole (ISO);5-cyclopropyl-1,2-oxazol-4-yl α, α,α-trifluoro-2-mesyl-p-tolyl ketone | — | 141112-29-0 | Repr. 2Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H400H410 | GHS08GHS09Wng | H361d (*)(*)(*)H410 |
| 606-055-00-2 | 1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone | 411-180-9 | 92836-10-7 | Acute Tox. 4 (*)STOT RE 2 (*)Aquatic Chronic 2 | H302H373 (*)(*)H411 | GHS08GHS07GHS09Wng | H302H373 (*)(*)H411 |
| 606-056-00-8 | 4-chloro-3',4'-dimethoxybenzophenone | 404-610-1 | 116412-83-0 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-057-00-3 | 4-propylcyclohexanone | 406-810-4 | 40649-36-3 | Skin Irrit. 2Aquatic Chronic 3 | H315H412 | GHS07Wng | H315H412 |
| 606-058-00-9 | 4'-fluoro-2,2-dimethoxyacetophenone | 407-500-1 | 21983-80-2 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 606-059-00-4 | 2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride | 412-390-3 | 86386-75-6 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1 | H302H318H317 | GHS05GHS07Dgr | H302H318H317 |
| 606-060-00-X | reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane;cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane | 412-950-7 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-061-00-5 | (3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone | 423-290-4 | 66938-41-8 | Muta. 2Aquatic Acute 1Aquatic Chronic 1 | H341H400H410 | GHS08GHS09Wng | H341H410 |
| 606-062-00-0 | tetrahydrothiopyran-3-carboxaldehyde | 407-330-8 | 61571-06-0 | Repr. 1BEye Dam. 1Aquatic Chronic 3 | H360D (*)(*)(*)H318H412 | GHS08GHS05Dgr | H360D (*)(*)(*)H318H412 |
| 606-063-00-6 | (E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal | 410-980-5 | 112704-51-5 | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 606-064-00-1 | pregn-5-ene-3,20-dione bis(ethylene ketal) | 407-450-0 | 7093-55-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 606-065-00-7 | 1-(4-morpholinophenyl)butan-1-one | 413-790-0 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-066-00-2 | (E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone | 410-440-9 | 164058-20-2 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-067-00-8 | reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone;1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone;1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone;1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanone | 414-870-8 | 96792-67-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-068-00-3 | 2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al | 415-770-7 | 1638-05-7 | STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 3 | H373 (*)(*)H317H412 | GHS08GHS07Wng | H373 (*)(*)H317H412 |
| 606-069-00-9 | spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] | 415-460-1 | 154171-76-3 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-070-00-4 | butroxydim (ISO);5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one | 414-790-3 | 138164-12-2 | Repr. 2Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H361fdH302H315H400H410 | GHS08GHS07GHS09Wng | H361fdH302H315H410 |
| 606-071-00-X | 17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one | 421-050-3 | 13258-43-0 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-072-00-5 | 3-acetyl-1-phenyl-pyrrolidine-2,4-dione | 421-600-2 | 719-86-8 | STOT RE 2 (*)Aquatic Chronic 2 | H373 (*)(*)H411 | GHS08GHS09Wng | H373 (*)(*)H411 |
| 606-073-00-0 | 4,4'-bis(dimethylamino)benzophenone;Michler's ketone | 202-027-5 | 90-94-8 | Carc. 1BMuta. 2Eye Dam. 1 | H350H341H318 | GHS08GHS05Dgr | H350H341H318 |
| 606-075-00-1 | 1-benzyl-5-ethoxyimidazolidine-2,4-dione | 417-340-4 | 65855-02-9 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 606-076-00-7 | 1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione | 418-630-3 | 136465-99-1 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 606-077-00-2 | (3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone | 418-650-2 | 104872-06-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-078-00-8 | 1-octylazepin-2-one | 420-040-6 | 59227-88-2 | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H314H317H411 | GHS05GHS07GHS09Dgr | H314H317H411 |
| 606-079-00-3 | 2-n-butyl-benzo[d]isothiazol-3-one | 420-590-7 | 4299-07-4 | Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H314H317H400H410 | GHS05GHS07GHS09Dgr | H314H317H410 |
| 606-080-00-9 | Reaction product of: 3-hydroxy-5,7-di-tert-butylbenzofuran-2-one with o-xylene | 417-100-9 | — | Aquatic Chronic 4 | H413 | H413 |
| 606-081-00-4 | (3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one | 419-790-7 | 4229-69-0 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 606-082-00-X | reaction mass of: butan-2-one oxime;syn-O,O'-di(butan-2-one oxime)diethoxysilane | 406-930-7 | STOT RE 1Skin Sens. 1Aquatic Chronic 3 | H372 (*)(*)H317H412 | GHS08GHS07Dgr | H372 (*)(*)H317H412 |
| 606-083-00-5 | 2-chloro-5-sec-hexadecylhydroquinone | 407-750-1 | 137193-60-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H319H315H317H412 | GHS07Wng | H319H315H317H412 |
| 606-084-00-0 | 1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione | 414-540-3 | 484-33-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-085-00-6 | (1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one | 418-530-1 | 79200-56-9 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1 | H302H318H317 | GHS05GHS07Dgr | H302H318H317 |
| 606-086-00-1 | 1-(3,3-dimethylcyclohexyl)pent-4-en-1-one | 422-330-8 | 56973-87-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 606-087-00-7 | 6-ethyl-5-fluoro-4(3H)-pyrimidone | 422-460-5 | 137234-87-8 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 606-088-00-2 | 2,4,4,7-tetramethyl-6-octen-3-one | 422-520-0 | 74338-72-0 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 606-089-00-8 | reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone;1,4-diamino-2,3-bis-phenoxyanthraquinone | 423-220-2 | 12223-77-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 606-091-00-9 | 6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one | 421-320-0 | 118289-55-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 606-092-00-4 | reaction mass of: (E)-oxacyclohexadec-12-en-2-one;(E)-oxacyclohexadec-13-en-2-one;a)(Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one | 422-320-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-001-00-0 | formic acid ... % | 200-579-1 | 64-18-6 | Skin Corr. 1A | H314 | GHS05Dgr | H314 | Skin Corr. 1A; H314: C ≥ 90 %Skin Corr. 1B; H314: 10 % ≤ C < 90 %Skin Irrit. 2; H315: 2 % ≤ C < 10 %Eye Irrit. 2; H319: 2 % ≤ C < 10 % | B |
| 607-002-00-6 | acetic acid ... % | 200-580-7 | 64-19-7 | Flam. Liq. 3Skin Corr. 1A | H226H314 | GHS02GHS05Dgr | H226H314 | Skin Corr. 1A; H314: C ≥ 90 %Skin Corr. 1B; H314: 25 % ≤ C < 90 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % | B |
| 607-003-00-1 | chloroacetic acid | 201-178-4 | 79-11-8 | Acute Tox. 3 (*)Skin Corr. 1BAquatic Acute 1 | H301H314H400 | GHS06GHS05GHS09Dgr | H301H314H400 |
| 607-004-00-7 | TCA (ISO);trichloroacetic acid | 200-927-2 | 76-03-9 | Skin Corr. 1AAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 | STOT SE 3; H335: C ≥ 1 % |
| 607-005-00-2 | TCA-sodium (ISO);sodium trichloroacetate | 211-479-2 | 650-51-1 | STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H335H400H410 | GHS07GHS09Wng | H335H410 |
| 607-006-00-8 | oxalic acid | 205-634-3 | 144-62-7 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H312H302 | GHS07Wng | H312H302 | (*) |
| 607-007-00-3 | salts of oxalic acid | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*) | H312H302 | GHS07Wng | H312H302 | (*) | A |
| 607-008-00-9 | acetic anhydride | 203-564-8 | 108-24-7 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H226H332H302H314 | GHS02GHS05GHS07Dgr | H226H332H302H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 5 % ≤ C < 25 %Eye Dam. 1; H318: 5 % ≤ C < 25 %Eye Irrit. 2; H319: 1 % ≤ C < 5 %STOT SE 3; H335: C ≥ 5 % |
| 607-009-00-4 | phthalic anhydride | 201-607-5 | 85-44-9 | Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H302H335H315H318H334H317 | GHS08GHS05GHS07Dgr | H302H335H315H318H334H317 |
| 607-010-00-X | propionic anhydride | 204-638-2 | 123-62-6 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H315: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
| 607-011-00-5 | acetyl chloride | 200-865-6 | 75-36-5 | Flam. Liq. 2Skin Corr. 1B | H225H314 | GHS02GHS05Dgr | H225H314 | EUH014 |
| 607-012-00-0 | benzoyl chloride | 202-710-8 | 98-88-4 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-013-00-6 | dimethyl carbonate | 210-478-4 | 616-38-6 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 607-014-00-1 | methyl formate | 203-481-7 | 107-31-3 | Flam. Liq. 1Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3 | H224H332H302H319H335 | GHS02GHS07Dgr | H224H332H302H319H335 |
| 607-015-00-7 | ethyl formate | 203-721-0 | 109-94-4 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3 | H225H332H302H319H335 | GHS02GHS07Dgr | H225H332H302H319H335 |
| 607-016-00-2 | propyl formate; [1]isopropyl formate [2] | 203-798-0 [1]210-901-2 [2] | 110-74-7 [1]625-55-8 [2] | Flam. Liq. 2Eye Irrit. 2STOT SE 3STOT SE 3 | H225H319H335H336 | GHS02GHS07Dgr | H225H319H335H336 | C |
| 607-017-00-8 | butyl formate; [1]tert-butyl formate; [2]isobutyl formate [3] | 209-772-5 [1]212-105-0 [2]208-818-1 [3] | 592-84-7 [1]762-75-4 [2]542-55-2 [3] | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H335 | GHS02GHS07Dgr | H225H319H335 | C |
| 607-018-00-3 | isopentyl formate; [1]2-methylbutyl formate [2] | 203-769-2 [1]252-343-2 [2] | 110-45-2 [1]35073-27-9 [2] | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H335 | GHS02GHS07Dgr | H225H319H335 | C |
| 607-019-00-9 | methyl chloroformate | 201-187-3 | 79-22-1 | Flam. Liq. 2Acute Tox. 2 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H225H330H312H302H314 | GHS02GHS06GHS05Dgr | H225H330H312H302H314 |
| 607-020-00-4 | ethyl chloroformate | 208-778-5 | 541-41-3 | Flam. Liq. 2Acute Tox. 2 (*)Acute Tox. 4 (*)Skin Corr. 1B | H225H330H302H314 | GHS02GHS06GHS05Dgr | H225H330H302H314 |
| 607-021-00-X | methyl acetate | 201-185-2 | 79-20-9 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 | EUH066 |
| 607-022-00-5 | ethyl acetate | 205-500-4 | 141-78-6 | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 | EUH066 |
| 607-023-00-0 | vinyl acetate | 203-545-4 | 108-05-4 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 | D |
| 607-024-00-6 | propyl acetate; [1]isopropyl acetate [2] | 203-686-1 [1]203-561-1 [2] | 109-60-4 [1]108-21-4 [2] | Flam. Liq. 2Eye Irrit. 2STOT SE 3 | H225H319H336 | GHS02GHS07Dgr | H225H319H336 | EUH066 | C |
| 607-025-00-1 | n-butyl acetate | 204-658-1 | 123-86-4 | Flam. Liq. 3STOT SE 3 | H226H336 | GHS02GHS07Wng | H226H336 | EUH066 |
| 607-026-00-7 | sec-butyl acetate; [1]isobutyl acetate; [2]tert-butyl acetate [3] | 203-300-1 [1]203-745-1 [2]208-760-7 [3] | 105-46-4 [1]110-19-0 [2]540-88-5 [3] | Flam. Liq. 2 | H225 | GHS02Dgr | H225 | EUH066 | C |
| 607-027-00-2 | methyl propionate | 209-060-4 | 554-12-1 | Flam. Liq. 2Acute Tox. 4 (*) | H225H332 | GHS02GHS07Dgr | H225H332 |
| 607-028-00-8 | ethyl propionate | 203-291-4 | 105-37-3 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 607-029-00-3 | n-butyl propionate; [1]sec-butyl propionate; [2]iso-butyl propionate [3] | 209-669-5 [1][2]208-746-0 [3] | 590-01-2 [1]591-34-4 [2]540-42-1 [3] | Flam. Liq. 3 | H226 | GHS02Wng | H226 | C |
| 607-030-00-9 | propyl propionate | 203-389-7 | 106-36-5 | Flam. Liq. 3Acute Tox. 4 (*) | H226H332 | GHS02GHS07Wng | H226H332 |
| 607-031-00-4 | butyl butyrate | 203-656-8 | 109-21-7 | Flam. Liq. 3 | H226 | GHS02Wng | H226 | C |
| 607-032-00-X | ethyl acrylate | 205-438-8 | 140-88-5 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H225H332H312H302H319H335H315H317 | GHS02GHS07Dgr | H225H332H312H302H319H335H315H317 | Skin Irrit. 2; H315: C ≥ 5 %Eye Irrit. 2; H319: C ≥ 5 %STOT SE 3; H335: C ≥ 5 % | D |
| 607-033-00-5 | n-butyl methacrylate | 202-615-1 | 97-88-1 | Flam. Liq. 3Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H226H319H335H315H317 | GHS02GHS07Wng | H226H319H335H315H317 | D |
| 607-034-00-0 | methyl acrylate;methyl propenoate | 202-500-6 | 96-33-3 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H225H332H312H302H319H335H315H317 | GHS02GHS07Dgr | H225H332H312H302H319H335H315H317 | D |
| 607-035-00-6 | methyl methacrylate;methyl 2-methylprop-2-enoate;methyl 2-methylpropenoate | 201-297-1 | 80-62-6 | Flam. Liq. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H225H335H315H317 | GHS02GHS07Dgr | H225H335H315H317 | D |
| 607-036-00-1 | 2-methoxyethyl acetate;methylglycol acetate | 203-772-9 | 110-49-6 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H360FDH332H312H302 | GHS08GHS07Dgr | H360FDH332H312H302 |
| 607-037-00-7 | 2-ethoxyethyl acetate;ethylglycol acetate | 203-839-2 | 111-15-9 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H360FDH332H312H302 | GHS08GHS07Dgr | H360FDH332H312H302 |
| 607-038-00-2 | 2-butoxyethyl acetate;butylglycol acetate | 203-933-3 | 112-07-2 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312 | GHS07Wng | H332H312 |
| 607-039-00-8 | 2,4-D (ISO);2,4-dichlorophenoxyacetic acid | 202-361-1 | 94-75-7 | Acute Tox. 4 (*)STOT SE 3Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H302H335H318H317H412 | GHS05GHS07Dgr | H302H335H318H317H412 |
| 607-040-00-3 | salts of 2,4-D | — | — | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 | A |
| 607-041-00-9 | 2,4,5-T (ISO);2,4,5-trichlorophenoxy acetic acid | 202-273-3 | 93-76-5 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H315H400H410 | GHS07GHS09Wng | H302H319H335H315H410 |
| 607-042-00-4 | salts and esters of 2,4,5-T;salts and esters of 2,4,5-trichlorophenoxy acetic acid | — | — | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H315H400H410 | GHS07GHS09Wng | H302H319H335H315H410 | A |
| 607-043-00-X | dicamba (ISO);2,5-dichloro-6-methoxybenzoic acid;3,6-dichloro-2-methoxybenzoic acid | 217-635-6 | 1918-00-9 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 607-044-00-5 | 3,6-dichloro-o-anisic acid, compound with dimethylamine (1:1); [1]potassium 3,6-dichloro-o-anisate [2] | 218-951-7 [1]233-002-7 [2] | 2300-66-5 [1]10007-85-9 [2] | Eye Irrit. 2Aquatic Chronic 3 | H319H412 | GHS07Wng | H319H412 |
| 607-045-00-0 | dichlorprop (ISO);2-(2,4-dichlorophenoxy) propionic acid | 204-390-5 | 120-36-5 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1 | H312H302H315H318 | GHS05GHS07Dgr | H312H302H315H318 |
| 607-046-00-6 | salts of dichlorprop | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 | A |
| 607-047-00-1 | fenoprop (ISO);2-(2,4,5-trichlorophenoxy)propionic acid | 202-271-2 | 93-72-1 | Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H315H400H410 | GHS07GHS09Wng | H302H315H410 |
| 607-048-00-7 | salts of fenoprop;salts of 2-(2,4,5-trichlorophenoxy)propionic acid | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | A |
| 607-049-00-2 | mecoprop (ISO);2-(4-chloro-o-tolyloxy) propionic acid;(RS)-2-(4-chloro-o-tolyloxy)propionic acid; [1]2-(4-chloro-2-methylphenoxy)propionic acid [2] | 230-386-8 [1]202-264-4 [2] | 7085-19-0 [1]708519-0 [2] | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H315H318H400H410 | GHS05GHS07GHS09Dgr | H302H315H318H410 | M=100 |
| 607-050-00-8 | salts of mecoprop | — | — | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H315H318H400H410 | GHS05GHS07GHS09Dgr | H302H315H318H410 | A |
| 607-051-00-3 | MCPA (ISO);4-chloro-o-tolyloxyacetic acid | 202-360-6 | 94-74-6 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1 | H302H315H318 | GHS05GHS07Dgr | H302H315H318 |
| 607-052-00-9 | salts and esters of MCPA | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 | A |
| 607-053-00-4 | MCPB (ISO);4-(4-chloro-o-tolyloxy) butyric acid | 202-365-3 | 94-81-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-054-00-X | salts and esters of MCPB | — | — | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 | A |
| 607-055-00-5 | endothal-sodium (ISO);disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate | 204-959-8 | 129-67-9 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H301H312H319H335H315 | GHS06Dgr | H301H312H319H335H315 |
| 607-056-00-0 | warfarin (ISO); [1](S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone; [2](R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] | 201-377-6 [1]226-907-3 [2]226-908-9 [3] | 81-81-2 [1]5543-57-7 [2]5543-58-8 [3] | Repr. 1ASTOT RE 1Aquatic Chronic 3 | H360D (*)(*)(*)H372 (*)(*)H412 | GHS08Dgr | H360D (*)(*)(*)H372 (*)(*)H412 |
| 607-057-00-6 | coumachlor (ISO);3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin | 201-378-1 | 81-82-3 | STOT RE 2 (*)Aquatic Chronic 3 | H373 (*)(*)H412 | GHS08Wng | H373 (*)(*)H412 |
| 607-058-00-1 | coumafuryl (ISO);fumarin;(RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin;4-hydroxy-3-[3-oxo-1-(2-furyl) butyl]coumarin | 204-195-5 | 117-52-2 | Acute Tox. 3 (*)STOT RE 1Aquatic Chronic 3 | H301H372 (*)(*)H412 | GHS06GHS08Dgr | H301H372 (*)(*)H412 |
| 607-059-00-7 | coumatetralyl;4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin | 227-424-0 | 5836-29-3 | Acute Tox. 1Acute Tox. 2 (*)STOT RE 1Aquatic Chronic 3 | H310H300H372 (*)(*)H412 | GHS06GHS08Dgr | H310H300H372 (*)(*)H412 |
| 607-060-00-2 | dicoumarol;4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) | 200-632-9 | 66-76-2 | STOT RE 1Acute Tox. 4 (*)Aquatic Chronic 2 | H372 (*)(*)H302H411 | GHS08GHS07GHS09Dgr | H372 (*)(*)H302H411 |
| 607-061-00-8 | acrylic acid;prop-2-enoic acid | 201-177-9 | 79-10-7 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1AAquatic Acute 1 | H226H332H312H302H314H400 | GHS02GHS05GHS07GHS09Dgr | H226H332H312H302H314H400 | STOT SE 3; H335: C ≥ 1 % | D |
| 607-062-00-3 | n-butyl acrylate | 205-480-7 | 141-32-2 | Flam. Liq. 3Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H226H319H335H315H317 | GHS02GHS07Wng | H226H319H335H315H317 | D |
| 607-063-00-9 | isobutyric acid | 201-195-7 | 79-31-2 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H312H302 | GHS07Wng | H312H302 |
| 607-064-00-4 | benzyl chloroformate | 207-925-0 | 501-53-1 | Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H314H400H410 | GHS05GHS09Dgr | H314H410 | STOT SE 3; H335: C ≥ 5 % |
| 607-065-00-X | bromoacetic acid | 201-175-8 | 79-08-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1AAquatic Acute 1 | H331H311H301H314H400 | GHS06GHS05GHS09Dgr | H331H311H301H314H400 |
| 607-066-00-5 | dichloroacetic acid | 201-207-0 | 79-43-6 | Skin Corr. 1AAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 |
| 607-067-00-0 | dichloroacetyl chloride | 201-199-9 | 79-36-7 | Skin Corr. 1AAquatic Acute 1 | H314H400 | GHS05GHS09Dgr | H314H400 |
| 607-068-00-6 | iodoacetic acid | 200-590-1 | 64-69-7 | Acute Tox. 3 (*)Skin Corr. 1A | H301H314 | GHS06GHS05Dgr | H301H314 |
| 607-069-00-1 | ethyl bromoacetate | 203-290-9 | 105-36-2 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*) | H330H310H300 | GHS06Dgr | H330H310H300 |
| 607-070-00-7 | ethyl chloroacetate | 203-294-0 | 105-39-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1 | H331H311H301H400 | GHS06GHS09Dgr | H331H311H301H400 |
| 607-071-00-2 | ethyl methacrylate | 202-597-5 | 97-63-2 | Flam. Liq. 2Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H225H319H335H315H317 | GHS02GHS07Dgr | H225H319H335H315H317 | D |
| 607-072-00-8 | 2-hydroxyethyl acrylate | 212-454-9 | 818-61-1 | Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1 | H311H314H317H400 | GHS06GHS05GHS09Dgr | H311H314H317H400 | (*)Skin Sens. 1; H317: C ≥ 0,2 % | D |
| 607-073-00-3 | 4-CPA (ISO);4-chlorophenoxyacetic acid | 204-581-3 | 122-88-3 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-074-00-9 | chlorfenac(ISO);2,3,6-trichlorophenylacetic acid | 201-599-3 | 85-34-7 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-075-00-4 | chlorfenprop-methyl;methyl 2-chloro-3-(4-chlorophenyl)propionate | 238-413-5 | 14437-17-3 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 607-076-00-X | dodine(ISO);dodecylguanidinium acetate | 219-459-5 | 2439-10-3 | Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H315H400H410 | GHS07GHS09Wng | H302H319H315H410 |
| 607-077-00-5 | erbon (ISO);2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate | — | 136-25-4 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-078-00-0 | fluenetil (ISO);2-fluoroethyl biphenyl-4-ylacetate | — | 4301-50-2 | Acute Tox. 1Acute Tox. 2 (*) | H310H300 | GHS06Dgr | H310H300 |
| 607-079-00-6 | kelevan (ISO);ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate;ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate | — | 4234-79-1 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H311H302H411 | GHS06GHS09Dgr | H311H302H411 |
| 607-080-00-1 | chloroacetyl chloride | 201-171-6 | 79-04-9 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Skin Corr. 1AAquatic Acute 1 | H331H311H301H372 (*)(*)H314H400 | GHS06GHS08GHS05GHS09Dgr | H331H311H301H372 (*)(*)H314H400 | EUH014EUH029 |
| 607-081-00-7 | fluoroacetic acid | 205-631-7 | 144-49-0 | Acute Tox. 2 (*)Aquatic Acute 1 | H300H400 | GHS06GHS09Dgr | H300H400 |
| 607-082-00-2 | fluoroacetates, soluble | — | — | Acute Tox. 2 (*)Aquatic Acute 1 | H300H400 | GHS06GHS09Dgr | H300H400 | A |
| 607-083-00-8 | 2,4-DB (ISO);4-(2,4-dichlorophenoxy)butyric acid | 202-366-9 | 94-82-6 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-084-00-3 | salts of 2,4-DB | — | — | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 | A |
| 607-085-00-9 | benzyl benzoate | 204-402-9 | 120-51-4 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-086-00-4 | diallyl phthalate | 205-016-3 | 131-17-9 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-088-00-5 | methacrylic acid;2-methylpropenoic acid | 201-204-4 | 79-41-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H312H302H314 | GHS05GHS07Dgr | H312H302H314 | STOT SE 3; H335: C ≥ 1 % | D |
| 607-089-00-0 | propionic acid ... % | 201-176-3 | 79-09-4 | Skin Corr. 1B | H314 | GHS05Dgr | H314 | Skin Corr. 1B; H314: C ≥ 25 %Skin Irrit. 2; H319: 10 % ≤ C < 25 %Eye Irrit. 2; H319: 10 % ≤ C < 25 %STOT SE 3; H335: C ≥ 10 % | B |
| 607-090-00-6 | thioglycolic acid | 200-677-4 | 68-11-1 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1B | H331H311H301H314 | GHS06GHS05Dgr | H331H311H301H314 | (*) |
| 607-091-00-1 | trifluoroacetic acid . . . % | 200-929-3 | 76-05-1 | Acute Tox. 4 (*) | H332 | GHS05 | H332 | * | B |
| Skin Corr. 1AAquatic Chronic 3 | H314H412 | GHS07Dgr | H314H412 |
| 607-092-00-7 | methyl lactate; [1]methyl (±)-lactate; [2]methyl (R)-lactate; [3]methyl (S)-(-)-lactate [4] | 208-930-0 [1]218-449-8 [2]241-420-6 [3]248-704-9 [4] | 547-64-8 [1]2155-30-8 [2]17392-83-5 [3]27871-49-4 [4] | Flam. Liq. 3Eye Irrit. 2STOT SE 3 | H226H319H335 | GHS02GHS07Wng | H226H319H335 | C |
| 607-093-00-2 | propionyl chloride | 201-170-0 | 79-03-8 | Flam. Liq. 2Skin Corr. 1B | H225H314 | GHS02GHS05Dgr | H225H314 | EUH014 | B D |
| 607-094-00-8 | peracetic acid . . . % | 201-186-8 | 79-21-0 | Flam. Liq. 3Org. Perox. D (*)(*)(*)(*)Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1AAquatic Acute 1 | H226H242H332H312H302H314H400 | GHS02GHS05GHS07GHS09Dgr | H226H242H332H312H302H314H400 | (*)STOT SE 3; H335: C ≥ 1 % | B D |
| 607-095-00-3 | maleic acid | 203-742-5 | 110-16-7 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H302H319H335H315 | GHS07Wng | H302H319H335H315 |
| 607-096-00-9 | maleic anhydride | 203-571-6 | 108-31-6 | Acute Tox. 4 (*)Skin Corr. 1BResp. Sens. 1Skin Sens. 1 | H302H314H334H317 | GHS08GHS05GHS07Dgr | H302H314H334H317 |
| 607-097-00-4 | benzene-1,2,4-tricarboxylic acid 1,2-anhydride;trimellitic anhydride | 209-008-0 | 552-30-7 | STOT SE 3Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H335H318H334H317 | GHS08GHS05GHS07Dgr | H335H318H334H317 |
| 607-098-00-X | benzene-1,2:4,5-tetracarboxylic dianhydride;benzene-1,2:4,5-tetracarboxylic dianhydride;pyromellitic dianhydride | 201-898-9 | 89-32-7 | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H318H334H317 | GHS08GHS05Dgr | H318H334H317 |
| 607-099-00-5 | 1,2,3,6-tetrahydrophthalic anhydride; [1]cis-1,2,3,6-tetrahydrophthalic anhydride; [2]3,4,5,6-tetrahydrophthalic anhydride; [3]tetrahydrophthalic anhydride [4] | 201-605-4 [1]213-308-7 [2]219-374-3 [3]247-570-9 [4] | 85-43-8 [1]935-79-5 [2]2426-02-0 [3]26266-63-7 [4] | Eye Dam. 1Resp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H318H334H317H412 | GHS08GHS05Dgr | H318H334H317H412 | C |
| 607-100-00-9 | benzophenone-3,3',4,4'-tetracarboxylic dianhydride;4,4'-carbonyldi(phthalic anhydride) | 219-348-1 | 2421-28-5 | Eye Irrit. 2STOT SE 3 | H319H335 | GHS07Wng | H319H335 | Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % |
| 607-101-00-4 | 1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylic anhydride chlorendic anhydride | 204-077-3 | 115-27-5 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | Skin Irrit. 2; H315: C ≥ 1 %Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % |
| 607-102-00-X | cyclohexane-1,2-dicarboxylic anhydride; [1]cis-cyclohexane-1,2-dicarboxylic anhydride; [2]trans-cyclohexane-1,2-dicarboxylic anhydride [3] | 201-604-9 [1]236-086-3 [2]238-009-9 [3] | 85-42-7 [1]13149-00-3 [2]14166-21-3 [3] | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H318H334H317 | GHS08GHS05Dgr | H318H334H317 | C |
| 607-103-00-5 | succinic anhydride | 203-570-0 | 108-30-5 | Eye Irrit. 2STOT SE 3 | H319H335 | GHS07Wng | H319H335 | Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % |
| 607-104-00-0 | cyclopentane-1,2,3,4-tetracarboxylic dianhydride | 227-964-7 | 6053-68-5 | Eye Irrit. 2STOT SE 3 | H319H335 | GHS07Wng | H319H335 | Eye Irrit. 2; H319: C ≥ 1 %STOT SE 3; H335: C ≥ 1 % |
| 607-105-00-6 | 8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride; [1]1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; [2](1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] | 204-957-7 [1]212-557-9 [2]220-384-5 [3] | 129-64-6 [1]826-62-0 [2]2746-19-2 [3] | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H318H334H317 | GHS08GHS05Dgr | H318H334H317 | C |
| 607-106-00-1 | 8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride | — | 123748-85-6 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H302H319H335H315H334 | GHS08GHS07Dgr | H302H319H335H315H334 | STOT SE 3; H335: C ≥ 10 % | C |
| 607-107-00-7 | 2-ethylhexyl acrylate | 203-080-7 | 103-11-7 | STOT SE 3Skin Irrit. 2Skin Sens. 1 | H335H315H317 | GHS07Wng | H335H315H317 | D |
| 607-108-00-2 | 2-hydroxy-1-methylethylacrylate; [1]2-hydroxypropylacrylate; [2]acrylic acid, monoester with propane-1,2-diol [3] | 220-852-9 [1]213-663-8 [2]247-118-0 [3] | 2918-23-2 [1]999-61-1 [2]25584-83-2 [3] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1 | H331H311H301H314H317 | GHS06GHS05Dgr | H331H311H301H314H317 | (*)Skin Sens. 1; H317: C ≥ 0,2 % | C D |
| 607-109-00-8 | hexamethylene diacrylate;hexane-1,6-diol diacrylate | 235-921-9 | 13048-33-4 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-110-00-3 | pentaerythritol triacrylate | 222-540-8 | 3524-68-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-111-00-9 | 2,2-bis(acryloyloxymethyl)butyl acrylate;trimethylolpropane triacrylate | 239-701-3 | 15625-89-5 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-112-00-4 | 2,2-dimethyltrimethylene diacrylate;neopentyl glycol diacrylate | 218-741-5 | 2223-82-7 | Acute Tox. 3 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H311H319H315H317 | GHS06Dgr | H311H319H315H317 | (*) | D |
| 607-113-00-X | isobutyl methacrylate | 202-613-0 | 97-86-9 | Flam. Liq. 3Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1 | H226H319H335H315H317H400 | GHS02GHS07GHS09Wng | H226H319H335H315H317H400 | D |
| 607-114-00-5 | ethylene dimethacrylate | 202-617-2 | 97-90-5 | STOT SE 3Skin Sens. 1 | H335H317 | GHS07Wng | H335H317 | STOT SE 3; H335: C ≥ 10 % | D |
| 607-115-00-0 | isobutyl acrylate | 203-417-8 | 106-63-8 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1 | H226H332H312H315H317 | GHS02GHS07Wng | H226H332H312H315H317 | D |
| 607-116-00-6 | cyclohexyl acrylate | 221-319-3 | 3066-71-5 | STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H335H315H411 | GHS07GHS09Wng | H335H315H411 | STOT SE 3; H335: C ≥ 10 % | D |
| 607-117-00-1 | 2,3-epoxypropyl acrylate;glycidyl acrylate | 203-440-3 | 106-90-1 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1 | H331H311H301H314H317 | GHS06GHS05Dgr | H331H311H301H314H317 | (*)Skin Sens. 1; H317: C ≥ 0,2 % | D |
| 607-118-00-7 | 1-methyltrimethylene diacrylate;1,3-butylene glycol diacrylate | 243-105-9 | 19485-03-1 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H312H314H317 | GHS05GHS07Dgr | H312H314H317 | D |
| 607-119-00-2 | tetramethylene diacrylate;1,4-butyleneglycol diacrylate | 213-979-6 | 1070-70-8 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H312H314H317 | GHS05GHS07Dgr | H312H314H317 | D |
| 607-120-00-8 | 2,2'-oxydiethyl diacrylate;diethylene glycol diacrylate | 223-791-6 | 4074-88-8 | Acute Tox. 3 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H311H319H315H317 | GHS06Dgr | H311H319H315H317 | (*)Skin Sens. 1; H317: C ≥ 0,2 % | D |
| 607-121-00-3 | 8,9,10-trinorborn-2-yl acrylate | — | 10027-06-2 | Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1 | H312H315H317 | GHS07Wng | H312H315H317 | D |
| 607-122-00-9 | pentaerythritol tetraacrylate | 225-644-1 | 4986-89-4 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-123-00-4 | 2,3-epoxypropyl methacrylate;glycidyl methacrylate | 203-441-9 | 106-91-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H332H312H302H319H315H317 | GHS07Wng | H332H312H302H319H315H317 | D |
| 607-124-00-X | 2-hydroxyethyl methacrylate | 212-782-2 | 868-77-9 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-125-00-5 | 2-hydroxypropyl methacrylate; [1]3-hydroxypropyl methacrylate [2] | 213-090-3 [1]220-426-2 [2] | 923-26-2 [1]2761-09-3 [2] | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 | C D |
| 607-126-00-0 | 2,2'-(ethylenedioxy)diethyl diacrylate;triethylene glycol diacrylate | 216-853-9 | 1680-21-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-127-00-6 | 2-diethylaminoethyl methacrylate | 203-275-7 | 105-16-8 | Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H332H319H315H317 | GHS07Wng | H332H319H315H317 | D |
| 607-128-00-1 | 2-tert-butylaminoethyl methacrylate | 223-228-4 | 3775-90-4 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 | D |
| 607-129-00-7 | ethyl lactate;ethyl DL-lactate; [1]ethyl (S)-2-hydroxypropionate;ethyl L-lactate;ethyl-(S)-lactate [2] | 202-598-0 [1]211-694-1 [2] | 97-64-3 [1]687-47-8 [2] | Flam. Liq. 3STOT SE 3Eye Dam. 1 | H226H335H318 | GHS02GHS05GHS07Dgr | H226H335H318 | C |
| 607-130-00-2 | pentyl acetate; [1]isopentyl acetate; [2]1-methylbutyl acetate; [3]2-methylbutyl acetat; [4]2(or 3)-methylbutyl acetate [5] | 211-047-3 [1]204-662-3 [2]210-946-8 [3]210-843-8 [4]282-263-3 [5] | 628-63-7 [1]123-92-2 [2]626-38-0 [3]624-41-9 [4]84145-37-9 [5] | Flam. Liq. 3 | H226 | GHS02Wng | H226 | EUH066 | C |
| 607-131-00-8 | isopentyl propionate; [1]pentyl propionate; [2]2-methylbutyl propionate [3] | 203-322-1 [1]210-852-7 [2]219-449-0 [3] | 105-68-0 [1]624-54-4 [2]2438-20-2 [3] | Flam. Liq. 3 | H226 | GHS02Wng | H226 | C |
| 607-132-00-3 | 2-dimethylaminoethyl methacrylate | 220-688-8 | 2867-47-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H312H302H319H315H317 | GHS07Wng | H312H302H319H315H317 | D |
| 607-133-00-9 | monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex | — | — | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H319H335H315H411 | GHS07GHS09Wng | H319H335H315H411 | STOT SE 3; H335: C ≥ 10 % | A |
| 607-134-00-4 | monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex | — | — | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | STOT SE 3; H335: C ≥ 10 % | A |
| 607-135-00-X | butyric acid | 203-532-3 | 107-92-6 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-136-00-5 | butyryl chloride | 205-498-5 | 141-75-3 | Flam. Liq. 2Skin Corr. 1B | H225H314 | GHS02GHS05Dgr | H225H314 |
| 607-137-00-0 | methyl acetoacetate | 203-299-8 | 105-45-3 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 607-138-00-6 | butyl chloroformate;chloroformic acid butyl ester | 209-750-5 | 592-34-7 | Flam. Liq. 3Acute Tox. 3 (*)Skin Corr. 1B | H226H331H314 | GHS02GHS06GHS05Dgr | H226H331H314 |
| 607-139-00-1 | 2-chloropropionic acid | 209-952-3 | 598-78-7 | Acute Tox. 4 (*)Skin Corr. 1A | H302H314 | GHS05GHS07Dgr | H302H314 |
| 607-140-00-7 | isobutyryl chloride | 201-194-1 | 79-30-1 | Flam. Liq. 2Skin Corr. 1A | H225H314 | GHS02GHS05Dgr | H225H314 |
| 607-141-00-2 | oxydiethylene bis(chloroformate) | 203-430-9 | 106-75-2 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H302H315H318H411 | GHS05GHS07GHS09Dgr | H302H315H318H411 |
| 607-142-00-8 | propyl chloroformate;chloroformic acid propylester;n-propyl chloroformate | 203-687-7 | 109-61-5 | Flam. Liq. 2Acute Tox. 3 (*)Skin Corr. 1B | H225H331H314 | GHS02GHS06GHS05Dgr | H225H331H314 |
| 607-143-00-3 | valeric acid | 203-677-2 | 109-52-4 | Skin Corr. 1BAquatic Chronic 3 | H314H412 | GHS05Dgr | H314H412 |
| 607-144-00-9 | adipic acid | 204-673-3 | 124-04-9 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 607-145-00-4 | methanesulphonic acid | 200-898-6 | 75-75-2 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-146-00-X | fumaric acid | 203-743-0 | 110-17-8 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 607-147-00-5 | oxalic acid diethylester;diethyl oxalate | 202-464-1 | 95-92-1 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 607-148-00-0 | guanidinium chloride;guanadine hydrochloride | 200-002-3 | 50-01-1 | Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2 | H302H319H315 | GHS07Wng | H302H319H315 |
| 607-149-00-6 | urethane (INN);ethyl carbamate | 200-123-1 | 51-79-6 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 607-150-00-1 | endothal (ISO);7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid | 205-660-5 | 145-73-3 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H301H312H319H335H315 | GHS06Dgr | H301H312H319H335H315 |
| 607-151-00-7 | propargite (ISO);2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite | 219-006-1 | 2312-35-8 | Carc. 2Acute Tox. 3 (*)Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H351H331H315H318H400H410 | GHS06GHS08GHS05GHS09Dgr | H351H331H315H318H410 | M=10 |
| 607-152-00-2 | 2,3,6-TBA (ISO);2,3,6-trichlorobenzoic acid | 200-026-4 | 50-31-7 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-153-00-8 | benazolin (ISO);4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid | 223-297-0 | 3813-05-6 | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H319H315H412 | GHS07Wng | H319H315H412 |
| 607-154-00-3 | ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate;benzoylprop-ethyl (ISO) | 244-845-5 | 22212-55-1 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-155-00-9 | 3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid;blasticidin-s | — | 2079-00-7 | Acute Tox. 2 (*) | H300 | GHS06Dgr | H300 |
| 607-156-00-4 | chlorfenson (ISO);4-chlorophenyl 4-chlorobenzenesulfonate | 201-270-4 | 80-33-1 | Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H315H400H410 | GHS07GHS09Wng | H302H315H410 |
| 607-157-00-X | 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin;difenacoum | 259-978-4 | 56073-07-5 | Acute Tox. 2 (*)STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H300H372 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H300H372 (*)(*)H410 |
| 607-158-00-5 | sodium salt of chloroacetic acid;sodium chloroacetate | 223-498-3 | 3926-62-3 | Acute Tox. 3 (*)Skin Irrit. 2Aquatic Acute 1 | H301H315H400 | GHS06GHS09Dgr | H301H315H400 |
| 607-159-00-0 | chlorobenzilate (ISO);ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate;ethyl 4,4'-dichlorobenzilate | 208-110-2 | 510-15-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-160-00-6 | isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate;clofop-isobutyl (ISO) | — | 51337-71-4 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-161-00-1 | diethanolamine salt of 4-CPA | — | — | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-162-00-7 | 2,2-dichloropropionic acid;dalapon | 200-923-0 | 75-99-0 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H302H315H318H412 | GHS05GHS07Dgr | H302H315H318H412 |
| 607-163-00-2 | 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione;dehydracetic acid | 208-293-9 | 520-45-6 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-164-00-8 | sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate;sodium dehydracetate | 224-580-1 | 4418-26-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-165-00-3 | diclofop-methyl (ISO)methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate;methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate; | 257-141-8 | 51338-27-3 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 607-166-00-9 | medinoterb acetate (ISO);6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate | 219-634-6 | 2487-01-6 | Acute Tox. 3 (*)Acute Tox. 4 (*) | H301H312 | GHS06Dgr | H301H312 |
| 607-167-00-4 | sodium 3-chloroacrylate | — | 4312-97-4 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H312H302 | GHS07Wng | H312H302 |
| 607-168-00-X | dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate;propylisome | — | 83-59-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H311H302H400H410 | GHS06GHS09Dgr | H311H302H410 |
| 607-169-00-5 | sodium fluoroacetate | 200-548-2 | 62-74-8 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Aquatic Acute 1 | H330H310H300H400 | GHS06GHS09Dgr | H330H310H300H400 |
| 607-170-00-0 | bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate;thiocyclam-oxalate | 250-859-2 | 31895-22-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 607-172-00-1 | 4-hydroxy-3-(3-(4'-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin;brodifacoum | 259-980-5 | 56073-10-0 | Acute Tox. 1Acute Tox. 2 (*)STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H310H300H372 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H310H300H372 (*)(*)H410 |
| 607-173-00-7 | dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate | 400-460-6 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-174-00-2 | reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate | 400-580-9 | — | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 607-175-00-8 | methyl 2-(2-nitrobenzylidene)acetoacetate | 400-650-9 | 39562-27-1 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-176-00-3 | reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) | 400-830-7 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-177-00-9 | methyl 2-(3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)3-methylureidosulphonyl)benzoate | 401-190-1 | 101200-48-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-178-00-4 | methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate | 401-340-6 | 83055-99-6 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-179-00-X | (benzothiazol-2-ylthio)succinic acid | 401-450-4 | 95154-01-1 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-180-00-5 | potassium 2-hydroxycarbazole-1-carboxylate | 401-630-2 | 96566-70-0 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Aquatic Chronic 3 | H302H319H335H412 | GHS07Wng | H302H319H335H412 |
| 607-181-00-0 | 3,5-dichloro-2,4-difluorobenzoyl fluoride | 401-800-6 | 101513-70-6 | Acute Tox. 3 (*)Skin Corr. 1BAcute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 3 | H331H314H302H317H412 | GHS06GHS05Dgr | H331H314H302H317H412 | EUH029 |
| 607-182-00-6 | methyl 3-sulphamoyl-2-thenoate | 402-050-2 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-183-00-1 | zinc 2-hydroxy-5-C13-18alkylbenzoate | 402-280-3 | — | Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H319H315H411 | GHS07GHS09Wng | H319H315H411 |
| 607-184-00-7 | S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate | 402-290-8 | 85702-90-5 | Flam. Liq. 3Resp. Sens. 1Skin Sens. 1 | H226H334H317 | GHS02GHS08Dgr | H226H334H317 |
| 607-185-00-2 | ethyl trans-3-dimethylaminoacrylate | 402-650-4 | 1117-37-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-186-00-8 | quinclorac (ISO);3,7-dichloroquinoline-8-carboxylic acid | 402-780-1 | 84087-01-4 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-187-00-3 | bis(2,2,6,6-tetramethyl-4-piperidyl) succinate | 402-940-0 | 62782-03-0 | Eye Irrit. 2Aquatic Chronic 3 | H319H412 | GHS07Wng | H319H412 |
| 607-188-00-9 | hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate | 402-970-4 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-189-00-4 | trimethylenediaminetetraacetic acid | 400-400-9 | 1939-36-2 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H318H400H410 | GHS05GHS07GHS09Dgr | H302H318H410 |
| 607-190-00-X | methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) | 401-890-7 | 77402-03-0 | Carc. 1BMuta. 1BAcute Tox. 4 (*)Eye Irrit. 2 | H350H340H302H319 | GHS08GHS07Dgr | H350H340H302H319 |
| 607-191-00-5 | isobutyl 3,4-epoxybutyrate | 401-920-9 | 100181-71-3 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 607-192-00-0 | disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate | 402-360-8 | 92511-22-3 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-194-00-1 | propylene carbonate | 203-572-1 | 108-32-7 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 607-195-00-7 | 2-methoxy-1-methylethyl acetate | 203-603-9 | 108-65-6 | Flam. Liq. 3Eye Irrit. 2 | H226H319 | GHS02GHS07Wng | H226H319 |
| 607-196-00-2 | heptanoic acid | 203-838-7 | 111-14-8 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-197-00-8 | nonanoic acid | 203-931-2 | 112-05-0 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-198-00-3 | propyl 3,4,5-trihydroxybenzoate | 204-498-2 | 121-79-9 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 607-199-00-9 | octyl 3,4,5-trihydroxybenzoate | 213-853-0 | 1034-01-1 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 607-200-00-2 | dodecyl 3,4,5-trihydroxybenzoate | 214-620-6 | 1166-52-5 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-201-00-8 | thiocarbonyl chloride | 207-341-6 | 463-71-8 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H331H302H319H335H315 | GHS06Dgr | H331H302H319H335H315 |
| 607-203-00-9 | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | 279-452-8 | 80387-97-9 | Repr. 1BSkin Sens. 1Aquatic Chronic 3 | H360D (*)(*)(*)H317H412 | GHS08GHS07Dgr | H360D (*)(*)(*)H317H412 |
| 607-204-00-4 | (chlorophenyl)(chlorotolyl)methane, mixed isomers | 400-140-6 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-205-00-X | methyl chloroacetate | 202-501-1 | 96-34-4 | Flam. Liq. 3Acute Tox. 3 (*)Acute Tox. 3 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1 | H226H331H301H335H315H318 | GHS02GHS06GHS05Dgr | H226H331H301H335H315H318 |
| 607-206-00-5 | isopropyl chloroacetate | 203-301-7 | 105-48-6 | Flam. Liq. 3Acute Tox. 3 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H226H301H319H335H315 | GHS02GHS06Dgr | H226H301H319H335H315 |
| 607-207-00-0 | haloxyfop-etotyl (ISO);2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate;haloxyfop-(2-ethoxyethyl) | 402-560-5 | 87237-48-7 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-208-00-6 | 4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers | 403-000-2 | 91853-67-7 | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 607-209-00-1 | reaction mass of O,O'-diisopropyl (pentathio)dithioformate and O,O'-diisopropyl (trithio)dithioformate and O,O'-diisopropyl (tetrathio)dithioformate | 403-030-6 | — | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 607-210-00-7 | methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) | 403-230-3 | 77402-05-2 | Carc. 1BMuta. 1BSkin Corr. 1BSkin Sens. 1 | H350H340H314H317 | GHS08GHS05GHS07Dgr | H350H340H314H317 |
| 607-211-00-2 | methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate | 403-270-1 | 6386-39-6 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-212-00-8 | poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate | 403-300-3 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-213-00-3 | ethyl 3,3-bis(tert-pentylperoxy)butyrate | 403-320-2 | 67567-23-1 | Org. Perox. D (*)(*)(*)(*)Flam. Liq. 3Aquatic Chronic 2 | H242H226H411 | GHS02GHS09Dgr | H242H226H411 |
| 607-214-00-9 | N,N-hydrazinodiacetic acid | 403-510-5 | 19247-05-3 | Acute Tox. 3 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 3 | H301H373 (*)(*)H317H412 | GHS06GHS08Dgr | H301H373 (*)(*)H317H412 |
| 607-215-00-4 | 3-(3-tert-butyl-4-hydroxyphenyl)propionic acid | 403-920-4 | 107551-67-7 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 607-216-00-X | glutamic acid, reaction products with N-(C12-14alkyl)propylenediamine | 403-950-8 | — | Acute Tox. 2 (*)Acute Tox. 4 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H330H302H314H400H410 | GHS06GHS05GHS09Dgr | H330H302H314H410 |
| 607-217-00-5 | 2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate | 403-960-2 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 607-218-00-0 | dichlorprop-P (ISO);(+)-R-2-(2,4-dichlorophenoxy)propionic acid | 403-980-1 | 15165-67-0 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H302H315H318H317 | GHS05GHS07Dgr | H302H315H318H317 |
| 607-219-00-6 | bis(2-ethylhexyl) dithiodiacetate | 404-510-8 | 62268-47-7 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 607-221-00-7 | 6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid | 404-550-6 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 607-222-00-2 | 6-(2,3-dimethylmaleimido)hexyl methacrylate | 404-870-6 | 63740-41-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-223-00-8 | transfluthrin (ISO);2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate | 405-060-5 | 118712-89-3 | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 607-224-00-3 | methyl 2-(3-nitrobenzylidene)acetoacetate | 405-270-7 | 39562-17-9 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 607-225-00-9 | 3-azidosulfonylbenzoic acid | 405-310-3 | 15980-11-7 | Self-React. C (*)(*)(*)(*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1 | H241H373 (*)(*)H318H317 | GHS02GHS08GHS05GHS07Dgr | H241H373 (*)(*)H318H317 |
| 607-226-00-4 | reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate | 405-360-6 | — | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H315H318H317H412 | GHS05GHS07Dgr | H315H318H317H412 |
| 607-227-00-X | potassium 2-amino-2-methylpropionate octahydrate | 405-560-3 | 120447-91-8 | Acute Tox. 4 (*)Skin Corr. 1A | H302H314 | GHS05GHS07Dgr | H302H314 |
| 607-228-00-5 | bis(2-methoxyethyl) phthalate | 204-212-6 | 117-82-8 | Repr. 1B | H360Df | GHS08Dgr | H360Df |
| 607-229-00-0 | diethylcarbamoyl chloride | 201-798-5 | 88-10-8 | Carc. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H351H332H302H319H335H315 | GHS08GHS07Wng | H351H332H302H319H335H315 |
| 607-230-00-6 | 2-ethylhexanoic acid | 205-743-6 | 149-57-5 | Repr. 2 | H361d (*)(*)(*) | GHS08Wng | H361d (*)(*)(*) |
| 607-231-00-1 | 3,6-dichloropyridine-2-carboxylic acid;clopyralid | 216-935-4 | 1702-17-6 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 607-232-00-7 | pyridate (ISO);O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate | 259-686-7 | 55512-33-9 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 607-233-00-2 | hexyl acrylate | 219-698-5 | 2499-95-8 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H335H315H317H411 | GHS07GHS09Wng | H319H335H315H317H411 |
| 607-234-00-8 | flurenol (ISO);9-hydroxy-9H-fluorene-9-carboxylic acid | 207-397-1 | 467-69-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-235-00-3 | mecrilate;methyl 2-cyanoacrylate | 205-275-2 | 137-05-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | STOT SE 3; H335: C ≥ 10 % |
| 607-236-00-9 | ethyl 2-cyanoacrylate | 230-391-5 | 7085-85-0 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 | STOT SE 3; H335: C ≥ 10 % |
| 607-237-00-4 | benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate;flurazole | 276-942-3 | 72850-64-7 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-238-00-X | tau-fluvalinate (ISO);cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate | — | 102851-06-9 | Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H315H400H410 | GHS07GHS09Wng | H302H315H410 |
| 607-239-00-5 | fenpropathrin (ISO);α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate | 254-485-0 | 39515-41-8 | Acute Tox. 2 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H301H312H400H410 | GHS06GHS09Dgr | H330H301H312H410 |
| 607-240-00-0 | cis-1,2,3,6-tetrahydro-4-methylphthalic anhydride; [1]1,2,3,6-tetrahydro-4-methylphthalic anhydride; [2]1,2,3,6-tetrahydro-3-methylphthalic anhydride; [3]tetrahydromethylphthalic anhydride; [4]1,2,3,6-tetrahydromethylphthalic anhydride; [5]tetrahydro-4-methylphthalic anhydride; [6]2,3,5,6-tetrahydro-2-methylphthalic anhydride [7] | 216-906-6 [1]222-323-8 [2]226-247-6 [3]234-290-7 [4]247-830-1 [5]251-823-9 [6]255-853-3 [7] | 1694-82-2 [1]3425-89-6 [2]5333-84-6 [3]11070-44-3 [4]26590-20-5 [5]34090-76-1 [6]42498-58-8 [7] | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H318H334H317 | GHS08GHS05Dgr | H318H334H317 | C |
| 607-241-00-6 | hexahydro-4-methylphthalic anhydride; [1]hexahydromethylphthalic anhydride; [2]hexahydro-1-methylphthalic anhydride; [3]hexahydro-3-methylphthalic anhydride [4] | 243-072-0 [1]247-094-1 [2]256-356-4 [3]260-566-1 [4] | 19438-60-9 [1]25550-51-0 [2]48122-14-1 [3]57110-29-9 [4] | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H318H334H317 | GHS08GHS05Dgr | H318H334H317 | C |
| 607-242-00-1 | tetrachlorophthalic anhydride | 204-171-4 | 117-08-8 | Eye Dam. 1Resp. Sens. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H318H334H317H400H410 | GHS08GHS05GHS09Dgr | H318H334H317H410 |
| 607-243-00-7 | sodium 3,6-dichloro-o-anisate; [1]3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1); [2]3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] | 217-846-3 [1]246-590-5 [2]258-527-9 [3] | 1982-69-0 [1]25059-78-3 [2]53404-28-7 [3] | Aquatic Chronic 3 | H412 | — | H412 |
| 607-244-00-2 | isooctyl acrylate | 249-707-8 | 29590-42-9 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H400H410 | GHS07GHS09Wng | H319H335H315H410 | STOT SE 3; H335: C ≥ 10 % |
| 607-245-00-8 | tert-butyl acrylate | 216-768-7 | 1663-39-4 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H225H332H312H302H335H315H317H412 | GHS02GHS07Dgr | H225H332H312H302H335H315H317H412 | D |
| 607-246-00-3 | allyl methacrylate;2-methyl-2-propenoic acid 2-propenyl ester | 202-473-0 | 96-05-9 | Flam. Liq. 3Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1 | H226H331H312H302H400 | GHS02GHS06GHS09Dgr | H226H331H312H302H400 |
| 607-247-00-9 | dodecyl methacrylate | 205-570-6 | 142-90-5 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H335H315H400H410 | GHS07GHS09Wng | H319H335H315H410 | STOT SE 3; H335: C ≥ 10 % |
| 607-248-00-4 | naptalam-sodium (ISO);sodium N-naphth-1-ylphthalamate | 205-073-4 | 132-67-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-249-00-X | (1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate | 256-032-2 | 42978-66-5 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H335H315H317H411 | GHS07GHS09Wng | H319H335H315H317H411 | STOT SE 3; H335: C ≥ 10 % |
| 607-250-00-5 | 4H-3,1-benzoxazine-2,4(1H)-dione | 204-255-0 | 118-48-9 | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 607-251-00-0 | 2-methoxypropyl acetate | 274-724-2 | 70657-70-4 | Flam. Liq. 3Repr. 1BSTOT SE 3 | H226H360D (*)(*)(*)H335 | GHS02GHS08GHS07Dgr | H226H360D (*)(*)(*)H335 |
| 607-252-00-6 | lambda-cyhalothrin (ISO);reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate (1:1) | 415-130-7 | 91465-08-6 | Acute Tox. 2 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H301H312H400H410 | GHS06GHS09Dgr | H330H301H312H410 |
| 607-253-00-1 | α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate;cyfluthrin | 269-855-7 | 68359-37-5 | Acute Tox. 2 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H300H331H400H410 | GHS06GHS09Dgr | H300H331H410 |
| 607-254-00-7 | α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate;beta-cyfluthrin | 269-855-7 | 68359-37-5 | Acute Tox. 2 (*)Acute Tox. 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H300H400H410 | GHS06GHS09Dgr | H330H300H410 |
| 607-255-00-2 | fluroxypyr (ISO);4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid | — | 69377-81-7 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-256-00-8 | azoxystrobin (ISO);methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylate | — | 131860-33-8 | Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H400H410 | GHS06GHS09Dgr | H331H410 |
| 607-257-00-3 | isopropyl propionate | 211-300-8 | 637-78-5 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 |
| 607-258-00-9 | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate | 403-990-6 | 70950-45-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-259-00-4 | methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate | 404-130-2 | 105560-93-8 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 607-260-00-X | ethyl 2-(3-nitrobenzylidene)acetoacetate | 404-490-0 | 39562-16-8 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 607-261-00-5 | iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate | 404-800-4 | 118832-72-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-262-00-0 | 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 405-050-0 | 86393-33-1 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 607-263-00-6 | potassium iron(III) 1,3-propanediamine-N,N,N',N'-tetraacetate hemihydrate | 405-680-6 | — | Self-heat. 2 (*)(*)(*)(*)Aquatic Chronic 2 | H252H411 | GHS02GHS09Wng | H252H411 |
| 607-264-00-1 | 2-chloro-4-(methylsulfonyl)benzoic acid | 406-520-8 | 53250-83-2 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-265-00-7 | ethyl-2-chloro-2,2-diphenylacetate | 406-580-5 | 52460-86-3 | Skin Irrit. 2Aquatic Chronic 3 | H315H412 | GHS07Wng | H315H412 |
| 607-266-00-2 | reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate];3,5-di-tert-butyl-salicylic acid | 406-890-0 | 130296-87-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-267-00-8 | tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate | 407-620-4 | 33610-13-8 | Resp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H334H317H412 | GHS08Dgr | H334H317H412 |
| 607-268-00-3 | 2-methylpropyl (R)-2-hydroxypropanoate | 407-770-0 | 61597-96-4 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 607-269-00-9 | (R)-2-(4-hydroxyphenoxy)propanoic acid | 407-960-3 | 94050-90-5 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-270-00-4 | 3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecane | 410-730-5 | 90498-90-1 | Acute Tox. 4 (*) | H312 | GHS07Wng | H312 |
| 607-271-00-X | 2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane | 417-420-9 | 156324-82-2 | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 607-272-00-5 | fluroxypyr-meptyl (ISO);methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate; [1]fluroxypyr-butometyl (ISO);2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] | 279-752-9 [1][2] | 81406-37-3 [1]154486-27-8 [2] | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-273-00-0 | ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate | 404-520-2 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 607-274-00-6 | 2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate | 405-350-1 | 54527-73-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-275-00-1 | sodium benzoyloxybenzene-4-sulfonate | 405-450-5 | 66531-87-1 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-276-00-7 | bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex | 405-635-0 | — | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 607-277-00-2 | reaction mass of: 2-(hexylthio)ethylamine hydrochloride;sodium propionate | 405-720-2 | — | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 607-278-00-8 | reaction mass of isomers of: sodium phenethylnaphthalenesulfonate;sodium naphthylethylbenzenesulfonate | 405-760-0 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 607-279-00-3 | reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate);n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate | 405-960-8 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-280-00-9 | sodium 4-chloro-1-hydroxybutane-1-sulfonate | 406-190-5 | 54322-20-2 | Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1 | H302H319H317 | GHS07Wng | H302H319H317 |
| 607-281-00-4 | reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates | 407-000-3 | 127519-17-9 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-282-00-X | 2-acetoxymethyl-4-benzyloxybut-1-yl acetate | 407-140-5 | 131266-10-9 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-283-00-5 | E-ethyl-4-oxo-4-phenylcrotonate | 408-040-4 | 15121-89-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H312H302H315H318H317H410 |
| 607-284-00-0 | reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate);lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triphenodioxazinedisulfonate (9:1) | 410-040-4 | 136213-76-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-285-00-6 | reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid;sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate;potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate | 410-065-0 | — | Skin Sens. 1 | H317 | GHS07Wng |
| 607-286-00-1 | reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate | 410-070-8 | 141880-36-6 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-287-00-7 | O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate | 410-140-8 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 607-288-00-2 | tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a,b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively | 410-160-7 | 148732-74-5 | Eye Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H319H317H412 | GHS07Wng | H319H317H412 |
| 607-289-00-8 | 3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid | 410-370-9 | 105488-33-3 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-290-00-3 | reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate;ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate | 410-540-2 | — | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 607-291-00-9 | dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate | 410-630-1 | 104051-92-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-292-00-4 | reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid;[1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid | 410-640-6 | — | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 607-293-00-X | reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate;N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate | 410-650-0 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 607-294-00-5 | sodium 2-benzoyloxy-1-hydroxyethane-sulfonate | 410-680-4 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-295-00-0 | reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate;hexasodium phosphonobutane-1,2,3,4-tetracarboxylate | 410-800-5 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-296-00-6 | reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid | 410-830-9 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-297-00-1 | (E—E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) | 410-960-6 | 92761-26-7 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-298-00-7 | 2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate | 411-010-3 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-299-00-2 | methyl 3-(acetylthio)-2-methyl-propanoate | 411-040-7 | 97101-46-7 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 607-300-00-6 | trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprate(II) where a=1,2,3,4 b=8,9,10,11 c=15,16,17,18 d=22,23,24,25 | 411-430-7 | — | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 607-301-00-1 | reaction mass of: dodecanoic acid;poly(1-7)lactate esters of dodecanoic acid | 411-860-5 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-302-00-7 | reaction mass of: tetradecanoic acid;poly(1-7)lactate esters of tetradecanoic acid | 411-910-6 | — | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H315H318H317H411 | GHS05GHS07GHS09Dgr | H315H318H317H411 |
| 607-303-00-2 | 1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 413-760-7 | 93107-30-3 | Repr. 2Aquatic Chronic 3 | H361f (*)(*)(*)H412 | GHS08Wng | H361f (*)(*)(*)H412 |
| 607-304-00-8 | fluazifop-butyl (ISO);butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | 274-125-6 | 69806-50-4 | Repr. 1BAquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H400H410 | GHS08GHS09Dgr | H360D (*)(*)(*)H410 |
| 607-305-00-3 | fluazifop-P-butyl (ISO);butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | — | 79241-46-6 | Repr. 2Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H400H410 | GHS08GHS09Wng | H361d (*)(*)(*)H410 |
| 607-306-00-9 | chlozolinate (ISO);ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate | 282-714-4 | 84332-86-5 | Carc. 2Aquatic Chronic 2 | H351H411 | GHS08GHS09Wng | H351H411 |
| 607-307-00-4 | vinclozolin (ISO);N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione | 256-599-6 | 50471-44-8 | Carc. 2Repr. 1BSkin Sens. 1Aquatic Chronic 2 | H351H360FDH317H411 | GHS08GHS07GHS09Dgr | H351H360FDH317H411 |
| 607-308-00-X | esters of 2,4-D | — | — | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 | A |
| 607-309-00-5 | carfentrazone-ethyl (ISO);ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate | — | 128639-02-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-310-00-0 | kresoxim-methyl (ISO);methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate | — | 143390-89-0 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 607-311-00-6 | benazolin-ethyl;ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate | 246-591-0 | 25059-80-7 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-312-00-1 | methoxyacetic acid | 210-894-6 | 625-45-6 | Repr. 1BAcute Tox. 4 (*)Skin Corr. 1B | H360FDH302H314 | GHS08GHS05GHS07Dgr | H360FDH302H314 | STOT SE 3; H335: C ≥ 5 % |
| 607-313-00-7 | neodecanoyl chloride | 254-875-0 | 40292-82-8 | Acute Tox. 2 (*)Acute Tox. 4 (*)Skin Corr. 1B | H330H302H314 | GHS06GHS06Dgr | H330H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 607-314-00-2 | ethofumesate (ISO);(±)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | 247-525-3 | 26225-79-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-315-00-8 | glyphosate (ISO);N-(phosphonomethyl)glycine | 213-997-4 | 1071-83-6 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 607-316-00-3 | glyphosate-trimesium;glyphosate-trimethylsulfonium | — | 81591-81-3 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07 GHS09Wng | H302H411 |
| 607-317-00-9 | bis(2-ethylhexyl) phthalate;di-(2-ethylhexyl) phthalate;DEHP | 204-211-0 | 117-81-7 | Repr. 1B | H360FD | GHS08Dgr | H360FD |
| 607-318-00-4 | dibutyl phthalate;DBP | 201-557-4 | 84-74-2 | Repr. 1BAquatic Acute 1 | H360DfH400 | GHS08GHS09Dgr | H360DfH400 |
| 607-319-00-X | deltamethrin (ISO);(S)-α-cyano-3-phenoxybenzyl (1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate | 258-256-6 | 52918-63-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 |
| 607-320-00-5 | bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate | 413-930-0 | 130066-57-8 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 607-321-00-0 | (S)-methyl-2-chloropropionate | 412-470-8 | 73246-45-4 | Flam. Liq. 3STOT RE 2 (*)Eye Irrit. 2 | H226H373 (*)(*)H319 | GHS02GHS08Wng | H226H373 (*)(*)H319 |
| 607-322-00-6 | 4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid | 413-120-7 | 107144-30-9 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-323-00-1 | 2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate | 413-850-6 | 123968-25-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-324-00-7 | reaction mass of: N,N-di(hydrogenated alkyl C14-C18)phtalamic acid;dihydrogenated alkyl (C14-C18)amine | 413-800-3 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-325-00-2 | (S)-2-chloropropionic acid | 411-150-5 | 29617-66-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 607-326-00-8 | reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate;isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate | 410-720-0 | 141847-13-4 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 607-327-00-3 | 2-(2-iodoethyl)-1,3-propanediol diacetate | 411-780-0 | 127047-77-2 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-328-00-9 | methyl 4-bromomethyl-3-methoxybenzoate | 410-310-1 | 70264-94-7 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H315H318H317H410 |
| 607-329-00-4 | reaction mass of: sodium 2-(C12-18—n-alkyl)amino-1,4-butandioate;sodium 2-octadecenyl-amino-1,4-butandioate | 411-250-9 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-330-00-X | (S)-2,3-dihydro-1H-indole-2-carboxylic acid | 410-860-2 | 79815-20-6 | Repr. 2STOT RE 2 (*)Skin Sens. 1 | H361f (*)(*)(*)H373 (*)(*)H317 | GHS08GHS07Wng | H361f (*)(*)(*)H373 (*)(*)H317 |
| 607-331-00-5 | reaction mass of: bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decanedioate;1,8-bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]octane | 406-750-9 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-332-00-0 | cyclopentyl chloroformate | 411-460-0 | 50715-28-1 | Flam. Liq. 3Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1 | H226H331H302H373 (*)(*)H318H317 | GHS02GHS06GHS08GHS05Dgr | H226H331H302H373 (*)(*)H318H317 |
| 607-333-00-6 | reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate;tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate | 405-670-1 | — | Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H302H373 (*)(*)H314H400H410 | GHS08GHS05GHS07GHS09Dgr | H302H373 (*)(*)H314H410 |
| 607-334-00-1 | ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate | 405-880-3 | 100501-62-0 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-335-00-7 | methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate | 406-250-0 | 72619-32-0 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 607-336-00-2 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate | 406-560-6 | 122760-85-4 | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H315H317H411 | GHS07GHS09Wng | H315H317H411 |
| 607-337-00-8 | di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate | 406-052-4 | 125078-60-6 | Flam. Liq. 3Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H226H302H315H318H411 | GHS02GHS05GHS07GHS09Dgr | H226H302H315H318H411 |
| 607-338-00-3 | 2-methylpropyl 2-hydroxy-2-methylbut-3-enoate | 406-235-9 | 72531-53-4 | Eye Irrit. 2Skin Irrit. 2 | H319H315 | GHS07Wng | H319H315 |
| 607-339-00-9 | 2,3,4,5-tetrachlorobenzoylchloride | 406-760-3 | 42221-52-3 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H302H314H317 | GHS05GHS07Dgr | H302H314H317 |
| 607-340-00-4 | 1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate | 406-990-4 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-341-00-X | (9S)-9-amino-9-deoxyerythromycin | 406-790-7 | 26116-56-3 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 607-342-00-5 | 4-chlorobutyl veratrate | 410-950-1 | 69788-75-6 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-343-00-0 | 4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) | 407-410-2 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-344-00-6 | reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid;N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate;3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propionate | 407-810-7 | — | STOT RE 2 (*) | H373 (*)(*) | GHS08Wng | H373 (*)(*) |
| 607-345-00-1 | potassium 2-(2,4-dichlorophenoxy)-(R)-propionate | 413-580-9 | 113963-87-4 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H302H315H318H317 | GHS05GHS07Dgr | H302H315H318H317 |
| 607-346-00-7 | 3-icosyl-4-henicosylidene-2-oxetanone | 401-210-9 | 83708-14-9 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-347-00-2 | sodium (R)-2-(2,4-dichlorophenoxy)propionate | 413-340-3 | 119299-10-4 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H302H315H318H317 | GHS05GHS07Dgr | H302H315H318H317 |
| 607-348-00-8 | magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) | 413-360-2 | — | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H302H315H318H317 | GHS05GHS07Dgr | H302H315H318H317 |
| 607-349-00-3 | mono-(tetrapropylammonium) hydrogen 2,2'-dithiobisbenzoate | 411-270-8 | — | Aquatic Chronic 3 | H412 | H412 |
| 607-350-00-9 | bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane | 412-060-9 | 136210-32-7 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-351-00-4 | methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate | 407-550-4 | 69184-17-4 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-352-00-X | 4,4'-oxydiphthalic anhydride | 412-830-4 | 1823-59-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-353-00-5 | reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate;ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate | 407-520-0 | 80657-64-3 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 607-354-00-0 | ethyl 2-cyclohexylpropionate | 412-280-5 | 2511-00-4 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-355-00-6 | p-tolyl 4-chlorobenzoate | 411-530-0 | 15024-10-9 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 607-356-00-1 | ethyl trans-2,2,6-trimethylcyclohexanecarboxylate | 412-540-8 | — | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 607-357-00-7 | reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran;cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran | 412-450-9 | 131766-73-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-358-00-2 | (1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate | 412-670-5 | 54275-93-3 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 607-359-00-8 | (1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate | 412-800-0 | 76109-32-5 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 607-360-00-3 | sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate | 411-680-7 | 133167-77-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-361-00-9 | methyl (R)-2-(4-hydroxyphenoxy)propionate | 411-950-4 | 96562-58-2 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 607-362-00-4 | reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)tetradec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoate | 413-500-2 | — | Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H315H318H411 | GHS05GHS09Dgr | H315H318H411 |
| 607-363-00-X | methyl-3-methoxyacrylate | 412-900-4 | 5788-17-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-364-00-5 | 3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione | 413-330-9 | 134724-55-3 | Aquatic Chronic 4 | H413 | H413 |
| 607-365-00-0 | 2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride | 410-620-7 | 119154-86-8 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H302H314H317 | GHS05GHS07Dgr | H302H314H317 |
| 607-366-00-6 | 3,5-dimethylbenzoyl chloride | 413-010-9 | 6613-44-1 | Skin Corr. 1BSkin Sens. 1 | H314H317 | GHS05GHS07Dgr | H314H317 |
| 607-367-00-1 | potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N,O,O,N)-ferrate-(1-) monohydrate | 411-640-9 | 153352-59-1 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-368-00-7 | 1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole | 411-650-3 | 110895-43-7 | Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 |
| 607-369-00-2 | reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid;cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid | 411-660-8 | 147027-04-1 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H302H315H318H317 | GHS05GHS07Dgr | H302H315H318H317 |
| 607-370-00-8 | 2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol | 412-210-3 | 41620-33-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-371-00-3 | 3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate | 413-410-3 | 88150-62-3 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-372-00-9 | ethoxylated bis phenol A di-(norbornene carboxylate) | 412-410-0 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 607-373-00-4 | (±) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate | 414-200-4 | 119738-06-6 | Muta. 2Repr. 1BAcute Tox. 4 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H341H360DfH302H373 (*)(*)H400H410 | GHS08GHS07GHS09Dgr | H341H360DfH302H373 (*)(*)H410 |
| 607-374-00-X | 5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride | 417-220-1 | 37441-29-5 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-375-00-5 | reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin;trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin | 421-960-0 | 90035-08-8 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 1Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H372 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H372 (*)(*)H410 |
| 607-376-00-0 | benzyl 2,4-dibromobutanoate | 420-710-8 | 23085-60-1 | Repr. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361f (*)(*)(*)H315H317H400H410 | GHS08GHS07GHS09Wng | H361f (*)(*)(*)H315H317H410 |
| 607-377-00-6 | trans-4-cyclohexyl-L-proline monohydrochloride | 419-160-1 | 90657-55-9 | Repr. 2Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H361f (*)(*)(*)H302H315H318H317 | GHS08GHS05GHS07Dgr | H361f (*)(*)(*)H302H315H318H317 |
| 607-378-00-1 | ammonium (Z)-α-methoxyimino-2-furylacetate | 405-990-1 | 97148-39-5 | Flam. Sol. 2 | H228 | GHS02Dgr | H228 | T |
| 607-379-00-7 | reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate;sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate;sodium [bis(2-hydroxyethyl)amino]methylsulfonate;N,N-bis(2-hydroxyethyl)stearamide | 401-230-8 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-380-00-2 | reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate;ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate;ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate | 407-320-3 | — | Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H315H318H412 | GHS05Dgr | H315H318H412 |
| 607-381-00-8 | reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid | 413-710-4 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-382-00-3 | 2-((4-amino-2-nitrophenyl)amino)benzoic acid | 411-260-3 | 117907-43-4 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 607-383-00-9 | reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate;2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate | 415-430-8 | 86403-32-9 | Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H318H317H400H410 | GHS05GHS07GHS09Dgr | H318H317H410 |
| 607-384-00-4 | reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid;C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate;C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate | 413-750-2 | 171090-93-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-385-00-X | Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate | 414-590-6 | 125229-74-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-386-00-5 | reaction mass of: tetradecanoic acid (42,5-47,5 %);poly(1-7)lactate esters of tetradecanoic acid (52,5-57,5 %) | 412-580-6 | 174591-51-6 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H315H318H317H410 |
| 607-387-00-0 | reaction mass of: dodecanoic acid (35-40 %);poly(1-7)lactate esters of dodecanoic acid (60-65 %) | 412-590-0 | 58856-63-6 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H315H318H317H410 |
| 607-388-00-6 | 4-ethylamino-3-nitrobenzoic acid | 412-090-2 | 2788-74-1 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 3 | H302H317H412 | GHS07Wng | H302H317H412 |
| 607-389-00-1 | trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate | 414-130-4 | 119710-96-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 607-390-00-7 | 1,2,3,4-tetrahydro-6-nitro-quinoxaline | 414-270-6 | 41959-35-7 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 607-391-00-2 | dimethylcyclopropane-1,1-dicarboxylate | 414-240-2 | 6914-71-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-392-00-8 | 2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate | 414-260-1 | 88938-37-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-393-00-3 | 3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 415-750-8 | 106447-44-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-394-00-9 | 5-methylpyrazine-2-carboxylic acid | 413-260-9 | 5521-55-1 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-395-00-4 | reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate;sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate | 410-230-7 | — | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H314H317H411 | GHS05GHS07GHS09Dgr | H314H317H411 |
| 607-396-00-X | bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate | 414-840-4 | 147783-69-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-397-00-5 | reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated);Ca phenates (branched C10-14 and C18-30 alkylated);Ca sulfurized phenates (branched C10-14 and C18-30 alkylated) | 415-930-6 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-398-00-0 | ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate | 414-820-5 | 125630-94-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-399-00-6 | 2,2-dimethyl 3-methyl-3-butenyl propanoate | 415-610-6 | 104468-21-5 | Skin Irrit. 2Aquatic Chronic 3 | H315H412 | GHS07Wng | H315H412 |
| 607-400-00-X | methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate | 414-400-1 | 32750-89-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-401-00-5 | ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate | 414-450-4 | 88805-65-6 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H315H318H317 | GHS05GHS07Dgr | H315H318H317 |
| 607-402-00-0 | methyl N-(phenoxycarbonyl)-L-valinate | 414-500-5 | 153441-77-1 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-403-00-6 | reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate;isopropyl alcohol | 414-810-0 | — | STOT RE 2 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H318H400H410 | GHS08GHS05GHS09Dgr | H373 (*)(*)H318H410 |
| 607-404-00-1 | reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid;di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate;di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate;(Z)-3,7-dimethyl-2,6-octadienyl butandioate;((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid | 415-190-4 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-405-00-7 | 2-hexyldecyl-p-hydroxybenzoate | 415-380-7 | 148348-12-3 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-406-00-2 | potassium 2,5-dichlorobenzoate | 415-700-5 | 184637-62-5 | Acute Tox. 4 (*)Eye Dam. 1 | H302H318 | GHS05GHS07Dgr | H302H318 |
| 607-407-00-8 | ethyl 2-carboxy-3-(2-thienyl)propionate | 415-680-8 | 143468-96-6 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1 | H315H318H317 | GHS05GHS07Dgr | H315H318H317 |
| 607-408-00-3 | potassium N-(4-fluorophenyl)glycinate | 415-710-1 | 184637-63-6 | STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H373 (*)(*)H318H317H412 | GHS08GHS05GHS07Dgr | H373 (*)(*)H318H317H412 |
| 607-409-00-9 | reaction mass of: (3R)-[1S-(1α, 2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid;inert biomass from Aspergillus terreus | 415-840-7 | — | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-410-00-4 | mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate | 415-880-5 | 779343-34-9 | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H317H400H410 | GHS05GHS07GHS09Dgr | H315H318H317H410 |
| 607-411-00-X | oxiranemethanol, 4-methylbenzene-sulfonate, (S)- | 417-210-7 | 70987-78-9 | Carc. 1BMuta. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H350H341H318H317H411 | GHS08GHS05GHS07GHS09Dgr | H350H341H318H317H411 |
| 607-412-00-5 | ethyl 2-(1-cyanocyclohexyl)acetate | 415-970-4 | 133481-10-4 | Acute Tox. 4 (*)STOT RE 2 (*)Aquatic Chronic 3 | H302H373 (*)(*)H412 | GHS08GHS07Wng | H302H373 (*)(*)H412 |
| 607-413-00-0 | trans-4-phenyl-L-proline | 416-020-1 | 96314-26-0 | Repr. 2Skin Sens. 1 | H361f (*)(*)(*)H317 | GHS08GHS07Wng | H361f (*)(*)(*)H317 |
| 607-414-00-6 | tris(2-ethylhexyl)-4,4',4''-(1,3,5-triazine-2,4,6-triyltriimino)tribenzoate | 402-070-1 | 88122-99-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-415-00-1 | poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) | 419-590-1 | — | Flam. Sol. 1Skin Sens. 1 | H228H317 | GHS02GHS07Dgr | H228H317 | T |
| 607-416-00-7 | 4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide | 420-730-7 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-418-00-8 | 2-ethylhexyl 4-aminobenzoate | 420-170-3 | 26218-04-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-419-00-3 | (3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid | 422-240-9 | 166596-68-5 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 607-420-00-9 | 2,2-bis(hydroxymethyl)butanoic acid | 424-090-1 | 10097-02-6 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 607-421-00-4 | cypermethrin cis/trans +/- 40/60;(RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 257-842-9 | 52315-07-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H332H302H335H400H410 | GHS07GHS09Wng | H332H302H335H410 |
| 607-422-00-X | α-cypermethrin | 257-842-9 | 67375-30-8 | Acute Tox. 3 (*)STOT RE 2 (*)STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H301H373 (*)(*)H335H400H410 | GHS06GHS08GHS09Dgr | H301H373 (*)(*)H335H410 |
| 607-423-00-5 | esters of mecoprop and of mecoprop-P | — | — | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 | A |
| 607-424-00-0 | trifloxystrobin (ISO);(E,E)-α-methoxyimino-{2-[[[[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetic acid methyl ester | — | 141517-21-7 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 607-425-00-6 | metalaxyl (ISO);methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate | 260-979-7 | 57837-19-1 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 3 | H302H317H412 | GHS07Wng | H302H317H412 |
| 607-426-00-1 | 1,2-benzenedicarboxylic acid, dipentylester, branched and linear; [1]n-pentyl-isopentylphthalate; [2]di-n-pentyl phthalate; [3]diisopentylphthalate [4] | 284-032-2 [1][2]205-017-9 [3]210-088-4 [4] | 84777-06-0 [1][2]131-18-0 [3]605-50-5 [4] | Repr. 1BAquatic Acute 1 | H360FDH400 | GHS08GHS09Dgr | H360FDH400 |
| 607-427-00-7 | bromoxynil heptanoate (ISO);2,6-dibromo-4-cyanophenyl heptanoate | 260-300-4 | 56634-95-8 | Repr. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H332H302H317H400H410 | GHS08GHS07GHS09Wng | H361d (*)(*)(*)H332H302H317H410 |
| 607-430-00-3 | BBP;benzyl butyl phthalate e | 201-622-7 | 85-68-7 | Repr. 1BAquatic Acute 1Aquatic Chronic 1 | H360DfH400H410 | GHS08GHS09Dgr | H360DfH410 |
| 607-431-00-9 | prallethrin (ISO);ETOC;2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | 245-387-9 | 23031-36-9 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H302H400H410 | GHS06GHS09Dgr | H331H302H410 |
| 607-432-00-4 | S-metolachlor;reaction mass of (S)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (80-100 %); [1] (R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20 %) [2] | [1][2] | 87392-12-9 [1]178961-20-1 [2] | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 607-433-00-X | cypermethrin cis/trans +/- 80/20;(RS)-α-cyano-3-phenoxybenzyl (1RS; 3RS; 1RS, 3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 257-842-9 | 52315-07-8 | Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H335H315H317H400H410 | GHS07GHS09Wng | H302H335H315H317H410 |
| 607-434-00-5 | mecoprop-P [1] and its salts;(R)-2-(4-chloro-2-methylphenoxy)propionic acid | 240-539-0 | 16484-77-8 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 607-435-00-0 | 2S-isopropyl-5R-methyl-1R-cyclohexyl 2,2-dihydroxyacetate | 416-810-6 | 111969-64-3 | STOT RE 2 (*)Eye Dam. 1Aquatic Chronic 2 | H373 (*)(*)H318H411 | GHS08GHS05GHS09Dgr | H373 (*)(*)H318H411 |
| 607-436-00-6 | 2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate | 417-350-9 | — | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 607-437-00-1 | 3-(4-aminophenyl)-2-cyano-2-propenoic acid | 417-480-6 | 252977-62-1 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-438-00-7 | methyl-2-[(aminosulfonyl)methyl]benzoate | 419-010-5 | 112941-26-1 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 607-439-00-2 | methyl tetrahydro-2-furancarboxylate | 420-670-1 | 37443-42-8 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-440-00-8 | methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate | 421-220-7 | 144740-59-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 607-441-00-3 | 3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionic acid | 421-490-6 | 167684-63-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-442-00-9 | benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate | 416-050-5 | 87460-09-1 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-443-00-4 | bis(2,4-di-tert-butyl-6-methylphenyl)ethyl phosphate | 416-140-4 | 145650-60-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-444-00-X | reaction mass of: cis-1,4-dimethylcyclohexyl dibenzoate;trans-1,4-dimethylcyclohexyl dibenzoate | 416-230-3 | 35541-81-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-445-00-5 | Iron (III) tris(4-methylbenzenesulfonate) | 420-960-8 | 77214-82-5 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-446-00-0 | methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate | 416-240-8 | 155522-12-6 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 607-447-00-6 | sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate | 416-370-5 | 156738-27-1 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 607-448-00-1 | 2,3,5,6-tetrafluorobenzoic acid | 416-800-1 | 652-18-6 | Skin Irrit. 2Eye Dam. 1 | H315H318 | GHS05Dgr | H315H318 |
| 607-449-00-7 | reaction mass of: 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate];4,4',4'',4'''-[[5,5'-[carbonylbis[imino(1,5,5-trimethyl-3,1-cyclohexanediyl)methylene]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,1',3,3'-tetrayl]tetrakis[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]tetrakisbenzenediazoniumtetra[bis(2-methylpropyl)naphthalenesulfonate] | 417-080-1 | — | Self-react. D (*)(*)(*)(*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H242H317H400H410 | GHS02GHS07GHS09Dgr | H242H317H410 |
| 607-450-00-2 | 2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate | 419-040-9 | 89604-92-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-451-00-8 | 4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzenesulfonic acid, sodium salt | 417-640-5 | 161935-19-9 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 607-453-00-9 | 4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) | 418-100-1 | 172964-15-7 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 607-454-00-4 | reaction mass of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid;cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid | 418-170-3 | 116193-72-7 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 607-455-00-X | 1-amino-4-(3-[4-chloro-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, sodium/lithium salt | 419-520-8 | 172890-93-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-456-00-5 | 3-amino-4-chlorobenzoic acid, hexadecyl ester | 419-700-6 | 143269-74-3 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-457-00-0 | tetrasodium dihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{6-[4-(2-aminoethyl)piperazin-1-yl]}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) | 420-350-1 | 172277-97-3 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 607-458-00-6 | reaction mass of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate;2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate;2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)oxy]ethanol]] | 420-850-1 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-459-00-1 | isopentyl 4-{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}benzoate | 418-930-4 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-460-00-7 | 3-tridecyloxy-propyl-ammonium 9-octadecenoate | 418-990-1 | 778577-53-0 | STOT RE 2 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H319H315H400H410 | GHS08GHS07GHS09Wng | H373 (*)(*)H319H315H410 |
| 607-461-00-2 | reaction mass of: pentasodium 2-{4-{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}-benzene-1,4-disulfonate;pentasodium 2-{4-{3-methyl-4-[7-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}-benzene-1,4-disulfonate | 421-160-1 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 607-462-00-8 | reaction mass of: 1-hexyl acetate;2-methyl-1-pentyl acetate;3-methyl-1-pentyl acetate;4-methyl-1-pentyl acetate;other mixed linear and branched C6-alkyl acetates | 421-230-1 | 88230-35-7 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-463-00-3 | 3-(phenothiazin-10-yl)propionic acid | 421-260-5 | 362-03-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-464-00-9 | reaction mass of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid;5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid | 421-280-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-465-00-4 | tris(2-hydroxyethyl)ammonium 7-{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}naphthalene-1,3-disulfonate | 421-440-3 | 778583-04-3 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-466-00-X | reaction mass of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate;phenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate;phenyl 3-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate | 421-480-1 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-467-00-5 | 1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate | 419-430-9 | 56533-00-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H312H302H373 (*)(*)H314H400H410 | GHS08GHS05GHS07GHS09Dgr | H312H302H373 (*)(*)H314H410 |
| 607-468-00-0 | reaction mass of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;disodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;trisodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;tetrasodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate | 419-450-8 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-469-00-6 | disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate | 419-460-2 | 120029-06-3 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-470-00-1 | potassium sodium 6,13-dichloro-3,10-bis{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | 414-100-0 | 154336-20-6 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 607-472-00-2 | ammonium iron(III) trimethylenediaminetetraacetate hemihydrate | 400-660-3 | 111687-36-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-474-00-3 | (4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | 410-430-4 | 117573-89-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-475-00-9 | reaction mass of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate;tetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate (1:1) | 412-940-2 | 148878-18-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-476-00-4 | trisodium N,N-bis(carboxymethyl)-β-alanine | 414-070-9 | 129050-62-0 | Skin Corr. 1BAquatic Chronic 3 | H314H412 | GHS05Dgr | H314H412 |
| 607-478-00-5 | tetramethylammonium hydrogen phthalate | 416-900-5 | 79723-02-7 | Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1 | H301H373 (*)(*)H400 | GHS06GHS08GHS09Dgr | H301H373 (*)(*)H400 |
| 607-479-00-0 | hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate | 418-550-9 | 168689-49-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-480-00-6 | 1,2-benzenedicarboxylic acid;di-C7-11-branched and linear alkylesters | 271-084-6 | 68515-42-4 | Repr. 1B | H360Df | GHS08Dgr | H360Df |
| 607-487-00-4 | reaction mass of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate;trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | 402-660-9 | — | Repr. 1BAquatic Chronic 3 | H360D (*)(*)(*)H412 | GHS08Dgr | H360D (*)(*)(*)H412 |
| 607-488-00-X | ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate | 414-210-9 | 147379-38-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-489-00-5 | reaction mass of: 2-ethylhexyl linolenate, linoleate and oleate;2-ethylhexyl epoxyoleate;2-ethylhexyl diepoxylinoleate;2-ethylhexyl triepoxylinolenate | 414-890-7 | 71302-79-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-490-00-0 | N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methyl glycinate | 415-060-7 | — | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 607-492-00-1 | 2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | 415-490-5 | 141773-73-1 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-493-00-7 | methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate | 415-670-3 | 78850-37-0 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-494-00-2 | bis(2-ethylhexyl)octylphosphonate | 417-170-0 | 52894-02-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-495-00-8 | sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate | 417-550-6 | 168151-92-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 607-496-00-3 | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 418-310-3 | 126050-54-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-497-00-9 | cerium oxide isostearate | 419-760-3 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 607-498-00-4 | (E)-3,7-dimethyl-2,6-octadienylhexadecanoate | 421-370-3 | 3681-73-0 | Skin Irrit. 2Aquatic Chronic 4 | H315H413 | GHS07Wng | H315H413 |
| 607-499-00-X | bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) | 421-660-1 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 607-500-00-3 | calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate | 421-670-4 | — | Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H315H400H410 | GHS07GHS09Wng | H315H410 |
| 607-501-00-9 | reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives | 421-820-9 | 192268-65-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 607-502-00-4 | (N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate | 422-200-0 | 178277-55-9 | Skin Corr. 1BAcute Tox. 4 (*)Aquatic Chronic 2 | H314H302H411 | GHS05GHS07GHS09Dgr | H314H302H411 |
| 607-503-00-X | 2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane | 422-210-5 | 68957-94-8 | Skin Corr. 1B | H314 | GHS05Dgr | H314 |
| 607-505-00-0 | pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate | 422-930-1 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-506-00-6 | reaction mass of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate;disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate | 422-970-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 607-507-00-1 | potassium, sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate | 422-980-2 | 187026-95-5 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-508-00-7 | disodium 3,3'-[iminobis[sulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] | 423-110-4 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 607-512-00-9 | trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate | 423-970-0 | 182926-43-8 | Aquatic Chronic 3 | H412 | — | H412 |
| 607-513-00-4 | reaction mass of: trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate;5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid sodium salt;5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid | 423-200-3 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 607-515-00-5 | reaction mass of: disodium hexyldiphenyl ether disulphonate;disodium dihexyldiphenyl ether disulphonate | 429-650-7 | 147732-60-3 | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 607-516-00-0 | N,N'-bis(trifluoroacetyl)-S,S'-bis-L-homocysteine | 429-670-6 | 105996-54-1 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 607-517-00-6 | (S)-α-(acetylthio)benzenepropanoic acid | 430-300-0 | 76932-17-7 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1 | H302H318H317 | GHS05GHS07Dgr | H302H318H317 |
| 607-526-00-5 | cartap (ISO);1,3-bis(carbamoylthio)-2-(dimethylamino)propane | — | 15263-53-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 607-527-00-0 | reaction mass of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-tridecafluorooctyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heptdecafluorodecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-pentacosafluorotetradecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heptadecafluorodecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate | 423-180-6 | — | STOT RE 2 (*) | H373 (*)(*) | GHS08Wng | H373 (*)(*) |
| 607-696-00-0 | pentyl formate | 211-340-6 | 638-49-3 | Flam. Liq. 3Eye Irrit. 2STOT SE 3 | H226H319H335 | GHS02GHS07Dgr | H226H319H335 | C |
| 607-697-00-6 | tert-butyl propionate | — | 20487-40-5 | Flam. Liq. 2 | H225 | GHS02Dgr | H225 | C |
| 608-001-00-3 | acetonitrile;cyanomethane | 200-835-2 | 75-05-8 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2 | H225H332H312H302H319 | GHS02GHS07Dgr | H225H332H312H302H319 |
| 608-002-00-9 | trichloroacetonitrile | 208-885-7 | 545-06-2 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H331H311H301H411 | GHS06GHS09Dgr | H331H311H301H411 |
| 608-003-00-4 | acrylonitrile | 203-466-5 | 107-13-1 | Flam. Liq. 2Carc. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H225H350H331H311H301H335H315H318H317H411 | GHS02GHS06GHS08GHS05GHS09Dgr | H225H350H331H311H301H335H315H318H317H411 | (*) | D |
| 608-004-00-X | 2-hydroxy-2-methylpropionitrile;2-cyanopropan-2-ol;acetone cyanohydrin | 200-909-4 | 75-86-5 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H400H410 | GHS06GHS09Dgr | H330H310H300H410 |
| 608-005-00-5 | n-butyronitrile | 203-700-6 | 109-74-0 | Flam. Liq. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H225H331H311H301 | GHS02GHS06Dgr | H225H331H311H301 |
| 608-006-00-0 | bromoxynil (ISO)3,5-dibromo-4-hydroxybenzonitrile;bromoxynil phenol | 216-882-7 | 1689-84-5 | Repr. 2Acute Tox. 2 (*)Acute Tox. 3 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H330H301H317H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H330H301H317H410 | M=10 |
| 608-007-00-6 | ioxynil (ISO)4-hydroxy-3,5-diiodobenzonitrile | 216-881-1 | 1689-83-4 | Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H331H301H312H373 (*)(*)H319H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H331H301H312H373 (*)(*)H319H410 | M=10 |
| 608-008-00-1 | chloroacetonitrile | 203-467-0 | 107-14-2 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H331H311H301H411 | GHS06GHS09Dgr | H331H311H301H411 |
| 608-009-00-7 | malononitrile | 203-703-2 | 109-77-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 |
| 608-010-00-2 | methacrylonitrile;2-methyl-2-propene nitrile | 204-817-5 | 126-98-7 | Flam. Liq. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Sens. 1 | H225H331H311H301H317 | GHS02GHS06Dgr | H225H331H311H301H317 | (*)Skin Sens. 1; H317: C ≥ 0,2 % | D |
| 608-011-00-8 | oxalonitrile;cyanogen | 207-306-5 | 460-19-5 | Flam. Gas 1Press. GasAcute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H220H331H400H410 | GHS02GHS04GHS06GHS09Dgr | H220H331H410 | U |
| 608-012-00-3 | benzonitrile | 202-855-7 | 100-47-0 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H312H302 | GHS07Wng | H312H302 |
| 608-013-00-9 | 2-chlorobenzonitrile | 212-836-5 | 873-32-5 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2 | H312H302H319 | GHS07Wng | H312H302H319 |
| 608-014-00-4 | chlorothalonil (ISO);tetrachloroisophthalonitrile | 217-588-1 | 1897-45-6 | Carc. 2Acute Tox. 2 (*)Eye Dam. 1STOT SE 3Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H330H318H335H317H400H410 | GHS06GHS08GHS05GHS09Dgr | H351H330H318H335H317H410 | M=10 |
| 608-015-00-X | dichlobenil (ISO);2,6-dichlorobenzonitrile | 214-787-5 | 1194-65-6 | Acute Tox. 4 (*)Aquatic Chronic 2 | H312H411 | GHS07GHS09Wng | H312H411 |
| 608-016-00-5 | 1,4-Dicyano-2,3,5,6-tetra-chloro-benzene | 401-550-8 | 1897-41-2 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 608-017-00-0 | bromoxynil octanoate (ISO);2,6-dibromo-4-cyanophenyl octanoate | 216-885-3 | 1689-99-2 | Repr. 2Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H331H302H317H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H331H302H317H410 | M=10 |
| 608-018-00-6 | ioxynil octanoate (ISO);4-cyano-2,6-diiodophenyl octanoate | 223-375-4 | 3861-47-0 | Repr. 2Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H301H319H317H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H301H319H317H410 | M=10 |
| 608-019-00-1 | 2,2'-dimethyl-2,2'-azodipropiononitrile;ADZN | 201-132-3 | 78-67-1 | Self-react. CAcute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H242H332H302H412 | GHS02GHS07Dgr | H242H332H302H412 | T |
| 608-021-00-2 | 3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile | 403-710-2 | 76823-93-3 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 608-022-00-8 | 3,7-dimethyloctanenitrile | 403-620-3 | 40188-41-8 | Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H315H317H411 | GHS07GHS09Wng | H315H317H411 |
| 608-023-00-3 | fenbuconazole (ISO);4-(4-chlorophenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butanenitrile | 406-140-2 | 114369-43-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 608-024-00-9 | 2-(4-(N-butyl-N-phenethylamino)phenyl)ethylene-1,1,2-tricarbonitrile | 407-650-8 | 97460-76-9 | Aquatic Chronic 4 | H413 | — | H413 |
| 608-025-00-4 | 2-nitro-4,5-bis(benzyloxy)phenylacetonitrile | 410-970-0 | 117568-27-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 608-026-00-X | 3-cyano-3,5,5-trimethylcyclohexanone | 411-490-4 | 7027-11-4 | Acute Tox. 4 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 3 | H302H373 (*)(*)H317H412 | GHS08GHS07Wng | H302H373 (*)(*)H317H412 |
| 608-027-00-5 | reaction mass of: 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;3-(2-ethylphenyl)-2,2-dimethylpropanenitrile;3-(3-ethylphenyl)-2,2-dimethylpropanenitrile | 412-660-0 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 608-028-00-0 | 4-(2-cyano-3-phenylamino acryloyloxymethyl)-cyclohexyl-methyl 2-cyano-3-phenylamino)-acrylate | 413-510-7 | 147374-67-2 | STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H373 (*)(*)H317H411 | GHS08GHS09Wng | H373 (*)(*)H317H411 |
| 608-029-00-6 | 1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridinecarbonitrile | 411-990-2 | 68612-94-2 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 608-030-00-1 | N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthyazol-5-yl-methylene)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamide | 412-340-0 | 147741-93-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 608-031-00-7 | 2-benzyl-2-methyl-3-butenitrile | 407-870-4 | 97384-48-0 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 608-033-00-8 | N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide | 407-970-8 | 75511-91-0 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 608-034-00-3 | chlorfenapyr;4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile | — | 122453-73-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H302H400H410 | GHS06GHS09Dgr | H331H302H410 |
| 608-035-00-9 | (±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile | 419-290-9 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 608-036-00-4 | 3-(2-{4-[2-(4-cyanophenyl)vinyl]phenyl}vinyl)benzonitrile | 419-060-8 | 79026-02-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 608-037-00-X | reaction mass of: (E)-2,12-tridecadiennitrile;(E)-3,12-tridecadiennitrile;(Z)-3,12-tridecadiennitrile | 422-190-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 608-038-00-5 | 2,2,4-trimethyl-4-phenyl-butane-nitrile | 422-580-8 | 75490-39-0 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 608-039-00-0 | 2-phenylhexanenitrile | 423-460-8 | 3508-98-3 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 608-040-00-6 | 4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) | 423-490-1 | 130755-46-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 608-041-00-1 | 4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-ene-3-yl)methyl)(1,1'-biphenyl)-2-carbonitrile | 423-500-4 | 138401-24-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 608-043-00-2 | 3-(cis-3-hexenyloxy)propanenitril | 415-220-6 | 142653-61-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H302H400H410 | GHS06GHS09Dgr | H331H302H410 |
| 608-065-00-2 | salts of bromoxynil with the exception of those specified elsewhere in this Annex | — | — | Repr. 2Acute Tox. 2 (*)Acute Tox. 3 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H330H301H317H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H330H301H317H410 | M=10 | A |
| 608-066-00-8 | salts of ioxynil with the exception of those specified elsewhere in this Annex | — | — | Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H331H301H312H373 (*)(*)H319H400H410 | GHS06GHS08GHS09Dgr | H361d (*)(*)(*)H331H301H312H373 (*)(*)H319H410 | M=10 | A |
| 609-001-00-6 | 1-nitropropane | 203-544-9 | 108-03-2 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H226H332H312H302 | GHS02GHS07Wng | H226H332H312H302 | (*) |
| 609-002-00-1 | 2-nitropropane | 201-209-1 | 79-46-9 | Flam. Liq. 3Carc. 1BAcute Tox. 4 (*)Acute Tox. 4 (*) | H226H350H332H302 | GHS02GHS08GHS07Dgr | H226H350H332H302 |
| 609-003-00-7 | nitrobenzene | 202-716-0 | 98-95-3 | Carc. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Aquatic Chronic 2 | H351H361f (*)(*)(*)H331H311H301H372 (*)(*)H411 | GHS06GHS08GHS09Dgr | H351H361f (*)(*)(*)H331H311H301H372 (*)(*)H411 |
| 609-004-00-2 | dinitrobenzene; [1]1,4-dinitrobenzene; [2]1,3-dinitrobenzene; [3]1,2-dinitrobenzene [4] | 246-673-6 [1]202-833-7 [2]202-776-8 [3]208-431-8 [4] | 25154-54-5 [1]100-25-4 [2]99-65-0 [3]528-29-0 [4] | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H373 (*)(*)H410 |
| 609-005-00-8 | 1,3,5-trinitrobenzene | 202-752-7 | 99-35-4 | Expl. 1.1Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H201H330H310H300H373 (*)(*)H400H410 | GHS01GHS06GHS08GHS09Dgr | H201H330H310H300H373 (*)(*)H410 |
| 609-006-00-3 | 4-nitrotoluene | 202-808-0 | 99-99-0 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 |
| 609-007-00-9 | 2,4-dinitrotoluene;dinitrotoluene, technical grade; [1]dinitrotoluene [2] | 204-450-0 [1]246-836-1 [2] | 121-14-2 [1]25321-14-6 [2] | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 |
| 609-008-00-4 | 2,4,6-trinitrotoluene;TNT | 204-289-6 | 118-96-7 | Expl. 1.1Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H201H331H311H301H373 (*)(*)H411 | GHS01GHS06GHS08GHS09Dgr | H201H331H311H301H373 (*)(*)H411 |
| 609-009-00-X | 2,4,6-trinitrophenol;picric acid | 201-865-9 | 88-89-1 | Expl. 1.1Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H201H331H311H301 | GHS01GHS06Dgr | H201H331H311H301 |
| 609-010-00-5 | salts of picric acid | — | — | Unst. ExplAcute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H201H331H311H301 | GHS01GHS06Dgr | H201H331H311H301 | T |
| 609-011-00-0 | 2,4,6-trinitroanisole | — | 606-35-9 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H201H332H312H302H411 | GHS01GHS07GHS09Wng | H201H332H312H302H411 |
| 609-012-00-6 | 2,4,6-trinitro-m-cresol | 210-027-1 | 602-99-3 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H201H332H312H302 | GHS01GHS07Wng | H201H332H312H302 |
| 609-013-00-1 | 2,4,6-trinitro-m-xylene | 211-187-5 | 632-92-8 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*) | H201H332H312H302H373 (*)(*) | GHS01GHS08GHS07Wng | H201H332H312H302H373 (*)(*) |
| 609-015-00-2 | 4-nitrophenol;p-nitrophenol | 202-811-7 | 100-02-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*) | H332H312H302H373 (*)(*) | GHS08GHS07Wng | H332H312H302H373 (*)(*) |
| 609-016-00-8 | dinitrophenol (reaction mass of isomers); [1]2,4(or 2,6)-dinitrophenol [2] | 247-096-2 [1]275-732-9 [2] | 25550-58-7 [1]71629-74-8 [2] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 |
| 609-018-00-9 | 2,4,6-trinitroresorcinol;styphnic acid | 201-436-6 | 82-71-3 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H201H332H312H302 | GHS01GHS07Wng | H201H332H312H302 | T |
| 609-019-00-4 | lead 2,4,6-trinitro-m-phenylene dioxide;lead 2,4,6-trinitroresorcinoxide;lead styphnate | 239-290-0 | 15245-44-0 | Unst. ExplRepr. 1AAcute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H200H360DfH332H302H373 (*)(*)H400H410 | GHS01GHS08GHS07GHS09Dgr | H200H360DfH332H302H373 (*)(*)H410 | 1 |
| 609-019-01-1 | lead 2,4,6-trinitro-m-phenylene dioxide;lead 2,4,6-trinitroresorcinoxide;lead styphnate (≥ 20 % phlegmatiser) | 239-290-0 | 15245-44-0 | Expl. 1.1Repr. 1AAcute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H201H360DfH332H302H373 (*)(*)H400H410 | GHS01GHS08GHS07GHS09Dgr | H201H360DfH332H302H373 (*)(*)H410 | 1 |
| 609-020-00-X | DNOC (ISO);4,6-dinitro-o-cresol | 208-601-1 | 534-52-1 | Muta. 2Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H330H310H300H315H318H317H400H410 | GHS06GHS08GHS05GHS07GHS09Dgr | H341H330H310H300H315H318H317H410 | EUH044 |
| 609-021-00-5 | sodium salt of DNOC;sodium 4,6-dinitro-o-cresolate; [1]potassium salt of DNOC;potassium 4,6-dinitro-o-cresolate [2] | 219-007-7 [1][2] | 2312-76-7 [1]5787-96-2 [2] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 |
| 609-022-00-0 | ammonium salt of DNOC;ammonium 4,6-dinitro-o-tolyl oxide | 221-037-0 | 2980-64-5 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H310H300H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H330H310H300H373 (*)(*)H410 |
| 609-023-00-6 | dinocap (ISO) | 254-408-0 | 39300-45-3 | Repr. 1BAcute Tox. 4 (*)STOT RE 2 (*)Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H332H373 (*)(*)H315H317H400H410 | GHS08GHS07GHS09Dgr | H360D (*)(*)(*)H332H373 (*)(*)H315H317H410 |
| 609-024-00-1 | binapacryl (ISO);2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate | 207-612-9 | 485-31-4 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H312H302H400H410 | GHS08GHS07GHS09Dgr | H360D (*)(*)(*)H312H302H410 |
| 609-025-00-7 | dinoseb(ISO);6-sec-butyl-2,4-dinitrophenol | 201-861-7 | 88-85-7 | Repr. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H360DfH311H301H319H400H410 | GHS06GHS08GHS09Dgr | H360DfH311H301H319H410 | EUH044 |
| 609-026-00-2 | salts and esters of dinoseb, with the exception of those specified elsewhere in this Annex | — | — | Repr. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H360DfH311H301H319H400H410 | GHS06GHS08GHS09Dgr | H360DfH311H301H319H410 | EUH044 | A |
| 609-027-00-8 | dinocton;reaction mass of isomers: methyl 2-octyl-4,6-dinitrophenyl carbonate, methyl 4-octyl-2,6-dinitrophenyl carbonate | — | 63919-26-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 609-028-00-3 | dinex (ISO);2-cyclohexyl-4,6-dinitrophenol | 205-042-5 | 131-89-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 |
| 609-029-00-9 | salts and esters of dinex | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 | A |
| 609-030-00-4 | dinoterb (ISO);2-tert-butyl-4,6-dinitrophenol | 215-813-8 | 1420-07-1 | Repr. 1BAcute Tox. 2 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H300H311H400H410 | GHS06GHS08GHS09Dgr | H360D (*)(*)(*)H300H311H410 | EUH044 |
| 609-031-00-X | salts and esters of dinoterb | — | — | Repr. 1BAcute Tox. 2 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H300H311H400H410 | GHS06GHS08GHS09Dgr | H360D (*)(*)(*)H300H311H410 | A |
| 609-032-00-5 | bromofenoxim (ISO);3,5-dibromo-4-hydroxybenzaldehyde-O-(2,4-dinitrophenyl)-oxime | 236-129-6 | 13181-17-4 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 609-033-00-0 | dinosam (ISO);2-(1-methylbutyl)-4,6-dinitrophenol | — | 4097-36-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 |
| 609-034-00-6 | salts and esters of dinosam | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H400H410 | GHS06GHS09Dgr | H331H311H301H410 | A |
| 609-035-00-1 | nitroethane | 201-188-9 | 79-24-3 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*) | H226H332H302 | GHS02GHS07Wng | H226H332H302 | (*) |
| 609-036-00-7 | nitromethane | 200-876-6 | 75-52-5 | Flam. Liq. 3Acute Tox. 4 (*) | H226H302 | GHS02GHS07Wng | H226H302 | (*) |
| 609-037-00-2 | 5-nitroacenaphthene | 210-025-0 | 602-87-9 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 609-038-00-8 | 2-nitronaphthalene | 209-474-5 | 581-89-5 | Carc. 1BAquatic Chronic 2 | H350H411 | GHS08GHS09Dgr | H350H411 |
| 609-039-00-3 | 4-nitrobiphenyl | 202-204-7 | 92-93-3 | Carc. 1BAquatic Chronic 2 | H350H411 | GHS08GHS09Dgr | H350H411 |
| 609-040-00-9 | nitrofen (ISO);2,4-dichlorophenyl 4-nitrophenyl ether | 217-406-0 | 1836-75-5 | Carc. 1BRepr. 1BAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H360D (*)(*)(*)H302H400H410 | GHS08GHS07GHS09Dgr | H350H360D (*)(*)(*)H302H410 |
| 609-041-00-4 | 2,4-dinitrophenol | 200-087-7 | 51-28-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1 | H331H311H301H373 (*)(*)H400 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H400 |
| 609-042-00-X | pendimethalin (ISO);N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | 254-938-2 | 40487-42-1 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 609-043-00-5 | quintozene (ISO);pentachloronitrobenzene | 201-435-0 | 82-68-8 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 609-044-00-0 | tecnazene (ISO);1,2,4,5-tetrachloro-3-nitrobenzene | 204-178-2 | 117-18-0 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 609-045-00-6 | reaction mass of: 4,6-dinitro-2-(3-octyl)phenyl methyl carbonate and 4,6-dinitro-2-(4-octyl)phenyl methyl carbonate;dinocton-6 | — | 8069-76-9 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 609-046-00-1 | trifluralin (ISO) (containing < 0.5 ppm NPDA);α, α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine (containing < 0.5 ppm NPDA);2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline (containing < 0.5 ppm NPDA);N,N-dipropyl-2,6-dinitro-4-trifluoromethylaniline (containing < 0.5 ppm NPDA) | 216-428-8 | 1582-09-8 | Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H319H317H400H410 | GHS07GHS09Wng | H319H317H410 |
| 609-047-00-7 | 2-nitroanisole | 202-052-1 | 91-23-6 | Carc. 1BAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 |
| 609-048-00-2 | sodium 3-nitrobenzenesulphonate | 204-857-3 | 127-68-4 | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 609-049-00-8 | 2,6-dinitrotoluene | 210-106-0 | 606-20-2 | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 3 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H412 | GHS06GHS08Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H412 |
| 609-050-00-3 | 2,3-dinitrotoluene | 210-013-5 | 602-01-7 | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H410 |
| 609-051-00-9 | 3,4-dinitrotoluene | 210-222-1 | 610-39-9 | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 |
| 609-052-00-4 | 3,5-dinitrotoluene | 210-566-2 | 618-85-9 | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 3 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H412 | GHS06GHS08Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H412 |
| 609-053-00-X | hydrazine-trinitromethane | 414-850-9 | — | Expl. 1.1 (*)(*)(*)(*)Self-react. ACarc. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Skin Sens. 1 | H201H240H350H331H301H317 | GHS01GHS06GHS08Dgr | H201H240H350H331H301H317 |
| 609-054-00-5 | 2,3-dinitrophenol; [1]2,5-dinitrophenol; [2]2,6-dinitrophenol; [3]3,4-dinitrophenol; [4]salts of dinitrophenol [5] | 200-628-7 [1]206-348-1 [2]209-357-9 [3]209-415-3 [4][5] | 66-56-8 [1]329-71-5 [2]573-56-8 [3]577-71-9 [4][5] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 |
| 609-055-00-0 | 2,5-dinitrotoluene | 210-581-4 | 619-15-8 | Carc. 1BMuta. 2Repr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H350H341H361f (*)(*)(*)H331H311H301H373 (*)(*)H411 |
| 609-056-00-6 | 2,2-dibromo-2-nitroethanol | 412-380-9 | 69094-18-4 | Expl. 1.1Carc. 2Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1ASkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H201H351H302H373 (*)(*)H314H317H400H410 | GHS01GHS08GHS05GHS07GHS09Dgr | H201H351H302H373 (*)(*)H314H317H410 | (*)STOT SE 3; H335: C ≥ 1 % | T |
| 609-057-00-1 | 3-chloro-2,4-difluoronitrobenzene | 411-980-8 | 3847-58-3 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H302H314H317H410 |
| 609-058-00-7 | 2-nitro-2-phenyl-1,3-propanediol | 410-360-4 | 5428-02-4 | STOT RE 1Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H372 (*)(*)H312H302H317H411 | GHS08GHS07GHS09Dgr | H372 (*)(*)H312H302H317H411 | EUH070 |
| 609-059-00-2 | 2-chloro-6-(ethylamino)-4-nitrophenol | 411-440-1 | 131657-78-8 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 609-060-00-8 | 4-[(3-hydroxypropyl)amino]-3-nitrophenol | 406-305-9 | 92952-81-3 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 609-061-00-3 | (E,Z)-4-chlorophenyl(cyclopropyl)ketone O-(4-nitrophenylmethyl)oxime | 406-100-4 | 94097-88-8 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 609-062-00-9 | 2-bromo-2-nitropropanol | 407-030-7 | 24403-04-1 | Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H311H302H373 (*)(*)H314H317H400H410 | GHS06GHS08GHS05GHS09Dgr | H311H302H373 (*)(*)H314H317H410 |
| 609-063-00-4 | 2-[(4-chloro-2-nitrophenyl)amino]ethanol | 413-280-8 | 59320-13-7 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 609-064-00-X | mesotrione(ISO);2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | — | 104206-82-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 609-065-00-5 | 2-nitrotoluene | 201-853-3 | 88-72-2 | Carc. 1BMuta. 1BRepr. 2Acute Tox. 4 (*)Aquatic Chronic 2 | H350H340H361f (*)(*)(*)H302H411 | GHS08GHS07GHS09Dgr | H350H340H361f (*)(*)(*)H302H411 |
| 609-066-00-0 | lithium sodium 3-amino-10-{4-(10-amino-6,13-dichloro-4,11-disulfonatobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-3-ylamino)-6-[methyl(2-sulfonato-ethyl)amino]-1,3,5-triazin-2-ylamino}-6,13-dichlorobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | 418-870-9 | 154212-58-5 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 2 (*) (*) | H332H312H302H371 (*)(*) | GHS08GHS07Dgr | H332H312H302H371 (*)(*) |
| 609-067-00-6 | sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine | 416-280-6 | 156769-97-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 609-068-00-1 | musk xylene;5-tert-butyl-2,4,6-trinitro-m-xylene | 201-329-4 | 81-15-2 | Expl. 1.1Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H201H351H400H410 | GHS01GHS08GHS09Wng | H201H351H410 | T |
| 609-070-00-2 | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene | 415-580-4 | 130841-23-5 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 609-071-00-8 | reaction mass of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine;2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol | 423-520-3 | 156137-33-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 610-001-00-3 | trichloronitromethane;chloropicrin | 200-930-9 | 76-06-2 | Acute Tox. 2 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H330H302H319H335H315 | GHS06Dgr | H330H302H319H335H315 |
| 610-002-00-9 | 1,1-dichloro-1-nitroethane | 209-854-0 | 594-72-9 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H331H311H301 | GHS06Dgr | H331H311H301 |
| 610-003-00-4 | chlorodinitrobenzene | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 | C |
| 610-004-00-X | 2-chloro-1,3,5-trinitrobenzene | 201-864-3 | 88-88-0 | Expl. 1.1Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H201H330H310H300H400H410 | GHS01GHS06GHS09Dgr | H201H330H310H300H410 |
| 610-005-00-5 | 1-chloro-4-nitrobenzene | 202-809-6 | 100-00-5 | Carc. 2Muta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H351H341H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H351H341H331H311H301H373 (*)(*)H411 |
| 610-006-00-0 | chloronitroanilines with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Chronic 2 | H330H310H300H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H330H310H300H373 (*)(*)H411 | A C |
| 610-007-00-6 | 1-chloro-1-nitropropane | 209-990-0 | 600-25-9 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H302 | GHS07Wng | H332H302 | (*) |
| 610-008-00-1 | 2,6-dichloro-4-nitroanisole | 403-350-6 | 17742-69-7 | Acute Tox. 3 (*)Aquatic Chronic 2 | H301H411 | GHS06GHS09Dgr | H301H411 |
| 610-009-00-7 | 2-chloro-4-nitroaniline | 204-502-2 | 121-87-9 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 610-010-00-2 | 2-bromo-1-(2-furyl)-2-nitroethylene | 406-110-9 | 35950-52-8 | Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 (*)(*)H314H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H302H373 (*)(*)H314H317H410 |
| 611-001-00-6 | azobenzene | 203-102-5 | 103-33-3 | Carc. 1BMuta. 2Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H341H332H302H373 (*)(*)H400H410 | GHS08GHS07GHS09Dgr | H350H341H332H302H373 (*)(*)H410 |
| 611-002-00-1 | azoxybenzene | 207-802-1 | 495-48-7 | Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H302 | GHS07Wng | H332H302 |
| 611-003-00-7 | fenaminosulf (ISO);sodium 4-dimethylaminobenzenediazosulphonate | 205-419-4 | 140-56-7 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H301H312H412 | GHS06Dgr | H301H312H412 |
| 611-004-00-2 | methyl-ONN-azoxymethyl acetate;methyl azoxy methyl acetate | 209-765-7 | 592-62-1 | Carc. 1BRepr. 1B | H350H360D (*)(*)(*) | GHS08Dgr | H350H360D (*)(*)(*) |
| 611-005-00-8 | disodium {5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}cuprate(2-);CI Direct Brown 95 | 240-221-1 | 16071-86-6 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 611-006-00-3 | 4-o-tolylazo-o-toluidine;4-amino-2',3-dimethylazobenzene;fast garnet GBC base;AAT;o-aminoazotoluene | 202-591-2 | 97-56-3 | Carc. 1BSkin Sens. 1 | H350H317 | GHS08Dgr | H350H317 |
| 611-007-00-9 | tricyclazole (ISO);5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazole; | 255-559-5 | 41814-78-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 611-008-00-4 | 4-aminoazobenzene;4-phenylazoaniline | 200-453-6 | 60-09-3 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 611-009-00-X | sodium (1-(5-(4-(4-anilino-3-sulphophenylazo)-2-methyl-5-methylsulphonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulphonato-2-naphtholato)iron(II) | 401-220-3 | — | Acute Tox. 4 (*)Aquatic Chronic 3 | H332H412 | GHS07Wng | H332H412 |
| 611-010-00-5 | 2'-(2-cyano-4,6-dinitrophenylazo)-5'-(N,N-dipropylamino)propionanilide | 403-010-7 | 106359-94-8 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 611-011-00-0 | N,N,N',N'-tetramethyl-3,3'-(propylenebis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridine-3,1-diyl)))di(propylammonium) dilactate | 403-340-1 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dg | H318H411 |
| 611-012-00-6 | reaction mass of 2,2-iminodiethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and 2-methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and N,N-diethylpropane-1,3-diamine 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate | 403-410-1 | 114565-65-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-013-00-1 | trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalene-3-sulfonate | 403-650-7 | 117409-78-6 | Expl. 1.3 (*)(*)(*)(*)Aquatic Chronic 2 | H203H411 | GHS01GHS09Dgr | H203H411 |
| 611-014-00-7 | (tetrasodium 1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium) hydroxide | 404-250-5 | 115099-55-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-015-00-2 | tetrasodium 4-amino-5-hydroxy-6-(4-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate | 404-320-5 | 116889-78-2 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-016-00-8 | reaction mass of 1,1'-((dihydroxyphenylene)bis(azo-3,1-phenylenazo(1-(3-dimethylaminopropyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))dipyridinium dichloride dihydrochloride, mixed isomers and 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(or2,6 or3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride | 404-540-1 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-017-00-3 | 2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramide | 404-910-2 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-018-00-9 | tetraammonium 5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalate | 405-130-5 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-019-00-4 | tetralithium 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | 405-150-4 | 106028-58-4 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-020-00-X | tetrakis(tetramethylammonium) 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | 405-170-3 | 116340-05-7 | Acute Tox. 3 (*)Skin Sens. 1Aquatic Chronic 3 | H301H317H412 | GHS06Dgr | H301H317H412 |
| 611-021-00-5 | 2-(4-(4-cyano-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethyl acetate | 405-480-9 | — | Acute Tox. 4 (*)STOT RE 2 (*)Skin Irrit. 2Aquatic Chronic 4 | H302H373 (*)(*)H315H413 | GHS08GHS07Wng | H302H373 (*)(*)H315H413 |
| 611-022-00-0 | 4-dimethylaminobenzenediazonium 3-carboxy-4-hydroxybenzenesulfonate | 404-980-4 | — | Self-react. CAcute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H242H331H301H312H373 (*)(*)H318H317H400H410 | GHS02GHS06GHS08GHS05GHS09Dgr | H242H331H301H312H373 (*)(*)H318H317H410 | T |
| 611-023-00-6 | disodium 7-(4,6-dichloro-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalene-2-sulfonate | 404-600-7 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-024-00-1 | Benzidine based azo dyes;4,4'-diarylazobiphenyl dyes, with the exception of those specified elsewhere in this Annex | — | — | Carc. 1B | H350 | GHS08Dgr | H350 | A |
| 611-025-00-7 | disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate;C.I. Direct Black 38 | 217-710-3 | 1937-37-7 | Carc. 1BRepr. 2 | H350H361d (*)(*)(*) | GHS08Dgr | H350H361d (*)(*)(*) |
| 611-026-00-2 | tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate];C.I. Direct Blue 6 | 220-012-1 | 2602-46-2 | Carc. 1BRepr. 2 | H350H361d (*)(*)(*) | GHS08Dgr | H350H361d (*)(*)(*) |
| 611-027-00-8 | disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate);C.I. Direct Red 28 | 209-358-4 | 573-58-0 | Carc. 1BRepr. 2 | H350H361d (*)(*)(*) | GHS08Dgr | H350H361d (*)(*)(*) |
| 611-028-00-3 | C,C'-azodi(formamide) | 204-650-8 | 123-77-3 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 | G |
| 611-029-00-9 | o-dianisidine based azo dyes;4,4'-diarylazo-3,3'-dimethoxybiphenyl dyes with the exception of those mentioned elsewhere in this Annex | — | — | Carc. 1B | H350 | GHS08Dgr | H350 | A H |
| 611-030-00-4 | o-tolidine based dyes;4,4'-diarylazo-3,3'-dimethylbiphenyl dyes, with the exception of those mentioned elsewhere in this Annex | — | — | Carc. 1B | H350 | GHS08Dgr | H350 | A H |
| 611-031-00-X | 4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride;C.I. Basic Red 9 | 209-321-2 | 569-61-9 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 611-032-00-5 | 1,4,5,8-tetraaminoanthraquinone;C.I. Disperse Blue 1 | 219-603-7 | 2475-45-8 | Carc. 1BSkin Irrit. 2Eye Dam. 1Skin Sens. 1 | H350H315H318H317 | GHS08GHS05GHS07Dgr | H350H315H318H317 |
| 611-033-00-0 | hexasodium [4,4''-azoxybis(2,2'-disulfonatostilbene-4,4'-diylazo)]-bis[5'-sulfonatobenzene-2,2'- diolato-O(2),O(2),N(1)]-copper(II) | 400-020-3 | 82027-60-9 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-034-00-6 | N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide | 402-430-8 | 105076-77-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-035-00-1 | tetralithium 6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalene-2,7-disulfonate | 403-660-1 | 107246-80-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-036-00-7 | 2-(4-(5,6(or 6,7)-dichloro-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethyl acetate | 405-440-0 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-037-00-2 | 3(or 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazolium methylsulphate | 406-055-0 | 124584-00-5 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 611-038-00-8 | trisodium 1-hydroxynaphthalene-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzene)- 2',2'',4-trisulfonate | 406-820-9 | — | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 611-039-00-3 | 7-[((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalene-2-sulfonic acid | 407-050-6 | 117715-57-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-040-00-9 | 3-(5-acetylamino-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalenesulfonic acid | 407-670-7 | 115099-58-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 611-041-00-4 | 2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazine-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamide | 407-680-1 | 98809-11-1 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 611-042-00-X | trisodium 5-amino-3-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalene-2,7-disulfonate | 411-770-6 | 136213-71-3 | Aquatic Chronic 3 | H412 | — | H412 |
| 611-043-00-5 | reaction mass of: trisodium N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))-chromate;trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate;trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate (2:1:1) | 402-850-1 | — | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 611-044-00-0 | reaction mass of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium [[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-);tert-alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-);tert-alkyl(C12-C14)ammonium ((1-(4(or 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromate(1-) | 403-720-7 | 117527-94-3 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-045-00-6 | 2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophene | 404-830-8 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 611-046-00-1 | 4,4'-diamino-2-methylazobenzene | 407-590-2 | 43151-99-1 | Acute Tox. 3 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H301H373 (*)(*)H317H400H410 | GHS06GHS08GHS09Dgr | H301H373 (*)(*)H317H410 |
| 611-047-00-7 | reaction mass of: 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole;2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 407-890-3 | 111381-11-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-048-00-2 | reaction mass of: 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole;2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 407-900-6 | 111381-12-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-049-00-8 | reaction mass of 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)-naphthalene-2-sulfonate, acetic acid, lactic acid (2:1:1) | 408-000-6 | 118658-98-3 | STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 3 | H373 (*)(*)H317H412 | GHS08Wng | H373 (*)(*)H317H412 |
| 611-051-00-9 | 2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methyl-benzothiazolium chloride | 411-110-7 | 136213-74-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 611-052-00-4 | monosodium aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonate], iron complex | 400-720-9 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 611-053-00-X | 2,2'-azobis[2-methylpropionamidine] dihydrochloride | 221-070-0 | 2997-92-4 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 611-055-00-0 | C.I. Disperse Yellow 3;N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamide | 220-600-8 | 2832-40-8 | Carc. 2Skin Sens. 1 | H351H317 | GHS08GHS07Wng | H351H317 |
| 611-056-00-6 | C.I. Solvent Yellow 14;1-phenylazo-2-naphthol | 212-668-2 | 842-07-9 | Carc. 2Muta. 2Skin Sens. 1Aquatic Chronic 4 | H351H341H317H413 | GHS08GHS07Wng | H351H341H317H413 |
| 611-057-00-1 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | 400-340-3 | 85136-74-9 | Carc. 1BAquatic Chronic 4 | H350H413 | GHS08Wng | H350H413 |
| 611-058-00-7 | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | 402-060-7 | 108225-03-2 | Carc. 1BEye Dam. 1Aquatic Chronic 2 | H350H318H411 | GHS08GHS05GHS09Dgr | H350H318H411 |
| 611-059-00-2 | octasodium 2-(6-(4-chloro-6-(3-(N-methyl-N-(4-chloro-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalene-1,5-disulfonate | 412-960-1 | 148878-21-1 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 611-060-00-8 | reaction mass of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate;ammonium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate;5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonaphthalen-2-ylazo]-isophthalic acid | 413-180-4 | 187285-15-0 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 611-061-00-3 | disodium 5-[5-[4-(5-chloro-2,6-difluoropyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonate | 412-530-3 | — | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 611-062-00-9 | octasodium 2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalene-1,5-disulfonate | 413-550-5 | — | Skin Irrit. 2Eye Dam. 1 | H315H318 | GHS05Dgr | H315H318 |
| 611-063-00-4 | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) | 413-590-3 | 164058-22-4 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 611-064-00-X | 4-(3,4-dichlorophenylazo)-2,6-di-sec-butyl-phenol | 410-600-8 | 124719-26-2 | STOT RE 2 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H315H400H410 | GHS08GHS07GHS09Wng | H373 (*)(*)H315H410 |
| 611-065-00-5 | 4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol | 410-610-2 | 111850-24-9 | STOT RE 2 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H319H315H317H400H410 | GHS08GHS07GHS09Wng | H373 (*)(*)H319H315H317H410 |
| 611-066-00-0 | tetrasodium 5-[4-chloro-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | 411-540-5 | 130201-57-9 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 611-067-00-6 | reaction mass of: bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate;bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate | 406-910-8 | — | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 611-068-00-1 | tetrasodium 4-amino-3,6-bis(5-[4-chloro-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | 400-690-7 | 85665-98-1 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-069-00-7 | N,N-di-[poly(oxyethylene)-co-poly(oxypropylene)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylaniline | 413-380-1 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-070-00-2 | reaction mass of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-);trisodium bis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromate(1-) | 405-665-4 | — | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 611-071-00-8 | tris(tetramethylammonium) 5-hydroxy-1-(4-sulphonatophenyl)-4-(4-sulphonatophenylazo)pyrazole-3-carboxylate | 406-073-9 | 131013-81-5 | Acute Tox. 3 (*)Aquatic Chronic 3 | H301H412 | GHS06Dgr | H301H412 |
| 611-072-00-3 | 2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzene, dihydrochloride | 407-010-8 | 118208-02-9 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 2 | H302H318H411 | GHS05GHS07GHS09Dgr | H302H318H411 |
| 611-073-00-9 | dimethyl 3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionate | 407-310-9 | 122630-55-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-074-00-4 | reaction mass of: sodium/potassium (3-(4-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II);sodium/potassium (3-(4-(5-(5-chloro-4,6-difluoropyrimidin-2-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II) | 407-100-7 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-075-00-X | reaction mass of: tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(2-amino-4-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate;tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(4-amino-2-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate (2:1) | 406-000-0 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 611-076-00-5 | 3-(2,6-dichloro-4-nitrophenylazo)-1-methyl-2-phenylindole | 406-280-4 | 117584-16-4 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 611-077-00-0 | dilithium disodium (5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenebisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalene-2,7-disulfonato(8)))dicuprate(2-) | 407-230-4 | 126637-70-5 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 611-078-00-6 | (2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dicopper(II) acetate lactate | 407-240-9 | 159604-94-1 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-079-00-1 | disodium 7-[4-chloro-6-(N-ethyl-o-toluidino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalenesulfonate | 410-390-8 | 147703-64-8 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 611-080-00-7 | sodium 3-(2-acetamido-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzenesulfonate | 410-150-2 | 147703-65-9 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-081-00-2 | tetrasodium [7-(2,5-dihydroxy-KO2-7-sulfonato-6-[4-(2,5,6-trichloro-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-KO8-naphthalene-1,3,5-trisulfonato(6-)]cuprate(II) | 411-470-5 | 141048-13-7 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 611-082-00-8 | reaction mass of: pentasodium bis(1-(3(or 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrate(1-);pentasodium [(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)-(5-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato]ferrate(1-) | 407-570-3 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-083-00-3 | reaction mass of: 2-[N-ethyl-4-[(5,6-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate;2-[N-ethyl-4-[(6,7-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate (1:1) | 411-560-4 | — | STOT RE 1Skin Sens. 1Aquatic Chronic 2 | H372 (*)(*)H317H411 | GHS08GHS07GHS09Dgr | H372 (*)(*)H317H411 |
| 611-084-00-9 | reaction mass of: N-(4-chlorophenyl)-4-(2,5-dichloro-4-(dimethylsulfamoyl)phenylazo)-3-hydroxy-2-naphthalenecarboxamide;N-(4-chlorophenyl)-4-(2,5-dichloro-4-(methylsulfamoyl)phenylazo)-3-hydroxy-2-naphthalenecarboxamide | 412-550-2 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 611-085-00-4 | reaction mass of: 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-amino-4-methyl-6-[3-(3-hydroxypropoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-amino-4-methyl-2-[3-(3-methoxypropoxy)propylamino]pyridine | 411-880-4 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-086-00-X | monolithium 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalenesulfonate], iron complex, monohydrate | 411-360-7 | — | Aquatic Chronic 3 | H412 | — | H412 |
| 611-087-00-5 | reaction mass of: 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxyl-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-phenoxyethane;3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) | 411-710-9 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 611-088-00-0 | reaction mass of: trilithium 4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate;trilithium 4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate | 411-890-9 | — | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 611-089-00-6 | 2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium methylsulfate | 411-100-2 | 136213-73-5 | STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H317H400H410 | GHS08GHS07GHS09Wng | H373 (*)(*)H317H410 |
| 611-090-00-1 | 2,5-dibutoxy-4-(morpholin-4-yl)benzenediazonium 4-methylbenzenesulfonate | 413-290-2 | 93672-52-7 | Self-react. CAcute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H242H302H318H317H412 | GHS02GHS05GHS07Dgr | H242H302H318H317H412 | T |
| 611-091-00-7 | sodium (1,0-1,95)/lithium (0,05-1) 5-((5-((5-chloro-6-fluoro-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinemethylsulfonate | 413-470-0 | 134595-59-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-092-00-2 | tert-(dodecyl/tetradecyl)-ammonium bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzenesulfonamidato)chromate | 413-210-6 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-093-00-8 | sodium 2-(4-(4-fluoro-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzene-1-sulfonate | 410-770-3 | 146177-84-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-094-00-3 | reaction mass of: 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichloro-1,3-benzothiazole;2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichloro-1,3-benzotriazole (1:1) | 411-600-0 | 143145-93-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-095-00-9 | hexasodium 1,1'-[(1-amino-8-hydroxy-3,6-disulfonate-2,7-naphthalenediyl)bis(azo(4-sulfonate-1,3-phenyl)imino[6-[(4-chloro-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxide | 412-240-7 | 89797-03-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-096-00-4 | methyl N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinate | 413-040-2 | 149850-30-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-097-00-X | reaction mass of iron complexes of: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)benzene and: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]benzene (n=2,5,6) | 414-150-3 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-098-00-5 | tetrakis(tetramethylammonium)3,3'-(6-(2-hydroxyethylamino)1,3,5-triazine-2,4-diylbisimino(2-methyl-4,1-phenyleneazo))bisnaphthalene-1,5-disulfonate | 405-950-3 | 131013-83-7 | Acute Tox. 3 (*)Aquatic Chronic 3 | H301H412 | GHS06Dgr | H301H412 |
| 611-099-00-0 | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | 401-500-5 | 118658-99-4 | Carc. 1BAquatic Chronic 2 | H350H411 | GHS08GHS09Dgr | H350H411 |
| 611-100-00-4 | potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazine-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate | 403-810-6 | 140876-13-7 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 611-101-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide | 405-200-5 | 104366-25-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-103-00-0 | trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) | 407-110-1 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 611-104-00-6 | reaction mass of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-);trisodium bis(2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)ferrate(1-);trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(4-nitro-2-sulfonatophenylazo)phenolato)ferrate(1-);trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(3-sulfonatophenylazo)phenolato)ferrate(1-);disodium 3,3'-(2,4-dihydroxy-1,3(or 1,5 or 3,5)-phenylenediazo)dibenzenesulfonate | 406-870-1 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-105-00-1 | sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate | 407-800-2 | 136213-75-7 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-106-00-7 | hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate | 410-180-6 | 157627-99-1 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 611-107-00-2 | potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate | 412-490-7 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-108-00-8 | disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate | 413-600-6 | 6527-62-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 611-109-00-3 | reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazine (2:1) | 407-710-3 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-110-00-9 | tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene | 408-210-8 | 124605-82-9 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-111-00-4 | disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydroxy-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) | 414-230-8 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-112-00-X | tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate | 413-070-6 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-113-00-5 | lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) | 414-280-0 | 149626-00-6 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 611-114-00-0 | lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3-)) chromate(2-) | 414-250-7 | 149564-66-9 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 611-115-00-6 | trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) | 414-290-5 | 149564-65-8 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 611-116-00-1 | reaction mass of: trisodium 5-{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | 414-620-8 | — | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 611-117-00-7 | 1,3-bis{6-fluoro-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}propane lithium-, sodium salt | 415-100-3 | 149850-29-3 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-118-00-2 | sodium 1,2-bis[4-[4-{4-(4-sulfophenylazo)-2-sulfophenylazo}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt | 413-990-8 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 611-119-00-8 | tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | 415-400-4 | 148878-22-2 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 611-120-00-3 | 5-{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfo-naphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt | 418-340-7 | 157707-94-3 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 611-121-00-9 | main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)phenylazo]naphthalene-2-ol;main component 8 (isomer): asym. 1:2 Cr-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)-naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalene-2-ol | 417-280-9 | 30785-74-1 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 611-122-00-4 | hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel | 417-250-5 | 151436-99-6 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 611-123-00-X | 3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammonium lactate | 424-310-4 | 178452-66-9 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 611-124-00-5 | reaction mass of: pentasodium 5-amino-3-(5-{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate;pentasodium 5-amino-6-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-3-(5-{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate;tetrasodium 5-amino-3-[5-{4-chloro-6-[4-(vinylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo]-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate | 424-320-9 | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 611-125-00-0 | reaction mass of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex;Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(2-hydroxyethylsulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex | 423-940-7 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 611-126-00-6 | 2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride | 424-120-1 | 174514-06-8 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 611-127-00-1 | pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate | 423-790-2 | — | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 | G |
| 611-128-00-7 | N,N'-bis{6-chloro-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt | 419-500-9 | 171599-85-2 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 611-129-00-2 | reaction mass of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid;5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid | 418-230-9 | 163879-69-4 | Expl. 1.3 (*)(*)(*)(*)Repr. 2STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H203H361f (*)(*)(*)H373 (*)(*)H317H411 | GHS01GHS08GHS07GHS09Dgr | H203H361f (*)(*)(*)H373 (*)(*)H317H411 |
| 611-130-00-8 | tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate | 418-520-5 | 183130-96-3 | Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H400H410 | GHS07GHS09Wng | H319H410 |
| 611-131-00-3 | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | 420-580-2 | 151798-26-4 | Repr. 1BAquatic Chronic 4 | H360D (*)(*)(*)H413 | GHS08Dgr | H360D (*)(*)(*)H413 |
| 611-132-00-9 | pentasodium bis{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato} chromate (III) | 419-210-2 | 178452-71-6 | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 611-133-00-4 | Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1-hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt | 419-260-5 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 611-134-00-X | trisodium 2-{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino}-4-sulfonatobenzoate, copper complex | 423-770-3 | — | Eye Dam. 1Aquatic Chronic 2 | H318H411 | GHS05GHS09Dgr | H318H411 |
| 611-135-00-5 | reaction product of: 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative, mixed potassium/sodium salt | 424-250-9 | — | Eye Dam. 1Aquatic Chronic 3 | H318H412 | GHS05Dgr | H318H412 |
| 611-136-00-0 | 2-{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-2-aminopropyl formate | 424-260-3 | — | Repr. 2Eye Dam. 1Aquatic Chronic 2 | H361f (*)(*)(*)H318H411 | GHS05GHS08GHS09Dgr | H361f (*)(*)(*)H318H411 |
| 611-137-00-6 | 6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole | 419-870-1 | 159038-16-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 611-138-00-1 | 2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole | 415-910-7 | 152828-25-6 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 611-140-00-2 | azafenidin (ISO);2-(2,4-dichloro-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one | — | 68049-83-2 | Repr. 1BSTOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H360DfH373 (*)(*)H400H410 | GHS08GHS09Dgr | H360DfH373 (*)(*)H410 | M=1000 |
| 612-001-00-9 | mono-methylamine; [1]di-methylamine; [2]tri-methylamine [3] | 200-820-0 [1]204-697-4 [2]200-875-0 [3] | 74-89-5 [1]124-40-3 [2]75-50-3 [3] | Flam. Gas 1Press. GasAcute Tox. 4 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1 | H220H332H335H315H318 | GHS02GHS04GHS05GHS07Dgr | H220H332H335H315H318 | (*)Skin Irrit. 2; H315: C ≥ 5 %Eye Dam. 1; H318: C ≥ 5 %Eye Irrit. 2; H319: 0,5 % ≤ C < 5 %STOT SE 3; H335: C ≥ 5 % | U5 |
| 612-001-01-6 | mono-methylamine ...%; [1]di-methylamine ...%; [2]tri-methylamine ...% [3] | 200-820-0 [1]204-697-4 [2]200-875-0 [3] | 74-89-5 [1]124-40-3 [2]75-50-3 [3] | Flam. Liq. 1Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H224H332H302H314 | GHS02GHS05GHS07Dgr | H224H332H302H314 | (*)STOT SE 3; H335: C ≥ 5 % | B |
| 612-002-00-4 | ethylamine | 200-834-7 | 75-04-7 | Flam. Gas 1Press. GasEye Irrit. 2STOT SE 3 | H220H319H335 | GHS02GHS04GHS07Dgr | H220H319H335 | U |
| 612-003-00-X | diethylamine | 203-716-3 | 109-89-7 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H225H332H312H302H314 | GHS02GHS05GHS07Dgr | H225H332H312H302H314 | STOT SE 3; H335: C ≥ 1 % |
| 612-004-00-5 | triethylamine | 204-469-4 | 121-44-8 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H225H332H312H302H314 | GHS02GHS05GHS07Dgr | H225H332H312H302H314 | STOT SE 3; H335: C ≥ 1 % |
| 612-005-00-0 | butylamine | 203-699-2 | 109-73-9 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H225H332H312H302H314 | GHS02GHS05GHS07Dgr | H225H332H312H302H314 | STOT SE 3; H335: C ≥ 1 % |
| 612-006-00-6 | ethylenediamine;1,2-diaminoethane | 203-468-6 | 107-15-3 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BResp. Sens. 1Skin Sens. 1 | H226H312H302H314H334H317 | GHS02GHS08GHS05GHS07Dgr | H226H312H302H314H334H317 |
| 612-007-00-1 | 2-aminopropane;isopropylamine | 200-860-9 | 75-31-0 | Flam. Liq. 1Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H224H319H335H315 | GHS02GHS07Dgr | H224H319H335H315 |
| 612-008-00-7 | aniline | 200-539-3 | 62-53-3 | Carc. 2Muta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H351H341H331H311H301H372 (*)(*)H318H317H400 | GHS06GHS08GHS05GHS09Dgr | H351H341H331H311H301H372 (*)(*)H318H317H400 | (*)STOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0,2 % ≤ C < 1 % |
| 612-009-00-2 | salts of aniline | — | — | Carc. 2Muta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H351H341H331H311H301H372 (*)(*)H318H317H400 | GHS06GHS08GHS05GHS09Dgr | H351H341H331H311H301H372 (*)(*)H318H317H400 | (*)STOT RE 1; H372: C ≥ 1 %STOT RE 2; H373: 0,2 % ≤ C < 1 % | A |
| 612-010-00-8 | chloroanilines (with exception of those specified elsewhere in this Annex) | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 | C |
| 612-011-00-3 | 4-nitrosoaniline | 211-535-6 | 659-49-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 |
| 612-012-00-9 | o-nitroaniline; [1]m-nitroaniline; [2]p-nitroaniline [3] | 201-855-4 [1]202-729-1 [2]202-810-1 [3] | 88-74-4 [1]99-09-2 [2]100-01-6 [3] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 3 | H331H311H301H373 (*)(*)H412 | GHS06GHS08Dgr | H331H311H301H373 (*)(*)H412 | C |
| 612-013-00-4 | 3-aminobenzene sulphonic acid;metanilic acid | 204-473-6 | 121-47-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 |
| 612-014-00-X | sulphanilic acid;4-aminobenzenesulphonic acid | 204-482-5 | 121-57-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H319H315H317 | GHS07Wng | H319H315H317 |
| 612-015-00-5 | N-methylaniline | 202-870-9 | 100-61-8 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 |
| 612-016-00-0 | N,N-dimethylaniline | 204-493-5 | 121-69-7 | Carc. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H351H331H311H301H411 | GHS06GHS08GHS09Dgr | H351H331H311H301H411 |
| 612-017-00-6 | N-methyl-N,2,4,6-tetranitroaniline;tetryl | 207-531-9 | 479-45-8 | Expl. 1.1Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H201H331H311H301H373 (*)(*) | GHS01GHS06GHS08Dgr | H201H331H311H301H373 (*)(*) |
| 612-018-00-1 | bis(2,4,6-trinitrophenyl)amine;hexyl | 205-037-8 | 131-73-7 | Expl. 1.1Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Chronic 2 | H201H330H310H300H373 (*)(*)H411 | GHS01GHS06GHS08GHS09Dgr | H201H330H310H300H373 (*)(*)H411 |
| 612-019-00-7 | dipicrylamine, ammonium salt | 220-639-0 | 2844-92-0 | Expl. 1.1Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Chronic 2 | H201H330H310H300H373 (*)(*)H411 | GHS01GHS06GHS08GHS09Dgr | H201H330H310H300H373 (*)(*)H411 | EUH001 |
| 612-020-00-2 | 1-naphthylamine | 205-138-7 | 134-32-7 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 612-022-00-3 | 2-naphthylamine | 202-080-4 | 91-59-8 | Carc. 1AAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 | Carc. 1A; H350: C ≥ 0,01 % |
| 612-023-00-9 | phenylhydrazine; [1]phenylhydrazinium chloride; [2]phenylhydrazine hydrochloride; [3]phenylhydrazinium sulphate (2:1) [4] | 202-873-5 [1]200-444-7 [2]248-259-0 [3]257-622-2 [4] | 100-63-0 [1]59-88-1 [2]27140-08-5 [3]52033-74-6 [4] | Carc. 1BMuta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1 | H350H341H331H311H301H372 (*)(*)H319H315H317H400 | GHS06GHS08GHS09Dgr | H350H341H331H311H301H372 (*)(*)H319H315H317H400 |
| 612-024-00-4 | m-toluidine;3-aminotoluene | 203-583-1 | 108-44-1 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1 | H331H311H301H373 (*)(*)H400 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H400 |
| 612-025-00-X | nitrotoluidines, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 | C |
| 612-026-00-5 | diphenylamine | 204-539-4 | 122-39-4 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H373 (*)(*)H400H410 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H410 |
| 612-027-00-0 | xylidines with the exception of those specified elsewhere in this Annex;dimethyl anilines with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 | C |
| 612-028-00-6 | p-phenylenediamine | 203-404-7 | 106-50-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H319H317H400H410 | GHS06GHS09Dgr | H331H311H301H319H317H410 |
| 612-029-00-1 | benzene-1,4-diamine dihydrochloride;p-phenylenediamine dihydrochloride | 210-834-9 | 624-18-0 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H319H317H400H410 | GHS06GHS09Dgr | H331H311H301H319H317H410 |
| 612-030-00-7 | 2-methyl-p-phenylenediamine sulphate [1] | 210-431-8 [1]228-871-4 [2] | 615-50-9 [1]6369-59-1 [2] | Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H301H332H312H317H411 | GHS06GHS09Dgr | H301H332H312H317H411 |
| 612-031-00-2 | N,N-dimethylbenzene-1,3-diamine; [1]4-amino-N,N-dimethylaniline;3-amino-N,N'-dimethylaniline [2] | 220-623-3 [1]202-807-5 [2] | 2836-04-6 [1]99-98-9 [2] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H331H311H301 | GHS06Dgr | H331H311H301 | C |
| 612-032-00-8 | N,N,N',N'-tetramethyl-p-phenylenediamine | 202-831-6 | 100-22-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 |
| 612-033-00-3 | 2-aminophenol | 202-431-1 | 95-55-6 | Muta. 2Acute Tox. 4 (*)Acute Tox. 4 (*) | H341H332H302 | GHS08GHS07Wng | H341H332H302 |
| 612-034-00-9 | 2-amino-4,6-dinitrophenol;picramic acid (< 20 % water) | 202-544-6 | 96-91-3 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H201H332H312H302H412 | GHS01GHS07Wng | H201H332H312H302H412 | T |
| 612-034-01-6 | 2-amino-4,6-dinitrophenol;picramic acid;[≥ 20 % water] | 202-544-6 | 96-91-3 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H332H312H302H412 | GHS07Wng | H332H312H302H412 | G |
| 612-035-00-4 | 2-methoxyaniline;o-anisidine | 201-963-1 | 90-04-0 | Carc. 1BMuta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*) | H350H341H331H311H301 | GHS06GHS08Dgr | H350H341H331H311H301 |
| 612-036-00-X | 3,3'-dimethoxybenzidine;o-dianisidine | 204-355-4 | 119-90-4 | Carc. 1BAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 |
| 612-037-00-5 | salts of 3,3'-dimethoxybenzidine;salts of o-dianisidine | — | — | Carc. 1BAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 | A |
| 612-038-00-0 | 2-nitro-p-anisidine;4-methoxy-2-nitroaniline | 202-547-2 | 96-96-8 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Chronic 3 | H330H310H300H373 (*)(*)H412 | GHS06GHS08Dgr | H330H310H300H373 (*)(*)H412 |
| 612-039-00-6 | 2-ethoxyaniline;o-phenetidine | 202-356-4 | 94-70-2 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H331H311H301H373 (*)(*) | GHS06GHS08Dgr | H331H311H301H373 (*)(*) |
| 612-040-00-1 | 2,4-dinitroaniline | 202-553-5 | 97-02-9 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Chronic 2 | H330H310H300H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H330H310H300H373 (*)(*)H411 |
| 612-041-00-7 | 4,4'-bi-o-toluidine | 204-358-0 | 119-93-7 | Carc. 1BAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 |
| 612-042-00-2 | benzidine;1,1'-biphenyl-4,4'-diamine;4,4'-diaminobiphenyl;biphenyl-4,4'-ylenediamine | 202-199-1 | 92-87-5 | Carc. 1AAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 | Carc. 1A; H350: C ≥ 0,01 % |
| 612-043-00-8 | N,N'-dimethylbenzidine | — | 2810-74-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 |
| 612-044-00-3 | N,N'-diacetylbenzidine | 210-338-2 | 613-35-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H332H312H302 | GHS07Wng | H332H312H302 |
| 612-046-00-4 | allylamine | 203-463-9 | 107-11-9 | Flam. Liq. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H225H331H311H301H411 | GHS02GHS06GHS09Dgr | H225H331H311H301H411 |
| 612-047-00-X | benzylamine | 202-854-1 | 100-46-9 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 612-048-00-5 | dipropylamine | 205-565-9 | 142-84-7 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H225H332H312H302H314 | GHS02GHS05GHS07Dgr | H225H332H312H302H314 | STOT SE 3; H335: C ≥ 1 % |
| 612-049-00-0 | di-n-butylamine; [1]di-sec-butylamine [2] | 203-921-8 [1]210-937-9 [2] | 111-92-2 [1]626-23-3 [2] | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H226H332H312H302 | GHS02GHS07Wng | H226H332H312H302 |
| 612-050-00-6 | cyclohexylamine | 203-629-0 | 108-91-8 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H226H312H302H314 | GHS02GHS05GHS07Dgr | H226H312H302H314 |
| 612-051-00-1 | 4,4'-diaminodiphenylmethane;4,4'-methylenedianiline | 202-974-4 | 101-77-9 | Carc. 1BMuta. 2STOT SE 1STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H350H341H370 (*)(*)H373 (*)(*)H317H411 | GHS08GHS07GHS09Dgr | H350H341H370 (*)(*)H373 (*)(*)H317H411 |
| 612-052-00-7 | (S)-sec-butylamine;(S)-2-aminobutane; [1](R)-sec-butylamine;(R)-2-aminobutane; [2]sec-butylamine;2-aminobutane [3] | 208-164-7 [1]236-232-6 [2]237-732-7 [3] | 513-49-5 [1]13250-12-9 [2]13952-84-6 [3] | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1AAquatic Acute 1 | H225H332H302H314H400 | GHS02GHS05GHS07GHS09Dgr | H225H332H302H314H400 | C |
| 612-053-00-2 | N-ethylaniline | 203-135-5 | 103-69-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H331H311H301H373 (*)(*) | GHS06GHS08Dgr | H331H311H301H373 (*)(*) |
| 612-054-00-8 | N,N-diethylaniline | 202-088-8 | 91-66-7 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 | (*) |
| 612-055-00-3 | N-methyl-o-toluidine; [1]N-methyl-m-toluidine; [2]N-methyl-p-toluidine [3] | 210-260-9 [1]211-795-0 [2]210-769-6 [3] | 611-21-2 [1]696-44-6 [2]623-08-5 [3] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 3 | H331H311H301H373 (*)(*)H412 | GHS06GHS08Dgr | H331H311H301H373 (*)(*)H412 | C |
| 612-056-00-9 | N,N-dimethyl-p-toluidine; [1]N,N-dimethyl-m-toluidine; [2]N,N-dimethyl-o-toluidine [3] | 202-805-4 [1]204-495-6 [2]210-199-8 [3] | 99-97-8 [1]121-72-2 [2]609-72-3 [3] | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 3 | H331H311H301H373 (*)(*)H412 | GHS06GHS08Dgr | H331H311H301H373 (*)(*)H412 | (*) | C |
| 612-057-00-4 | piperazine | 203-808-3 | 110-85-0 | Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H314H334H317H412 | GHS08GHS05Dgr | H314H334H317H412 |
| 612-058-00-X | 2,2'-iminodiethylamine;diethylenetriamine | 203-865-4 | 111-40-0 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H312H302H314H317 | GHS05GHS07Dgr | H312H302H314H317 |
| 612-059-00-5 | 3,6-diazaoctanethylenediamin;triethylenetetramine | 203-950-6 | 112-24-3 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H312H314H317H412 | GHS05GHS07Dgr | H312H314H317H412 |
| 612-060-00-0 | 3,6,9-triazaundecamethylenediamine;tetraethylenepentamine | 203-986-2 | 112-57-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H312H302H314H317H411 | GHS05GHS07GHS09Dgr | H312H302H314H317H411 |
| 612-061-00-6 | 3-aminopropyldimethylamine;N,N-dimethyl-1,3-diaminopropane | 203-680-9 | 109-55-7 | Flam. Liq. 3Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H226H302H314H317 | GHS02GHS05GHS07Dgr | H226H302H314H317 |
| 612-062-00-1 | 3-aminopropyldiethylamine;N,N-diethyl-1,3-diaminopropane | 203-236-4 | 104-78-9 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H226H312H302H314H317 | GHS02GHS05GHS07Dgr | H226H312H302H314H317 |
| 612-063-00-7 | 3,3'-iminodi(propylamine);dipropylenetriamine | 200-261-2 | 56-18-8 | Acute Tox. 2 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1ASkin Sens. 1 | H330H311H302H314H317 | GHS06GHS05Dgr | H330H311H302H314H317 |
| 612-064-00-2 | 3,6,9,12-tetra-azatetradecamethylenediamine;pentacthylenehexamine | 223-775-9 | 4067-16-7 | Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H314H317H400H410 | GHS05GHS07GHS09Dgr | H314H317H410 |
| 612-065-00-8 | polyethlyenepolyamines with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H312H302H314H317H410 |
| 612-066-00-3 | dicyclohexylamine | 202-980-7 | 101-83-7 | Acute Tox. 4 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H302H314H400H410 | GHS05GHS07GHS09Dgr | H302H314H410 |
| 612-067-00-9 | 3-aminomethyl-3,5,5-trimethylcyclohexylamine | 220-666-8 | 2855-13-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H312H302H314H317H412 | GHS05GHS07Dgr | H312H302H314H317H412 |
| 612-068-00-4 | 3,3'-dichlorobenzidine;3,3'-dichlorobiphenyl-4,4'-ylenediamine | 202-109-0 | 91-94-1 | Carc. 1BAcute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H312H317H400H410 | GHS08GHS07GHS09Dgr | H350H312H317H410 |
| 612-069-00-X | salts of 3,3'-dichlorobenzidine;salts of 3,3'-dichlorobiphenyl-4,4'-ylenediamine | — | — | Carc. 1BAcute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H312H317H400H410 | GHS08GHS07GHS09Dgr | H350H312H317H410 | A |
| 612-070-00-5 | salts of benzidine | 208-519-6208-520-1244-236-4252-984-8 | 531-85-1531-86-221136-70-936341-27-2 | Carc. 1AAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 | A |
| 612-071-00-0 | salts of 2-naphthylamine | 209-030-0210-313-6 | 553-00-4612-52-2 | Carc. 1AAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 | A |
| 612-072-00-6 | biphenyl-4-ylamine;xenylamine;4-aminobiphenyl | 202-177-1 | 92-67-1 | Carc. 1AAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 |
| 612-073-00-1 | salts of biphenyl-4-ylamine;salts of xenylamine;salts of 4-aminobiphenyl | — | — | Carc. 1AAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 | A |
| 612-074-00-7 | benzyldimethylamine | 203-149-1 | 103-83-3 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BAquatic Chronic 3 | H226H332H312H302H314H412 | GHS02GHS05GHS07Dgr | H226H332H312H302H314H412 |
| 612-075-00-2 | 2-aminoethyldimethylamine;2-dimethylaminoethylamine | 203-541-2 | 108-00-9 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H225H312H302H314 | GHS02GHS05GHS07Dgr | H225H312H302H314 |
| 612-076-00-8 | ethyldimethylamine | 209-940-8 | 598-56-1 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H225H332H302H314 | GHS02GHS05GHS07Dgr | H225H332H302H314 |
| 612-077-00-3 | dimethylnitrosoamine;N-nitrosodimethylamine | 200-549-8 | 62-75-9 | Carc. 1BAcute Tox. 2 (*)Acute Tox. 3 (*)STOT RE 1Aquatic Chronic 2 | H350H330H301H372 (*)(*)H411 | GHS06GHS08GHS09Dgr | H350H330H301H372 (*)(*)H411 | Carc. 1B; H350: C ≥ 0,001 % |
| 612-078-00-9 | 2,2'-dichloro-4,4'-methylenedianiline;4,4'-methylene bis(2-chloroaniline) | 202-918-9 | 101-14-4 | Carc. 1BAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 |
| 612-079-00-4 | salts of 2,2'-dichloro-4,4'-methylenedianiline;salts of 4,4'-methylenebis(2-chloroaniline) | — | — | Carc. 1BAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H302H400H410 | GHS08GHS07GHS09Dgr | H350H302H410 | A |
| 612-080-00-X | 4-amino-N,N-diethylaniline;N,N-diethyl-p-phenylendiamine | 202-214-1 | 93-05-0 | Acute Tox. 3 (*)Skin Corr. 1B | H301H314 | GHS06GHS05Dgr | H301H314 |
| 612-081-00-5 | salts of 4,4'-bi-o-toluidine;salts of 3,3'-dimethylbenzidine;salts of o-tolidine | 210-322-5265-294-7277-985-0 | 612-82-864969-36-474753-18-7 | Carc. 1BAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 | A |
| 612-082-00-0 | thiourea;thiocarbamide | 200-543-5 | 62-56-6 | Carc. 2Repr. 2Acute Tox. 4 (*)Aquatic Chronic 2 | H351H361d (*)(*)(*)H302H411 | GHS08GHS07GHS09Wng | H351H361d (*)(*)(*)H302H411 |
| 612-083-00-6 | 1-methyl-3-nitro-1-nitrosoguanidine | 200-730-1 | 70-25-7 | Carc. 1BAcute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H350H332H319H315H411 | GHS08GHS07GHS09Dgr | H350H332H319H315H411 | Carc. 1B; H350: C ≥ 0,01 % |
| 612-084-00-1 | dapsone;4,4'-diamino diphenyl sulfone | 201-248-4 | 80-08-0 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 612-085-00-7 | 4,4'-methylenedi-o-toluidine | 212-658-8 | 838-88-0 | Carc. 1BAcute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H302H317H400H410 | GHS08GHS07GHS09Dgr | H350H302H317H410 |
| 612-086-00-2 | amitraz (ISO);N,N-bis(2,4-xylyliminomethyl) methylamine | 251-375-4 | 33089-61-1 | Acute Tox. 4 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 (*)(*)H317H400H410 | GHS08GHS07GHS09Wng | H302H373 (*)(*)H317H410 | M=10 |
| 612-087-00-8 | guazatine (ISO) | 108173-90-6 | Acute Tox. 2 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H330H312H302H335H315H318H400H410 | GHS06GHS05GHS09Dgr | H330H312H302H335H315H318H410 |
| 612-088-00-3 | simazine (ISO);6-chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine | 204-535-2 | 122-34-9 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 612-089-00-9 | 1,5-naphthylenediamine | 218-817-8 | 2243-62-1 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 612-090-00-4 | 2,2'-(nitrosoimino)bisethanol | 214-237-4 | 1116-54-7 | Carc. 1B | H350 | GHS08Dgr | H350 |
| 612-091-00-X | o-toluidine;2-aminotoluene | 202-429-0 | 95-53-4 | Carc. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Aquatic Acute 1 | H350H331H301H319H400 | GHS06GHS08GHS09Dgr | H350H331H301H319H400 |
| 612-092-00-5 | N,N'-(2,2-dimethylpropylidene)hexamethylenediamine | 401-660-6 | 1000-78-8 | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 612-093-00-0 | 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline | 401-790-3 | 104147-32-2 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 612-094-00-6 | 4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride | 402-190-4 | — | STOT RE 1Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H372 (*)(*)H302H318H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H372 (*)(*)H302H318H317H410 |
| 612-095-00-1 | benzyl-2-hydroxydodecyldimethylammonium benzoate | 402-610-6 | 113694-52-3 | Skin Corr. 1BAcute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H314H302H400H410 | GHS05GHS07GHS09Dgr | H314H302H410 |
| 612-096-00-7 | 4,4'-carbonimidoylbis[N,N-dimethylaniline] | 207-762-5 | 492-80-8 | Carc. 2Acute Tox. 4 (*)Eye Irrit. 2Aquatic Chronic 2 | H351H302H319H411 | GHS08GHS07GHS09Wng | H351H302H319H411 |
| 612-097-00-2 | salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] | — | — | Carc. 2Acute Tox. 4 (*)Eye Irrit. 2Aquatic Chronic 2 | H351H302H319H411 | GHS08GHS07GHS09Wng | H351H302H319H411 | A |
| 612-098-00-8 | nitrosodipropylamine | 210-698-0 | 621-64-7 | Carc. 1BAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 | Carc. 1B; H350: C ≥ 0,001 % |
| 612-099-00-3 | 4-methyl-m-phenylenediamine;2,4-toluenediamine | 202-453-1 | 95-80-7 | Carc. 1BAcute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H350H301H312H319H317H411 | GHS06GHS08GHS09Dgr | H350H301H312H319H317H411 |
| 612-100-00-7 | propylenediamine | 201-155-9 | 78-90-0 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1A | H226H312H302H314 | GHS02GHS05GHS07Dgr | H226H312H302H314 |
| 612-101-00-2 | methenamine;hexamethylenetetramine | 202-905-8 | 100-97-0 | Flam. Sol. 2Resp. Sens. 1Skin Sens. 1 | H228H334H317 | GHS02GHS08Dgr | H228H334H317 |
| 612-102-00-8 | N,N-bis(3-aminopropyl)methylamine | 203-336-8 | 105-83-9 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1B | H331H311H302H314 | GHS06GHS05Dgr | H331H311H302H314 |
| 612-103-00-3 | N,N,N',N'-tetramethylethylenediamine | 203-744-6 | 110-18-9 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H225H332H302H314 | GHS02GHS05GHS07Dgr | H225H332H302H314 |
| 612-104-00-9 | hexamethylenediamine | 204-679-6 | 124-09-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 3Skin Corr. 1B | H312H302H335H314 | GHS05GHS07Dgr | H312H302H335H314 |
| 612-105-00-4 | 2-piperazin-1-ylethylamine | 205-411-0 | 140-31-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H312H302H314H317H412 | GHS05GHS07Dgr | H312H302H314H317H412 |
| 612-106-00-X | 2,6-diethylaniline | 209-445-7 | 579-66-8 | Acute Tox. 4 (*) | H302 | — | H302 |
| 612-107-00-5 | 1-phenylethylamine; [1]DL-α-methylbenzylamine [2] | 202-706-6 [1]210-545-8 [2] | 98-84-0 [1]618-36-0 [2] | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 612-108-00-0 | 3-aminopropyltriethoxysilane | 213-048-4 | 919-30-2 | Acute Tox. 4 (*)Skin Corr. 1B | H302H314 | GHS05GHS07Dgr | H302H314 |
| 612-109-00-6 | bis(2-dimethylaminoethyl)(methyl)amine | 221-201-1 | 3030-47-5 | Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1B | H311H302H314 | GHS06GHS05Dgr | H311H302H314 |
| 612-110-00-1 | 2,2'-dimethyl-4,4'-methylenebis(cyclohexylamine) | 229-962-1 | 6864-37-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1AAquatic Chronic 2 | H331H311H302H314H411 | GHS06GHS05GHS09Dgr | H331H311H302H314H411 |
| 612-111-00-7 | 2-methyl-m-phenylenediamine;2,6-toluenediamine | 212-513-9 | 823-40-5 | Muta. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H341H312H302H317H411 | GHS08GHS07GHS09Wng | H341H312H302H317H411 |
| 612-112-00-2 | p-anisidine;4-methoxyaniline | 203-254-2 | 104-94-9 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)STOT RE 2 (*)Aquatic Acute 1 | H330H310H300H373 (*)(*)H400 | GHS06GHS08GHS09Dgr | H330H310H300H373 (*)(*)H400 |
| 612-113-00-8 | 6-methyl-2,4-bis(methylthio)phenylene-1,3-diamine | 403-240-8 | 106264-79-3 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 612-114-00-3 | R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamide hydrogen 2,3-bis(benzoyloxy)succinate | 404-390-7 | — | Flam. Sol. 1Skin Sens. 1Aquatic Chronic 3 | H228H317H412 | GHS02GHS07Wng | H228H317H412 |
| 612-115-00-9 | dimethyldioctadecylammonium hydrogen sulfate | 404-050-8 | 123312-54-9 | Eye Irrit. 2Aquatic Chronic 4 | H319H413 | GHS07Wng | H319H413 |
| 612-116-00-4 | C8-18alkylbis(2-hydroxyethyl)ammonium bis(2-ethylhexyl)phosphate | 404-690-8 | 68132-19-4 | Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H314H317H400H410 | GHS06GHS05GHS09Dgr | H331H314H317H410 |
| 612-117-00-X | C12-14—tert-alkylamine, methylphosphonic acid salt | 404-750-3 | 119415-07-5 | Acute Tox. 4 (*)Skin Corr. 1BAquatic Chronic 2 | H302H314H411 | GHS05GHS07GHS09Dgr | H302H314H411 |
| 612-118-00-5 | A reaction mass of: (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium 4-toluenesulfonate;(1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromide | 405-080-4 | — | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 612-119-00-0 | benzyldimethyloctadecylammonium 3-nitrobenzenesulfonate | 405-330-2 | — | Skin Irrit. 2Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H400H410 | GHS05GHS09Dgr | H315H318H410 |
| 612-120-00-6 | aclonifen (ISO);2-chloro-6-nitro-3-phenoxyaniline | 277-704-1 | 74070-46-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 612-121-00-1 | amines, polyethylenepoly-;HEPA | 268-626-9 | 68131-73-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H312H302H314H317H410 |
| 612-122-00-7 | hydroxylamine | 232-259-2 | 7803-49-8 | Unst. Expl.Met. Corr. 1Acute Tox. 4 (*)STOT RE 2 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H200H290H302H373 (*)(*)H335H315H318H317H400 | GHS01GHS08GHS05GHS07GHS09Dgr | H200H290H302H373 (*)(*)H335H315H318H317H400 | T |
| 612-123-00-2 | hydroxylammonium chloride;hydroxylamine hydrochloride; [1]bis(hydroxylammonium) sulphate;hydroxylamine sulphate (2:1); [2]hydroxylammonium hydrogensulphate;hydroxylamine sulphate (1:1) [3] | 226-798-2 [1]233-118-8 [2]233-154-4 [3] | 5470-11-1 [1]10039-54-0 [2]10046-00-1 [3] | Met. Corr. 1Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1 | H290H302H373 (*)(*)H319H315H317H400 | GHS08GHS05GHS07GHS09Wng | H290H302H373 (*)(*)H319H315H317H400 | G T |
| 612-124-00-8 | N,N,N-trimethylanilinium chloride | 205-319-0 | 138-24-9 | Acute Tox. 3 (*)Acute Tox. 3 (*) | H311H301 | GHS06Dgr | H311H301 |
| 612-125-00-3 | 2-methyl-p-phenylenediamine;2,5-toluenediamine | 202-442-1 | 95-70-5 | Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H301H332H312H317H411 | GHS06GHS09Dgr | H301H332H312H317H411 |
| 612-126-00-9 | toluene-2,4-diammonium sulphate;4-methyl-m-phenylenediamine sulfate | 265-697-8 | 65321-67-7 | Carc. 1BAcute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H350H301H312H319H317H411 | GHS06GHS08GHS09Dgr | H350H301H312H319H317H411 |
| 612-127-00-4 | 3-aminophenol | 209-711-2 | 591-27-5 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H332H302H411 | GHS07GHS09Wng | H332H302H411 |
| 612-128-00-X | 4-aminophenol | 204-616-2 | 123-30-8 | Muta. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H341H332H302H400H410 | GHS08GHS07GHS09Wng | H341H332H302H410 |
| 612-129-00-5 | diisopropylamine | 203-558-5 | 108-18-9 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H225H332H302H314 | GHS02GHS05GHS07Dgr | H225H332H302H314 | STOT SE 3; H335: C ≥ 5 % |
| 612-130-00-0 | 2,6-diamino-3,5-diethyltoluene;4,6-diethyl-2-methyl-1,3-benzenediamine; [1]2,4-diamino-3,5-diethyltoluene;2,4-diethyl-6-methyl-1,3-benzenediamine; [2]diethylmethylbenzenediamine [3] | 218-255-3 [1]218-256-9 [2]270-877-4 [3] | 2095-01-4 [1]2095-02-5 [2]68479-98-1 [3] | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H312H302H373 (*)(*)H319H400H410 | GHS08GHS07GHS09Wng | H312H302H373 (*)(*)H319H410 | C |
| 612-131-00-6 | didecyldimethylammonium chloride | 230-525-2 | 7173-51-5 | Acute Tox. 4 (*)Skin Corr. 1B | H302H314 | GHS05GHS07Dgr | H302H314 |
| 612-132-00-1 | N,N'-diphenyl-p-phenylenediamine;N,N'-diphenyl-1,4-benzenediamine | 200-806-4 | 74-31-7 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 612-133-00-7 | (4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammonium sulphate;4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulphate | 247-162-0 | 25646-77-9 | Acute Tox. 3 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H301H373 (*)(*)H317H400H410 | GHS06GHS08GHS09Dgr | H301H373 (*)(*)H317H410 |
| 612-134-00-2 | N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methanesulphonamide sesquisulphate;4-(N-ethyl-N-2-methanesulphonylaminoethyl)-2-methylphenylenediamine sesquisulphate monohydrate | 247-161-5 | 25646-71-3 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 612-135-00-8 | N-2-naphthylaniline;N-phenyl-2-naphthylamine | 205-223-9 | 135-88-6 | Carc. 2Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H351H319H315H317H411 | GHS08GHS07GHS09Wng | H351H319H315H317H411 |
| 612-136-00-3 | N-isopropyl-N'-phenyl-p-phenylenediamine | 202-969-7 | 101-72-4 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 | Skin Sens. 1; H317: C ≥ 0,1 % |
| 612-137-00-9 | 4-chloroaniline | 203-401-0 | 106-47-8 | Carc. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H331H311H301H317H400H410 | GHS06GHS08GHS09Dgr | H350H331H311H301H317H410 |
| 612-138-00-4 | furalaxyl (ISO);methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-DL-alaninate | 260-875-1 | 57646-30-7 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 612-139-00-X | mefenacet (ISO);2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide | 277-328-8 | 73250-68-7 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 612-140-00-5 | quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides | 264-151-6 | 63449-41-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BAquatic Acute 1 | H312H302H314H400 | GHS05GHS07GHS09Dgr | H312H302H314H400 |
| 612-141-00-0 | 4,4'-methylenebis(2-ethylaniline);4,4'-methylenebis(2-ethylbenzeneamine) | 243-420-1 | 19900-65-3 | Carc. 2Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H351H302H400H410 | GHS08GHS07GHS09Wng | H351H302H410 |
| 612-142-00-6 | biphenyl-2-ylamine | 201-990-9 | 90-41-5 | Carc. 2Acute Tox. 4 (*)Aquatic Chronic 3 | H351H302H412 | GHS08GHS07Wng | H351H302H412 |
| 612-143-00-1 | N5,N5-diethyltoluene-2,5-diamine monohydrochloride;4-diethylamino-2-methylaniline monohydrochloride | 218-130-3 | 2051-79-8 | Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H301H319H317H400H410 | GHS06GHS09Dgr | H301H319H317H410 |
| 612-144-00-7 | flumetralin (ISO);N-(2-chloro-6-fluorobenzyl)-N-ethyl-α, α,α-trifluoro-2,6-dinitro-p-toluidine | — | 62924-70-3 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H319H315H317H400H410 | GHS07GHS09Wng | H319H315H317H410 |
| 612-145-00-2 | o-phenylenediamine | 202-430-6 | 95-54-5 | Carc. 2Muta. 2Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H341H301H332H312H319H317H400H410 | GHS06GHS08GHS09Dgr | H351H341H301H332H312H319H317H410 |
| 612-146-00-8 | o-phenylenediamine dihydrochloride | 210-418-7 | 615-28-1 | Carc. 2Muta. 2Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H341H301H332H312H319H317H400H410 | GHS06GHS08GHS09Dgr | H351H341H301H332H312H319H317H410 |
| 612-147-00-3 | m-phenylenediamine | 203-584-7 | 108-45-2 | Muta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H331H311H301H319H317H400H410 | GHS06GHS08GHS09Dgr | H341H331H311H301H319H317H410 |
| 612-148-00-9 | m-phenylenediamine dihydrochloride | 208-790-0 | 541-69-5 | Muta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H331H311H301H319H317H400H410 | GHS06GHS08GHS09Dgr | H341H331H311H301H319H317H410 |
| 612-149-00-4 | 1,3-diphenylguanidine | 203-002-1 | 102-06-7 | Repr. 2Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H361f (*)(*)(*)H302H319H335H315H411 | GHS08GHS07GHS09Wng | H361f (*)(*)(*)H302H319H335H315H411 |
| 612-150-00-X | spiroxamine (ISO);8-tert-butyl-1,4-dioxaspiro[4.5]decan-2-ylmethyl(ethyl)(propyl)amine | — | 118134-30-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H315H317H400H410 | GHS07GHS09Wng | H332H312H302H315H317H410 |
| 612-151-00-5 | diaminotoluene, technical product — reaction mass of [2] and [3];methyl-phenylenediamine; [1]4-methyl-m-phenylene diamine; [2]2-methyl-m-phenylene diamine [3] | 246-910-3 [1]202-453-1 [2]212-513-9 [3] | 25376-45-8 [1]95-80-7 [2]823-40-5 [3] | Carc. 1BAcute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H350H301H332H312H319H317H411 | GHS06GHS08GHS09Dgr | H350H301H332H312H319H317H411 |
| 612-152-00-0 | N,N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamine | 406-610-7 | 62478-82-4 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1AAquatic Chronic 3 | H226H332H302H373 (*)(*)H314H412 | GHS02GHS08GHS05GHS07Dgr | H226H332H302H373 (*)(*)H314H412 |
| 612-153-00-6 | 4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzene, monohydrochloride | 407-020-2 | 132885-85-9 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 3 | H302H317H412 | GHS07Wng | H302H317H412 |
| 612-154-00-1 | 6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthene] | 410-890-6 | 95235-29-3 | Aquatic Chronic 4 | H413 | — | H413 |
| 612-155-00-7 | 2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthene | 411-730-8 | 93071-94-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 612-156-00-2 | reaction mass of: trihexadecylmethylammonium chloride;dihexadecyldimethylammonium chloride | 405-620-9 | — | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 612-157-00-8 | (Z)-1-benzo[b]thien-2-ylethanone oxime hydrochloride | 410-780-8 | — | Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H373 (*)(*)H318H317H411 | GHS08GHS05GHS07GHS09Dgr | H302H373 (*)(*)H318H317H411 |
| 612-158-00-3 | reaction mass of: bis(5-dodecyl-2-hydroxybenzald-oximate) copper (II) C12-alkyl group is branched;4-dodecylsalicylaldoxime | 410-820-4 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 612-159-00-9 | Reaction products of: trimethylhexamethylene diamine (a mixture of 2,2,4-trimethyl-1,6-hexanediamine and 2,4,4-trimethyl-1,6-hexanediamine, EINECS listed), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxirane derivatives) and p-toluene-sulfonic acid | 410-880-1 | — | Acute Tox. 4 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H302H314H400H410 | GHS05GHS07GHS09Dgr | H302H314H410 |
| 612-160-00-4 | p-toluidine;4-aminotoluene; [1]toluidinium chloride; [2]toluidine sulphate (1:1) [3] | 203-403-1 [1]208-740-8 [2]208-741-3 [3] | 106-49-0 [1]540-23-8 [2]540-25-0 [3] | Carc. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1 | H351H331H311H301H319H317H400 | GHS06GHS08GHS09Dgr | H351H331H311H301H319H317H400 |
| 612-161-00-X | 2,6-xylidine;2,6-dimethylaniline | 201-758-7 | 87-62-7 | Carc. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H351H332H312H302H335H315H411 | GHS08GHS07GHS09Wng | H351H332H312H302H335H315H411 |
| 612-162-00-5 | dimethyldioctadecylammonium chloride;DODMAC | 203-508-2 | 107-64-2 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 612-163-00-0 | metalaxyl-M (ISO);mefenoxam;(R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propionic acid methyl ester | — | 70630-17-0 | Acute Tox. 4 (*)Eye Dam. 1 | H302H318 | GHS05GHS07Dgr | H302H318 |
| 612-164-00-6 | 2-butyl-2-ethyl-1,5-diaminopentane | 412-700-7 | 137605-95-9 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H312H302H373 (*)(*)H314H317H412 | GHS08GHS05GHS07Dgr | H312H302H373 (*)(*)H314H317H412 |
| 612-165-00-1 | N,N'-diphenyl-N,N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamine | 413-810-8 | 65181-78-4 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 612-166-00-7 | reaction mass of: cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1);trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1) | 411-830-1 | 114765-88-7 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H318H317H412 | GHS05GHS07Dgr | H318H317H412 |
| 612-167-00-2 | 5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]azepine-hydrochloride | 410-490-1 | — | Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H373 (*)(*)H318H317H411 | GHS08GHS05GHS07GHS09Dgr | H302H373 (*)(*)H318H317H411 |
| 612-168-00-8 | 3,5-dichloro-2,6-difluoropyrdine-4-amine | 220-630-1 | 2840-00-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H312H302H411 | GHS07GHS09Wng | H312H302H411 |
| 612-170-00-9 | 4-chlorophenyl cyclopropyl ketone O-(4-aminobenzyl)oxime | 405-260-2 | — | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 612-171-00-4 | N,N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethane | 410-060-3 | 130728-76-6 | Muta. 2Skin Sens. 1Aquatic Chronic 2 | H341H317H411 | GHS08GHS09Wng | H341H317H411 |
| 612-172-00-X | 4,4'-methylenebis(N,N'-dimethylcyclohexanamine | 412-840-9 | 13474-64-1 | Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1AAquatic Chronic 3 | H302H373 (*)(*)H314H412 | GHS08GHS05GHS07Dgr | H302H373 (*)(*)H314H412 |
| 612-173-00-5 | lithium 1-amino-4-(4-tert-butylanilino)anthraquinone-2-sulfonate | 411-140-0 | 125328-86-1 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 612-174-00-0 | 4,4-dimethoxybutylamine | 407-690-6 | 19060-15-2 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 3 | H302H314H317H412 | GHS05GHS07Dgr | H302H314H317H412 |
| 612-175-00-6 | 2-(O-aminooxy)ethylamine dihydrochloride | 412-310-7 | 37866-45-8 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 612-176-00-1 | polymer of 1,3-dibromopropane and N,N-diethyl-N',N'-dimethyl-1,3-propanediamine | 410-570-6 | 143747-73-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 612-177-00-7 | 2-naphthylamino-6-sulfomethylamide | 412-120-4 | 104295-55-8 | STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H373 (*)(*)H317H411 | GHS08GHS09Wng | H373 (*)(*)H317H411 |
| 612-178-00-2 | 1,4,7,10-tetraazacyclododecane disulfate | 412-080-8 | 112193-77-8 | Acute Tox. 4 (*)STOT SE 3Eye Dam. 1Aquatic Chronic 3 | H302H335H318H412 | GHS05GHS07Dgr | H302H335H318H412 |
| 612-179-00-8 | 1-(2-propenyl)pyridinium chloride | 412-740-5 | 25965-81-5 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 612-180-00-3 | 3-aminobenzylamine | 412-230-2 | 4403-70-7 | Acute Tox. 4 (*)Skin Corr. 1BAquatic Chronic 2 | H302H314H411 | GHS05GHS07GHS09Dgr | H302H314H411 |
| 612-181-00-9 | 2-phenylthioaniline | 413-030-8 | 1134-94-7 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 612-182-00-4 | 1-ethyl-1-methylmorpholinium bromide | 418-210-1 | 65756-41-4 | Muta. 2 | H341 | GHS08Wng | H341 |
| 612-183-00-X | 1-ethyl-1-methylpyrrolidinium bromide | 418-200-5 | 69227-51-6 | Muta. 2 | H341 | GHS08Wng | H341 |
| 612-184-00-5 | 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-one | 403-830-5 | 89331-94-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 612-185-00-0 | 1-[3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide | 407-400-8 | 59493-72-0 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 612-186-00-6 | bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate | 406-770-8 | 149057-64-7 | STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H318H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H373 (*)(*)H318H317H410 |
| 612-187-00-1 | 2,3,4-trifluoroaniline | 407-170-9 | 3862-73-5 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H312H302H373 (*)(*)H315H318H411 | GHS08GHS05GHS07GHS09Dgr | H312H302H373 (*)(*)H315H318H411 |
| 612-188-00-7 | 4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) | 407-560-9 | 107934-68-9 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 612-189-00-2 | 4-amino-2-(aminomethyl)phenol dihydrochloride | 412-510-4 | 135043-64-0 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 612-190-00-8 | 4,4'-methylenebis(2-isopropyl-6-methylaniline) | 415-150-6 | 16298-38-7 | STOT RE 2 (*)Aquatic Chronic 2 | H373 (*)(*)H411 | GHS08GHS09Wng | H373 (*)(*)H411 |
| 612-191-00-3 | polymer of allylamine hydrochloride | 415-050-2 | 71550-12-4 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 612-192-00-9 | 2-isopropyl-4-(N-methyl)aminomethylthiazole | 414-800-6 | 154212-60-9 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H312H302H315H318H411 | GHS05GHS07GHS09Dgr | H312H302H315H318H411 |
| 612-193-00-4 | 3-methylaminomethylphenylamine | 414-570-7 | 18759-96-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H312H302H314H317H410 |
| 612-194-00-X | 2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N,N,N-trimethyl-1-propanammonium chloride | 414-670-0 | 141890-30-4 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H318H400H410 | GHS05GHS07GHS09Dgr | H302H318H410 |
| 612-195-00-5 | bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate | 415-210-1 | 160236-81-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H318H400H410 | GHS05GHS07GHS09Dgr | H332H302H318H410 |
| 612-196-00-0 | 4-chloro-o-toluidine; [1]4-chloro-o-toluidine hydrochloride [2] | 202-441-6 [1]221-627-8 [2] | 95-69-2 [1]3165-93-3 [2] | Carc. 1BMuta. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H350H341H331H311H301H400H410 | GHS06GHS08GHS09Dgr | H350H341H331H311H301H410 |
| 612-197-00-6 | 2,4,5-trimethylaniline; [1]2,4,5-trimethylaniline hydrochloride [2] | 205-282-0 [1][2] | 137-17-7 [1]21436-97-5 [2] | Carc. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H350H331H311H301H411 | GHS06GHS08GHS09Dgr | H350H331H311H301H411 |
| 612-198-00-1 | 4,4'-thiodianiline and its salts | 205-370-9 | 139-65-1 | Carc. 1BAcute Tox. 4 (*)Aquatic Chronic 2 | H350H302H411 | GHS08GHS07GHS09Dgr | H350H302H411 |
| 612-199-00-7 | 4,4'-oxydianiline and its salts;p-aminophenyl ether | 202-977-0 | 101-80-4 | Carc. 1BMuta. 1BRepr. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 2 | H350H340H361f (*)(*)(*)H331H311H301H411 | GHS06GHS08GHS09Dgr | H350H340H361f (*)(*)(*)H331H311H301H411 |
| 612-200-00-0 | 2,4-diaminoanisole;4-methoxy-m-phenylenediamine; [1]2,4-diaminoanisole sulphate [2] | 210-406-1 [1]254-323-9 [2] | 615-05-4 [1]39156-41-7 [2] | Carc. 1BMuta. 2Acute Tox. 4 (*)Aquatic Chronic 2 | H350H341H302H411 | GHS08GHS07GHS09Dgr | H350H341H302H411 |
| 612-201-00-6 | N,N,N',N'-tetramethyl-4,4'-methylendianiline | 202-959-2 | 101-61-1 | Carc. 1BAquatic Acute 1Aquatic Chronic 1 | H350H400H410 | GHS08GHS09Dgr | H350H410 |
| 612-202-00-1 | 3,4-dichloroaniline | 202-448-4 | 95-76-1 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H318H317H400H410 | GHS06GHS05GHS09Dgr | H331H311H301H318H317H410 |
| 612-204-00-2 | C.I. Basic Violet 3;4-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride | 208-953-6 | 548-62-9 | Carc. 2Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H351H302H318H400H410 | GHS08GHS05GHS07GHS09Dgr | H351H302H318H410 |
| 612-205-00-8 | C.I. Basic Violet 3 with ≥ 0,1 % of Michler's ketone (EC no. 202-027-5) | 208-953-6 | 548-62-9 | Carc. 1BAcute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H350H302H318H400H410 | GHS08GHS05GHS07GHS09Dgr | H350H302H318H410 |
| 612-206-00-3 | famoxadone (ISO);3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione | — | 131807-57-3 | STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H400H410 | GHS08GHS09Wng | H373 (*)(*)H410 |
| 612-207-00-9 | 4-ethoxyaniline;p-phenetidine | 205-855-5 | 156-43-4 | Muta. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1 | H341H332H312H302H319H317 | GHS08GHS07Wng | H341H332H312H302H319H317 |
| 612-209-00-X | 6-methoxy-m-toluidine;p-cresidine | 204-419-1 | 120-71-8 | Carc. 1BAcute Tox. 4 (*) | H350H302 | GHS08GHS07Dgr | H350H302 |
| 612-210-00-5 | 5-nitro-o-toluidine; [1]5-nitro-o-toluidine hydrochloride [2] | 202-765-8 [1]256-960-8 [2] | 99-55-8 [1]51085-52-0 [2] | Carc. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Chronic 3 | H351H331H311H301H412 | GHS06GHS08Dgr | H351H331H311H301H412 |
| 612-211-00-0 | N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide | 416-470-9 | 170292-97-4 | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 612-212-00-6 | 2,6-dichloro-4-trifluoromethylaniline | 416-430-0 | 24279-39-8 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H315H317H400H410 | GHS07GHS09Wng | H332H302H315H317H410 |
| 612-213-00-1 | isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine | 419-850-2 | 148348-13-4 | Skin Corr. 1BAquatic Chronic 3 | H314H412 | GHS05Dgr | H314H412 |
| 612-214-00-7 | 4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine | 421-390-2 | 89114-90-9 | Aquatic Chronic 4 | H413 | — | H413 |
| 612-215-00-2 | 3-chloro-2-(isopropylthio)aniline | 421-700-6 | 179104-32-6 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 612-217-00-3 | 1-methoxy-2-propylamine | 422-550-4 | 37143-54-7 | Flam. Liq. 2Skin Corr. 1BAcute Tox. 4 (*)Aquatic Chronic 3 | H225H314H302H412 | GHS02GHS05GHS07Dgr | H225H314H302H412 |
| 613-001-00-1 | ethyleneimine;aziridine | 205-793-9 | 151-56-4 | Flam. Liq. 2Carc. 1BMuta. 1BAcute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Skin Corr. 1BAquatic Chronic 2 | H225H350H340H330H310H300H314H411 | GHS02GHS06GHS08GHS05GHS09Dgr | H225H350H340H330H310H300H314H411 | D |
| 613-002-00-7 | pyridine | 203-809-9 | 110-86-1 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H225H332H312H302 | GHS02GHS07Dgr | H225H332H312H302 | (*) |
| 613-003-00-2 | 1,2,3,4-tetranitrocarbazole | — | 6202-15-9 | Expl. 1.1Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*) | H201H332H312H302 | GHS01GHS07Wng | H201H332H312H302 |
| 613-004-00-8 | crimidine (ISO);2-chloro-6-methylpyrimidin-4-yldimethylamine | 208-622-6 | 535-89-7 | Acute Tox. 2 (*) | H300 | GHS06Dgr | H300 |
| 613-007-00-4 | desmetryne (ISO);6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine | 213-800-1 | 1014-69-3 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 613-008-00-X | dazomet (ISO);tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione | 208-576-7 | 533-74-4 | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H400H410 | GHS07GHS09Wng | H302H319H410 |
| 613-009-00-5 | 2,4,6-trichloro-1,3,5-triazine;cyanuric chloride | 203-614-9 | 108-77-0 | Acute Tox. 2 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1 | H330H302H314H317 | GHS06GHS05Dgr | H330H302H314H317 | EUH014 | STOT SE 3; H335: C ≥ 5 % |
| 613-010-00-0 | ametryn (ISO);2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazine | 212-634-7 | 834-12-8 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-011-00-6 | amitrole (ISO);1,2,4-triazol-3-ylamine | 200-521-5 | 61-82-5 | Repr. 2STOT RE 2 (*)Aquatic Chronic 2 | H361d (*)(*)(*)H373 (*)(*)H411 | GHS08GHS09Wng | H361d (*)(*)(*)H373 (*)(*)H411 |
| 613-012-00-1 | bentazone (ISO);3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide | 246-585-8 | 25057-89-0 | Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H302H319H317H412 | GHS07Wng | H302H319H317H412 |
| 613-013-00-7 | cyanazine (ISO);2-(4-chloro-6-ethylamino-1,3,5-triazine-2-ylamino)-2-methylpropionitrile | 244-544-9 | 21725-46-2 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-014-00-2 | ethoxyquin(ISO);6-ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | 202-075-7 | 91-53-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-015-00-8 | fenazaflor (ISO);phenyl 5,6-dichloro-2-trifluoromethylbenzimidazole-1-carboxylate | 238-134-9 | 14255-88-0 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 613-016-00-3 | fuberidazole(ISO);2-(2-furyl)benzimidazole | 223-404-0 | 3878-19-1 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-017-00-9 | bis (8-hydroxyquinolinium) sulphate | 205-137-1 | 134-31-6 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-018-00-4 | morfamquat (ISO);1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridilium ion | — | 7411-47-4 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 3 | H302H319H335H315H412 | GHS07Wng | H302H319H335H315H412 |
| 613-019-00-X | thioquinox(ISO);2-thio-1,3-dithiolo(4,5,b)quinoxaline | 202-272-8 | 93-75-4 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-020-00-5 | tridemorph (ISO);2,6-dimethyl-4-tridecylmorpholine | 246-347-3 | 24602-86-6 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H332H302H315H400H410 | GHS08GHS07GHS09Dgr | H360D (*)(*)(*)H332H302H315H410 |
| 613-021-00-0 | dithianon (ISO);5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile | 222-098-6 | 3347-22-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-022-00-6 | pyrethrins including cinerins, with the exception of those specified elsewhere in this Annex | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | A |
| 613-023-00-1 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S(*)(Z)],3β]]-chrysanthemate;pyrethrin I | 204-455-8 | 121-21-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 |
| 613-024-00-7 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S(*)(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate;pyrethrin II | 204-462-6 | 121-29-9 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 |
| 613-025-00-2 | cinerin I;3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | 246-948-0 | 25402-06-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-026-00-8 | cinerin II;3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropanecarboxylate | 204-454-2 | 121-20-0 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-027-00-3 | piperidine | 203-813-0 | 110-89-4 | Flam. Liq. 2Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1B | H225H331H311H314 | GHS02GHS06GHS05Dgr | H225H331H311H314 | (*) |
| 613-028-00-9 | morpholine | 203-815-1 | 110-91-8 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H226H332H312H302H314 | GHS02GHS05GHS07Dg | H226H332H312H302H314 |
| 613-029-00-4 | dichloro-1,3,5-triazinetrione;dichloroisocyanuric acid | 220-487-5 | 2782-57-2 | Ox. Sol. 2Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H272H302H319H335H400H410 | GHS03GHS07GHS09Dgr | H272H302H319H335H410 | EUH031 | T |
| 613-030-00-X | troclosene potassium; [1]troclosene sodium [2] | 218-828-8 [1]220-767-7 [2] | 2244-21-5 [1]2893-78-9 [2] | Ox. Sol. 2Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H272H302H319H335H400H410 | GHS03GHS07GHS09Dgr | H272H302H319H335H410 | EUH031 | (*)STOT SE 3; H335: C ≥ 10 %EUH031: C ≥ 10 % |
| 613-030-01-7 | troclosene sodium, dihydrate | 220-767-7 | 51580-86-0 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H302H319H335H400H410 | GHS07GHS09Wng | H302H319H335H410 | EUH031 |
| 613-031-00-5 | symclosene;trichloroisocyanuric acid;trichloro-1,3,5-triazinetrion | 201-782-8 | 87-90-1 | Ox. Sol. 2Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Aquatic Acute 1Aquatic Chronic 1 | H272H302H319H335H400H410 | GHS03GHS07GHS09Dgr | H272H302H319H335H410 | EUH031 |
| 613-032-00-0 | methyl-2,3,5,6-tetrachloro-4-pyridylsulphone;2,3,5,6-tetrachloro-4-(methylsulphonyl)pyridine | 236-035-5 | 13108-52-6 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1 | H312H302H319H317 | GHS07Wng | H312H302H319H317 |
| 613-033-00-6 | 2-methylaziridine;propyleneimine | 200-878-7 | 75-55-8 | Flam. Liq. 2Carc. 1BAcute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Eye Dam. 1Aquatic Chronic 2 | H225H350H330H310H300H318H411 | GHS02GHS06GHS08GHS05GHS09Dgr | H225H350H330H310H300H318H411 | Carc. 1B; H350: C ≥ 0,01 % |
| 613-034-00-1 | 1,2-dimethylimidazole | 217-101-2 | 1739-84-0 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1 | H302H315H318 | GHS05GHS07Dgr | H302H315H318 |
| 613-035-00-7 | 1-methylimidazole | 210-484-7 | 616-47-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Corr. 1B | H312H302H314 | GHS05GHS07Dgr | H312H302H314 |
| 613-036-00-2 | 2-methylpyridine;2-picoline | 203-643-7 | 109-06-8 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3 | H226H332H312H302H319H335 | GHS02GHS07Wng | H226H332H312H302H319H335 |
| 613-037-00-8 | 4-methylpyridine;4-picoline | 203-626-4 | 108-89-4 | Flam. Liq. 3Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H226H311H332H302H319H335H315 | GHS02GHS06Dgr | H226H311H332H302H319H335H315 |
| 613-038-00-3 | 6-phenyl-1,3,5-triazine-2,4-diyldiamine;6-phenyl-1,3,5-triazine-2,4-diamine;benzoguanamine | 202-095-6 | 91-76-9 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 613-039-00-9 | ethylene thiourea;imidazolidine-2-thione;2-imidazoline-2-thiol | 202-506-9 | 96-45-7 | Repr. 1BAcute Tox. 4 (*) | H360D (*)(*)(*)H302 | GHS08GHS07Dgr | H360D (*)(*)(*)H302 |
| 613-040-00-4 | azaconazole (ISO);1-{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}-1H-1,2.4-triazole | 262-102-3 | 60207-31-0 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-041-00-X | morpholine-4-carbonyl chloride | 239-213-0 | 15159-40-7 | Carc. 2Eye Irrit. 2Skin Irrit. 2 | H351H319H315 | GHS08Wng | H351H319H315 | EUH014 |
| 613-042-00-5 | imazalil (ISO);1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole | 252-615-0 | 35554-44-0 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H318H400H410 | GHS05GHS07GHS09Dgr | H332H302H318H410 |
| 613-043-00-0 | imazalil sulphate (ISO) powder;1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1](±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] | 261-351-5 [1]281-291-3 [2] | 58594-72-2 [1]83918-57-4 [2] | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 613-043-01-8 | imazalil sulphate (ISO), aqueous solution;1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1](±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] | 261-351-5 [1]281-291-3 [2] | 58594-72-2 [1]83918-57-4 [2] | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H314H317H400H410 | GHS05GHS07GHS09Wng | H302H314H317H410 | Skin Corr. 1B; H314: C ≥ 50 %Skin Irrit. 2; H315: 30 % ≤ C < 50 %Eye Dam. 1; H318: 15 % ≤ C < 50 %Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
| 613-044-00-6 | captan (ISO);1,2,3,6-tetrahydro-N-(trichloromethylthio)phthalimide | 205-087-0 | 133-06-2 | Carc. 2Acute Tox. 3 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H351H331H318H317H400 | GHS06GHS08GHS05GHS09Dgr | H351H331H318H317H400 |
| 613-045-00-1 | folpet (ISO);N-(trichloromethylthio)phthalimide | 205-088-6 | 133-07-3 | Carc. 2Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1 | H351H332H319H317H400 | GHS08GHS07GHS09Wng | H351H332H319H317H400 |
| 613-046-00-7 | captafol (ISO);1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachloroethylthio)phthalimide | 219-363-3 | 2425-06-1 | Carc. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H350H317H400H410 | GHS08GHS09Dgr | H350H317H410 |
| 613-047-00-2 | 1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate;dimetilan (ISO) | 211-420-0 | 644-64-4 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 |
| 613-048-00-8 | carbendazim (ISO);methyl benzimidazol-2-ylcarbamate | 234-232-0 | 10605-21-7 | Muta. 1BRepr. 1BAquatic Acute 1Aquatic Chronic 1 | H340H360FDH400H410 | GHS08GHS09Dgr | H340H360FDH410 |
| 613-049-00-3 | benomyl (ISO);methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate | 241-775-7 | 17804-35-2 | Muta. 1BRepr. 1BSTOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H340H360FDH335H315H317H400H410 | GHS08GHS07GHS09Dgr | H340H360FDH335H315H317H410 | M=10 |
| 613-050-00-9 | carbadox (INN);methyl 3-(quinoxalin-2-ylmethylene)carbazate 1,4-dioxide;2-(methoxycarbonylhydrazonomethyl)quinoxaline 1,4-dioxide | 229-879-0 | 6804-07-5 | Flam. Sol. 1Carc. 1BAcute Tox. 4 (*) | H228H350H302 | GHS02GHS08GHS07Dgr | H228H350H302 | T |
| 613-051-00-4 | molinate (ISO);S-ethyl 1-perhydroazepinecarbothioate;S-ethyl perhydroazepine-1-carbothioate | 218-661-0 | 2212-67-1 | Carc. 2Repr. 2Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H361f (*)(*)(*)H332H302H373 (*)(*)H317H400H410 | GHS08GHS07GHS09Wng | H351H361f (*)(*)(*)H332H302H373 (*)(*)H317H410 | M=100 |
| 613-052-00-X | trifenmorph (ISO);4-tritylmorpholine | 215-812-2 | 1420-06-0 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-053-00-5 | anilazine (ISO);2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline | 202-910-5 | 101-05-3 | Eye Irrit. 2Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H315H400H410 | GHS07GHS09Wng | H319H315H410 |
| 613-054-00-0 | thiabendazol (ISO);2-(thiazole-4-yl)benzimidazole | 205-725-8 | 148-79-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-056-00-1 | 1,2-dimethyl-3,5-diphenylpyrazolium methylsulphate;difenzoquat methyl sulfate | 256-152-5 | 43222-48-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS09Wng | H302H410 |
| 613-057-00-7 | dodemorph (ISO);4-cyclododecyl-2,6-dimethylmorpholine | 216-474-9 | 1593-77-7 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 2 | H319H335H315H411 | GHS07GHS09Wng | H319H335H315H411 |
| 613-058-00-2 | permethrin (ISO);m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 258-067-9 | 52645-53-1 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H317H400H410 | GHS07GHS09Wng | H332H302H317H410 | M=1000 |
| 613-059-00-8 | profluralin (ISO);N-(cyclopropylmethyl)-α, α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine | 247-656-6 | 26399-36-0 | Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H400H410 | GHS07GHS09Wng | H319H410 |
| 613-060-00-3 | resmethrin (ISO);5-benzyl-3-furylmethyl (±)-cis—trans-chrysanthemate | 233-940-7 | 10453-86-8 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-061-00-9 | 6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl) pyrrole-2-carboxylate;ryania | 239-732-2 | 15662-33-6 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 613-062-00-4 | sabadilla (ISO);veratrine | — | 8051-02-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H319H335H315 | GHS07Wng | H319H335H315 |
| 613-063-00-X | secbumeton (ISO);2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | 247-554-1 | 26259-45-0 | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H400H410 | GHS07GHS09Wng | H302H319H410 |
| 613-064-00-5 | 5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolane;sesamex | — | 51-14-9 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-065-00-0 | simetryn (ISO);2,4-bis(ethylamino)-6-methylthio-1,3,5-triazine | 213-801-7 | 1014-70-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-066-00-6 | terbumeton (ISO);2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | 251-637-8 | 33693-04-8 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-067-00-1 | propazine(ISO);2-chloro-4,6-bis(isopropylamino)-1,3,5-triazine | 205-359-9 | 139-40-2 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 613-068-00-7 | atrazine (ISO);2-chloro-4-ethylamine-6-isopropylamine-1,3,5-triazine | 217-617-8 | 1912-24-9 | STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H317H400H410 | GHS08GHS09Wng | H373 (*)(*)H317H410 |
| 613-069-00-2 | ε-caprolactam | 203-313-2 | 105-60-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2 | H332H302H319H335H315 | GHS07Wng | H332H302H319H335H315 |
| 613-070-00-8 | propylenethiourea | — | 2122-19-2 | Repr. 2Acute Tox. 4 (*)Aquatic Chronic 3 | H361d (*)(*)(*)H302H412 | GHS08GHS07Wng | H361d (*)(*)(*)H302H412 |
| 613-071-00-3 | 2-fluoro-5-trifluoromethylpyridine | 400-290-2 | 69045-82-5 | Flam. Liq. 3Skin Sens. 1Aquatic Chronic 3 | H226H317H412 | GHS02GHS07Wng | H226H317H412 |
| 613-072-00-9 | N,N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine | 401-280-0 | 91273-04-0 | Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H314H317H411 | GHS05GHS07GHS09Dgr | H314H317H411 |
| 613-073-00-4 | N,N-dimethyl-2-(3-(4-chlorophenyl)-4,5-dihydropyrazol-1-ylphenylsulphonyl)ethylamine | 401-410-6 | 10357-99-0 | STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H373 (*)(*)H317H411 | GHS08GHS09Wng | H373 (*)(*)H317H411 |
| 613-074-00-X | 3-(3-methylpent-3-yl)isoxazol-5-ylamine | 401-460-9 | 82560-06-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Eye Dam. 1Aquatic Chronic 3 | H331H301H318H412 | GHS06GHS05Dgr | H331H301H318H412 |
| 613-075-00-5 | 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione | 401-570-7 | 89415-87-2 | Ox. Sol. 1 (*)(*)(*)(*)Acute Tox. 3 (*)Skin Corr. 1BAcute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1 | H271H331H314H302H317H400 | GHS03GHS06GHS05GHS09Dgr | H271H331H314H302H317H400 |
| 613-076-00-0 | 3-chloro-5-trifluoromethyl-2-pyridylamine | 401-670-0 | 79456-26-1 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 613-077-00-6 | reaction mass of 5-heptyl-1,2,4-triazol-3-ylamine and 5-nonyl-1,2,4-triazol-3-ylamine | 401-940-8 | — | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Chronic 2 | H302H319H411 | GHS07GHS09Wng | H302H319H411 |
| 613-078-00-1 | N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine | 401-990-0 | 106990-43-6 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-079-00-7 | 4-(1(or 4 or 5 or 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridine, reaction mass of isomers | 402-520-7 | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H312H302H315H317H400H410 | GHS07GHS09Wng | H312H302H315H317H410 |
| 613-080-00-2 | 3-(bis(2-ethylhexyl)aminomethyl)benzothiazole-2(3H)-thione | 402-540-6 | 105254-85-1 | Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H314H317H400H410 | GHS05GHS07GHS09Dgr | H314H317H410 |
| 613-081-00-8 | 1-butyl-2-methylpyridinium bromide | 402-680-8 | 26576-84-1 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 613-082-00-3 | 2-methyl-1-pentylpyridinium bromide | 402-690-2 | — | Acute Tox. 4 ((*))Acute Tox. 4 ((*))Aquatic Chronic 3 | H312H302H412 | GHS07Wng | H312H302H412 |
| 613-083-00-9 | 2-(4-(3-(4-chlorophenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammonium formate | 402-120-2 | — | Skin Corr. 1BSTOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H314H373 (*)(*)H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H314H373 (*)(*)H317H410 |
| 613-084-00-4 | 2-(4-(3-(4-chlorophenyl)-4,5-dihydropyrazolyl)phenylsulphonyl)ethyldimethylammonium hydrogen phosphonate | 402-490-5 | 106359-93-7 | Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H400H410 | GHS07GHS09Wng | H319H410 |
| 613-085-00-X | reaction mass of 1,1'-(methylenebis(4,1-phenylene))dipyrrole-2,5-dione and N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamide and 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrole-2,5-dione | 401-970-1 | — | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 613-086-00-5 | caffeine | 200-362-1 | 58-08-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-087-00-0 | tetrahydrothiophene | 203-728-9 | 110-01-0 | Flam. Liq. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H225H332H312H302H319H315H412 | GHS02GHS07Dgr | H225H332H312H302H319H315H412 |
| 613-088-00-6 | 1,2-benzisothiazol-3(2H)-one;1,2-benzisothiazolin-3-one | 220-120-9 | 2634-33-5 | Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H302H315H318H317H400 | GHS05GHS07GHS09Dgr | H302H315H318H317H400 | Skin Sens. 1; H317: C ≥ 0,05 % |
| 613-089-00-1 | diquat dibromide; [1]diquat dichloride; [2]6,7-dihydrodipyrido[1,2-α:2',1'-c]pyrazinediylium dihydroxide [3] | 201-579-4 [1]223-714-6 [2]301-467-6 [3] | 85-00-7 [1]4032-26-2 [2]94021-76-8 [3] | Acute Tox. 2 (*)STOT RE 1Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H372 (*)(*)H302H319H335H315H317H400H410 | GHS06GHS08GHS09Dgr | H330H372 (*)(*)H302H319H335H315H317H410 |
| 613-090-00-7 | paraquat dichloride;1,1-dimethyl-4,4'-bipyridinium dichloride; [1]paraquat dimethylsulfate;1,1-dimethyl-4,4'-bipyridinium dimethyl sulphate [2] | 217-615-7 [1]218-196-3 [2] | 1910-42-5 [1]2074-50-2 [2] | Acute Tox. 2 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H330H311H301H372 (*)(*)H319H335H315H400H410 | GHS06GHS08GHS09Dgr | H330H311H301H372 (*)(*)H319H335H315H410 |
| 613-091-00-2 | morfamquat dichloride; [1]morfamquat sulfate [2] | 225-062-8 [1]-[2] | 4636-83-3 [1]29873-36-7 [2] | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Chronic 3 | H302H319H335H315H412 | GHS07Wng | H302H319H335H315H412 |
| 613-092-00-8 | 1,10-phenanthroline | 200-629-2 | 66-71-7 | Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 613-093-00-3 | hexasodium 6,13-dichloro-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | 400-050-7 | 85153-92-0 | Resp. Sens. 1Skin Sens. 1 | H334H317 | GHS08Dgr | H334H317 |
| 613-094-00-9 | 4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamine | 401-360-5 | 5248-39-5 | Acute Tox. 4 (*)STOT RE 2 (*) | H302H373 (*)(*) | GHS08GHS07Wng | H302H373 (*)(*) |
| 613-095-00-4 | sodium 3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzenesulfonate | 403-080-9 | 92484-48-5 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 613-096-00-X | 2-amino-6-ethoxy-4-methylamino-1,3,5-triazine | 403-580-7 | 62096-63-3 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-097-00-5 | 7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid | 403-690-5 | 111298-82-9 | Resp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H334H317H412 | GHS08Dgr | H334H317H412 |
| 613-098-00-0 | N-(n-octyl)-2-pyrrolidone | 403-700-8 | 2687-94-7 | Skin Corr. 1BAquatic Chronic 2 | H314H411 | GHS05GHS09Dgr | H314H411 |
| 613-099-00-6 | 1-dodecyl-2-pyrrolidone | 403-730-1 | 2687-96-9 | Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H314H317H400H410 | GHS05GHS07GHS09Dgr | H314H317H410 |
| 613-100-00-X | 2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridine-7,14-dione | 404-230-6 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 613-101-00-5 | N—tert-pentyl-2-benzothiazolesulfenamide | 404-380-2 | 110799-28-5 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 613-102-00-0 | dimethomorph (ISO);4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine | 404-200-2 | 110488-70-5 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 613-103-00-6 | sodium 5-n-butylbenzotriazole | 404-450-2 | 118685-34-0 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H302H314H317H411 | GHS05GHS07GHS09Dgr | H302H314H317H411 |
| 613-104-00-1 | 5-tert-butyl-3-isoxazolylamine hydrochloride | 404-840-2 | — | Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Aquatic Chronic 3 | H302H373 (*)(*)H318H412 | GHS08GHS05GHS07Dgr | H302H373 (*)(*)H318H412 |
| 613-105-00-7 | hexakis(tetramethylammonium) 4,4'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-morpholino-1,3,5-triazine-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalene-2,7-disulfonate) | 405-160-9 | 124537-30-0 | Acute Tox. 3 (*)Skin Sens. 1Aquatic Chronic 3 | H301H317H412 | GHS06Dgr | H301H317H412 |
| 613-106-00-2 | tetrapotassium 2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienylidene)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzene-1,4-disulfonate | 405-240-3 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 613-107-00-8 | hexasodium 2,2'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-(N-cyanoethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazine-4,2-diyl)imino)dibenzene-1,4-disulfonate | 405-280-1 | 76508-02-6 | Eye Irrit. 2 | H319 | GHS07Wng | H319 |
| 613-108-00-3 | benzothiazole-2-thiol | 205-736-8 | 149-30-4 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 613-109-00-9 | bis(piperidinothiocarbonyl) disulphide | 202-328-1 | 94-37-1 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1 | H319H335H315H317 | GHS07Wng | H319H335H315H317 |
| 613-110-00-4 | dimepiperate (ISO);S-(1-methyl-1-phenylethyl) piperidine-1-carbothioate | 262-784-2 | 61432-55-1 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 613-111-00-X | 1,2,4-triazole | 206-022-9 | 288-88-0 | Repr. 2Acute Tox. 4 (*)Eye Irrit. 2 | H361d (*)(*)(*)H302H319 | GHS08GHS07Wng | H361d (*)(*)(*)H302H319 |
| 613-112-00-5 | octhilinone (ISO);2-octyl-2H-isothiazol-3-one | 247-761-7 | 26530-20-1 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H311H302H314H317H400H410 | GHS06GHS05GHS09Dgr | H331H311H302H314H317H410 | Skin Sens. 1; H317: C ≥ 0,05 % |
| 613-113-00-0 | 2-(morpholinothio)benzothiazole | 203-052-4 | 102-77-2 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H315H317H411 | GHS07GHS09Wng | H319H315H317H411 |
| 613-114-00-6 | 2,2',2"-(hexahydro-1,3,5-triazine-1,3,5-triyl)triethanol;1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazine | 225-208-0 | 4719-04-4 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 | Skin Sens. 1; H317: C ≥ 0,1 % |
| 613-115-00-1 | hymexazol (ISO);3-hydroxy-5-methylisoxazole | 233-000-6 | 10004-44-1 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Chronic 3 | H302H318H412 | GHS05GHS07Dgr | H302H318H412 |
| 613-116-00-7 | tolylfluanid (ISO);dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide | 211-986-9 | 731-27-1 | Acute Tox. 3 (*)STOT RE 2 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H373 (*)(*)H319H335H315H317H400H410 | GHS06GHS08GHS09Dgr | H331H373 (*)(*)H319H335H315H317H410 |
| 613-117-00-2 | diniconazole (ISO);(E)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol;(E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol | — | 76714-88-0 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-118-00-8 | flubenzimine (ISO);N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]thiazolidin-2-ylidene]aniline | 253-703-1 | 37893-02-0 | Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H319H400H410 | GHS07GHS09Wng | H319H410 |
| 613-119-00-3 | (benzothiazol-2-ylthio)methyl thiocyanate;TCMTB | 244-445-0 | 21564-17-0 | Acute Tox. 2 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H330H302H319H315H317H400H410 | GHS06GHS09Dgr | H330H302H319H315H317H410 |
| 613-120-00-9 | bioresmethrin;(5-bezylfur-3-yl)methyl(1R)-trans-2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboylate | 249-014-0 | 28434-01-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-121-00-4 | chlorsulfuron (ISO);2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulphonamide | 265-268-5 | 64902-72-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-122-00-X | diclobutrazole (ISO);(R(*), R(*))-(±)-β-[(2,4-dichlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol;(2RS, 3RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol | — | 75736-33-3 | Eye Irrit. 2Aquatic Chronic 2 | H319H411 | GHS07GHS09Wng | H319H411 |
| 613-123-00-5 | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione;etem | 251-684-4 | 33813-20-6 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-124-00-0 | fenpropimorph (ISO);cis-4-[3-(p—tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine | 266-719-9 | 67564-91-4 | Repr. 2Acute Tox. 4 (*)Skin Irrit. 2Aquatic Chronic 2 | H361d (*)(*)(*)H302H315H411 | GHS08GHS07GHS09Wng | H361d (*)(*)(*)H302H315H411 |
| 613-125-00-6 | hexythiazox(ISO);trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide | — | 78587-05-0 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-126-00-1 | imazapyr (ISO);2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate | — | 81334-34-1 | Eye Irrit. 2Aquatic Chronic 3 | H319H412 | GHS07Wng | H319H412 |
| 613-127-00-7 | 1,1-dimethylpiperidinium chloride;mepiquat chloride | 246-147-6 | 24307-26-4 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 613-128-00-2 | prochloraz (ISO);N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide | 266-994-5 | 67747-09-5 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-129-00-8 | metamitron (ISO);4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one | 255-349-3 | 41394-05-2 | Acute Tox. 4 (*)Aquatic Acute 1 | H302H400 | GHS07GHS09Wng | H302H400 |
| 613-131-00-9 | pyroquilon (ISO);1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one | — | 57369-32-1 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 613-132-00-4 | hexazinone (ISO);3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione | 257-074-4 | 51235-04-2 | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H302H319H400H410 | GHS07GHS09Wng | H302H319H410 |
| 613-133-00-X | etridiazole (ISO);5-ethoxy-3-trichloromethyl-1,2,4-thiadiazole | 219-991-8 | 2593-15-9 | Carc. 2Acute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H351H331H312H302H400H410 | GHS06GHS08GHS09Dgr | H351H331H312H302H410 |
| 613-134-00-5 | myclobutanil(ISO);2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile | — | 88671-89-0 | Repr. 2Acute Tox. 4 (*)Eye Irrit. 2Aquatic Chronic 2 | H361d (*)(*)(*)H302H319H411 | GHS08GHS07GHS09Wng | H361d (*)(*)(*)H302H319H411 |
| 613-135-00-0 | di(benzothiazol-2-yl) disulphide | 204-424-9 | 120-78-5 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 | EUH031 |
| 613-136-00-6 | N-cyclohexylbenzothiazole-2-sulphenamide | 202-411-2 | 95-33-0 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 613-137-00-1 | methabenzthiazuron (ISO);1-(1,3-benzothiazol-2-yl)1,3-dimethylurea | 242-505-0 | 18691-97-9 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-138-00-7 | quinoxyfen (ISO);5,7-dichloro-4-(4-fluorophenoxy)quinoline | — | 124495-18-7 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 613-139-00-2 | metsulfuron-methyl;2-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl) benzoic acid | — | 74223-64-6 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-140-00-8 | cycloheximide (ISO);4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione | 200-636-0 | 66-81-9 | Muta. 2Repr. 1BAcute Tox. 2 (*)Aquatic Chronic 2 | H341H360D (*)(*)(*)H300H411 | GHS06GHS08GHS09Dgr | H341H360D (*)(*)(*)H300H411 |
| 613-141-00-3 | 1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinone | 401-470-3 | 93686-63-6 | Aquatic Chronic 4 | H413 | — | H413 |
| 613-142-00-9 | trans—N-methyl-2-styryl-[4'-aminomethine-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridinium acetate | 405-860-4 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-143-00-4 | 1-(3-phenylpropyl)-2-methylpyridinium bromide | 405-930-4 | 10551-42-5 | Acute Tox. 4 (*)Eye Irrit. 2Aquatic Chronic 3 | H302H319H412 | GHS07Wng | H302H319H412 |
| 613-144-00-X | reaction products of: poly(vinyl acetate), partially hydrolyzed, with (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethyl sulfate | 406-460-2 | 125139-08-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 613-145-00-5 | (S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium 4-methylbenzenesulfonate | 406-960-0 | 77497-97-3 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 613-146-00-0 | N-ethyl-N-methylpiperidinium iodide | 407-780-5 | 4186-71-4 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 613-147-00-6 | 4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholine | 407-940-4 | 111681-72-2 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 613-148-00-1 | tetrasodium 1,2-bis(4-fluoro-6-[5-(1-amino-2-sulfonatoanthrachinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethane | 411-240-4 | 143683-23-2 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 613-149-00-7 | pyridaben (ISO);2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one | 405-700-3 | 96489-71-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)Aquatic Acute 1Aquatic Chronic 1 | H331H301H400H410 | GHS06GHS09Dgr | H331H301H410 |
| 613-150-00-2 | 2,2'-[3,3'-(piperazine-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l,m,n][3,8]phenanthroline-1,3,6-trione | 406-295-6 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 613-151-00-8 | 1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymine | 406-360-9 | 104218-44-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 613-152-00-3 | phenyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate | 406-600-2 | 89392-03-0 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-153-00-9 | 2,3,5-trichloropyridine | 407-270-2 | 16063-70-0 | Aquatic Chronic 3 | H412 | — | H412 |
| 613-154-00-4 | 2-amino-4-chloro-6-methoxypyrimidine | 410-050-9 | 5734-64-5 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-155-00-X | 5-chloro-2,3-difluoropyridine | 410-090-7 | 89402-43-7 | Flam. Liq. 3Acute Tox. 4 (*)Aquatic Chronic 3 | H226H302H412 | GHS02GHS07Wng | H226H302H412 |
| 613-156-00-5 | 2-butyl-4-chloro-5-formylimidazole | 410-260-0 | 83857-96-9 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-157-00-0 | 2,4-diamino-5-methoxymethylpyrimidine | 410-330-0 | 54236-98-5 | Acute Tox. 4 (*)STOT RE 2 (*)Eye Irrit. 2 | H302H373 (*)(*)H319 | GHS08GHS07Wng | H302H373 (*)(*)H319 |
| 613-158-00-6 | 2,3-dichloro-5-trifluoromethyl-pyridine | 410-340-5 | 69045-84-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H332H302H318H317H411 | GHS05GHS07GHS09Dgr | H332H302H318H317H411 |
| 613-159-00-1 | fenazaquin (ISO);4-[2-[4-(1,1-dimethylethyl)phenyl]-ethoxy]quinazoline | 410-580-0 | 120928-09-8 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H301H332H400H410 | GHS06GHS09Dgr | H301H332H410 |
| 613-160-00-7 | (1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptane dihydrobromide | 411-000-9 | 125224-62-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 613-163-00-3 | azimsulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urea | — | 120162-55-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-164-00-9 | flufenacet (ISO);N-(4-fluorophenyl)-N-isopropyl-2-(5-trifluoromethyl-[1,3,4]thiadiazol-2-yloxy)acetamide | — | 142459-58-3 | Acute Tox. 4 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 (*)(*)H317H400H410 | GHS08GHS07GHS09Wng | H302H373 (*)(*)H317H410 |
| 613-165-00-4 | flupyrsulfuron-methyl-sodium (ISO);methyl 2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluoromethyl]nicotinate, monosodium salt | — | 144740-54-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-166-00-X | flumioxazin (ISO);N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide | — | 103361-09-7 | Repr. 1BAquatic Acute 1Aquatic Chronic 1 | H360D (*)(*)(*)H400H410 | GHS08GHS09Dgr | H360D (*)(*)(*)H410 |
| 613-167-00-5 | reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-2H -isothiazol-3-one [EC no. 220-239-6] (3:1);reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-4-isothiazolin-3-one [EC no. 220-239-6] (3:1) | — | 55965-84-9 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H311H301H314H317H400H410 | GHS06GHS05GHS09Dgr | H331H311H301H314H317H410 | Skin Corr. 1B; H314: C ≥ 0,6 %Skin Irrit. 2; H315: 0,06 % ≤ C < 0,6 %Eye Irrit. 2; H319: 0,06 % ≤ C < 0,6 %Skin Sens. 1; H317: C ≥ 0,0015 % |
| 613-168-00-0 | 1-vinyl-2-pyrrolidone | 201-800-4 | 88-12-0 | Carc. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)STOT SE 3Eye Dam. 1 | H351H332H312H302H373 (*)(*)H335H318 | GHS06GHS05GHS09Dgr | H351H332H312H302H373 (*)(*)H335H318 | D |
| 613-169-00-6 | 9-vinylcarbazole | 216-055-0 | 1484-13-5 | Muta. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H341H312H302H315H317H400H410 | GHS08GHS07GHS09Wng | H341H312H302H315H317H410 |
| 613-170-00-1 | 2,2-ethylmethylthiazolidine | 404-500-3 | 694-64-4 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 613-171-00-7 | hexaconazole (ISO);(RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol | 413-050-7 | 79983-71-4 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H302H317H411 | GHS07GHS09Wng | H302H317H411 |
| 613-172-00-2 | 5-chloro-1,3-dihydro-2H-indol-2-one | 412-200-9 | 17630-75-0 | Repr. 2Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 3 | H361f (*)(*)(*)H302H317H412 | GHS08GHS07Wng | H361f (*)(*)(*)H302H317H412 |
| 613-173-00-8 | fluquinconazole (ISO);3-(2,4-dichlorophenyl)-6-fluoro-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-one | 411-960-9 | 136426-54-5 | Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 1Acute Tox. 4 (*)Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H331H301H372 (*)(*)H312H315H400H410 | GHS06GHS08GHS09Dgr | H331H301H372 (*)(*)H312H315H410 |
| 613-174-00-3 | (±) 2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether | 407-760-6 | 112281-77-3 | Carc. 2Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H351H332H302H411 | GHS08GHS07GHS09Wng | H351H332H302H411 |
| 613-175-00-9 | epoxiconazole(ISO);(2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane | 406-850-2 | 133855-98-8 | Carc. 2Repr. 2Aquatic Chronic 2 | H351H361fdH411 | GHS08GHS09Wng | H351H361fdH411 |
| 613-176-00-4 | 2-methyl-2-azabicyclo[2.2.1]heptane | 404-810-9 | 4524-95-2 | Flam. Liq. 3Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1B | H226H312H302H373 (*)(*)H314 | GHS02GHS08GHS05GHS07Dgr | H226H312H302H373 (*)(*)H314 |
| 613-177-00-X | 8-amino-7-methylquinoline | 412-760-4 | 5470-82-6 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Chronic 2 | H312H302H317H411 | GHS07GHS09Wng | H312H302H317H411 |
| 613-178-00-5 | 4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidine | 410-470-2 | 137796-06-6 | Skin Corr. 1BSkin Sens. 1 | H314H317 | GHS05GHS07Dgr | H314H317 | STOT SE 3; H335: C ≥ 5 % |
| 613-179-00-0 | lithium 3-oxo-1,2(2H)-benzisothiazol-2-ide | 411-690-1 | 111337-53-2 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Chronic 2 | H302H314H317H411 | GHS05GHS07Dgr | H302H314H317H411 |
| 613-180-00-6 | N-(1,1-dimethylethyl)bis(2-benzothiazolesulfen)amide | 407-430-1 | 3741-80-8 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-181-00-1 | 5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | 405-090-9 | 67485-29-4 | STOT RE 1Acute Tox. 4 (*)Eye Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H372 (*)(*)H302H319H400H410 | GHS08GHS07GHS09Dgr | H372 (*)(*)H302H319H410 |
| 613-182-00-7 | 1-(1-naphthylmethyl)quinolinium chloride | 406-220-7 | 65322-65-8 | Carc. 2Muta. 2Acute Tox. 4 (*)Skin Irrit. 2Eye Dam. 1Aquatic Chronic 3 | H351H341H302H315H318H412 | GHS08GHS05GHS07Dgr | H351H341H302H315H318H412 |
| 613-183-00-2 | reaction mass of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one;5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one | 413-640-4 | — | STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H400H410 | GHS08GHS09Wng | H373 (*)(*)H410 |
| 613-184-00-8 | nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate | 413-670-8 | — | Eye Irrit. 2Skin Sens. 1 | H319H317 | GHS07Wng | H319H317 |
| 613-185-00-3 | 2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one | 407-630-9 | 82633-79-2 | Acute Tox. 3 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H301H318H317H400H410 | GHS06GHS05GHS09Dgr | H301H318H317H410 |
| 613-186-00-9 | (2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate | 408-050-9 | 76855-69-1 | Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H317H411 | GHS07GHS09Wng | H319H317H411 |
| 613-188-00-X | 1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinone | 411-500-7 | 116256-11-2 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 613-189-00-5 | 1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane | 414-030-0 | 52667-88-6 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 613-190-00-0 | disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate | 414-040-5 | 149530-93-8 | Acute Tox. 4 (*)Skin Sens. 1 | H302H317 | GHS07Wng | H302H317 |
| 613-191-00-6 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 421-150-7 | 143860-04-2 | Repr. 1BSkin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H360F (*)(*)(*)H314H400H410 | GHS08GHS05GHS09Dgr | H360F (*)(*)(*)H314H410 |
| 613-193-00-7 | pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate | 414-930-3 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 613-194-00-2 | 6,13-dichloro-3,10-bis{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt | 418-000-8 | 163062-28-0 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 613-195-00-8 | 2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) | 418-280-1 | 18600-59-4 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 613-196-00-3 | 5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt | 418-380-5 | 168113-78-8 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 613-197-00-9 | reaction mass of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine;2,4,6-tri(methylcarbamoyl)-1,3,5-triazine;[(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine;[(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine | 420-390-1 | 187547-46-2 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-199-00-X | reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione;reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | 421-550-1 | — | Carc. 1BRepr. 1BSkin Sens. 1Aquatic Chronic 3 | H350H360D (*)(*)(*)H317H412 | GHS08Dgr | H350H360D (*)(*)(*)H317H412 |
| 613-200-00-3 | Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfonyl)aniline, sodium salts | 420-980-7 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 613-201-00-9 | (R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole | 422-390-5 | 143322-57-0 | Repr. 2STOT RE 1Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361f (*)(*)(*)H372 (*)(*)H332H302H317H400H410 | GHS08GHS07GHS09Dgr | H361f (*)(*)(*)H372 (*)(*)H332H302H317H410 | EUH070 |
| 613-202-00-4 | pymetrozine (ISO);(E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | — | 123312-89-0 | Carc. 2Aquatic Chronic 3 | H351H412 | GHS08Wng | H351H412 |
| 613-203-00-X | pyraflufen-ethyl; [1]pyraflufen [2] | -[1]-[2] | 129630-19-9 [1]129630-17-7 [2] | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-204-00-5 | oxadiargyl (ISO);3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one;5-tert-butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one | 254-637-6 | 39807-15-3 | Repr. 2STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H361d (*)(*)(*)H373 (*)(*)H400H410 | GHS08GHS09Wng | H361d (*)(*)(*)H373 (*)(*)H410 |
| 613-205-00-0 | propiconazole(ISO);(±) 1-[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole | 262-104-4 | 60207-90-1 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 613-206-00-6 | fenamidone (ISO);(S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one | — | 161326-34-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-208-00-7 | imazamox (ISO);(RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid | — | 114311-32-9 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-209-00-2 | cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride | 417-430-3 | 63645-17-0 | Acute Tox. 3 (*)STOT RE 2 (*)Skin Sens. 1Aquatic Chronic 2 | H301H373 (*)(*)H317H411 | GHS06GHS08GHS09Dgr | H301H373 (*)(*)H317H411 |
| 613-210-00-8 | 2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane | 417-650-1 | 88128-57-8 | STOT RE 2 (*)Aquatic Chronic 3 | H373 (*)(*)H412 | GHS08Wng | H373 (*)(*)H412 |
| 613-211-00-3 | N-methyl-4-(p-formylstyryl)pyridinium methylsulfate | 418-240-3 | 74401-04-0 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 613-212-00-9 | 4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinane-1,1-dioxide) | 418-320-8 | 133467-41-1 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 613-213-00-4 | cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline | 416-040-0 | 120807-02-5 | Aquatic Chronic 3 | H412 | — | H412 |
| 613-214-00-X | N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide | 416-260-7 | 147613-95-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 613-215-00-5 | 2-chloromethyl-3,4-dimethoxypyridinium chloride | 416-440-5 | 72830-09-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H312H302H373 (*)(*)H315H318H317H411 | GHS08GHS05GHS07GHS09Dgr | H312H302H373 (*)(*)H315H318H317H411 |
| 613-216-00-0 | 6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole | 416-490-8 | 162208-01-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-217-00-6 | 4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidine | 416-770-1 | 73754-27-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 613-218-00-1 | 6-hydroxyindole | 417-020-4 | 2380-86-1 | Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H302H318H317H411 | GHS05GHS07GHS09Dgr | H302H318H317H411 |
| 613-219-00-7 | 7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole | 417-140-7 | 79185-77-6 | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 613-220-00-2 | trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide | 417-290-3 | 147086-81-5 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 613-221-00-8 | 2-chloro-5-methyl-pyridine | 418-050-0 | 18368-64-4 | Acute Tox. 4 (*)Acute Tox. 4 (*)Skin Irrit. 2Aquatic Chronic 3 | H312H302H315H412 | GHS07Wng | H312H302H315H412 |
| 613-222-00-3 | 4-(1-oxo-2-propenyl)-morpholine | 418-140-1 | 5117-12-4 | Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1 | H302H373 (*)(*)H318H317 | GHS08GHS05GHS07Dgr | H302H373 (*)(*)H318H317 |
| 613-223-00-9 | N-isopropyl-3-(4-fluorophenyl)-1H-indole | 418-790-4 | 93957-49-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 613-224-00-4 | 2,5-dimercaptomethyl-1,4-dithiane | 419-770-8 | 136122-15-1 | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H302H314H317H410 |
| 613-225-00-X | reaction mass of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine;2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. | 421-290-9 | — | STOT RE 2 (*)Aquatic Chronic 4 | H373 (*)(*)H413 | GHS08Wng | H373 (*)(*)H413 |
| 613-226-00-5 | 1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl)-pyridinium dichloride | 420-950-3 | 163831-67-2 | Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H318H400H410 | GHS05GHS09Dgr | H318H410 |
| 613-227-00-0 | (±)-[(R(*),R(*)) and (R(*),S(*))]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | 419-600-2 | 99199-90-3 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 613-228-00-6 | (±)-(R(*),S(*))-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | 419-630-6 | 793669-26-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 613-230-00-7 | florasulam (ISO);2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c];pyrimidine-2-sulfonanilide | — | 145701-23-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 613-233-00-3 | 4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane | 423-230-7 | 56552-15-9 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 614-001-00-4 | nicotine (ISO);3-(N-methyl-2-pyrrolidinyl)pyridine | 200-193-3 | 54-11-5 | Acute Tox. 1Acute Tox. 3 (*)Aquatic Chronic 2 | H310H301H411 | GHS06GHS09Dgr | H310H301H411 |
| 614-002-00-X | salts of nicotine | — | — | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*)Aquatic Chronic 2 | H330H310H300H411 | GHS06GHS09Dgr | H330H310H300H411 | A |
| 614-003-00-5 | strychnine | 200-319-7 | 57-24-9 | Acute Tox. 1Acute Tox. 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H310H300H400H410 | GHS06GHS09Dgr | H310H300H410 |
| 614-004-00-0 | salts of strychnine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H330H300H400H410 | GHS06GHS09Dgr | H330H300H410 | A |
| 614-005-00-6 | colchicine | 200-598-5 | 64-86-8 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-006-00-1 | brucine;2,3-dimethoxystrychnine | 206-614-7 | 357-57-3 | Acute Tox. 2 (*)Acute Tox. 2 (*)Aquatic Chronic 3 | H330H300H412 | GHS06Dgr | H330H300H412 |
| 614-007-00-7 | brucine sulphate; [1]brucine nitrate; [2]strychnidin-10-one, 2,3-dimethoxy-, mono[(R)-1-methylheptyl 1,2-benzenedicarboxylate]; [3]strychnidin-10-one, 2,3-dimethoxy-, compd. with (S)mono(1-methylheptyl)-1,2-benzenedicarboxylate (1:1) [4] | 225-432-9 [1]227-317-9 [2]269-439-5 [3]269-710-8 [4] | 4845-99-2 [1]5786-97-0 [2]68239-26-9 [3]68310-42-9 [4] | Acute Tox. 2 (*)Acute Tox. 2 (*)Aquatic Chronic 3 | H330H300H412 | GHS06Dgr | H330H300H412 | A |
| 614-008-00-2 | aconitine | 206-121-7 | 302-27-2 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-009-00-8 | salts of aconitine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 | A |
| 614-010-00-3 | atropine | 200-104-8 | 51-55-8 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-011-00-9 | salts of atropine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 | A |
| 614-012-00-4 | hyoscyamine | 202-933-0 | 101-31-5 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-013-00-X | salts of hyoscyamine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 | A |
| 614-014-00-5 | hyoscine | 200-090-3 | 51-34-3 | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*) | H330H310H300 | GHS06Dgr | H330H310H300 |
| 614-015-00-0 | salts of hyoscine | — | — | Acute Tox. 2 (*)Acute Tox. 1Acute Tox. 2 (*) | H330H310H300 | GHS06Dgr | H330H310H300 | A |
| 614-016-00-6 | pilocarpine | 202-128-4 | 92-13-7 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-017-00-1 | salts of pilocarpine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 | A |
| 614-018-00-7 | papaverine | 200-397-2 | 58-74-2 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 614-019-00-2 | salts of papaverine | — | — | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 | A |
| 614-020-00-8 | physostigmine | 200-332-8 | 57-47-6 | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 |
| 614-021-00-3 | salts of physostigmine | — | — | Acute Tox. 2 (*)Acute Tox. 2 (*) | H330H300 | GHS06Dgr | H330H300 | A |
| 614-022-00-9 | digitoxin | 200-760-5 | 71-63-6 | Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H331H301H373 (*)(*) | GHS06GHS08Dgr | H331H301H373 (*)(*) |
| 614-023-00-4 | ephedrine | 206-080-5 | 299-42-3 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 614-024-00-X | salts of ephedrine | — | — | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 | A |
| 614-025-00-5 | ouabain | 211-139-3 | 630-60-4 | Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H331H301H373 (*)(*) | GHS06GHS08Dgr | H331H301H373 (*)(*) |
| 614-026-00-0 | strophantin-K | 234-239-9 | 11005-63-3 | Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*) | H331H301H373 (*)(*) | GHS06GHS08Dgr | H331H301H373 (*)(*) |
| 614-027-00-6 | bufa-4,20,22-trienolide, 6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxy-, (3β, 6β)-;red squill;scilliroside | 208-077-4 | 507-60-8 | Acute Tox. 2 (*) | H300 | GHS06Dgr | H300 |
| 614-028-00-1 | reaction mass of: 2-ethylhexyl mono-D-glucopyranoside;2-ethylhexyl di-D-glucopyranoside | 414-420-0 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 614-029-00-7 | constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside;constitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside;constitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside | 419-640-0 | 68784-14-5 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 615-001-00-7 | methyl isocyanate | 210-866-3 | 624-83-9 | Flam. Liq. 2Repr. 2Acute Tox. 2 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT SE 3Skin Irrit. 2Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H225H361d (*)(*)(*)H330H311H301H335H315H318H334H317 | GHS02GHS06GHS06GHS08GHS05Dgr | H225H361d (*)(*)(*)H330H311H301H335H315H318H334H317 |
| 615-002-00-2 | methyl isothiocyanate | 209-132-5 | 556-61-6 | Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H301H314H317H400H410 | GHS06GHS05GHS09Dgr | H331H301H314H317H410 |
| 615-003-00-8 | thiocyanic acid | 207-337-4 | 463-56-9 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H332H312H302H412 | GHS07Wng | H332H312H302H412 | EUH032 |
| 615-004-00-3 | salts of thiocyanic acid | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H332H312H302H412 | GHS07Wng | H332H312H302H412 | EUH032 | A |
| 615-005-00-9 | 4,4'-methylenediphenyl diisocyanate;diphenylmethane-4,4'-diisocyanate; [1]2,2'-methylenediphenyl diisocyanate;diphenylmethane-2,2'-diisocyanate; [2]o-(p-isocyanatobenzyl)phenyl isocyanate;diphenylmethane-2,4'-diisocyanate; [3]methylenediphenyl diisocyanate [4] | 202-966-0 [1]219-799-4 [2]227-534-9 [3]247-714-0 [4] | 101-68-8 [1]2536-05-2 [2]5873-54-1 [3]26447-40-5 [4] | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1 | H332H319H335H315H334H317 | GHS08GHS07Dgr | H332H319H335H315H334H317 | Eye Irrit.; H319: C ≥ 5 %STOT SE 3; H335: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 %Resp. Sens. 1; H334: C ≥ 0,1 % | C2 |
| 615-006-00-4 | 2-methyl-m-phenylene diisocyanate;toluene-2,4-di-isocyanate; [1]4-methyl-m-phenylene diisocyanate;toluene-2,6-di-isocyanate; [2]m-tolylidene diisocyanate;toluene-diisocyanate [3] | 202-039-0 [1]209-544-5 [2]247-722-4 [3] | 91-08-7 [1]584-84-9 [2]26471-62-5 [3] | Carc. 2Acute Tox. 2 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H351H330H319H335H315H334H317H412 | GHS06GHS08Dgr | H351H330H319H335H315H334H317H412 | Resp. Sens. 1; H334: C ≥ 0,1 % | C |
| 615-007-00-X | 1,5-naphthylene diisocyanate | 221-641-4 | 3173-72-6 | Acute Tox. 4 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Aquatic Chronic 3 | H332H319H335H315H334H412 | GHS08GHS07Dgr | H332H319H335H315H334H412 |
| 615-008-00-5 | 3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate;isophorone di-isocyanate | 223-861-6 | 4098-71-9 | Acute Tox. 3 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1Aquatic Chronic 2 | H331H319H335H315H334H317H411 | GHS06GHS08GHS09Dgr | H331H319H335H315H334H317H411 | (*)Resp. Sens. 1; H334: C ≥ 0,5 %Skin Sens.1; H317: C ≥ 0,5 % | 2 |
| 615-009-00-0 | 4,4'-methylenedi(cyclohexyl isocyanate);dicyclohexylmethane-4,4'-di-isocyanate | 225-863-2 | 5124-30-1 | Acute Tox. 3 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1 | H331H319H335H315H334H317 | GHS06GHS08Dgr | H331H319H335H315H334H317 | (*)Resp. Sens. 1; H334: C ≥ 0,5 %Skin Sens. 1; H317: C ≥ 0,5 % | 2 |
| 615-010-00-6 | 2,2,4-trimethylhexamethylene-1,6-di-isocyanate; [1]2,4,4-trimethylhexamethylene-1,6-di-isocyanate [2] | 241-001-8 [1]239-714-4 [2] | 16938-22-0 [1]15646-96-5 [2] | Acute Tox. 3 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H331H319H335H315H334 | GHS06GHS08Dgr | H331H319H335H315H334 | (*)Resp. Sens. 1; H334: C ≥ 0,5 %Skin Sens. 1; H317: C ≥ 0,5 % | C2 |
| 615-011-00-1 | hexamethylene-di-isocyanate | 212-485-8 | 822-06-0 | Acute Tox. 3 (*)Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1Skin Sens. 1 | H331H319H335H315H334H317 | GHS06GHS08Dgr | H331H319H335H315H334H317 | (*)Resp. Sens. 1; H334: C ≥ 0,5 %Skin Sens. 1; H317: C ≥ 0,5 % | 2 |
| 615-012-00-7 | 4-isocyanatosulphonyltoluene;tosyl isocyanate | 223-810-8 | 4083-64-1 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 | EUH014 | Eye Irrit.; H319: C ≥ 5 %STOT SE 3; H335: C ≥ 5 %Skin Irrit. 2; H315: C ≥ 5 % |
| 615-013-00-2 | cyanamide;carbanonitril | 206-992-3 | 420-04-2 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H301H312H319H315H317 | GHS06Dgr | H301H312H319H315H317 |
| 615-014-00-8 | tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrate | — | 7276-58-6 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 615-015-00-3 | 1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate;isobornyl thiocyanoacetate | 204-081-5 | 115-31-1 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 615-016-00-9 | potassium cyanate | 209-676-3 | 590-28-3 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 615-017-00-4 | calcium cyanamide | 205-861-8 | 156-62-7 | Acute Tox. 4 (*)STOT SE 3Eye Dam. 1 | H302H335H318 | GHS05GHS07Dgr | H302H335H318 |
| 615-018-00-X | 2-(2-butoxyethoxy)ethyl thiocyanate | 203-985-7 | 112-56-1 | Flam. Liq. 3Acute Tox. 3 (*)Acute Tox. 3 (*) | H226H311H301 | GHS02GHS06Dgr | H226H311H301 |
| 615-019-00-5 | dicyclohexylcarbodiimide | 208-704-1 | 538-75-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1 | H311H302H318H317 | GHS06GHS05Dgr | H311H302H318H317 |
| 615-020-00-0 | methylene dithiocyanate | 228-652-3 | 6317-18-6 | Acute Tox. 2 (*)Acute Tox. 3 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1 | H330H301H314H317H400 | GHS06GHS05GHS09Dgr | H330H301H314H317H400 |
| 615-021-00-6 | 1,3,5-tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione;TGIC | 219-514-3 | 2451-62-9 | Muta. 1BAcute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H340H331H301H373 (*)(*)H318H317H412 | GHS06GHS08GHS05Dgr | H340H331H301H373 (*)(*)H318H317H412 |
| 615-022-00-1 | methyl 3-isocyanatosulfonyl-2-thiophene-carboxylate | 410-550-7 | 79277-18-2 | STOT RE 2 (*)Resp. Sens. 1Skin Sens. 1 | H373 (*)(*)H334H317 | GHS08Dgr | E; R2H373 (*)(*)H334H317 | EUH014 |
| 615-023-00-7 | 2-(isocyanatosulfonylmethyl)benzoic acid methyl ester;(alt.):methyl 2-(isocyanatosulfonylmethyl)benzoate | 410-900-9 | 83056-32-0 | Flam. Liq. 3Muta. 2Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Resp. Sens. 1 | H226H341H332H373 (*)(*)H318H334 | GHS02GHS08GHS05GHS07Dgr | H226H341H332H373 (*)(*)H318H334 | EUH014 |
| 615-024-00-2 | 2-phenylethylisocyanate | 413-080-0 | 1943-82-4 | Acute Tox. 3 (*)Acute Tox. 4 (*)Skin Corr. 1AResp. Sens. 1Skin Sens. 1Aquatic Chronic 2 | H331H302H314H334H317H411 | GHS06GHS08GHS05GHS09Dgr | H331H302H314H334H317H411 |
| 615-025-00-8 | 4,4'-ethylidenediphenyl dicyanate | 405-740-1 | 47073-92-7 | Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H332H302H373 (*)(*)H318H400H410 | GHS08GHS05GHS07GHS09Dgr | H332H302H373 (*)(*)H318H410 |
| 615-026-00-3 | 4,4'-methylenebis(2,6-dimethylphenyl cyanate) | 405-790-4 | 101657-77-6 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 615-028-00-4 | ethyl 2-(isocyanatosulfonyl)benzoate | 410-220-2 | 77375-79-2 | (*)(*)(*)(*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Resp. Sens. 1Skin Sens. 1 | H302H373 (*)(*)H318H334H317 | GHS08GHS05GHS07Dgr | E; R2H302H373 (*)(*)H318H334H317 | EUH014 |
| 615-029-00-X | 2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane | 411-280-2 | — | Acute Tox. 2 (*)Acute Tox. 4 (*)Skin Corr. 1BResp. Sens. 1Skin Sens. 1Aquatic Chronic 3 | H330H302H314H334H317H412 | GHS06GHS08GHS05Dgr | H330H302H314H334H317H412 |
| 615-030-00-5 | alkali salts, alkali earth salts and other salts of thiocyanic acid not mentioned elsewhere in this Annex | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 3 | H332H312H302H412 | GHS07Wng | H332H312H302H412 | EUH032 | A |
| 615-031-00-0 | thallium salt of thiocyanic acid | 222-571-7 | 3535-84-0 | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Chronic 2 | H332H312H302H411 | GHS07GHS09Wng | H332H312H302H411 | EUH032 | A |
| 615-032-00-6 | metal salts of thiocyanic acid not mentioned elsewhere in this Annex | — | — | Acute Tox. 4 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H332H312H302H400H410 | GHS07GHS09Wng | H332H312H302H410 | EUH032 | A |
| 616-001-00-X | N,N-dimethylformamide;dimethyl formamide | 200-679-5 | 68-12-2 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2 | H360D (*)(*)(*)H332H312H319 | GHS08GHS07Dgr | H360D (*)(*)(*)H332H312H319 |
| 616-002-00-5 | 2-fluoroacetamide | 211-363-1 | 640-19-7 | Acute Tox. 2 (*)Acute Tox. 3 (*) | H300H311 | GHS06Dgr | H300H311 |
| 616-003-00-0 | acrylamide;prop-2-enamide | 201-173-7 | 79-06-1 | Carc. 1BMuta. 1BRepr. 2Acute Tox. 3 (*)STOT RE 1Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 | H350H340H361f (*)(*)(*)H301H372 (*)(*)H332H312H319H315H317 | GHS06GHS08Dgr | H350H340H361f (*)(*)(*)H301H372 (*)(*)H332H312H319H315H317 | D |
| 616-004-00-6 | allidochlor (ISO);N,N-diallylchloroacetamide | 202-270-7 | 93-71-0 | Acute Tox. 4 (*)Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H312H302H319H315H411 | GHS07GHS09Wng | H312H302H319H315H411 |
| 616-005-00-1 | chlorthiamid (ISO);2,6-dichloro (thiobenzamide) | 217-637-7 | 1918-13-4 | Acute Tox. 4 (*) | H302 | GHS07Wng | H302 |
| 616-006-00-7 | dichlofluanid (ISO);N-dichlorofluoromethylthio-N',N'-dimethyl-N-phenylsulphamide | 214-118-7 | 1085-98-9 | Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H319H317H400H410 | GHS07GHS09Wng | H332H319H317H410 |
| 616-007-00-2 | diphenamid (ISO);N,N-dimethyl-2,2-diphenylacetamide | 213-482-4 | 957-51-7 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 616-008-00-8 | propachlor (ISO);2-chloro-N-isopropylacetanilide;α-chloro-N-isopropylacetanilide | 217-638-2 | 1918-16-7 | Acute Tox. 4 (*)Eye Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H319H317H400H410 | GHS07GHS09Wng | H302H319H317H410 |
| 616-009-00-3 | propanil (ISO);3',4'-dichloropropionanilide | 211-914-6 | 709-98-8 | Acute Tox. 4 (*)Aquatic Acute 1 | H302H400 | GHS07GHS09Wng | H302H400 |
| 616-010-00-9 | tosylchloramide sodium | 204-854-7 | 127-65-1 | Acute Tox. 4 (*)Skin Corr. 1BResp. Sens. 1 | H302H314H334 | GHS08GHS05GHS07Dg | H302H314H334 | EUH031 |
| 616-011-00-4 | N,N-dimethylacetamide | 204-826-4 | 127-19-5 | Repr. 1BAcute Tox. 4 (*)Acute Tox. 4 (*) | H360D (*)(*)(*)H332H312 | GHS08GHS07Dgr | H360D (*)(*)(*)H332H312 | Repr. 1B; H360D: C ≥ 5 % |
| 616-012-00-X | N-(dichlorofluoromethylthio)phthalimide;N-(fluorodichloromethylthio)phthalimide | 211-952-3 | 719-96-0 | Skin Irrit. 2 | H315 | GHS07Wng | H315 |
| 616-013-00-5 | butyraldehyde oxime | 203-792-8 | 110-69-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)Eye Irrit. 2 | H311H302H319 | GHS06Dgr | H311H302H319 |
| 616-014-00-0 | 2-butanone oxime;ethyl methyl ketoxime;ethyl methyl ketone oxime | 202-496-6 | 96-29-7 | Carc. 2Acute Tox. 4 (*)Eye Dam. 1Skin Sens. 1 | H351H312H318H317 | GHS08GHS05GHS07Dgr | H351H312H318H317 |
| 616-015-00-6 | alachlor (ISO);2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide | 240-110-8 | 15972-60-8 | Carc. 2Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H351H302H317H400H410 | GHS08GHS07GHS09Wng | H351H302H317H410 | M=10 |
| 616-016-00-1 | 1-(3,4-dichlorophenylimino) thiosemicarbazide | — | 5836-73-7 | Acute Tox. 2 (*) | H300 | GHS06Dgr | H300 |
| 616-017-00-7 | cartap hydrochloride | 239-309-2 | 15263-52-2 | Acute Tox. 4 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H312H302H400H410 | GHS07GHS09Wng | H312H302H410 |
| 616-018-00-2 | N,N-diethyl-m-toluamide;deet | 205-149-7 | 134-62-3 | Acute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H302H319H315H412 | GHS07Wng | H302H319H315H412 |
| 616-019-00-8 | perfluidone (ISO);1,1,1-trifluoro-N-(4-phenylsulphonyl-o-tolyl)methanesulphonamide; | 253-718-3 | 37924-13-3 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 616-020-00-3 | tebuthiuron (ISO);1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | 251-793-7 | 34014-18-1 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 616-021-00-9 | thiazafluron (ISO);1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea | 246-901-4 | 25366-23-8 | Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 616-022-00-4 | acetamide | 200-473-5 | 60-35-5 | Carc. 2 | H351 | GHS08Wng | H351 |
| 616-023-00-X | N-hexadecyl(or octadecyl)-N-hexadecyl(or octadecyl)benzamide | 401-980-6 | — | Skin Irrit. 2Skin Sens. 1 | H315H317 | GHS07Wng | H315H317 |
| 616-024-00-5 | 2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide | 402-260-4 | 54942-74-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-025-00-0 | valinamide | 402-840-7 | 20108-78-5 | Repr. 2Eye Irrit. 2Skin Sens. 1 | H361f (*)(*)(*)H319H317 | GHS08Wng | H361f (*)(*)(*)H319H317 |
| 616-026-00-6 | thioacetamide | 200-541-4 | 62-55-5 | Carc. 1BAcute Tox. 4 (*)Eye Irrit. 2Skin Irrit. 2Aquatic Chronic 3 | H350H302H319H315H412 | GHS08GHS07Dgr | H350H302H319H315H412 |
| 616-027-00-1 | tris(2-(2-hydroxyethoxy)ethyl)ammonium 3-acetoacetamido-4-methoxybenzenesulfonate | 403-760-5 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-028-00-7 | N-(4-(3-(4-cyanophenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | 403-790-9 | 108673-51-4 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-029-00-2 | N,N'-ethylenebis(vinylsulfonylacetamide) | 404-790-1 | 66710-66-5 | Eye Dam. 1Skin Sens. 1 | H318H317 | GHS05GHS07Dgr | H318H317 |
| 616-030-00-8 | ethidimuron (ISO);1-(5-ethylsulphonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | 250-010-6 | 30043-49-3 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 616-031-00-3 | dimethachlor (ISO);2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide; | 256-625-6 | 50563-36-5 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 616-032-00-9 | diflufenican (ISO);N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide | — | 83164-33-4 | Aquatic Chronic 3 | H412 | — | H412 |
| 616-033-00-4 | cyprofuram (ISO);N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropanecarboxamide | 274-050-9 | 69581-33-5 | Acute Tox. 3 (*)Acute Tox. 4 (*)Aquatic Acute 1Aquatic Chronic 1 | H301H312H400H410 | GHS06GHS09Dgr | H301H312H410 |
| 616-034-00-X | pyracarbolid; (ISO);3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide | 246-419-4 | 24691-76-7 | Aquatic Chronic 3 | H412 | — | H412 |
| 616-035-00-5 | cymoxanil (ISO);2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide | 261-043-0 | 57966-95-7 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 616-036-00-0 | 2-chloracetamide | 201-174-2 | 79-07-2 | Repr. 2Acute Tox. 3 (*)Skin Sens. 1 | H361f (*)(*)(*)H301H317 | GHS06GHS08Dgr | H361f (*)(*)(*)H301H317 | Skin Sens. 1; H317: C ≥ 0,1 % |
| 616-037-00-6 | acetochlor (ISO);2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide | 251-899-3 | 34256-82-1 | Acute Tox. 4 (*)STOT SE 3Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H332H335H315H317H400H410 | GHS07GHS09Wng | H332H335H315H317H410 |
| 616-038-00-1 | (4-aminophenyl)-N-methylmethylensulfonamide hydrochloride | 406-010-5 | 88918-84-7 | Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H318H317H411 | GHS05GHS07GHS09Dgr | H318H317H411 |
| 616-039-00-7 | 3',5'-dichloro-4'-ethyl-2'-hydroxypalmitanilide | 406-200-8 | 117827-06-2 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-040-00-2 | potassium N-(4-toluenesulfonyl)-4-toluenesulfonamide | 406-650-5 | 97888-41-0 | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 616-041-00-8 | 3',5'-dichloro-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxyhexananilide | 406-840-8 | 101664-25-9 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-042-00-3 | N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamide | 407-070-5 | 142859-67-4 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-043-00-9 | isoxaben (ISO);N-[3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide | 407-190-8 | 82558-50-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-044-00-4 | N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)-butanamide | 402-510-2 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 616-045-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilide | 405-190-2 | 122371-93-1 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-046-00-5 | N-(2-(6-chloro-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | 406-390-2 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-047-00-0 | reaction mass of: 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide;2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C18)alkylacetamide | 406-640-0 | — | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-048-00-6 | 3'-trifluoromethylisobutyranilide | 406-740-4 | 1939-27-1 | STOT RE 2 (*)Aquatic Chronic 2 | H373 (*)(*)H411 | GHS08GHS09Wng | H373 (*)(*)H411 |
| 616-049-00-1 | 2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-hexanamide | 408-150-2 | 99141-89-6 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-050-00-7 | lufenuron (ISO);N-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)-phenyl-aminocarbonyl]-2,6-difluorobenzamide | 410-690-9 | 103055-07-8 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 616-051-00-2 | reaction mass of: 2,4 -bis(N'-(4-methylphenyl)-ureido)-toluene;2,6 -bis(N'-(4-methylphenyl)-ureido)-toluene | 411-070-0 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 616-052-00-8 | formamide | 200-842-0 | 75-12-7 | Repr. 1B | H360D (*)(*)(*) | GHS08Dgr | H360D (*)(*)(*) |
| 616-053-00-3 | N-methylacetamide | 201-182-6 | 79-16-3 | Repr. 1B | H360D (*)(*)(*) | GHS08Dgr | H360D (*)(*)(*) |
| 616-054-00-9 | iprodione (ISO);3-(3,5-dichlorophenyl)-2,4-dioxo-N-isopropylimidazolidine-1-carboxamide | 253-178-9 | 36734-19-7 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 616-055-00-4 | propyzamide (ISO);3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide | 245-951-4 | 23950-58-5 | Carc. 2Aquatic Acute 1Aquatic Chronic 1 | H351H400H410 | GHS08GHS09Wng | H351H410 |
| 616-056-00-X | N-methylformamide | 204-624-6 | 123-39-7 | Repr. 1BAcute Tox. 4 (*) | H360D (*)(*)(*)H312 | GHS08GHS07Dg | H360D (*)(*)(*)H312 |
| 616-057-00-5 | reaction mass of: N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide;N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide;methacrylamide;2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide;N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide | 412-790-8 | — | Carc. 1BMuta. 2STOT RE 2 (*) | H350H341H373 (*)(*) | GHS08Dgr | H350H341H373 (*)(*) |
| 616-058-00-0 | 1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzene | 412-570-1 | 119462-56-5 | STOT RE 2 (*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H318H317H400H410 | GHS08GHS05GHS07GHS09Dgr | H373 (*)(*)H318H317H410 |
| 616-059-00-6 | 4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalenecarboxamide | 412-650-6 | 121487-83-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-060-00-1 | Condensation product of: 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexene-1,2-dicarboxylic acid with polyamines (primarily amino-ethyl-piperazine and triethylenetetramine) | 413-770-1 | — | Acute Tox. 4 (*)Skin Corr. 1BSkin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H314H317H400H410 | GHS05GHS07GHS09Dgr | H302H314H317H410 |
| 616-061-00-7 | N,N'-1,6-hexanediylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamide | 413-610-0 | 124172-53-8 | Eye Irrit. 2Aquatic Chronic 3 | H319H412 | GHS07Wng | H319H412 |
| 616-062-00-2 | N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenylacetamide | 411-590-8 | 70693-57-1 | Skin Corr. 1BAquatic Chronic 3 | H314H412 | GHS05Dgr | H314H412 |
| 616-063-00-8 | 3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)-yl)-2,5-pyrrolidindione | 411-920-0 | 106917-30-0 | Acute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1AAquatic Acute 1Aquatic Chronic 1 | H331H302H373 (*)(*)H314H400H410 | GHS06GHS08GHS05GHS09Dgr | H331H302H373 (*)(*)H314H410 |
| 616-064-00-3 | N—tert-butyl-3-methylpicolinamide | 406-720-5 | 32998-95-1 | Aquatic Chronic 3 | H412 | — | H412 |
| 616-065-00-9 | 3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurea | 411-970-3 | 79881-89-3 | Acute Tox. 4 (*)STOT RE 2 (*) | H302H373 (*)(*) | GHS08GHS07Wng | H302H373 (*)(*) |
| 616-066-00-4 | 5,6,12,13-tetrachloroanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone | 405-100-1 | 115662-06-1 | Repr. 2 | H361f (*)(*)(*) | GHS08Wng | H361f (*)(*)(*) |
| 616-067-00-X | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorobenzoate | 407-300-4 | 92683-20-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-068-00-5 | potassium 4-(11-methacrylamidoundecanamido)benzenesulfonate | 406-500-9 | 174393-75-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-069-00-0 | 1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamide | 406-210-2 | 110560-22-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-070-00-6 | reaction mass of: 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea;3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urea;3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-530-2 | — | Aquatic Chronic 4 | H413 | — | H413 |
| 616-071-00-1 | reaction mass of: bis(N-cyclohexyl-N'-phenyleneureido)methylene;bis(N-octadecyl-N'-phenyleneureido)methylene;bis(N-dicyclohexyl-N'-phenyleneureido)methylene (1:2:1) | 406-550-1 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-072-00-7 | 1-(2-deoxy-5-O-trityl-β-D-threopentofuranosyl)thymine | 407-120-6 | 55612-11-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-073-00-2 | 4'-ethoxy-2-benzimidazoleanilide | 407-600-5 | 120187-29-3 | Muta. 2Aquatic Chronic 4 | H341H413 | GHS08Wng | H341H413 |
| 616-074-00-8 | N-butyl-2-(4-morpholinylcarbonyl)benzamide | 407-730-2 | 104958-67-0 | Eye Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H319H317H412 | GHS07Wng | H319H317H412 |
| 616-075-00-3 | D,L-(N,N-diethyl-2-hydroxy-2-phenylacetamide) | 408-120-9 | 65197-96-8 | Acute Tox. 4 (*)Eye Dam. 1 | H302H318 | GHS05GHS07Dgr | H302H318 |
| 616-076-00-9 | tebufenozide (ISO);N—tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide | 412-850-3 | 112410-23-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 616-077-00-4 | reaction mass of: 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfonic acid;potassium 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfate | 411-310-4 | — | Eye Dam. 1 | H318 | GHS05Dgr | H318 |
| 616-078-00-X | 2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)hexanamide | 411-330-3 | 104541-33-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-079-00-5 | 1,6-hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate | 411-700-4 | 140921-24-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-080-00-0 | 4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzenesulfonamide) | 411-850-0 | 119018-29-0 | Aquatic Chronic 3 | H412 | — | H412 |
| 616-081-00-6 | 5-bromo-8-naphtholactam | 413-480-5 | 24856-00-6 | Acute Tox. 4 (*)Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H317H400H410 | GHS07GHS09Wng | H302H317H410 |
| 616-082-00-1 | N-(5-chloro-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)benzamide | 413-200-1 | 129604-78-0 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 616-083-00-7 | [2-[(4-nitrophenyl)amino]ethyl]urea | 410-700-1 | 27080-42-8 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 616-084-00-2 | 2,4-bis[N'-(4-methylphenyl)ureido]toluene | 411-790-5 | — | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-085-00-8 | 3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione | 412-190-6 | 168900-02-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-086-00-3 | 2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene | 412-250-1 | 102387-48-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-087-00-9 | reaction mass of: 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecane-1,16-diyl-prop-2-enoate;7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoate | 412-260-6 | 52658-19-2 | Eye Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H319H317H411 | GHS07GHS09Wng | H319H317H411 |
| 616-088-00-4 | 2-aminosulfonyl-N,N-dimethylnicotinamide | 413-440-7 | 112006-75-4 | Skin Sens. 1Aquatic Chronic 3 | H317H412 | GHS07Wng | H317H412 |
| 616-089-00-X | 5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran | 415-360-8 | 41107-56-6 | Muta. 2 | H341 | GHS08Wng | H341 |
| 616-090-00-5 | 1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride | 415-660-9 | 70918-74-0 | Acute Tox. 3 (*)Acute Tox. 3 (*)Acute Tox. 3 (*)STOT RE 2 (*)Aquatic Chronic 2 | H331H311H301H373 (*)(*)H411 | GHS06GHS08GHS09Dgr | H331H311H301H373 (*)(*)H411 |
| 616-091-00-0 | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | 423-400-0 | 59653-74-6 | Muta. 1BAcute Tox. 3 (*)Acute Tox. 4 (*)STOT RE 2 (*)Eye Dam. 1Skin Sens. 1 | H340H331H302H373 (*)(*)H318H317 | GHS06GHS08GHS05Dgr | H340H331H302H373 (*)(*)H318H317 |
| 616-092-00-6 | Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide | 404-035-6 | — | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-093-00-1 | Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride | 406-620-1 | 129217-90-9 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 616-094-00-7 | 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-370-3 | 58890-25-8 | Skin Sens. 1Aquatic Chronic 4 | H317H413 | GHS07Wng | H317H413 |
| 616-095-00-2 | 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-690-3 | 43136-14-7 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-096-00-8 | N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide | 408-110-4 | 110483-07-3 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-097-00-3 | N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide | 411-840-6 | 83372-55-8 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-098-00-9 | 1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide | 411-750-7 | 119126-15-7 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 616-099-00-4 | 2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl]-3-oxopentanamide | 414-170-2 | 135937-20-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-100-00-8 | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea | 414-180-7 | 10218-17-4 | Acute Tox. 4 (*)Skin Irrit. 2 | H302H315 | GHS07Wng | H302H315 |
| 616-101-00-3 | (S)-N—tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide | 414-600-9 | 149182-72-9 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 616-102-00-9 | reaction mass of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene);1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl)-ω-oxy-poly(oxyethylene-co-oxypropylene)]-3-(or 2-)propanol;1,2,3-tris[α-(3-mercaptopropanoxycarbonyl-amino)methylphenylaminocarbonyl)-ω-oxy-poly-(oxyethylene-co-oxypropylene)]propane] | 415-870-0 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 616-103-00-4 | (S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide | 415-030-3 | 120298-38-6 | Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H317H400H410 | GHS07GHS09Wng | H317H410 |
| 616-104-00-X | benalaxyl (ISO);methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate | 275-728-7 | 71626-11-4 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-105-00-5 | chlorotoluron (ISO);3-(3-chloro-p-tolyl)-1,1-dimethylurea | 239-592-2 | 15545-48-9 | Carc. 2Repr. 2Aquatic Acute 1Aquatic Chronic 1 | H351H361d (*)(*)(*)H400H410 | GHS08GHS09Wng | H351H361d (*)(*)(*)H410 |
| 616-106-00-0 | phenmedipham (ISO);methyl 3-(3-methylcarbaniloyloxy)carbanilate | 237-199-0 | 13684-63-4 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-108-00-1 | iodosulfuron-methyl-sodium;sodium ({[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide | — | 144550-36-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-109-00-7 | sulfosulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea | — | 141776-32-1 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-110-00-2 | cyclanilide (ISO);1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid | 419-150-7 | 113136-77-9 | Acute Tox. 4 (*)Aquatic Chronic 2 | H302H411 | GHS07GHS09Wng | H302H411 |
| 616-111-00-8 | fenhexamid (ISO);N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid | 422-530-5 | 126833-17-8 | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 616-112-00-3 | oxasulfuron (ISO);oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate | — | 144651-06-9 | STOT RE 2 (*)Aquatic Acute 1Aquatic Chronic 1 | H373 (*)(*)H400H410 | GHS08GHS09Wng | H373 (*)(*)H410 |
| 616-113-00-9 | desmedipham (ISO);ethyl 3-phenylcarbamoyloxyphenylcarbamate | 237-198-5 | 13684-56-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 | M=10 |
| 616-114-00-4 | dodecanamide, N,N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- | 418-010-2 | 136897-58-0 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-115-00-X | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide | 416-150-9 | 136450-06-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-116-00-5 | N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate | 416-790-9 | 143052-96-4 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-117-00-0 | N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide | 416-860-9 | 777891-21-1 | Repr. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H361f (*)(*)(*)H317H400H410 | GHS08GHS09Wng | H361f (*)(*)(*)H317H410 |
| 616-118-00-6 | N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride | 417-950-0 | 65797-42-4 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 616-119-00-1 | 2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide | 418-060-5 | 118020-93-2 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-120-00-7 | reaction mass of: N-(3-dimethylamino-4-methyl-phenyl)-benzamide;N-(3-dimethylamino-2-methyl-phenyl)-benzamide;N-(3-dimethylamino-3-methyl-phenyl)-benzamide | 420-600-1 | — | STOT RE 2 (*)Aquatic Chronic 2 | H373 (*)(*)H411 | GHS08GHS09Wng | H373 (*)(*)H411 |
| 616-121-00-2 | 2,4-dihydroxy-N-(2-methoxyphenyl)benzamide | 419-090-1 | 129205-19-2 | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 616-123-00-3 | N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamide | 414-740-0 | 96141-86-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-124-00-9 | lithium bis(trifluoromethylsulfonyl)imide | 415-300-0 | 90076-65-6 | Acute Tox. 3 (*)Acute Tox. 3 (*)Skin Corr. 1BAquatic Chronic 3 | H311H301H314H412 | GHS06GHS05Dgr | H311H301H314H412 |
| 616-125-00-4 | 3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide | 415-730-9 | 151338-11-3 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | 410 |
| 616-127-00-5 | reaction mass of: N,N'-Ethane-1,2-diylbis(decanamide);12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamide;N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | 430-050-2 | — | Skin Sens. 1Aquatic Chronic 2 | H317H411 | GHS07GHS09Wng | H317H411 |
| 616-128-00-0 | N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide | 417-530-7 | 123590-00-1 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-129-00-6 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | 419-710-0 | 42774-15-2 | Acute Tox. 4 (*)Eye Irrit. 2 | H302H319 | GHS07Wng | H302H319 |
| 616-130-00-1 | N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide | 421-780-2 | 150919-56-5 | Aquatic Chronic 4 | H413 | — | H413 |
| 616-132-00-2 | N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide | 423-250-6 | 130016-98-7 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 616-133-00-8 | N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide | 423-990-1 | 149118-66-1 | Acute Tox. 4 (*)Eye Dam. 1Aquatic Acute 1Aquatic Chronic 1 | H302H318H400H410 | GHS05GHS07GHS09Dgr | H302H318H410 |
| 616-134-00-3 | 3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide | 401-820-5 | 793710-14-2 | Aquatic Chronic 3 | H412 | — | H412 |
| 616-135-00-9 | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide | 430-230-0 | 136522-17-3 | Acute Tox. 4 (*)Aquatic Chronic 3 | H302H412 | GHS07Wng | H302H412 |
| 616-142-00-7 | 1,3-Bis(vinylsulfonylacetamido)propane | 428-350-3 | 93629-90-4 | Muta. 2Eye Dam. 1Skin Sens. 1Aquatic Chronic 3 | H341H318H317H412 | GHS08GHS05GHS07Dgr | H341H318H317H412 |
| 616-143-00-2 | N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide | 422-560-9 | 149591-38-8 | Repr. 2Eye Irrit. 2Aquatic Chronic 4 | H361f (*)(*)(*)H319H413 | GHS08Wng | H361f (*)(*)(*)H319H413 |
| 617-001-00-2 | di-tert-butyl peroxide | 203-733-6 | 110-05-4 | Org. Perox. EFlam. Liq. 2 | H242H225 | GHS02Dgr | H242H225 |
| 617-002-00-8 | α,α-dimethylbenzyl hydroperoxide;cumene hydroperoxide | 201-254-7 | 80-15-9 | Org. Perox. EAcute Tox. 3 (*)Acute Tox. 4 (*)Acute Tox. 4 (*)STOT RE 2 (*)Skin Corr. 1BAquatic Chronic 2 | H242H331H312H302H373 (*)(*)H314H411 | GHS02GHS06GHS08GHS05GHS09Dgr | H242H331H312H302H373 (*)(*)H314H411 | Skin Corr. 1B; H314: C ≥ 10 %Skin Irrit. 2; H315: 3 % ≤ C < 10 %Eye Dam. 1; H318: 3 % ≤ C < 10 %Eye Irrit. 2; H319: 1 % ≤ C < 3 %STOT SE 3; H335: C < 10 % |
| 617-003-00-3 | dilauroyl peroxide | 203-326-3 | 105-74-8 | Org. Perox. D | H242 | GHS02Dgr | H242 |
| 617-004-00-9 | 1,2,3,4-tetrahydro-1-naphthyl hydroperoxide | 212-230-0 | 771-29-9 | Org. Perox. DAcute Tox. 4 (*)Skin Corr. 1BAquatic Acute 1Aquatic Chronic 1 | H242H302H314H400H410 | GHS02GHS05GHS07GHS09Dgr | H242H302H314H410 | STOT SE 3; H335: C ≥ 5 % |
| 617-006-00-X | bis(α,α-dimethylbenzyl) peroxide | 201-279-3 | 80-43-3 | Org. Perox. FEye Irrit. 2Skin Irrit. 2Aquatic Chronic 2 | H242H319H315H411 | GHS02GHS07GHS09Wng | H242H319H315H411 |
| 617-007-00-5 | tert-butyl α,α-dimethylbenzyl peroxide | 222-389-8 | 3457-61-2 | Org. Perox. E Skin Irrit. 2Aquatic Chronic 2 | H242H315H411 | GHS02GHS07GHS09Wng | H242H315H411 |
| 617-008-00-0 | dibenzoyl peroxide;benzoyl peroxide | 202-327-6 | 94-36-0 | Org. Perox. BEye Irrit. 2Skin Sens. 1 | H241H319H317 | GHS01GHS02GHS07Wng | H241H319H317 | T |
| 617-010-00-1 | 1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1]1,1'-dioxybiscyclohexan-1-ol; [2]cyclohexylidene hydroperoxide; [3]cyclohexanone, peroxide [4][> 91 % solution] | 201-091-1 [1]219-306-2 [2]220-279-4 [3]235-527-7 [4] | 78-18-2 [1]2407-94-5 [2]2699-11-8 [3]12262-58-7 [4] | Org. Perox. AAcute Tox. 4 (*)Skin Corr. 1B | H240H302H314 | GHS01GHS05GHS07Dgr | H240H302H314 | STOT SE 3; H335: C ≥ 5 % | C T |
| 617-010-01-9 | 1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1]1,1'-dioxybiscyclohexan-1-ol; [2]cyclohexylidene hydroperoxide; [3]cyclohexanone, peroxide [4][≤ 91 % solution] | 201-091-1 [1]219-306-2 [2]220-279-4 [3]235-527-7 [4] | 78-18-2 [1]2407-94-5 [2]2699-11-8 [3]12262-58-7 [4] | Org. Perox. CAcute Tox. 4 (*)Skin Corr. 1B | H242H302H314 | GHS02GHS05GHS07Dgr | H242H302H314 | STOT SE 3; H335: C ≥ 5 % | C T |
| 617-012-00-2 | 8-p-menthyl hydroperoxide;p-menthane hydroperoxide | 201-281-4 | 80-47-7 | Org. Perox. DSkin Corr. 1BAcute Tox. 4 (*) | H242H314H332 | GHS02GHS05GHS07Dgr | H242H314H332 | STOT SE 3; H335: C ≥ 5 % |
| 617-013-00-8 | O,O—tert-butyl O-docosyl monoperoxyoxalate | 404-300-6 | 116753-76-5 | Org. Perox. C (*)(*)(*)(*)Aquatic Acute 1Aquatic Chronic 1 | H242H400H410 | GHS02GHS09Dgr | H242H410 |
| 617-014-00-3 | 6-(nonylamino)-6-oxo-peroxyhexanoic acid | 406-680-9 | 104788-63-8 | Org. Perox. C (*)(*)(*)(*)Eye Dam. 1Skin Sens. 1Aquatic Acute 1 | H242H318H317H400 | GHS02GHS05GHS07GHS09Dgr | H242H318H317H400 |
| 617-015-00-9 | bis(4-methylbenzoyl)peroxide | 407-950-9 | 895-85-2 | Org. Perox. B (*)(*)(*)(*)Aquatic Acute 1Aquatic Chronic 1 | H241H400H410 | GHS01GHS02GHS09Dgr | H241H410 |
| 617-016-00-4 | 3-hydroxy-1,1-dimethylbutyl 2-ethyl-2-methylheptaneperoxoate | 413-910-1 | — | Org. Perox. C (*)(*)(*)(*)Flam. Liq. 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H242H226H315H400H410 | GHS02GHS07GHS09Dgr | H242H226H315H410 |
| 617-017-00-X | reaction mass of: 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzene;2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzene | 412-140-3 | 32144-25-5 | Org. Perox. D (*)(*)(*)(*)Aquatic Chronic 4 | H242H413 | GHS02Dgr | H242H413 | T |
| 617-018-00-5 | reaction mass of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63 % by weight;1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight | 410-840-3 | 71566-50-2 | Org. Perox. C (*)(*)(*)(*)Aquatic Chronic 2 | H242H411 | GHS02GHS09Dgr | H242H411 | T |
| 617-019-00-0 | 6-(phthalimido)peroxyhexanoic acid | 410-850-8 | 128275-31-0 | Org. Perox. DEye Dam. 1Aquatic Acute 1 | H242H318H400 | GHS02GHS05GHS09DgDgr | H242H318H400 | T |
| 617-020-00-6 | 1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) | 420-060-5 | 117663-11-3 | Flam. Liq. 3Org. Perox. D (*)(*)(*)(*)Aquatic Chronic 2 | H226H242H411 | GHS02GHS09Dgr | H226H242H411 |
| 647-001-00-8 | glucosidase, β- | 232-589-7 | 9001-22-3 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 647-002-00-3 | cellulase | 232-734-4 | 9012-54-8 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 647-003-00-9 | cellobiohydrolase, exo- | 253-465-9 | 37329-65-0 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 647-004-00-4 | cellulases with the exception of those specified elsewhere in this Annex | — | — | Resp. Sens. 1 | H334 | GHS08Dgr | H334 | A |
| 647-005-00-X | bromelain, juice | 232-572-4 | 9001-00-7 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-006-00-5 | ficin | 232-599-1 | 9001-33-6 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-007-00-0 | papain | 232-627-2 | 9001-73-4 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-008-00-6 | pepsin A | 232-629-3 | 9001-75-6 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-009-00-1 | rennin | 232-645-0 | 9001-98-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-010-00-7 | trypsin | 232-650-8 | 9002-07-7 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-011-00-2 | chymotrypsin | 232-671-2 | 9004-07-3 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-012-00-8 | subtilisin | 232-752-2 | 9014-01-1 | STOT SE 3Skin Irrit. 2Eye Dam. 1Resp. Sens. 1 | H335H315H318H334 | GHS08GHS05 GHS07Dgr | H335H315H318H334 |
| 647-013-00-3 | proteinase, microbial neutral | 232-966-6 | 9068-59-1 | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-014-00-9 | proteases with the exception of those specified elsewhere in this Annex | — | — | Eye Irrit. 2STOT SE 3Skin Irrit. 2Resp. Sens. 1 | H319H335H315H334 | GHS08GHS07Dgr | H319H335H315H334 |
| 647-015-00-4 | amylase, α- | 232-565-6 | 9000-90-2 | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 647-016-00-X | amylases with the exception of those specified elsewhere in this Annex | — | — | Resp. Sens. 1 | H334 | GHS08Dgr | H334 |
| 648-001-00-0 | Distillates (coal tar), benzole fraction;Light Oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists of hydrocarbons having carbon numbers primarily in the range of C4 to C10 and distilling in the approximate range of 80 oC to 160 oC (175oF to 320oF).] | 283-482-7 | 84650-02-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-002-00-6 | Tar oils, brown-coal;Light Oil;[The distillate from lignite tar boiling in the range of approximately 80 oC to 250 oC (176oF to 482oF). Composed primarily of aliphatic and aromatic hydrocarbons and monobasic phenols.] | 302-674-4 | 94114-40-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-003-00-1 | Benzol forerunnings (coal);Light Oil Redistillate, low boiling;[The distillate from coke oven light oil having an approximate distillation range below 100 oC (212oF). Composed primarily of C4 to C6 aliphatic hydrocarbons.] | 266-023-5 | 65996-88-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-004-00-7 | Distillates (coal tar), benzole fraction, BTX-rich;Light Oil Redistillate, low boiling;[A residue from the distillation of crude benzole to remove benzole fronts. Composed primarily of benzene, toluene and xylenes boiling in the range of approximately 75 oC to 200 oC (167oF to 392oF).] | 309-984-9 | 101896-26-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-005-00-2 | Aromatic hydrocarbons, C6-10, C8-rich;Light Oil Redistillate, low boiling | 292-697-5 | 90989-41-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-006-00-8 | Solvent naphtha (coal), light;Light Oil Redistillate, low boiling | 287-498-5 | 85536-17-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-007-00-3 | Solvent naphtha (coal), xylene-styrene cut;Light Oil Redistillate, intermediate boiling | 287-502-5 | 85536-20-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-008-00-9 | Solvent naphtha (coal), coumarone-styrene contg.;Light Oil Redistillate, intermediate boiling | 287-500-4 | 85536-19-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-009-00-4 | Naphtha (coal), distn. residues;Light Oil Redistillate, high boiling;[The residue remaining from the distillation of recovered naphtha. Composed primarily of naphthalene and condensation products of indene and styrene.] | 292-636-2 | 90641-12-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-010-00-X | Aromatic hydrocarbons, C8;Light Oil Redistillate, high boiling | 292-694-9 | 90989-38-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-012-00-0 | Aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product;Light Oil Redistillate, high boiling;[A complex combination of hydrocarbons obtained from the evaporation of solvent under vacuum from polymerized hydrocarbon resin. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C9 and boiling in the range of approximately 120 oC to 215 oC (248oF to 419oF).] | 295-281-1 | 91995-20-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-013-00-6 | Aromatic hydrocarbons, C9-12, benzene distn.;Light Oil Redistillate, high boiling | 295-551-9 | 92062-36-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-014-00-1 | Extract residues (coal), benzole fraction alk., acid ext.;Light Oil Extract Residues, low boiling;[The redistillate from the distillate, freed of tar acids and tar bases, from bituminous coal high temperature tar boiling in the approximate range of 90 oC to 160 oC (194oF to 320oF). It consists predominantly of benzene, toluene and xylenes.] | 295-323-9 | 91995-61-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-015-00-7 | Extract residues (coal tar), benzole fraction alk., acid ext.;Light Oil Extract Residues, low boiling;[A complex combination of hydrocarbons obtained by the redistillation of the distillate of high temperature coal tar (tar acid and tar base free). It consists predominantly of unsubstituted and substituted mononuclear aromatic hydrocarbons boiling in the range of 85 oC-195 oC (185oF-383oF).] | 309-868-8 | 101316-63-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-016-00-2 | Extract residues (coal), benzole fraction acid;Light Oil Extract Residues, low boiling;[An acid sludge by-product of the sulphuric acid refining of crude high temperature coal. Composed primarily of sulfuric acid and organic compounds.] | 298-725-2 | 93821-38-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-017-00-8 | Extract residues (coal), light oil alk., distn. overheads;Light Oil Extract Residues, low boiling;[The first fraction from the distillation of aromatic hydrocarbons, coumarone, naphthalene and indene rich prefactionator bottoms or washed carbolic oil boiling substantially below 145 oC (293oF). Composed primarily of C7 and C8 aliphatic and aromatic hydrocarbons.] | 292-625-2 | 90641-02-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-018-00-3 | Extract residues (coal), light oil alk., acid ext., indene fraction;Light Oil Extract Residues, intermediate boiling | 309-867-2 | 101316-62-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-019-00-9 | Extract residues (coal), light oil alk., indene naphtha fraction;Light Oil Extract Residues, high boiling;[The distillate from aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oils, having an approximate boiling range of 155 oC to 180 oC (311oF to 356oF). Composed primarily of indene, indan and trimethylbenzenes.] | 292-626-8 | 90641-03-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-020-00-4 | Solvent naphtha (coal);Light Oil Extract Residues, high boiling;[The distillate from either high temperature coal tar, coke oven light oil, or coal tar oil alkaline extract residue having an approximate distillation range of 130 oC to 210 oC (266oF to 410oF) Composed primarily of indene and other polycyclic ring systems containing a single aromatic ring. May contain phenolic compounds and aromatic nitrogen bases.] | 266-013-0 | 65996-79-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-021-00-X | Distillates (coal tar), light oils, neutral fraction;Light Oil Extract Residues, high boiling;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of alkyl-substituted one ring aromatic hydrocarbons boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF). May also include unsaturated hydrocarbons such as indene and coumarone.] | 309-971-8 | 101794-90-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-022-00-5 | Distillates (coal tar), light oils, acid exts.;Light Oil Extract Residues, high boiling;[This oil is a complex mixture of aromatic hydrocarbons, primarily indene, naphthalene, coumarone, phenol, and o—, m- and p-cresol and boiling in the range of 140 oC to 215 oC (284oF to 419oF).] | 292-609-5 | 90640-87-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-023-00-0 | Distillates (coal tar), light oils;Carbolic Oil;[A complex combination of hydrocarbons obtained by distillation of coal tar. It consists of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills at the approximate range of 150 oC to 210 oC (302oF to 410oF).] | 283-483-2 | 84650-03-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-024-00-6 | Tar oils, coal;Carbolic Oil;[The distillate from high temperature coal tar having an approximate distillation range of 130 oC to 250 oC (266oF to 410oF). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bases.] | 266-016-7 | 65996-82-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-026-00-7 | Extract residues (coal), light oil alk., acid ext.;Carbolic Oil Extract Residue;[The oil resulting from the acid washing of alkali-washed carbolic oil to remove the minor amounts of basic compounds (tar bases). Composed primarily of indene, indan and alkylbenzenes.] | 292-624-7 | 90641-01-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-027-00-2 | Extract residues (coal), tar oil alk.;Carbolic Oil Extract Residue;[The residue obtained from coal tar oil by an alkaline wash such as aqueous sodium hydroxide after the removal of crude coal tar acids. Composed primarily of naphthalenes and aromatic nitrogen bases.] | 266-021-4 | 65996-87-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-028-00-8 | Extract oils (coal), light oil;Acid Extract;[The aqueous extract produced by an acidic wash of alkali-washed carbolic oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | 292-622-6 | 90640-99-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-029-00-3 | Pyridine, alkyl derivs.;Crude Tar Bases;[The complex combination of polyalkylated pyridines derived from coal tar distillation or as high-boiling distillates approximately above 150 oC (302oF) from the reaction of ammonia with acetaldehyde, formaldehyde or paraformaldehyde.] | 269-929-9 | 68391-11-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-030-00-9 | Tar bases, coal, picoline fraction;Distillate Bases;[Pyridine bases boiling in the range of approximately 125 oC to 160 oC (257oF 320oF) obtained by distillation of neutralized acid extract of the base-containing tar fraction obtained by the distillation of bituminous coal tars. Composed chiefly of lutidines and picolines.] | 295-548-2 | 92062-33-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-031-00-4 | Tar bases, coal, lutidine fraction;Distillate Bases | 293-766-2 | 91082-52-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-032-00-X | Extract oils (coal), tar base, collidine fraction;Distillate Bases;[The extract produced by the acidic extraction of bases from crude coal tar aromatic oils, neutralization, and distillation of the bases. Composed primarily of collidines, aniline, toluidines, lutidines, xylidines.] | 273-077-3 | 68937-63-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-033-00-5 | Tar bases, coal, collidine fraction;Distillate Bases;[The distillation fraction boiling in the range of approximately 181 oC to 186 oC (356oF to 367oF) from the crude bases obtained from the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of bituminous coal tar. It contains chiefly aniline and collidines.] | 295-543-5 | 92062-28-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-034-00-0 | Tar bases, coal, aniline fraction;Distillate Bases;[The distillation fraction boiling in the range of approximately 180 oC to 200 oC (356oF to 392oF) from the crude bases obtained by dephenolating and debasing the carbolated oil from the distillation of coal tar. It contains chiefly aniline, collidines, lutidines and toluidines.] | 295-541-4 | 92062-27-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-035-00-6 | Tar bases, coal, toluidine fraction;Distillate Bases | 293-767-8 | 91082-53-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-036-00-1 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction;Redistillates;[A complex combination of hydrocarbons obtained as a redistillate from the fractional distillation of bituminous coal high temperature tar and residual oils that are obtained by the pyrolytic production of alkenes and alkynes from petroleum products or natural gas. It consists predominantly of indene and boils in a range of approximately 160 oC to 190 oC (320oF to 374oF).] | 295-292-1 | 91995-31-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-037-00-7 | Distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils;Redistillates;[The redistillate obtained from the fractional distillation of bituminous coal high temperature tar and pyrolysis residual oils and boiling in the range of approximately 190 oC to 270 oC (374oF to 518oF). Composed primarily of substituted dinuclear aromatics.] | 295-295-8 | 91995-35-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-038-00-2 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate;Redistillates;[The redistillate from the fractional distillation of dephenolated and debased methylnaphthalene oil obtained from bituminous coal high temperature tar and pyrolysis residual oils boiling in the approximate range of 220 oC to 230 oC (428oF to 446oF). It consists predominantly of unsubstituted and substituted dinuclear aromatic hydrocarbons.] | 295-329-1 | 91995-66-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-039-00-8 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils;Redistillates;[A neutral oil obtained by debasing and dephenolating the oil obtained from the distillation of high temperature tar and pyrolysis residuel oils which has a boiling range of 225 oC to 255 oC (437oF to 491oF). Composed primarily of substituted dinuclear aromatic hydrocarbons.] | 310-170-0 | 122070-79-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-040-00-3 | Extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues;Redistillates;[Residue from the distillation of dephenolated and debased methylnaphthalene oil (from bituminous coal tar and pyrolysis residual oils) with a boiling range of 240 oC to 260 oC (464oF to 500oF). Composed primarily of substituted dinuclear aromatic and heterocyclic hydrocarbons.] | 310-171-6 | 122070-80-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-041-00-9 | Absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained as a redistillate from the distillation of wash oil. It consists predominantly of 2-ringed aromatic and heterocyclic hydrocarbons boiling in the range of approximately 260 oC to 290 oC (500oF to 554oF).] | 309-851-5 | 101316-45-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-042-00-4 | Distillates (coal tar), upper, fluorene-rich;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists af aromatic and polycyclic hydrocarbons primarily fluorene and some acenaphthene.] | 284-900-0 | 84989-11-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-043-00-X | Creosote oil, acenaphthene fraction, acenaphthene-free;Wash Oil Redistillate;[The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] | 292-606-9 | 90640-85-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-044-00-5 | Distillates (coal tar), heavy oils;Heavy Anthracene Oil;[Distillate from the fractional distillation of coal tar of bituminous coal, with boiling range of 240 oC to 400 oC (464oF to 752oF). Composed primarily of tri- and polynuclear hydrocarbons and heterocyclic compounds.] | 292-607-4 | 90640-86-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-045-00-0 | Distillates (coal tar), upper;Heavy Anthracene Oil;[The distillate from coal tar having an approximate distillation range of 220 oC to 450 oC (428oF to 842oF). Composed primarily of three to four membered condensed ring aromatic hydrocarbons and other hydrocarbons.] | 266-026-1 | 65996-91-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-046-00-6 | Anthracene oil, acid ext.;Anthracene Oil Extract Residue;[A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 oC to 365 oC (617oF to 689oF). It contains predominantly anthracene and phenanthrene and their alkyl derivatives.] | 295-274-3 | 91995-14-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-047-00-1 | Distillates (coal tar);Heavy Anthracene Oil;[The distillate from coal tar having an approximate distillation range of 100 oC to 450 oC (212oF to 842oF). Composed primarily of two to four membered condensed ring aromatic hydrocarbons, phenolic compounds, and aromatic nitrogen bases.] | 266-027-7 | 65996-92-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-048-00-7 | Distillates (coal tar), pitch, heavy oils;Heavy Anthracene Oil;[The distillate from the distillation of the pitch obtained from bituminous high temperature tar. Composed primarily of tri- and polynuclear aromatic hydrocarbons and boiling in the range of approximately 300 oC to 470 oC (572oF to 878oF). The product may also contain heteroatoms.] | 295-312-9 | 91995-51-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-049-00-2 | Distillates (coal tar), pitch;Heavy Anthracene Oil;[The oil obtained from condensation of the vapors from the heat treatment of pitch. Composed primarily of two- to four-ring aromatic compounds boiling in the range of 200 oC to greater than 400 oC (392oF to greater than 752oF).] | 309-855-7 | 101316-49-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-050-00-8 | Distillates (coal tar), heavy oils, pyrene fraction;Heavy Anthracene Oil Redistillate;[The redistillate obtained from the fractional distillation of pitch distillate boiling in the range of approximately 350 oC to 400 oC (662oF to 752oF). Consists predominantly of tri- and polynuclear aromatics and heterocyclic hydrocarbons.] | 295-304-5 | 91995-42-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-051-00-3 | Distillates (coal tar), pitch, pyrene fraction;Heavy Anthracene Oil Redistillate;[The redistillate obtained from the fractional distillation of pitch distillate and boiling in the range of approximately 380 oC to 410 oC (7160 to 770oF). Composed primarily of tri- and polynuclear aromatic hydrocarbons and heterocyclic compounds.] | 295-313-4 | 91995-52-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-052-00-9 | Paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated;Coal Tar Extract;[A complet combination of hydrocarbons obtained by the treatment of lignite carbonization tar with activated carbon for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-296-6 | 97926-76-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-053-00-4 | Paraffin waxes (coal), brown-coal high-temp tar, clay-treated;Coal Tar Extract;[A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with bentonite for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-297-1 | 97926-77-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-054-00-X | Pitch;Pitch | 263-072-4 | 61789-60-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-055-00-5 | Pitch, coal tar, high-temp.;Pitch;[The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 oC to 180 oC (86oF to 356oF). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | 266-028-2 | 65996-93-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-056-00-0 | Pitch, coal tar, high-temp., heat-treated;Pitch;[The heat treated residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 80 oC to 180 oC (176oF to 356oF). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | 310-162-7 | 121575-60-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-057-00-6 | Pitch, coal tar, high-temp., secondary;Pitch Redistillate;[The residue obtained during the distillation of high boiling fractions from bituminous coal high temperature tar and/or pitch coke oil, with a softening point of 140 oC to 170 oC (284oF to 392oF) according to DIN 52025. Composed primarily of tri- and polynuclear aromatic compounds which also contain heteroatoms.] | 302-650-3 | 94114-13-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-058-00-1 | Residues (coal tar), pitch distn.;Pitch Redistillate;[Residue from the fractional distillation of pitch distillate boiling in the range of approximately 400 oC to 470 oC (752oF to 846oF). Composed primarily of polynuclear aromatic hydrocarbons, and heterocyclic compounds.] | 295-507-9 | 92061-94-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-059-00-7 | Tar, coal, high-temp., distn. and storage residues;Coal Tar Solids Residue;[Coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage vessels. Consists predominantly of carbon and contains a small quantity of hetero compounds as well as ash components.] | 295-535-1 | 92062-20-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-060-00-2 | Tar, coal, storage residues;Coal Tar Solids Residue;[The deposit removed from crude coal tar storages. Composed primarily of coal tar and carbonaceous particulate matter.] | 293-764-1 | 91082-50-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-061-00-8 | Tar, coal, high-temp., residues;Coal Tar Solids Residue;[Solids formed during the coking of bituminous coal to produce crude bituminous coal high temperature tar. Composed primarily of coke and coal particles, highly aromatized compounds and mineral substances.] | 309-726-5 | 100684-51-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-062-00-3 | Tar, coal, high-temp., high-solids;Coal Tar Solids Residue;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons with a high solid content of coal-type materials.] | 273-615-7 | 68990-61-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-063-00-9 | Waste solids, coal-tar pitch coking;Coal Tar Solids Residue;[The combination of wastes formed by the coking of bituminous coal tar pitch. It consists predominantly of carbon.] | 295-549-8 | 92062-34-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-064-00-4 | Extract residues (coal), brown;Coal Tar Extract;[The residue from extraction of dried coal.] | 294-285-0 | 91697-23-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-065-00-X | Paraffin waxes (coal), brown-coal-high-temp. tar;Coal Tar Extract;[A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | 295-454-1 | 92045-71-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-066-00-5 | Paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated;Coal Tar Extract;[A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process treated with hydrogen in the presence of a catalyst. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | 295-455-7 | 92045-72-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-067-00-0 | Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated;Coal Tar Extract;[A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with silicic acid for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-298-7 | 97926-78-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-068-00-6 | Tar, coal, low-temp., distn. residues;Tar Oil, intermediate boiling;[Residues from fractional distillation of low temperature coal tar to remove oils that boil in a range up to approximately 300 oC (572oF). Composed primarily of aromatic compounds.] | 309-887-1 | 101316-85-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-069-00-1 | Pitch, coal tar, low-temp;Pitch Residue;[A complex black solid or semi-solid obtained from the distillation of a low temperature coal tar. It has a softening point within the approximate range of 40 oC to 180 oC (104oF to 356oF). Composed primarily of a complex mixture of hydrocarbons.] | 292-651-4 | 90669-57-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-070-00-7 | Pitch, coal tar, low-temp., oxidized;Pitch Residue, oxidised;[The product obtained by air-blowing, at elevated temperature, low-temperature coal tar pitch. It has a softening-point within the approximate range of 70 oC to 180 oC (158oF to 356oF). Composed primarily of a complex mixture of hydrocarbons.] | 292-654-0 | 90669-59-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-071-00-2 | Pitch, coal tar, low-temp., heat-treated;Pitch Residue, oxidised;Pitch Residue, heat-treated;[A complex black solid obtained by the heat treatment of low temperature coal tar pitch. It has a softening point within the approximate range of 50 oC to 140 oC (122oF to 284oF). Composed primarily of a complex mixture of aromatic compounds.] | 292-653-5 | 90669-58-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-072-00-8 | Distillates (coal-petroleum), condensed-ring arom;Distillates;[The distillate from a mixture of coal and tar and aromatic petroleum streams having an approximate distillation range of 220 oC to 450 oC (428oF to 842oF). Composed primarily of 3- to 4-membered condensed ring aromatic hydrocarbons.] | 269-159-3 | 68188-48-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-073-00-3 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived;Pyrolysis Products;[A complex combination hydrocarbons obtained from mixed coal tar pitch-polyethylene-polypropylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-956-6 | 101794-74-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-074-00-9 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived;Pyrolysis Products;[A complex combination of hydrocarbons obtained from mixed coal tar pitch-polyethylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-957-1 | 101794-75-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-075-00-4 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived;Pyrolysis Products;[A complex combination of hydrocarbons obtained from mixed coal tar pitch-polystyrene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-958-7 | 101794-76-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-076-00-X | Pitch, coal tar-petroleum;Pitch Residues;[The residue from the distillation of a mixture of coal tar and aromatic petroleum streams. A solid with a softening point from 40 oC to 180 oC (140oF to 356oF). Composed primarily of a complex combination of three or more membered condensed ring aromatic hydrocarbons.] | 269-109-0 | 68187-57-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-077-00-5 | Phenanthrene, distn. residues;Heavy Anthracene Oil Redistillate;[Residue from the distillation of crude phenanthrene boiling in the approximate range of 340 oC to 420 oC (644oF to 788oF). It consists predominantly of phenanthrene, anthracene and carbazole.] | 310-169-5 | 122070-78-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-078-00-0 | Distillates (coal tar), upper, fluorene-free;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists of aromatic polycyclic hydrocarbons, primarily diphenyl, dibenzofuran and acenaphthene.] | 284-899-7 | 84989-10-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-079-00-6 | Anthracene oil;Anthracene oil;[A complex combination of polycyclic aromatic hydrocarbons obtained from coal tar having an approximate distillation range of 300 oC ot 400 oC (572oF to 752oF). Composed primarily of phenanthrene, anthracene and carbazole.] | 292-602-7 | 90640-80-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-080-00-1 | Residues (coal tar), creosote oil distn.;Wash Oil Redistillate;[The residue from the fractional distillation of wash oil boiling in the approximate range of 270 oC to 330 oC (518oF to 626oF). It consists predominantly of dinuclear aromatic and heterocyclic hydrocarbons.] | 295-506-3 | 92061-93-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-081-00-7 | Tar, coal;Coal tar;[The by-product from the destructive distillation of coal. Almost black semisolid. A complex combination of aromatic hydro-carbons, phenolic compounds, nitrogen bases and thiophene.] | 232-361-7 | 8007-45-2 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 648-082-00-2 | Tar, coal, high-temp.;Coal tar;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons. May contain minor amounts of phenolic compounds and aromatic nitrogen bases.] | 266-024-0 | 65996-89-6 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 648-083-00-8 | Tar, coal, low-temp.;Coal oil;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in low temperature (less than 700 oC (1292oF)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of condensed ring aromatic hydrocarbons, phenolic compounds, aromatic nitrogen bases, and their alkyl derivatives.] | 266-025-6 | 65996-90-9 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 648-084-00-3 | Distillates (coal), coke-oven light oil, naphthalene cut;Naphthalene Oil;[The complex combination of hydrocarbons obtained from prefractionation (continuous distillation) of coke oven light oil. It consists predominantly of naphthalene, coumarone and indene and boils above 148 oC (298oF).] | 285-076-5 | 85029-51-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-085-00-9 | Distillates (coal tar), naphthalene oils;Naphthalene Oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills in the approximate range of 200 oC to 250 oC (392oF to 482oF).] | 283-484-8 | 84650-04-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-086-00-4 | Distillates (coal tar), naphthalene oils, naphthalene-low;Naphthalene Oil Redistillate;[A complex combination of hydrocarbons obtained by crystallization of naphthalene oil. Composed primarily of naphthalene, alkyl naphthalenes and phenolic compounds.] | 284-898-1 | 84989-09-3 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-087-00-X | Distillates (coal tar), naphthalene oil crystn. mother liquor;Naphthalene Oil Redistillate;[A complex combination of organic compounds obtained as a filtrate from the crystallization of the naphthalene fraction from coal tar and boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). Contains chiefly naphthalene, thionaphthene and alkylnaphthalenes.] | 295-310-8 | 91995-49-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-088-00-5 | Extract residues (coal), naphthalene oil, alk.;Naphthalene Oil Extract Residue;[A complex combination of hydrocarbons obtained from the alkali washing of naphthalene oil to remove phenolic compounds (tar acids). It is composed of naphthalene and alkyl naphthalenes.] | 310-166-9 | 121620-47-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-089-00-0 | Extract residues (coal), naphthalene oil, alk., naphthalene-low;Naphthalene Oil Extract Residue;[A complex combination of hydrocarbons remaining after the removal of naphthalene from alkali-washed naphthalene oil by a crystallization process. It is composed primarily of naphthalene and alkyl naphthalenes.] | 310-167-4 | 121620-48-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-090-00-6 | Distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.;Naphthalene Oil Extract Residue;[The oil remaining after the removal of phenolic compounds (tar acids) from drained naphthalene oil by an alkali wash. Composed primarily of naphthalene and alkyl naphthalenes.] | 292-612-1 | 90640-90-7 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-091-00-1 | Extract residues (coal), naphthalene oil alk., distn. overheads;Naphthalene Oil Extract Residue;[The distillation from alkali-washed naphthalene oil having an approximate distillation range of 180 oC to 220 oC (356oF to 428oF). Composed primarily of naphthalene, alkylbenzenes, indene and indan.] | 292-627-3 | 90641-04-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-092-00-7 | Distillates (coal tar), naphthalene oils, methylnaphthalene fraction;Methylnaphthalene Oil;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of substituted two ring aromatic hydrocarbons and aromatic nitrogen bases boiling in the range of approximately 225 oC to 255 oC (437oF to 491oF).] | 309-985-4 | 101896-27-9 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-093-00-2 | Distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction;Methylnaphthalene Oil;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of indole and methylnaphthalene boiling in the range of approximately 235 oC to 255 oC (455oF to 491oF).] | 309-972-3 | 101794-91-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-094-00-8 | Distillates (coal tar), naphthalene oils, acid exts.;Methylnaphthalene Oil Extract Residue;[A complex combination of hydrocarbons obtained by debasing the methylnaphthalene fraction obtained by the distillation of coal tar and boiling in the range of approximately 230 oC to 255 oC (446oF to 491oF). Contains chiefly 1(2)-methylnaphthalene, naphthalene, dimethylnaphthalene and biphenyl.] | 295-309-2 | 91995-48-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-095-00-3 | Extract residues (coal), naphthalene oil alk., distn. residues;Methylnaphthalene Oil Extract Residue;[The residue from the distillation of alkali-washed naphthalene oil having an approximate distillation range of 220 oC to 300 oC (428oF to 572oF). Composed primarily of naphthalene, alkylnaphthalenes and aromatic nitrogen bases.] | 292-628-9 | 90641-05-7 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-096-00-9 | Extract oils (coal), acidic, tar-base free;Methylnaphthalene Oil Extract Residue;[The extract oil boiling in the range of approximately 220 oC to 265 oC (428oF to 509oF) from coal tar alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove tar bases. Composed primarily of alkylnaphthalenes.] | 284-901-6 | 84989-12-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-097-00-4 | Distillates (coal tar), benzole fraction, distn. residues;Wash Oil;[A complex combination of hydrocarbons obtained from the distillation of crude benzole (high temperature coal tar). It may be a liquid with the approximate distillation range of 150 oC to 300 oC (302oF to 572oF) or a semi-solid or solid with a melting point up to 70 oC (158oF). It is composed primarily of naphthalene and alkyl naphthalenes.] | 310-165-3 | 121620-46-0 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-098-00-X | Creosote oil, acenaphthene fraction;Wash Oil;[A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240 oC to 280 oC (464oF to 536oF). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] | 292-605-3 | 90640-84-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-099-00-5 | Creosote oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200 oC to 325 oC (392oF to 617oF).] | 263-047-8 | 61789-28-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-100-00-9 | Creosote oil, high-boiling distillate;Wash Oil;[The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5 oC (41oF).] | 274-565-9 | 70321-79-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-101-00-4 | Creosote;[The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] | 232-287-5 | 8001-58-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-102-00-X | Extract residues (coal), creosote oil acid;Wash Oil Extract Residue;[A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250 oC to 280 oC (482oF to 536oF). It consists predominantly of biphenyl and isomeric diphenylnaphthalenes.] | 310-189-4 | 122384-77-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-103-00-5 | Anthracene oil, anthracene paste;Anthracene Oil Fraction;[The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.] | 292-603-2 | 90640-81-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-104-00-0 | Anthracene oil, anthracene-low;Anthracene Oil Fraction;[The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered aromatic compounds.] | 292-604-8 | 90640-82-7 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-105-00-6 | Residues (coal tar), anthracene oil distn.;Anthracene Oil Fraction;[The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340 oC to 400 oC (644oF to 752oF). It consists predominantly of tri- and polynuclear aromatic and heterocyclic hydrocarbons.] | 295-505-8 | 92061-92-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-106-00-1 | Anthracene oil, anthracene paste, anthracene fraction;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling in the range of 330 oC to 350 oC (626oF to 662oF). It contains chiefly anthracene, carbazole and phenanthrene.] | 295-275-9 | 91995-15-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-107-00-7 | Anthracene oil, anthracene paste, carbazole fraction;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthrancene oil from bituminous coal high temperature tar and boiling in the approximate range of 350 oC to 360 oC (662oF to 680oF). It contains chiefly anthacene, carbazole and phenanthrene.] | 295-276-4 | 91995-16-3 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-108-00-2 | Anthracene oil, anthracene paste, distn. lights;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous light temperature tar and boiling in the range of approximately 290 oC to 340 oC (554oF to 644oF). It contains chiefly trinuclear aromatics and their dihydro derivatives.] | 295-278-5 | 91995-17-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-109-00-8 | Tar oils, coal, low-temp.;Tar Oil, high boiling;[A distillate from low-temperature coal tar. Composed primarily of hydrocarbons, phenolic compounds and aromatic nitrogen bases boiling in the range of approximately 160 oC to 340 oC (320oF to 644oF).] | 309-889-2 | 101316-87-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-110-00-3 | Extract residues (coal), low temp. coal atar alk.;[The residue from low temperature coal tar oils after an alkaline wash, such as aqueous sodium hydroxide, to remove crude coal tar acids. Composed primarily of hydrocarbons and aromatic nitrogen bases.] | 310-191-5 | 122384-78-5 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-111-00-9 | Phenols, ammonia liquor ext.;Alkaline Extract;[The combination of phenols extracted, using isobutyl acetate, from the ammonia liquor condensed from the gas evolved in low-temperature (less than 700 oC (1292oF)) destructive distillation of coal. It consists predominantly of a mixture of monohydric and dihydric phenols.] | 284-881-9 | 84988-93-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-112-00-4 | Distillates (coal tar), light oils, alk. exts.;Alkaline Extract;[The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | 292-610-0 | 90640-88-3 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-113-00-X | Extracts, coal tar oil alk.;Alkaline Extract;[The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | 266-017-2 | 65996-83-0 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-114-00-5 | Distillates (coal tar), naphthalene oils, alk. exts.;Alkaline Extract;[The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxid. Composed primarily of the alkali salts of various phenolic compounds.] | 292-611-6 | 90640-89-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-115-00-0 | Extract residues (coal), tar oil alk., carbonated, limed;Crude Phenols;[The product obtained by treatment of coal tar oil alkaline extract with CO2 and CaO. Composed primarily of CaCO3, Ca(OH)2, Na2CO3 and other organic and inorganic impurities.] | 292-629-4 | 90641-06-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-116-00-6 | Tar acids, coal, crude;Crude Phenols;[The reaction product obtained by neutralizing coal tar oil alkaline extract with an acidic solution, such as aqueous sulfuric acid, or gaseous carbon dioxide, to obtain the free acids. Composed primarily of tar acids such as phenol, cresols, and xylenols.] | 266-019-3 | 65996-85-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-117-00-1 | Tar acids, brown-coal, crude;Crude Phenols;[An acidified alkaline extract of brown coal tar distillate. Composed primarily of phenol and phenol homologs.] | 309-888-7 | 101316-86-3 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-118-00-7 | Tar acids, brown-coal gasification;Crude Phenols;[A complex combination of organic compounds obtained from brown coal gasification. Composed primarily of C6-10 hydroxy aromatic phenols and their homologs.] | 295-536-7 | 92062-22-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-119-00-2 | Tar acids, distn. residues;Distillate Phenols;[A residue from the distillation of crude phenol from coal. It consists predominantly of phenols having carbon numbers in the range of C8 through C10 with a softening point of 60 oC to 80 oC (140oF to 176oF).] | 306-251-5 | 96690-55-0 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-120-00-8 | Tar acids, methylphenol fraction;Distillate Phenols;[The fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-892-9 | 84989-04-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-121-00-3 | Tar acids, polyalkylphenol fraction;Distillate Phenols;[The fraction of tar aicds, recovered by distillation of low-temperature coal tar crude tar acids, having an approximate boiling range of 225 oC to 320 oC (437oF to 608oF). Composed primarily of polyalkylphenols.] | 284-893-4 | 84989-05-9 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-122-00-9 | Tar acids, xylenol fraction;Distillate Phenols;[The fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-895-5 | 84989-06-0 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-123-00-4 | Tar acids, ethylphenol fraction;Distillate Phenols;[The fraction of tar acids, rich in 3- and 4-ethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-891-3 | 84989-03-7 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-124-00-X | Tar acids, 3,5-xylenol fraction;Distillate Phenols;[The fraction of tar acids, rich in 3,5-dimethylphenol, recovered by distillation of low-temperature coal tar acids.] | 284-896-0 | 84989-07-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-125-00-5 | Tar acids, residues, distillates, first-cut;Distillate Phenols;[The residue from the distillation in the range of 235 oC to 355 oC (481oF to 697oF) of light carbolic oil.] | 270-713-1 | 68477-23-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-126-00-0 | Tar acids, cresylic, residues;Distillate Phenols;[The residue from crude coal tar acids after removal of phenol, cresols, xylenols and any higher boiling phenols. A black solid with a melting point approximately 80 oC (176oF). Composed primarily of polyalkyphenols, resin gums, and inorganic salts.] | 271-418-0 | 68555-24-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-127-00-6 | Phenols, C9-11;Distillate Phenols | 293-435-2 | 91079-47-9 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-128-00-1 | Tar acids, cresylic;Distillate Phenols;[A complex combination of organic compounds obtained from brown coal and boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). It contains chiefly phenols and pyridine bases.] | 295-540-9 | 92062-26-5 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-129-00-7 | Tar acids, brown-coal, C2-alkylphenol fraction;Distillate Phenols;[The distillate from the acidification of alkaline washed lignite tar distillate boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). Composed primarily of m- and p-ethylphenol as well as cresols and xylenols.] | 302-662-9 | 94114-29-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-130-00-2 | Extract oils (coal), naphthalene oils;Acid Extract;[The aqueous extract produced by an acidic wash of alkali-washed napthalene oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | 292-623-1 | 90641-00-2 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-131-00-8 | Tar bases, quinoline derivs.;Distillate Bases | 271-020-7 | 68513-87-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-132-00-3 | Tar bases, coal, quinoline derivs. fraction;Distillate Bases | 274-560-1 | 70321-67-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-133-00-9 | Tar bases, coal, distn. residues;Distillate Bases;[The distillation residue remaining after the distillation of the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of coal tars. It contains chiefly aniline, collidines, quinoline and quinoline derivatives and toluidines.] | 295-544-0 | 92062-29-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-134-00-4 | Hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of a polyethylene/polypropylene mixture with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70 oC to 120 oC (158oF to 248oF).] | 309-745-9 | 100801-63-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-135-00-X | Hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of polyethylene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of 70 oC to 120 oC (158oF to 248oF).] | 309-748-5 | 100801-65-8 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-136-00-5 | Hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of polystyrene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70 oC to 210 oC (158oF to 410oF).] | 309-749-0 | 100801-66-9 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-137-00-0 | Extract residues (coal), tar oil alk., naphthalene distn. residues;Naphthalene Oil Extract Residue;[The residue obtained from chemical oil extracted after the removal of naphthalene by distillation composed primarily of two to four membered condensed ring aromatic hydrocarbons and aromatic nitrogen bases.] | 277-567-8 | 73665-18-6 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-138-00-6 | Creosote oil, low-boiling distillate;Wash Oil;[The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38 oC (100oF).] | 274-566-4 | 70321-80-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-139-00-1 | Tar acids, cresylic, sodium salts, caustic solns.;Alkaline Extract | 272-361-4 | 68815-21-4 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-140-00-7 | Extract oils (coal), tar base;Acid Extract;[The extract from coal tar oil alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillatin to remove naphthalene. Composed primarily of the acid salts of various aromatic nitrogen bases including pyridine, quinoline, and their alkyl derivatives.] | 266-020-9 | 65996-86-3 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-141-00-2 | Tar bases, coal, crude;Crude Tar Bases;[The reaction product obtained by neutralizing coal tar base extract oil with an alkaline solution, such as aqueous sodium hydroxide, to obtain the free bases. Composed primarily of such organic bases as acridine, phenanthridine, pyridine, quinoline and their alkyl derivatives.] | 266-018-8 | 65996-84-1 | Carc. 1B | H350 | GHS08Dgr | H350 | HJM |
| 648-142-00-8 | Residues (coal), liq. solvent extn.;[A cohesive powder composed of coal mineral matter and undissolved coal remaining after extraction of coal by a liquid solvent.] | 302-681-2 | 94114-46-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-143-00-3 | Coal liquids, liq. solvent extn. soln.;[The product obtained by filtration of coal mineral matter and undissolved coal from coal extract solution produced by digesting coal in a liquid solvent. A black, viscous, highly complex liquid combination composed primarily of aromatic and partly hydro-genated aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic and other aromatic oxygen compounds and their alkyl derivatives.] | 302-682-8 | 94114-47-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-144-00-9 | Coal liquids, liq. solvent extn.;[The substantially solvent-free product obtained by the distillation of the solvent from filtered coal extract solution produced by digesting coal in a liquid solvent. A black semi-solid, composed primarily of a complex combination of condensed-ring aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic compounds and other aromatic oxygen compounds, and their alkyl derivatives.] | 302-683-3 | 94114-48-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H M |
| 648-145-00-4 | Tar brown-coal;[An oil distilled from brown-coal tar. Composed primarily of aliphatic, naphthenic and one- to three-ring aromatic hydrocarbons, their alkyl derivates, heteroaromatics and one- and two-ring phenols boiling in the range of approximately 150 oC to 360 oC (302oF to 680oF).] | 309-885-0 | 101316-83-0 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 648-146-00-X | Tar, brown-coal, low-temp.;[A tar obtained from low temperature carbonization and low temperature gasification of brown coal. Composed primarily of aliphatic, naphthenic and cyclic aromatic hydrocarbons, heteroaromatic hydrocarbons and cyclic phenols.] | 309-886-6 | 101316-84-1 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 648-147-00-5 | Light oil (coal), coke-oven;Crude benzole;[The volatile organic liquid extracted from the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. Composed primarily of benzene, toluene, and xylenes. May contain other minor hydrocarbon constituents.] | 266-012-5 | 65996-78-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-148-00-0 | Distillates (coal), liq. solvent extn., primary;[The liquid product of condensation of vapors emitted during the digestion of coal in a liquid solvent and boiling in the range of approximately 30 oC to 300 oC (86oF to 572oF). Composed primarily of partly hydrogenated condensed-ring aromatic hydrocarbons, aromatic compounds containing nitrogen, oxygen and sulfur, and their alkyl derivatives having carbon numbers predominantly in the range of C4 through C14.] | 302-688-0 | 94114-52-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-149-00-6 | Distillates (coal), solvent extn., hydrocracked;[Distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction process and boiling in the range of approximately 30 oC to 300 oC (86oF to 572oF). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 through C14. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | 302-689-6 | 94114-53-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-150-00-1 | Naphtha (coal), solvent extn., hydrocracked;[Fraction of the distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30 oC to 180 oC (86oF to 356oF). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 to C9. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | 302-690-1 | 94114-54-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-151-00-7 | Gasoline, coal solvent extn., hydrocracked naphtha;[Motor fuel produced by the reforming of the refined naphtha fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30 oC to 180 oC (86oF to 356oF). Composed primarily of aromatic and naphthenic hydrocarbons, their alkyl derivatives and alkyl hydrocarbons having carbon numbers in the range of C4 through C9.] | 302-691-7 | 94114-55-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 648-152-00-2 | Distillates (coal), solvent extn., hydrocracked middle;[Distillate obtained from the hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 300 oC (356oF to 572oF). Composed primarily of two-ring aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes having carbon numbers predominantly in the range of C9 through C14. Nitrogen, sulfur and oxygen-containing compounds are also present.] | 302-692-2 | 94114-56-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-153-00-8 | Distillates (coal), solvent extn., hydrocracked hydrogenated middle;[Distillate from the hydrogenation of hydrocracked middle distillate from coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 280 oC (356oF to 536oF). Composed primarily of hydrogenated two- ring carbon compounds and their alkyl derivatives having carbon numbers predominantly in the range of C9 through C14.] | 302-693-8 | 94114-57-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 648-154-00-3 | Fuels, jet aircraft, coal solvent extn., hydrocracked hydrogenated;[Jet engine fuel produced by hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 225 oC (356oF to 473oF). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C10 through C12.] | 302-694-3 | 94114-58-6 | Carc. 2 | H351 | GHS08Wng | H350 | H |
| 648-155-00-9 | Fuels, diesel, coal solvent extn., hydrocracked hydrogenated;[Diesel engine fuel produced by the hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 200 oC to 280 oC (392oF to 536oF). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C11 through C14.] | 302-695-9 | 94114-59-7 | Carc. 2 | H351 | GHS08Wng | H350 | H |
| 648-156-00-4 | Light oil (coal), semi-coking process;Fresh oil;[The volatile organic liquid condensed from the gas evolved in the low temperature (less than 700 oC (1292oF) destructive distillation of coal. Composed primarily of C6-10 hydrocarbons.] | 292-635-7 | 90641-11-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H J |
| 649-001-00-3 | Extracts (petroleum), light naphthenic distillate solvent | 265-102-1 | 64742-03-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-002-00-9 | Extracts (petroleum), heavy paraffinic distillate solvent | 265-103-7 | 64742-04-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-003-00-4 | Extracts (petroleum), light paraffinic distillate solvent | 265-104-2 | 64742-05-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-004-00-X | Extracts (petroleum), heavy naphthenic distillate solvent | 265-111-0 | 64742-11-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-005-00-5 | Extracts (petroleum), light vacuum gas oil solvent | 295-341-7 | 91995-78-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-006-00-0 | hydrocarbons C26-55, arom-rich | 307-753-7 | 97722-04-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-007-00-6 | fatty acids, tall-oil, reaction products with iminodiethanol and boric acid | 400-160-5 | — | Skin Irrit. 2Aquatic Chronic 2 | H315H411 | GHS07GHS09Wng | H315H411 |
| 649-008-00-1 | Residues (petroleum), atm. tower;Heavy Fuel oil;[A complex residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-045-2 | 64741-45-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-009-00-7 | Gas oils (petroleum), heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 oC to 600 oC (662oF to 1112oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 265-058-3 | 64741-57-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-010-00-2 | Distillates (petroleum), heavy catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 oC to 500 oC (500oF to 932oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-063-0 | 64741-61-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-011-00-8 | Clarified oils (petroleum), catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-064-6 | 64741-62-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-012-00-3 | Residues (petroleum), hydrocracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the products of a hydrocracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF).] | 265-076-1 | 64741-75-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-013-00-9 | Residues (petroleum), thermal cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-081-9 | 64741-80-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-014-00-4 | Distillates (petroleum), heavy thermal cracked;Heavy Fuel oil;[A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C15 through C36 and boiling in the range of approximately 260 oC to 480 oC (500oF to 896oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-082-4 | 64741-81-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-015-00-X | Gas oils (petroleum), hydrotreated vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C50 and boiling in the range of approximately 230 oC to 600 oC (446oF to 1112oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-162-9 | 64742-59-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-016-00-5 | Residues (petroleum), hydrodesulfurized atmospheric tower;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating an atmospheric tower residuum with hydrogen in the presence of a catalyst under conditions primarily to remove organic sulfur compounds. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-181-2 | 64742-78-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-017-00-0 | Gas oils (petroleum), hydrodesulfurized heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 oC to 600 oC (662oF to 1112 oC). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-189-6 | 64742-86-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-018-00-6 | Residues (petroleum), steam-cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained as the residual fraction from the distillation of the products of a steam cracking process (including steam cracking to produce ethylene). It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C14 and boiling above approximately 260 oC (500oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-193-8 | 64742-90-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-019-00-1 | Residues (petroleum), atmospheric;Heavy Fuel oil;[A complex residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 oC (392oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 269-777-3 | 68333-22-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-020-00-7 | Clarified oils (petroleum), hydrodesulfurized catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating catalytic cracked clarified oil with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 269-782-0 | 68333-26-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-021-00-2 | Distillates (petroleum), hydrodesulfurized intermediate catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating intermediate catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 oC to 450 oC (401oF to 842oF). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | 269-783-6 | 68333-27-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-022-00-8 | Distillates (petroleum), hydrodesulfurized heavy catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treatment of heavy catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 oC to 500 oC (500oF to 932oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 269-784-1 | 68333-28-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-023-00-3 | Fuel oil, residues-straight-run gas oils, high-sulfur;Heavy Fuel oil | 270-674-0 | 68476-32-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-024-00-9 | Fuel oil, residual;Heavy Fuel oil;[The liquid product from various refinery streams, usually residues. The composition is complex and varies with the source of the crude oil.] | 270-675-6 | 68476-33-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-025-00-4 | Residues (petroleum), catalytic reformer fractionator residue distn.;Heavy Fuel oil;[A complex residuum from the distillation of catalytic reformer fractionator residue. It boils approximately above 399 oC (750oF).] | 270-792-2 | 68478-13-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-026-00-X | Residues (petroleum), heavy coker gas oil and vacuum gas oil;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and vacuum gas oil. It predominantly consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-796-4 | 68478-17-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-027-00-5 | Residues (petroleum), heavy coker and light vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and light vacuum gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-983-0 | 68512-61-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-028-00-0 | Residues (petroleum), light vacuum;Heavy Fuel oil;[A complex residuum from the vacuum distillation of the residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-984-6 | 68512-62-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-029-00-6 | Residues (petroleum), steam-cracked light;Heavy Fuel oil;[A complex residuum from the distillation of the products from a steam-cracking process. It consists predominantly of aromatic and unsaturated hydrocarbons having carbon numbers greater than C7 and boiling in the range of approximately 101 oC to 555 oC (214oF to 1030oF).] | 271-013-9 | 68513-69-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-030-00-1 | Fuel oil, No 6;Heavy Fuel oil;[A distillate oil having a minimum viscosity of 900 SUS at 37.7 oC (100oF) to a maximum of 9000 SUS at 37.7 oC (100oF).] | 271-384-7 | 68553-00-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-031-00-7 | Residues (petroleum), topping plant, low-sulfur;Heavy Fuel oil;[A low-sulfur complex combination of hydrocarbons produced as the residual fraction from the topping plant distillation of crude oil. It is the residuum after the straight-run gasoline cut, kerosene cut and gas oil cut have been removed.] | 271-763-7 | 68607-30-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-032-00-2 | Gas oils (petroleum), heavy atmospheric;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C35 and boiling in the range of approximately 121 oC to 510 oC (250oF to 950oF).] | 272-184-2 | 68783-08-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-033-00-8 | Residues (petroleum), coker scrubber, Condensed-ring-arom.-contg.;Heavy Fuel oil;[A very complex combination of hydrocarbons produced as the residual fraction from the distillation of vaccum residuum and the products from a thermal cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed rind aromatic hydrocarbons.] | 272-187-9 | 68783-13-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-034-00-3 | Distillates (petroleum), petroleum residues vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from the atmospheric distillation of crude oil.] | 273-263-4 | 68955-27-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-035-00-9 | Residues (petroleum), steam-cracked, resinous;Heavy Fuel oil;[A complex residuum from the distillation of steam-cracked petroleum residues.] | 273-272-3 | 68955-36-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-036-00-4 | Distillates (petroleum), intermediate vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum, distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C14 through C42 and boiling in the range of approximately 250 oC to 545 oC (482oF to 1013oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 274-683-0 | 70592-76-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-037-00-X | Distillates (petroleum), light vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C35 and boiling in the range of approximately 250 oC to 545 oC (482oF to 1013oF).] | 274-684-6 | 70592-77-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-038-00-5 | Distillates (petroleum), vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having numbers predominantly in the range of C15 through C50 and boiling in the range of approximately 270 oC to 600 oC (518oF to 1112oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 274-685-1 | 70592-78-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-039-00-0 | Gas oils (petroleum), hydrodesulfurized coker heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by hydrodesulfurization of heavy coker distillate stocks, It consists predominantly of hydrocarbons having carbon numbers predominantly in the range C18 to C44 and boiling in the range of approximately 304 oC to 548 oC (579oF to 1018oF). Likely to contain 5 % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 285-555-9 | 85117-03-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-040-00-6 | Residues (petroleum), steam-cracked, distillates;Heavy Fuel oil;[A complex combination of hydrocarbons obtained during the production of refined petroleum tar by the distillation of steam cracked tar. It consists predominantly of aromatic and other hydrocarbons and organic sulfur compounds.] | 292-657-7 | 90669-75-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-041-00-1 | Residues (petroleum), vacuum, light;Heavy Fuel oil;[A complex residuum from the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C24 and boiling above approximately 390 oC (734oF).] | 292-658-2 | 90669-76-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-042-00-7 | Fuel oil, heavy, high-sulfur;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the distillation of crude petroleum. It consists predominantly of aliphatic, aromatic and cycloaliphatic hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 295-396-7 | 92045-14-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-043-00-2 | Residues (petroleum), catalytic cracking;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 oC (392oF).] | 295-511-0 | 92061-97-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-044-00-8 | Distillates (petroleum), intermediate catalytic cracked, thermally degraded;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 220 oC to 450 oC (428oF to 842oF). This stream is likely to contain organic sulfur compounds.] | 295-990-6 | 92201-59-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-045-00-3 | Residual oils (petroleum);Heavy Fuel oil;[A complex combination of hydrocarbons, sulfur compounds and metal-containing organic compounds obtained as the residue from refinery fractionation cracking processes. It produces a finished oil with a viscosity above 2cSt. at 100 oC.] | 298-754-0 | 93821-66-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-046-00-9 | Residues, steam cracked, thermally treated;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the treatment and distillation of raw steam-cracked naphtha. It consists predominantly of unsaturated hydrocarbons boiling in the range above approximately 180 oC (356oF).] | 308-733-0 | 98219-64-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-047-00-4 | Distillates (petroleum), hydrodesulfurized full-range middle;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating a petroleum stock with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF).] | 309-863-0 | 101316-57-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-048-00-X | Residues (petroleum), catalytic reformer fractionator;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C25 and boiling in the range of approximately 160 oC to 400 oC (320oF to 725oF). This stream is likely to contain 5 wt. % or more of 4- or 6-membered condensed ring aromatic hydrocarbons.] | 265-069-3 | 64741-67-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-049-00-5 | Petroleum;Crude oil;[A complex combination of hydrocarbons, It consists predominantly of aliphatic, alicyclic and aromatic hydrocarbons. It may also contain small amounts of nitrogen, oxygen and sulfur compounds. This category encompasses light, medium, and heavy petroleums, as well as the oils extended from tar sands. Hydrocarbonaceous materials requiring major chemical changes for their recovery or conversion to petroleum refinery feedstocks such as crude shale oils; upgraded shale oils and liquid coal fuels are not included in this definition.] | 232-298-5 | 8002-05-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-050-00-0 | Distillates (petroleum), light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated aliphatic hydrocarbons normally present in this distillation range of crude oil.] | 265-051-5 | 64741-50-0 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-051-00-6 | Distillates (petroleum), heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated aliphatic hydrocarbons.] | 265-052-0 | 64741-51-1 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-052-00-1 | Distillates (petroleum), light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-053-6 | 64741-52-2 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-053-00-7 | Distillates (petroleum), heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-054-1 | 64741-53-3 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-054-00-2 | Distillates (petroleum), acid-treated heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-117-3 | 64742-18-3 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-055-00-8 | Distillates (petroleum), acid-treated light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-118-9 | 64742-19-4 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-056-00-3 | Distillates (petroleum), acid-treated heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of a least 100 SUS at 100oF (19cSt at 40 oC).] | 265-119-4 | 64742-20-7 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-057-00-9 | Distillates (petroleum), acid-treated light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-121-5 | 64742-21-8 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-058-00-4 | Distillates (petroleum), chemically neutralized heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained from a treating process to remove acidic materials. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of aliphatic hydrocarbons.] | 265-127-8 | 64742-27-4 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-059-00-X | Distillates (petroleum), chemically neutralized light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-128-3 | 64742-28-5 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-060-00-5 | Distillates (petroleum), chemically neutralized heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-135-1 | 64742-34-3 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-061-00-0 | Distillates (petroleum), chemically neutralized light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS a 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-136-7 | 64742-35-4 | Carc. 1A | H350 | GHS08Dgr | H350 | H |
| 649-062-00-6 | Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consists of hydrocarbons having carbon numbers in the range of C2 through C4, predominantly C3.] | 270-755-0 | 68477-73-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-063-00-1 | Gases (petroleum), catalytic cracker;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-756-6 | 68477-74-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-064-00-7 | Gases (petroleum), catalytic cracker, C1-5-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C5.] | 270-757-1 | 68477-75-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-065-00-2 | Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons having carbon numbers in the range of C2 through C6, predominantly C2 through C4.] | 270-758-7 | 68477-76-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-066-00-8 | Gases (petroleum), catalytic reformer, C1-4-rich;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C4.] | 270-760-8 | 68477-79-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-067-00-3 | Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed;Petroleum gas;[A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normally exceed the critical temperature of these combinations.] | 270-765-5 | 68477-83-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-068-00-9 | Gases (petroleum), C4-rich;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | 270-767-6 | 68477-85-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-069-00-4 | Gases (petroleum), deethanizer overheads;Petroleum gas;[A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] | 270-768-1 | 68477-86-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-070-00-X | Gases (petroleum), deisobutanizer tower overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 270-769-7 | 68477-87-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-071-00-5 | Gases (petroleum), depropanizer dry, propene-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene with some ethane and propane.] | 270-772-3 | 68477-90-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-072-00-0 | Gases (petroleum), depropanizer overheads;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 270-773-9 | 68477-91-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-073-00-6 | Gases (petroleum), gas recovery plant depropanizer overheads;Petroleum gas;[A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4, predominantly propane.] | 270-777-0 | 68477-94-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-074-00-1 | Gases (petroleum), Girbatol unit feed;Petroleum gas;[A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 270-778-6 | 68477-95-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-075-00-7 | Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free;Petroleum gas | 270-782-8 | 68477-99-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-076-00-2 | Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked vacuum residue. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-802-5 | 68478-21-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-077-00-8 | Tail gas (petroleum), catalytic cracked naphtha stabilization absorber;Petroleum gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-803-0 | 68478-22-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-078-00-3 | Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and hydrodesulfurizing processes treated to remove acidic impurities. It consists predominantly of hydrocarbons having cabon numbers predominantly in the range of C1 through C5.] | 270-804-6 | 68478-24-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-079-00-9 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 270-806-7 | 68478-26-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-080-00-4 | Tail gas (petroleum), saturate gas plant mixed stream, C4-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer tail gas. It consists of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly butane and isobutane.] | 270-813-5 | 68478-32-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-081-00-X | Tail gas (petroleum), saturate gas recovery plant, C1-2-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists predominantly of hydrocarbons having carbon numbers in the range of C1through C5, predominantly methane and ethane.] | 270-814-0 | 68478-33-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-082-00-5 | Tail gas (petroleum), vacuum residues thermal cracker;Petroleum gas;[A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-815-6 | 68478-34-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-083-00-0 | Hydrocarbons, C3-4-rich, petroleum distillate;Petroleum gas;[A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C3 through C4.] | 270-990-9 | 68512-91-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-084-00-6 | Gases (petroleum), full-range straight-run naphtha dehexanizer off;petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-000-8 | 68513-15-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-085-00-1 | Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich;Petroleum gas;[A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4. It may also contain small amounts of hydrogen and hydrogen sulfide.] | 271-001-3 | 68513-16-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-086-00-7 | Gases (petroleum), light straight-run naphtha stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-002-9 | 68513-17-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-087-00-2 | Residues (petroleum), alkylation splitter, C4-rich;Petroleum gas;[A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane and boiling in the range of approximately - 11.7 oC to 27.8 oC (11oF to 82oF).] | 271-010-2 | 68513-66-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-088-00-8 | Hydrocarbons, C1-4;Petroleum gas;[A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately minus 164 oC to minus 0.5 oC (-263oF to 31oF).] | 271-032-2 | 68514-31-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-089-00-3 | Hydrocarbons, C1-4, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately - 164 oC to - 0.5 oC (-263oF to 31oF).] | 271-038-5 | 68514-36-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-090-00-9 | Hydrocarbons, C1-3;Petroleum gas;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164 oC to minus 42 oC (-263oF to - 44oF).] | 271-259-7 | 68527-16-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-091-00-4 | Hydrocarbons, C1-4, debutanizer fraction;Petroleum gas | 271-261-8 | 68527-19-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-092-00-X | Gases (petroleum), C1-5, wet;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 271-624-0 | 68602-83-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-093-00-5 | Hydrocarbons, C2-4;Petroleum gas | 271-734-9 | 68606-25-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-094-00-0 | Hydrocarbons, C3;Petroleum gas | 271-735-4 | 68606-26-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-095-00-6 | Gases (petroleum), alkylation feed;Petroleum gas;[A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 271-737-5 | 68606-27-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-096-00-1 | Gases (petroleum), depropanizer bottoms fractionation off;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] | 271-742-2 | 68606-34-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-097-00-7 | Gases (petroleum), refinery blend;Petroleum gas;[A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-183-7 | 68783-07-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-098-00-2 | Gases (petroleum), catalytic cracking;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | 272-203-4 | 68783-64-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-099-00-8 | Gases (petroleum), C2-4, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C2 through C4 and boiling in the range of approximately - 51 oC to - 34 oC (-60oF to - 30oF).] | 272-205-5 | 68783-65-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-100-00-1 | Gases (petroleum), crude oil fractionation off;Petroleum gas;[A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-871-7 | 68918-99-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-101-00-7 | Gases (petroleum), dehexanizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-872-2 | 68919-00-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-102-00-2 | Gases (petroleum), light straight run gasoline fractionation stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-878-5 | 68919-05-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-103-00-8 | Gases (petroleum), naphtha unifiner desulfurization stripper off;Petroleum gas;[A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-879-0 | 68919-06-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-104-00-3 | Gases (petroleum), straight-run naphtha catalytic reforming off;Petroleum gas;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, and propane.] | 272-882-7 | 68919-09-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-105-00-9 | Gases (petroleum), fluidized catalytic cracker splitter overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the fractionation of the charge to the C3 -C4 splitter. It consists predominantly of C3 hydrocarbons.] | 272-893-7 | 68919-20-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-106-00-4 | Gases (petroleum), straight-run stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-883-2 | 68919-10-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-107-00-X | Gases (petroleum), catalytic cracked naphtha debutanizer;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-169-3 | 68952-76-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-108-00-5 | Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-170-9 | 68952-77-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-109-00-0 | Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber;petroleum gas;[A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-175-6 | 68952-81-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-110-00-6 | Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-176-1 | 68952-82-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-111-00-1 | Gases (petroleum, light steam-cracked, butadiene conc.;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process, It consists of hydrocarbons having a carbon number predominantly of C4.] | 273-265-5 | 68955-28-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-112-00-7 | Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead;Petroleum gas;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 273-270-2 | 68955-34-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-113-00-2 | Hydrocarbons, C4;Petroleum gas | 289-339-5 | 87741-01-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-114-00-8 | Alkanes, C1-4, C3-rich;Petroleum gas | 292-456-4 | 90622-55-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-115-00-3 | Gases (petroleum), steam-cracker C3-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of approximately - 70 oC to 0 oC (-94oF to 32oF).] | 295-404-9 | 92045-22-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-116-00-9 | Hydrocarbons, C4, steam-cracker distillate;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predominantly 1-butene and 2-butene, containing also butane and isobutene and boiling in the range of approximately minus 12 oC to 5 oC (10.4oF to 41oF).] | 295-405-4 | 92045-23-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-117-00-4 | Petroleum gases, liquefied, sweetened, C4 fraction;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists predominantly of C4 saturated and unsaturated hydrocarbons.] | 295-463-0 | 92045-80-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | HKSU |
| 649-118-00-X | Hydrocarbons, C4, 1,3-butadiene- and isobutene-free;Petroleum gas | 306-004-1 | 95465-89-7 | Flam. Gas 1Press. GasCarc. 1B | H220H350 | GHS02GHS04GHS08Dgr | H220H350 | H K U |
| 649-119-00-5 | Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free;Petroleum gas | 307-769-4 | 97722-19-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-120-00-0 | Gases (petroleum), amine system feed;Refinery gas;[The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 may also be present.] | 270-746-1 | 68477-65-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-121-00-6 | Gases (petroleum), benzene unit hydrodesulfurizer off;Refinery gas;[Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, including benzene, may also be present.] | 270-747-7 | 68477-66-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-122-00-1 | Gases (petroleum), benzene unit recycle, hydrogen-rich;Refinery gas;[A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydrocarbons having carbon numbers in the range of C1 through C6.] | 270-748-2 | 68477-67-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-123-00-7 | Gases (petroleum), blend oil, hydrogen-nitrogen-rich;Refinery gas;[A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide, and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-749-8 | 68477-68-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-124-00-2 | Gases (petroleum), catalytic reformed naphtha stripper overheads;Refinery gas;[A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 270-759-2 | 68477-77-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-125-00-8 | Gases (petroleum), C6-8 catalytic reformer recycle;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It may also contain various small amounts of carbon monoxide, carbon dioxide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-761-3 | 68477-80-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-126-00-3 | Gases (petroleum), C6-8 catalytic reformer;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 and hydrogen.] | 270-762-9 | 68477-81-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-127-00-9 | Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich;Refinery gas | 270-763-4 | 68477-82-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-128-00-4 | Gases (petroleum), C2-return stream;Refinery gas;[A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and ethylene. It contains predominantly hydrocarbons such as methane, ethane, and ethylene with small amounts of hydrogen, nitrogen and carbon monoxide.] | 270-766-0 | 68477-84-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-129-00-X | Gases (petroleum), dry sour, gas-concn.-unit-off;Refinery gas;[The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 270-774-4 | 68477-92-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-130-00-5 | Gases (petroleum), gas concn. reabsorber distn.;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide and hydrocarbons having carbon numbers in the range of C1 through C3.] | 270-776-5 | 68477-93-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-131-00-0 | Gases (petroleum), hydrogen absorber off;Refinery gas;[A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] | 270-779-1 | 68477-96-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-132-00-6 | Gases (petroleum), hydrogen-rich;Refinery gas;[A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] | 270-780-7 | 68477-97-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-133-00-1 | Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich;Refinery gas;[A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-781-2 | 68477-98-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-134-00-7 | Gases (petroleum), recycle, hydrogen-rich;Refinery gas;[A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | 270-783-3 | 68478-00-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-135-00-2 | Gases (petroleum), reformer make-up, hydrogen-rich;Refinery gas;[A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-784-9 | 68478-01-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-136-00-8 | Gases (petroleum), reforming hydrotreater;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 thorugh C5.] | 270-785-4 | 68478-02-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-137-00-3 | Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon dioxide, nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] | 270-787-5 | 68478-03-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-138-00-9 | Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-788-0 | 68478-04-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-139-00-4 | Gases (petroleum), thermal cracking distn.;Refinery gas;[A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-789-6 | 68478-05-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-140-00-X | Tail gas (petroleum), catalytic cracker refractionation absorber;Refinery gas;[A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 270-805-1 | 68478-25-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-141-00-5 | Tail gas (petroleum), catalytic reformed naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-807-2 | 68478-27-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-142-00-0 | Tail gas (petroleum), catalytic reformed naphtha stabilizer;Refinery gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-808-8 | 68478-28-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-143-00-6 | Tail gas (petroleum), cracked distillate hydrotreater separator;Refinery gas;[A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-809-3 | 68478-29-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-144-00-1 | Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-810-9 | 68478-30-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-145-00-7 | Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads;Refinery gas;[A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consists of hydrogen, methane, ethane and propane.] | 270-999-8 | 68513-14-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-146-00-2 | Gases (petroleum), reformer effluent high-pressure flash drum off;Refinery gas;[A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-003-4 | 68513-18-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-147-00-8 | Gases (petroleum), reformer effluent low-pressure flash drum off;Refinery gas;[A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-005-5 | 68513-19-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-148-00-3 | Gases (petroleum), oil refinery gas distn. off;Refinery gas;[A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or obtained by cracking ethane and propane. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C2, hydrogen, nitrogen, and carbon monoxide.] | 271-258-1 | 68527-15-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-149-00-9 | Gases (petroleum), benzene unit hydrotreater depentanizer overheads;Refinery gas;[A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of hydrogen, ethane and propane with various small amounts of nitrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6. It may contain trace amounts of benzene.] | 271-623-5 | 68602-82-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-150-00-4 | Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator;Refinery gas;[A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cracker. It consists of hydrogen, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 271-625-6 | 68602-84-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-151-00-X | Petroleum products, refinery gases;Refinery gas;[A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-750-6 | 68607-11-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-152-00-5 | Gases (petroleum), hydrocracking low-pressure separator;Refinery gas;[A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 272-182-1 | 68783-06-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-153-00-0 | Gases (petroleum), refinery;Refinery gas;[A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 272-338-9 | 68814-67-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-154-00-6 | Gases (petroleum), platformer products separator off;Refinery gas;[A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 272-343-6 | 68814-90-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-155-00-1 | Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off;Refinery gas;[The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with various small amounts of nitrogen, hydrogen sulfide, carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C4 through C5.] | 272-775-5 | 68911-58-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-156-00-7 | Gases (petroleum), hydrotreated sour kerosine flash drum;Refinery gas;[A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane with various small amounts of nitrogen, carbon monoxide, and hydro-carbons having carbon numbers predominantly in the range of C2 through C5.] | 272-776-0 | 68911-59-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-157-00-2 | Gases (petroleum), distillate unifiner desulfurization stripper off;Refinery gas;[A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] | 272-873-8 | 68919-01-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-158-00-8 | Gases (petroleum), fluidized catalytic cracker fractionation off;Refinery gas;[A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-874-3 | 68919-02-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-159-00-3 | Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off;Refinery gas;[A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and propane.] | 272-875-9 | 68919-03-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-160-00-9 | Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off;Refinery gas;[A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-876-4 | 68919-04-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-161-00-4 | Gases (petroleum), platformer stabilizer off, light ends fractionation;Refinery gas;[A complex combination obtained by the fractionation of the light ends of the platinum reactors of the plattformer unit. It consists of hydrogen, methane, ethane and propane.] | 272-880-6 | 68919-07-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-162-00-X | Gases (petroleum), preflash tower off, crude distn.;Refinery gas;[A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-881-1 | 68919-08-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-163-00-5 | Gases (petroleum), tar stripper off;Refinery gas;[A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-884-8 | 68919-11-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-164-00-0 | Gases (petroleum), unifiner stripper off;Refinery gas;[A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] | 272-885-3 | 68919-12-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-165-00-6 | Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] | 273-173-5 | 68952-79-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-166-00-1 | Tail gas (petroleum), straight-run naphtha hydrodesulfurizer;Refinery gas;[A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 273-174-0 | 68952-80-7 | Press. GasFlam. Gas 1Carc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-167-00-7 | Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation;Refinery gas;[A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfurizer. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-269-7 | 68955-33-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-168-00-2 | Gases (petroleum), crude distn. and catalytic cracking;Refinery gas;[A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-563-5 | 68989-88-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-169-00-8 | Gases (petroleum), gas oil diethanolamine scrubber off;Refinery gas;[A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | 295-397-2 | 92045-15-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-170-00-3 | Gases (petroleum), gas oil hydrodesulfurization effluent;Refinery gas;[A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 295-398-8 | 92045-16-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-171-00-9 | Gases (petroleum), gas oil hydrodesulfurization purge;Refinery gas;[A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 295-399-3 | 92045-17-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-172-00-4 | Gases (petroleum), hydrogenator effluent flash drum off;Refinery gas;[A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 295-400-7 | 92045-18-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-173-00-X | Gases (petroleum), naphtha steam cracking high-pressure residual;Refinery gas;[A complex combination obtained as a mixture of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained during the preparation of subsequent products. It consists predominantly of hydrogen and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 with which natural gas may also be mixed.] | 295-401-2 | 92045-19-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-174-00-5 | Gases (petroleum), residue visbaking off;Refinery gas;[A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 295-402-8 | 92045-20-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-175-00-0 | Foots oil (petroleum), acid-treated;Foots oil;[A complex combination of hydrocarbons obtained by treatment of Foot's oil with sulfuric acid. It consists predominantly of branched-chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | 300-225-7 | 93924-31-3 | Flam. Gas 1Press. GasCarc. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-176-00-6 | Foots oil (petroleum), clay-treated;Foots oil;[A complex combination of hydrocarbons obtained by treatment of Foot's oil with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of branched chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | 300-226-2 | 93924-32-4 | Flam. Gas 1Press. GasCarc. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-177-00-1 | Gases (petroleum), C3-4;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane and propylene, and boiling in the range of approximately - 51 oC to - 1 oC (-60oF to 30oF.)] | 268-629-5 | 68131-75-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-178-00-7 | Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber;Petroleum gas;[The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | 269-617-2 | 68307-98-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-179-00-2 | Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | 269-618-8 | 68307-99-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-180-00-8 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-619-3 | 68308-00-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-181-00-3 | Tail gas (petroleum), cracked distillate hydrotreater stripper;Petroleum gas;[A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-620-9 | 68308-01-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-182-00-9 | Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-630-3 | 68308-10-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-183-00-4 | Tail gas (petroleum), gas oil catalytic cracking absorber;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-623-5 | 68308-03-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-184-00-X | Tail gas (petroleum), gas recovery plant;Petroleum gas;[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-624-0 | 68308-04-3 | Press. GasFlam. Gas 1Carc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-185-00-5 | Tail gas (petroleum), gas recovery plant deethanizer;Petroleum gas;[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbon having carbon numbers predominantly in the range of C1 through C4.] | 269-625-6 | 68308-05-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-186-00-0 | Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams and treated to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-626-1 | 68308-06-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-187-00-6 | Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-627-7 | 68308-07-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-188-00-1 | Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-629-8 | 68308-09-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-189-00-7 | Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-631-9 | 68308-11-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-190-00-2 | Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-632-4 | 68308-12-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-191-00-8 | Gases (petroleum), catalytic cracked overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C5 and boiling in the range of approximately - 48 oC to 32 oC (-54oF to 90oF).] | 270-071-2 | 68409-99-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-193-00-9 | Alkanes, C1-2;Petroleum gas | 270-651-5 | 68475-57-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-194-00-4 | Alkanes, C2-3;Petroleum gas | 270-652-0 | 68475-58-1 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-195-00-X | Alkanes, C3-4;Petroleum gas | 270-653-6 | 68475-59-2 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-196-00-5 | Alkanes, C4-5;Petroleum gas | 270-654-1 | 68475-60-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-197-00-0 | Fuel gases;Petroleum gas;[A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] | 270-667-2 | 68476-26-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-198-00-6 | Fuel gases, crude oil of distillates;Petroleum gas;[A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately - 217 oC to - 12 oC (-423oF to 10oF).] | 270-670-9 | 68476-29-9 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-199-00-1 | Hydrocarbons, C3-4;Petroleum gas | 270-681-9 | 68476-40-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-200-00-5 | Hydrocarbons, C4-5;Petroleum gas | 270-682-4 | 68476-42-6 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-201-00-0 | Hydrocarbons, C2-4, C3-rich;Petroleum gas | 270-689-2 | 68476-49-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-202-00-6 | Petroleum gases, liquefied;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately - 40 oC to 80 oC (-40 oF to 176 oF).] | 270-704-2 | 68476-85-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | HKSU |
| 649-203-00-1 | Petroleum gases, liquefied, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately - 40 oC to 80 oC (-40 oF to 176 oF).] | 270-705-8 | 68476-86-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | HKSU |
| 649-204-00-7 | Gases (petroleum), C3-4, isobutane-rich;Petroleum gas;[A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C4, predominantly isobutane.] | 270-724-1 | 68477-33-8 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-205-00-2 | Distillates (petroleum), C3-6, piperylene-rich;Petroleum gas;[A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C6, predominantly piperylenes.] | 270-726-2 | 68477-35-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-206-00-8 | Gases (petroleum), butane splitter overheads;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 270-750-3 | 68477-69-0 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-207-00-3 | Gases (petroleum), C2-;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] | 270-751-9 | 68477-70-3 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-208-00-9 | Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfide and other acidic components. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | 270-752-4 | 68477-71-4 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-209-00-4 | Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | 270-754-5 | 68477-72-5 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-210-00-X | Tail gas (petroleum), isomerized naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-628-2 | 68308-08-7 | Flam. Gas 1Press. GasCarc. 1AMuta. 1B | H220H350H340 | GHS02GHS04GHS08Dgr | H220H350H340 | H K U |
| 649-211-00-5 | Foots oil (petroleum), carbon-treated;Foots oil;[A complex combination of hydrocarbons obtained by the treatment of Foots oil with activated carbon for the removal of trace constituents and impurities. It consists predominantly of saturated straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-126-0 | 97862-76-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-212-00-0 | Distillates (petroleum), sweetened middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-088-7 | 64741-86-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-213-00-6 | Gas oils (petroleum), solvent-refined;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-092-9 | 64741-90-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-214-00-1 | Distillates (petroleum), solvent-refined middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-093-4 | 64741-91-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-215-00-7 | Gas oils (petroleum), acid-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-112-6 | 64742-12-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-216-00-2 | Distillates (petroleum), acid-treated middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 oC to 345 oC (401oF to 653oF).] | 265-113-1 | 64742-13-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-217-00-8 | Distillates (petroleum), acid-treated light;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-114-7 | 64742-14-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-218-00-3 | Gas oils (petroleum), chemically neutralized;Gasoil — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-129-9 | 64742-29-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-219-00-9 | Distillates (petroleum), chemically neutralized middle;Gasoil — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 oC to 345 oC (401oF to 653oF).] | 265-130-4 | 64742-30-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-220-00-4 | Distillates (petroleum), clay-treated middle;Gasoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-139-3 | 64742-38-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-221-00-X | Distillates (petroleum), hydrotreated middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-148-2 | 64742-46-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-222-00-5 | Gas oils (petroleum), hydrodesulfurized;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-182-8 | 64742-79-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-223-00-0 | Distillates (petroleum), hydrodesulfurized middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-183-3 | 64742-80-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-224-00-6 | Fuels, diesel;Gasoil — unspecified;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 163 oC to 357 oC (325oF to 675oF).] | 269-822-7 | 68334-30-5 | Carc. 2 | H351 | GHS08Wng | H351 | H N |
| 649-225-00-1 | Fuel oil, No 2;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 32,6 SUS at 37,7oC (100oF) to a maximum of 37,9 SUS at 37,7oC (100oF).] | 270-671-4 | 68476-30-2 | Carc. 2 | H351 | GHS08Wng | H351 | H |
| 649-226-00-7 | Fuel oil, No 4;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 45 SUS at 37,7oC (100oF) to a maximum of 125 SUS at 37,7oC (100oF).] | 270-673-5 | 68476-31-3 | Carc. 2 | H351 | GHS08Wng | H351 | H |
| 649-227-00-2 | Fuels, diesel, No 2;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 32,6 SUS at 37,7oC (100oF).] | 270-676-1 | 68476-34-6 | Carc. 2 | H351 | GHS08Wng | H351 | H |
| 649-228-00-8 | Distillates (petroleum), catalytic reformer fractionator residue, high-boiling;Gasoil — unspecified;[A complex combination of hydrocarbons from the distillation of catalytic reformer fracftionator residue. It boils in the range of approximately 343 oC to 399 oC (650oF to 750oF).] | 270-719-4 | 68477-29-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-229-00-3 | Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling;Gasoil — unspecified;[A complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils in the range of approximately 288 oC to 371 oC (550oF to 700oF).] | 270-721-5 | 68477-30-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-230-00-9 | Distillates (petroleum), catalytic reformer fractionator residue, low-boiling;Gasoil — unspecified;[The complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils approximately below 288 oC (550oF).] | 270-722-0 | 68477-31-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-231-00-4 | Distillates (petroleum), highly refined middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the subjection of a petroleum fraction to several of the following steps: filtration, centrifugation, atmospheric distillation, vacuum distillation, acidification, neutralization and clay treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C20.] | 292-615-8 | 90640-93-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-232-00-X | Distillates (petroleum) catalytic reformer, heavy arom. conc.;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from the distillation of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C16 and boiling in the range of approximately 200 oC to 300 oC (392oF to 572oF).] | 295-294-2 | 91995-34-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-233-00-5 | Gas oils, paraffinic;Gasoil — unspecified;[A distillate obtained from the redistillation of a complex combination of hydrocarbons obtained by the distillation of the effluents from a severe catalytic hydrotreatment of paraffins. It boils in the range of approximately 190 oC to 330 oC (374oF to 594oF).] | 300-227-8 | 93924-33-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-234-00-0 | Naphtha (petroleum), solvent-refined hydrodesulfurized heavy;Gasoil — unspecified | 307-035-3 | 97488-96-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-235-00-6 | Hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a middle distillate with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 290 oC to 350 oC (554oF to 662oF). It produces a finished oil having a viscosity of 2cSt at 100 oC (212oF).] | 307-659-6 | 97675-85-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-236-00-1 | Hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of heavy paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C20 and boiling in the range of approximately 230 oC to 350 oC (446oF to 662oF). It produces a finished oil having a viscosity of 2cSt at 100 oC (212oF).] | 307-660-1 | 97675-86-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-237-00-7 | Hydrocarbons, C11-17, solvent-extd. light naphthenic;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a visciosity of 2.2 cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 200 oC to 300 oC (392oF to 572oF).] | 307-757-9 | 97722-08-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-238-00-2 | Gas oils, hydrotreated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from the redistillation of the effluents from the treatment of paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C27 and boiling in the range of approximately 330 oC to 340 oC (626oF to 644oF).] | 308-128-1 | 97862-78-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-239-00-8 | Distillates (petroleum), carbon-treated light paraffinic;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of a petroleum oil fraction with activated charcoal for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C28.] | 309-667-5 | 100683-97-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-240-00-3 | Distillates (petroleum), intermediate paraffinic, carbon-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of petroleum with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 309-668-0 | 100683-98-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-241-00-9 | Distillates (petroleum), intermediate paraffinic, clay-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of petroleum with bleaching earth for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 309-669-6 | 100683-99-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-242-00-4 | Alkanes, C12-26-branched and linear | 292-454-3 | 90622-53-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-243-00-X | Lubricating greases;Grease;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. May contain organic salts of alkali metals, alkaline earth metals, and/or aluminium compounds.] | 278-011-7 | 74869-21-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-244-00-5 | Slack wax (petroleum);Slack wax;[A complex combination of hydrocarbons obtained from a petroleum fraction by solvent crystallization (solvent dewaxing) or as a distillation fraction from a very waxy crude. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 265-165-5 | 64742-61-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-245-00-0 | Slack wax (petroleum), acid-treated;Slack wax;[A complex combination of hydrocarbons obtained as a raffinate by treatment of a petroleum slack wax fraction with sulfuric acid treating process. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 292-659-8 | 90669-77-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-246-00-6 | Slack wax (petroleum), clay-treated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of a petroleum slack wax fraction with natural or modified clay in either a contacting or percolation process. It consists predominantly of saturated straight and branched hydrocarbons having carbon numbers predominantly greater than C20.] | 292-660-3 | 90669-78-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-247-00-1 | Slack wax (petroleum), hydrotreated;Slack wax;[A complex combination of hydrocarbons obtained by treating slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 295-523-6 | 92062-09-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-248-00-7 | Slack wax (petroleum), low-melting;Slack wax;[A complex combination of hydrocarbons obtained from a petroleum fraction by solvent deparaffination. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 295-524-1 | 92062-10-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-249-00-2 | Slack wax (petroleum), low-melting, hydrotreated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of low-melting petroleum slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 295-525-7 | 92062-11-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-250-00-8 | Slack wax (petroleum), low-melting, carbon-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting slack wax with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-155-9 | 97863-04-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-251-00-3 | Slack wax (petroleum), low-melting, clay-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with bentonite for removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-156-4 | 97863-05-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-252-00-9 | Slack wax (petroleum), low-melting, silicic acid-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-158-5 | 97863-06-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-253-00-4 | Slack wax (petroleum), carbon-treated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of petroleum slack wax with activated charcoal for the removal of trace polar constituents and impurities.] | 309-723-9 | 100684-49-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-254-00-X | Petrolatum;Petrolatum;[A complex combination of hydrocarbons obtained as a semi-solid from dewaxing paraffinic residual oil. It consists predominantly of saturated crystalline and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | 232-373-2 | 8009-03-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-255-00-5 | Petrolatum (petroleum), oxidized;Petrolatum;[A complex combination of organic compounds, predominantly high molecular weight carboxylic acids, obtained by the air oxidation of petrolatum.] | 265-206-7 | 64743-01-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-256-00-0 | Petrolatum (petroleum), alumina-treated;Petrolatum;[A complex combination of hydrocarbons obtained when petrolatum is treated with Al2O3 to remove polar components and impurities. It consists predominantly of saturated, crystalline, and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | 285-098-5 | 85029-74-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-257-00-6 | Petrolatum (petroleum), hydrotreated;Petrolatum;[A complex combination of hydrocarbons obtained as a semi-solid from dewaxed paraffinic residual oil treated with hydrogen in the presence of a catalyst. It consists predominantly of saturated microcrystalline and liquid hydrocarbons having carbon numbers predominantly greater than C20.] | 295-459-9 | 92045-77-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-258-00-1 | Petrolatum (petroleum), carbon-treated;Petrolatum;[A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | 308-149-6 | 97862-97-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-259-00-7 | Petrolatum (petroleum), silicic acid-treated;Petrolatum;[A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | 308-150-1 | 97862-98-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-260-00-2 | Petrolatum (petroleum), clay-treated;Petrolatum;[A complex combination of hydrocarbons obtained by treatment of petrolatum with bleaching earth for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of greater than C25.] | 309-706-6 | 100684-33-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H N |
| 649-261-00-8 | Gasoline, natural;Low boiling point naphtha;[A complex combination of hydrocarbons separated from natural gas by processes such as refrigeration or absorption. It consists predominantly of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately minus 20 oC to 120 oC (-4oF to 248oF).] | 232-349-1 | 8006-61-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-262-00-3 | Naphtha;Low boiling point naphtha;[Refined, partly refined, or unrefined petroleum products by the distillation of natural gas. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 100 oC to 200 oC (212oF to 392oF).]] | 232-443-2 | 8030-30-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-263-00-9 | Ligroine;Low boiling point naphtha;[A complex combination of hydrocarbons obtained by the fractional distillation of petroleum. This fraction boils in a range of approximately 20 oC to 135 oC (58oF to 275oF).] | 232-453-7 | 8032-32-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-264-00-4 | Naphtha (petroleum), heavy straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-041-0 | 64741-41-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-265-00-X | Naphtha (petroleum), full-range straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 220 oC (-4oF to 428oF).] | 265-042-6 | 64741-42-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-266-00-5 | Naphtha (petroleum), light straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately minus 20 oC to 180 oC (-4oF to 356oF).] | 265-046-8 | 64741-46-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-267-00-0 | Solvent naphtha (petroleum), light aliph.;Low boiling point naphtha;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 35 oC to 160 oC (95oF to 320oF).] | 265-192-2 | 64742-89-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-268-00-6 | Distillates (petroleum), straight-run light;Low boiling point naphtha;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C7 and boiling in the range of approximately - 88 oC to 99 oC (-127oF to 210oF).] | 270-077-5 | 68410-05-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-269-00-1 | Gasoline, vapor-recovery;Low boiling point naphtha;[A complex combination of hydrocarbons separated from the gases from vapor recovery systems by cooling. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately - 20 oC to 196 oC (-4oF to 384oF).] | 271-025-4 | 68514-15-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-270-00-7 | Gasoline, straight-run, topping-plant;Low boiling point naphtha;[A complex combination of hydrocarbons produced from the topping plant by the distillation of crude oil. It boils in the range of approximately 36,1oC to 193,3oC (97oF to 380oF).] | 271-727-0 | 68606-11-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-271-00-2 | Naphtha (petroleum), unsweetened;Low boiling point naphtha;[A complex combination of hydrocarbons produced from the distillation of naphtha streams from various refinery processes. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 0 oC to 230 oC (25oF to 446oF).] | 272-186-3 | 68783-12-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-272-00-8 | Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads;Low boiling point naphtha;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C3 through C6..] | 272-931-2 | 68921-08-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-273-00-3 | Naphtha (petroleum), heavy straight run, arom.-contg.;Low boiling point naphtha;[A complex combination of hydrocarbons obtained from a distillation process of crude petroleum. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130 oC to 210 oC (266oF to 410oF).] | 309-945-6 | 101631-20-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-274-00-9 | Naphtha (petroleum), full-range alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consist of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 220 oC (194oF to 428oF).] | 265-066-7 | 64741-64-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-275-00-4 | Naphtha (petroleum), heavy alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 to C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 150 oC to 220 oC (302oF to 428oF).] | 265-067-2 | 64741-65-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-276-00-X | Naphtha (petroleum), light alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of aproximately 90 oC to 160 oC (194oF to 320oF).] | 265-068-8 | 64741-66-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-277-00-5 | Naphtha (petroleum), isomerization;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained from catalytic isomerization of straight chain paraffinic C4 through C6 hydrocarbons. It consists predominantly of saturated hydrocarbons such as isobutane, isopentane, 2,2-dimethylbutane, 2-methylpentane, and 3-methylpentane.] | 265-073-5 | 64741-70-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-278-00-0 | Naphtha (petroleum), solvent-refined light;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF).] | 265-086-6 | 64741-84-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-279-00-6 | Naphtha (petroleum), solvent-refined heavy;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-095-5 | 64741-92-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-280-00-1 | Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts.;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from the UDEX extraction process on the catalytic reformer stream. It consists of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C9.] | 270-088-5 | 68410-71-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-281-00-7 | Raffinates (petroleum), reformer, Lurgi unit-sepd.;Low boiling point modified naphtha;[The complex combination of hydrocarbons obtained as a raffinate from a Lurgi separation unit. It consists predominantly of non-aromatic hydrocarbons with various small amounts of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8.] | 270-349-3 | 68425-35-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-282-00-2 | Naphtha (petroleum), full-range alkylate, butane-contg.;Low boiling point modified naphta;[A complex combination of hydrocarbons produced by the distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C7 through C12 with some butanes and boiling in the range of approximately 35 oC to 200 oC (95oF to 428oF).] | 271-267-0 | 68527-27-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-283-00-8 | Distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinates from a solvent extraction process of hydrotreated light distillate from steam-cracked naphtha.] | 295-315-5 | 91995-53-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-284-00-3 | Naphtha (petroleum), C4-12 butane-alkylate, isooctane-rich;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by alkylation of butanes. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12, rich in isooctane, and boiling in the range of approximately 35 oC to 210 oC (95oF to 410oF).] | 295-430-0 | 92045-49-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-285-00-9 | Hydrocarbons, hydrotreated light naphtha distillates, solvent-refined;Low boiling point modified naphtha;[A combination of hydrocarbons obtained from the distillation of hydrotreated naphtha followed by a solvent extraction and distillation process. It consists predominantly of saturated hydrocarbons boiling in the range of approximately 94 oC to 99 oC (201oF to 210oF).] | 295-436-3 | 92045-55-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-286-00-4 | Naphtha (petroleum), isomerization, C6-fraction;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by distillation of a gasoline which has been catalytically isomerized. It consists predominantly of hexane isomers boiling in the range of approximately 60 oC to 66 oC (140oF to 151oF).] | 295-440-5 | 92045-58-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-287-00-X | Hydrocarbons, C6-7, naphtha-cracking, solvent-refined;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by the sorption of benzene from a catalytically fully hydrogenated benzene-rich hydrocarbon cut that was distillatively obtained from prehydrogenated cracked naphtha. It consists predominantly of paraffinic and naphthenic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 70 oC to 100 oC (158oF to 212oF).] | 295-446-8 | 92045-64-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-288-00-5 | Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by distillation of hydrotreated naphtha followed by solvent extraction. It consists predominantly of saturated hydrocarbons and boiling in the range of approximately 65 oC to 70 oC (149oF to 158oF).] | 309-871-4 | 101316-67-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-289-00-0 | Naphtha (petroleum), heavy catalytic cracked;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by a distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (148oF to 446oF). It contains a relatively large proportion of unsaturated hydrocarbons.] | 265-055-7 | 64741-54-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-290-00-6 | Naphtha (petroleum), light catalytic cracked;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF). It contains a relatively large proportion of unsaturated hydrocarbons.] | 265-056-2 | 64741-55-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-291-00-1 | Hydrocarbons, C3-11, catalytic cracker distillates;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillations of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C11 and boiling in a range approximately up to 204 oC (400oF).] | 270-686-6 | 68476-46-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-292-00-7 | Naphtha (petroleum), catalytic cracked light distd.;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-185-8 | 68783-09-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-293-00-2 | Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.;Low boiling point cat-cracked naphtha.;[A complex combination of hydrocarbons obtained by treating a light distillate from steam-cracked naphtha. It consists predom-inantly of aromatic hydrocarbons.] | 295-311-3 | 91995-50-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-294-00-8 | Naphtha (petroleum), heavy catalytic cracked, sweetened;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting a catalytic cracked petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 60 oC to 200 oC (140oF to 392oF).] | 295-431-6 | 92045-50-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-295-00-3 | Naphtha (petroleum), light catalytic cracked sweetened;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting naphtha from a catalytic cracking process to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons boiling in a range of approxim-ately 35 oC to 210 oC (95oF to 410oF).] | 295-441-0 | 92045-59-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-296-00-9 | Hydrocarbons, C8-12, catalytic-cracking, chem. neutralized;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of a cut from the catalytic cracking process, having undergone an alkaline washing. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130 oC to 210 oC (266oF to 410oF).] | 295-794-0 | 92128-94-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-297-00-4 | Hydrocarbons, C8-12, catalytic cracker distillates;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by distillation of products from a catalytic cracking process. It consists pre-dominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C12 and boiling in the range of approximately 140 oC to 210 oC (284oF to 410oF).] | 309-974-4 | 101794-97-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-298-00-X | Hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened;Low boiling point cat-cracked naphtha | 309-987-5 | 101896-28-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-299-00-5 | Naphtha (petroleum), light catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol. % or more benzene.]] | 265-065-1 | 64741-63-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-300-00-9 | Naphtha (petroleum), heavy catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-070-9 | 64741-68-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-301-00-4 | Distillates (petroleum), catalytic reformed depentanizer;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons from the distillation of products from a catalytic reforming process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 49 oC to 63 oC - 57oF to 145oF).] | 270-660-4 | 68475-79-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-302-00-X | Hydrocarbons, C2-6, C6-8 catalytic reformer;Low boiling point cat-reformed naphtha | 270-687-1 | 68476-47-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-303-00-5 | Residues (petroleum), C6-8 catalytic reformer;Low boiling point cat-reformed naphtha';[A complex residuum from the catalytic reforming of C6-8 feed. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 270-794-3 | 68478-15-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-304-00-0 | Naphtha (petroleum), light catalytic reformed, arom.-free;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained from distillation of products from a catalytic reforming process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 35 oC to 120 oC (95oF to 248oF). It contains a relatively large proportion of branched chain hydrocarbons with the aromatic components removed.] | 270-993-5 | 68513-03-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-305-00-6 | Distillates (petroleum), catalytic reformed straight-run naphtha overheads;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha followed by the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-008-1 | 68513-63-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-306-00-1 | Petroleum products, hydrofiner-powerformer reformates;Low boiling point cat-reformed naphtha;[The complex combination of hydrocarbons obtained in a hydrofiner-powerformer process and boiling in a range of approximately 27 oC to 210 oC (80oF to 410oF).] | 271-058-4 | 68514-79-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-307-00-7 | Naphtha (petroleum, full-range reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35 oC to 230 oC (95oF to 446oF).] | 272-895-8 | 68919-37-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-308-00-2 | Naphtha (petroleum), catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30 oC to 220 oC (90oF to 430oF). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol.% or more benzene.] | 273-271-8 | 68955-35-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-309-00-8 | Distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction;Low boiling point cat-reformed naphtha;[A complex combination of alkylbenzenes obtained by the catalytic reforming of petroleum naphtha. It consists predominantly of alkylbenzenes having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 160 oC to 180 oC (320oF to 356oF).] | 285-509-8 | 85116-58-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-310-00-3 | Aromatic hydrocarbons, C8, catalytic reforming-derived;Low boiling point cat-reformed naphtha | 295-279-0 | 91995-18-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-311-00-9 | Aromatic hydrocarbons, C7-12, C8-rich;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 (primarily C8) and can contain nonaromatic hydrocarbons, both boiling in the range of approximately 130 oC to 200 oC (266oF to 392oF).] | 297-401-8 | 93571-75-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-312-00-4 | Gasoline, C5-11, high-octane stabilized reformed;Low boiling point cat-reformed naphtha;[A complex high octane combination of hydrocarbons obtained by the catalytic dehydrogenation of a predominantly naphthenic naphtha. It consists predominantly of aromatics and non-aromatics having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 45 oC to 185 oC (113oF to 365oF).] | 297-458-9 | 93572-29-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-313-00-X | Hydrocarbons, C7-12, C >9-arom.-rich, reforming heavy fraction;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 120 oC to 210 oC (248oF to 380oF) and C9 and higher aromatic hydrocarbons.] | 297-465-7 | 93572-35-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-314-00-5 | Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 35 oC to 125 oC (94oF to 257oF), benzene and toluene.] | 297-466-2 | 93572-36-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-315-00-0 | Foots oil (petroleum), silicic acid-treated;Foots oil;[A complex combination of hydrocarbons obtained by the treatment of Foots oil with silicic acid for removal of trace constituents and impurities. It consists predominantly of straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-127-6 | 97862-77-6 | Carc. 1B | H350H304 | GHS08Dgr | H350H304 | H L |
| 649-316-00-6 | Naphtha (petroleum), light thermal cracked;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons from distillation of products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately minus 10 oC to 130 oC (14oF to 266oF).] | 265-075-6 | 64741-74-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-317-00-1 | Naphtha (petroleum), heavy thermal cracked;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons from distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 220 oC (148oF to 428oF).] | 265-085-0 | 64741-83-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-318-00-7 | Distillates (petroleum), heavy arom.;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This higher boiling fraction consists predominantly of C5-C7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having carbon number predominantly of C5. This stream may contain benzene.] | 267-563-4 | 67891-79-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-319-00-2 | Distillates (petroleum), light arom.;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This lower boiling fraction consists predominantly of C5-C7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having a carbon number predominantly of C5. This stream may contain benzene.] | 267-565-5 | 67891-80-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-320-00-8 | Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons obtained by the pyrolysis fractionation at 816 oC (1500oF) of naphtha and raffinate. It consists predominantly of hydrocarbons having a carbon number of C9 and boiling at approximately 204 oC (400oF).] | 270-344-6 | 68425-29-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-321-00-3 | Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived;Low boiling point thermally cracked naphtha;A complex combination of hydrocarbons obtained by the fractionation pyrolysis at 816 oC (1500oF) of naphtha and raffinate. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8, including benzene.] | 270-658-3 | 68475-70-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-322-00-9 | Distillates (petroleum), thermal cracked naphtha and gas oil;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by distillation of thermally cracked naphtha and/or gas oil. It consists predominantly of olefinic hydrocarbons having a carbon number of C5 and boiling in the range of approximately 33 oC to 60 oC (91oF to 140oF).] | 271-631-9 | 68603-00-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-323-00-4 | Distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists predominantly of hydrocarbons having a carbon number of C5 with some dimerized C5 olefins and boiling in the range of approximately 33 oC to 184 oC (91oF to 363oF).] | 271-632-4 | 68603-01-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-324-00-X | Distillates (petroleum), thermal cracked naphtha and gas oil, extractive;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists of paraffinic and olefinic hydrocarbons, predominantly isoamylenes such as 2-methyl-1-butene and 2-methyl-2-butene and boiling in the range of approximately 31 oC to 40 oC (88oF to 104oF).] | 271-634-5 | 68603-03-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-325-00-5 | Distillates (petroleum), light thermal cracked, debutanized arom.;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists predominantly of aromatic hydrocarbons, primarily benzene.] | 273-266-0 | 68955-29-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-326-00-0 | Naphtha (petroleum), light thermal cracked, sweetened;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate from the high temperature thermal cracking of heavy oil fractions to a sweetening process to convert mercaptans. It consists predominantly of aromatics, olefins and saturated hydrocarbons boiling in the range of approximately 20 oC to 100 oC (68oF to 212oF).] | 295-447-3 | 92045-65-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-327-00-6 | Naphtha (petroleum), hydrotreated heavy;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C13 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-150-3 | 64742-48-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-328-00-1 | Naphtha (petroleum), hydrotreated light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-151-9 | 64742-49-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-329-00-7 | Naphtha (petroleum), hydrodesulfurized light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-178-6 | 64742-73-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-330-00-2 | Naphtha (petroleum), hydrodesulfurized heavy;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-185-4 | 64742-82-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-331-00-8 | Distillates (petroleum), hydrotreated middle, intermediate boiling;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by the distillation of products from a middle distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 127 oC to 188 oC (262oF to 370oF).] | 270-092-7 | 68410-96-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-332-00-3 | Distillates (petroleum), light distillate hydrotreating process, low-boiling;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by the distillation of products from the light distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C9 and boiling in the range of approximately 3 oC to 194 oC (37oF to 382oF).] | 270-093-2 | 68410-97-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-333-00-9 | Distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by distillation of the products from a heavy naphtha hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 49 oC to 68 oC (-57oF to 155oF).] | 270-094-8 | 68410-98-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-334-00-4 | Solvent naphtha (petroleum), light arom., hydrotreated;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF).] | 270-988-8 | 68512-78-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-335-00-X | Naphtha (petroleum), hydrodesulfurized thermal cracked light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by fractionation of hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23 oC to 195 oC (73oF to 383oF).] | 285-511-9 | 85116-60-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-336-00-5 | Naphtha (petroleum), hydrotreated light, cycloalkane-contg.;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from the distillation of a petroleum fraction. It consists predominantly of alkanes and cycloalkanes boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 285-512-4 | 85116-61-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-337-00-0 | Naphtha (petroleum), heavy steam-cracked, hydrogenated;Low boiling point hydrogen treated naphtha | 295-432-1 | 92045-51-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-338-00-6 | Naphtha (petroleum), hydrodesulfurized full-range;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately 30 oC to 250 oC (86oF to 482oF).] | 295-433-7 | 92045-52-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-339-00-1 | Naphtha (petroleum), hydrotreated light steam-cracked;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction, derived from a pyrolysis process, with hydrogen in the presence of a catalyst. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF).] | 295-438-4 | 92045-57-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-340-00-7 | Hydrocarbons, C4-12, naphtha-cracking, hydrotreated;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by distillation from the product of a naphtha steam cracking process and subsequent catalytic selective hydrogenation of gum formers. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30 oC to 230 oC (86oF to 446oF).] | 295-443-1 | 92045-61-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-341-00-2 | Solvent naphtha (petroleum), hydrotreated light naphthenic;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of cycloparaffinic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 73 oC to 85 oC (163oF to 185oF).] | 295-529-9 | 92062-15-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-342-00-8 | Naphtha (petroleum), light steam-cracked, hydrogenated;Low boiling point hydrogen treated naphtha;[A complex comination of hydrocarbons produced from the separation and subsequent hydrogenation of the products of a steam-cracking process to produce ethylene. It consists predominantly of saturated and unsaturated paraffins, cyclic paraffins and cyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately 50 oC to 200 oC (122oF to 392oF). The proportion of benzene hydrocarbons may vary up to 30 wt. % and the stream may also contain small amounts of sulphur and oxygenated compounds.] | 296-942-7 | 93165-55-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-343-00-3 | Hydrocarbons, C6-11, hydrotreated, dearomatized;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-852-0 | 93763-33-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-344-00-9 | Hydrocarbons, C9-12, hydrotreated, dearomatized;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-853-6 | 93763-34-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-345-00-4 | Stoddard solvent;Low boiling point naphtha — unspecified;[A colourless, refined petroleum distillate that is free from rancid or objectionable odors and that boils in a range of approximately 300oF to 400oF.] | 232-489-3 | 8052-41-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-346-00-X | Natural gas condensates (petroleum);Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated as a liquid from natural gas in a surface separator by retrograde condensation. It consists mainly of hydrocarbons having carbon numbers predominantly in the range of C2 to C20. It is a liquid at atmospheric temperature and pressure.] | 265-047-3 | 64741-47-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-347-00-5 | Natural gas (petroleum), raw liq. mix;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated as a liquid from natural gas in a gas recycling plant by processes such as refrigeration or absorption. It consists mainly of saturated aliphatic hydrocarbons having carbon numbers in the range of C2 through C8.] | 265-048-9 | 64741-48-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-348-00-0 | Naphtha (petroleum), light hydrocracked;Low boiling naphtha — unspecified;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C4 through C10, and boiling in the range of approximately minus 20 oC to 180 oC (-4oF to 356oF).] | 265-071-4 | 64741-69-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-349-00-6 | Naphtha (petroleum), heavy hydrocracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12, and boiling in the range of approximately 65 oC to 230 oC (148oF to 446oF).] | 265-079-8 | 64741-78-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-350-00-1 | Naphtha (petroleum), sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately minus 10 oC to 230 oC (14oF to 446oF).] | 265-089-2 | 64741-87-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-351-00-7 | Naphtha (petroleum), acid-treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-115-2 | 64742-15-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-352-00-2 | Naphtha (petroleum), chemically neutralized heavy;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-122-0 | 64742-22-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-353-00-8 | Naphtha (petroleum), chemically neutralized light;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-123-6 | 64742-23-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-354-00-3 | Naphtha (petroleum), catalytic dewaxed;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the catalytic dewaxing of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35 oC to 230 oC (95oF to 446oF).] | 265-170-2 | 64742-66-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-355-00-9 | Naphtha (petroleum), light steam-cracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF). This stream is likely to contain 10 vol.% or more benzene.] | 265-187-5 | 64742-83-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-356-00-4 | Solvent naphtha (petroleum), light arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF).] | 265-199-0 | 64742-95-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-357-00-X | Aromatic hydrocarbons, C6-10, acid-treated, neutralized;Low boiling point naphtha — unspecified | 268-618-5 | 68131-49-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-358-00-5 | Distillates (petroleum), C3-5, 2-methyl-2-butene-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons from the distillation of hydrocarbons usually ranging in carbon numbers from C3 through C5, predominantly isopentane and 3-methyl-1-butene. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C5, predominantly 2-methyl-2-butene.] | 270-725-7 | 68477-34-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-359-00-0 | Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the distillation of polymerized steam-cracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12.]] | 270-735-1 | 68477-50-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-360-00-6 | Distillates (petroleum), steam-cracked, C5-12 fraction;Low boiling point naphtha — unspecified;[A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C12.] | 270-736-7 | 68477-53-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-361-00-1 | Distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction;Low boiling point naphtha — unspecified | 270-738-8 | 68477-55-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-362-00-7 | Extracts (petroleum), cold-acid, C4-6;Low boiling point naphtha — unspecified;[A complex combination of organic compounds produced by cold acid unit extraction of saturated and unsaturated aliphatic hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly pentanes and amylenes. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | 270-741-4 | 68477-61-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-363-00-2 | Distillates (petroleum), depentanizer overheads;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from a catalytic cracked gas stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | 270-771-8 | 68477-89-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-364-00-8 | Residues (petroleum), butane splitter bottoms;Low boiling point naphtha — unspecified;[A complex residuum from the distillation of butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4through C6.] | 270-791-7 | 68478-12-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-365-00-3 | Residual oils (petroleum), deisobutanizer tower;Low boiling point naphtha — unspecified;[A complex residuum from the atmospheric distillation of the butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | 270-795-9 | 68478-16-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-366-00-9 | Naphtha (petroleum), full-range coker;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C15 and boiling in the range of approximately 43 oC to 250 oC (110oF to 500oF).] | 270-991-4 | 68513-02-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-367-00-4 | Naphtha (petroleum), steam-cracked middle arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by the distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 130 oC to 220 oC (266oF to 428oF).]] | 271-138-9 | 68516-20-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-368-00-X | Naphtha (petroleum), clay-treated full-range straight-run;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons resulting from treatment of full-range straight-run naphtha with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately - 20 oC to 220 oC (-4oF to 429oF).] | 271-262-3 | 68527-21-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-369-00-5 | Naphtha (petroleum), clay-treated light straight-run;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons resulting from treatment of light straight-run naphtha with a natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities, present. It consists of hydro-carbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of approximately 93 oC to 180 oC (200oF to 356oF.] | 271-263-9 | 68527-22-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-370-00-0 | Naphtha (petroleum), light steam-cracked arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C9 and boiling in the range of approximately 110 oC to 165 oC (230oF to 329oF).] | 271-264-4 | 68527-23-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-371-00-6 | Naphtha (petroleum), light steam-cracked, debenzenized;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 80 oC to 218 oC (176oF to 424oF).] | 271-266-5 | 68527-26-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-372-00-1 | Naphtha (petroleum), arom.-contg.;Low boiling point naphtha — unspecified | 271-635-0 | 68603-08-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-373-00-7 | Gasoline, pyrolysis, debutanizer bottoms;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists of hydrocarbons having carbon numbers predominantly greater than C5.] | 271-726-5 | 68606-10-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-374-00-2 | Naphtha (petroleum), light, sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 20 oC to 100 oC (-4oF to 212oF).] | 272-206-0 | 68783-66-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-375-00-8 | Natural gas condensates;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated and/or condensed from natural gas during transportation and collected at the wellhead and/or from the production, gathering, transmission, and distribution pipelines in deeps, scrubbers, etc. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C2 through C8.] | 272-896-3 | 68919-39-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H J |
| 649-376-00-3 | Distillates (petroleum), naphtha unifiner stripper;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by stripping the products from the naphtha unifiner. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 272-932-8 | 68921-09-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-377-00-9 | Naphtha (petroleum), catalytic reformed light, arom.-free fraction;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons remaining after removal of aromatic compounds from catalytic reformed light naphtha in a selective absorption process. It consists predominantly of paraffinic and cyclic compounds having carbon numbers predominantly in the range of C5 to C8 and boiling in the range of approximately 66 oC to 121 oC (151oF to 250oF).] | 285-510-3 | 85116-59-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-378-00-4 | Gasoline;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons consisting primarily of paraffins, cycloparaffins, aromatic and olefinic hydrocarbons having carbon numbers predominantly greater than C3 and boiling in the range of 30 oC to 260 oC (86oF to 500oF).] | 289-220-8 | 86290-81-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-379-00-X | Aromatic hydrocarbons, C7-8, dealkylation products, distn. residues;Low boiling point naphtha — unspecified | 292-698-0 | 90989-42-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-380-00-5 | Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the depentanizer column before hydrotreatment of the aromatic charges. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C6, predominantly pentanes and pentenes, and boiling in the range of approximately 25 oC to 40 oC (77oF to 104oF).] | 295-298-4 | 91995-38-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-381-00-0 | Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of heat-soaked steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | 295-302-4 | 91995-41-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-382-00-6 | Extracts (petroleum), catalytic reformed light naphtha solvent;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as the extract from the solvent extraction of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C8 and boiling in the range of approximately 100 oC to 200 oC (212oF to 392oF).] | 295-331-2 | 91995-68-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-383-00-1 | Naphtha (petroleum), hydrodesulfurized light, dearomatized;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of hydrodesulfurized and dearomatized light petroleum fractions. It consists predominantly of C7 paraffins and cycloparaffins boiling in a range of approximately 90 oC to 100 oC (194oF to 212oF).] | 295-434-2 | 92045-53-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-384-00-7 | Naphtha (petroleum), light, C5-rich, sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C5, predominantly C5, and boiling in the range of approximately minus 10 oC to 35 oC (14oF to 95oF).] | 295-442-6 | 92045-60-8 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-385-00-2 | Hydrocarbons, C8-11, naphtha-cracking, toluene cut;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation from prehydrogenated cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C11 and boiling in the range of approximately 130 oC to 205 oC (266oF to 401oF).] | 295-444-7 | 92045-62-0 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-386-00-8 | Hydrocarbons, C4-11, naphtha-cracking, arom.-free;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from prehydrogenated cracked naphtha after distillative separation of benzene- and toluene-containing hydrocarbon cuts and a higher boiling fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range C4 through C11 and boiling in the range of approximately 30 oC to 205 oC (86oF to 401oF).] | 295-445-2 | 92045-63-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-387-00-3 | Naphtha (petroleum), light heat-soaked, steam-cracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the fractionation of steam cracked naphtha after recovery from a heat soaking process. It consists predominantly of hydrocarbons having a carbon numbers predominantly in the range of C4 through C6 and boiling in the range of approximately 0 oC to 80 oC (32oF to 176oF.] | 296-028-8 | 92201-97-3 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-388-00-9 | Distillates (petroleum), C6-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the distillation of a petroleum feedstock. It consists predominantly of hydrocarbons having carbon numbers of C5 through C7, rich in C6, and boiling in the range of approximately 60 oC to 70 oC (140oF to 158oF).] | 296-903-4 | 93165-19-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-389-00-4 | Gasoline, pyrolysis, hydrogenated;Low boiling point naphtha-unspecified;[A distillation fraction from the hydrogenation of pyrolysis gasoline boiling in the range of approximately 20 oC to 200 oC (68oF to 392oF).] | 302-639-3 | 94114-03-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-390-00-X | Distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of the polymerized C8 through C12 fraction from steam-cracked petroleum distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | 305-750-5 | 95009-23-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-391-00-5 | Extracts (petroleum) heavy naphtha solvent, clay-treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment of heavy naphthic solvent petroleum extract with bleaching earth. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C18 and boiling in the range of approximately 80 oC to 180 oC (175oF to 356oF).] | 308-261-5 | 97926-43-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-392-00-0 | Naphtha (petroleum), light steam-cracked, debenzenized, thermally treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment and distillation of debenzenized light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 95 oC to 200 oC (203oF to 392oF).] | 308-713-1 | 98219-46-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-393-00-6 | Naphtha (petroleum), light steam-cracked, thermally treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment and distillation of light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 35 oC to 80 oC (95oF to 176oF).] | 308-714-7 | 98219-47-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-394-00-1 | Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of petroleum light fraction, hydrodesulfurized and dearomatized. It consists predominantly of hydrocarbons having carbon numbers in the range of C7 through C9, predominantly C8 paraffins and cycloparaffins, boiling in the range of approximately 120 oC to 130 oC (248oF to 266oF).] | 309-862-5 | 101316-56-7 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-395-00-7 | Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained during the sorptions of toluene from a hydrocarbon fraction from cracked gasoline treated with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C8 and boiling in the range of approximately 80 oC to 135 oC (176oF to 275oF).] | 309-870-9 | 101316-66-9 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-396-00-2 | Naphtha (petroleum), hydrodesulfurized full-range coker;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23 oC to 196 oC (73oF to 385oF).] | 309-879-8 | 101316-76-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-397-00-8 | Naphtha (petroleum), sweetened light;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 20 oC to 130 oC (68oF to 266oF).] | 309-976-5 | 101795-01-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-398-00-3 | Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly C5.] | 310-012-0 | 102110-14-5 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-399-00-9 | Hydrocarbons, C5-rich, dicyclopentadiene-contg.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of the products from a stream-cracking process. It consists predominantly of hydrocarbons having carbon numbers of C5 and dicyclopentadiene and boiling in the range of approximately 30 oC to 170 oC (86oF to 338oF).] | 310-013-6 | 102110-15-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-400-00-2 | Residues (petroleum), steam-cracked light, arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of the products of steam cracking or similar processes after taking off the very light products resulting in a residue starting with hydrocarbons having carbon numbers greater than C5. It consists predominantly of aromatic hydrocarbons having carbon numbers greater than C5 and boiling above approximately 40 oC (104oF).] | 310-057-6 | 102110-55-4 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-401-00-8 | Hydrocarbons, C ≥ 5, C5-6-rich;Low boiling point naphtha — unspecified | 270-690-8 | 68476-50-6 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-402-00-3 | Hydrocarbons, C5-rich;Low boiling point naphtha — unspecified | 270-695-5 | 68476-55-1 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-403-00-9 | Aromatic hydrocarbons, C8-10;Low boiling point naphtha — unspecified | 292-695-4 | 90989-39-2 | Carc. 1BAsp. Tox. 1 | H350H304 | GHS08Dgr | H350H304 | H P |
| 649-404-00-4 | Kerosine (petroleum);Straight run kerosine;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (320oF to 554oF).] | 232-366-4 | 8008-20-6 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-405-00-X | Solvent naphtha (petroleum), medium aliph.;Straight run kerosine;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 140 oC to 220 oC (284oF to 428oF).] | 265-191-7 | 64742-88-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-406-00-5 | Solvent naphtha (petroleum) heavy aliph.;Straight run kerosine;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C11 through C16 and boiling in the range of approximately 190 oC to 290 oC (374oF to 554oF).] | 265-200-4 | 64742-96-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-407-00-0 | Kerosine (petroleum), straight-run wide-cut;Straight run kerosine;[A complex combination of hydrocarbons obtained as a wide cut hydrocarbon fuel cut from atmospheric distillation and boiling in the range of approximately 70 oC to 220 oC (158oF to 428oF).] | 295-418-5 | 92045-37-9 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-408-00-6 | Distillates (petroleum), steam-cracked;Cracked kerosine;[A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C7 through C16 and boiling in the range of approximately 90 oC to 290 oC (190oF to 554oF).] | 265-194-3 | 64742-91-2 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-409-00-1 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction;Cracked kerosine;[A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists of hydro-carbons having carbon numbers in the range of C8 through C10 and boiling in the range of approximately 129 oC to 194 oC (264oF to 382oF).] | 270-728-3 | 68477-39-4 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-410-00-7 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction;Cracked kerosine;[A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C10 through C12.] | 270-729-9 | 68477-40-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-411-00-2 | Distillates (petroleum), steam-cracked, C8-12 fraction;Cracked kerosine;[A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | 270-737-2 | 68477-54-3 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-412-00-8 | Kerosine (petroleum), hydrodesulfurized thermal cracked;Cracked kerosine;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons predominantly in the range of C8 to C16 and boiling in the range of approximately 120 oC to 283 oC (284oF to 541oF).] | 285-507-7 | 85116-55-8 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-413-00-3 | Aromtic hydrocarbons, C≥10, steam-cracking, hydrotreated;Cracked kerosine;[A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly greater than C10 and boiling in the range of approximately 150 oC to 320 oC (302oF to 608oF).] | 292-621-0 | 90640-98-5 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-414-00-9 | Naphtha (petroleum), steam-cracked, hydrotreated, C9-10-arom.-rich;Cracked kerosine;[A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process thereafter treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C9 through C10 and boiling in the range of approximately 140 oC to 200 oC (284oF to 392oF).] | 292-637-8 | 90641-13-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-415-00-4 | Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of thermal-cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF.] | 309-866-7 | 101316-61-4 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-416-00-X | Distillates (petroleum), catalytic cracked heavy tar light;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of catalytic cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF).] | 309-938-8 | 101631-13-4 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-417-00-5 | Solvent naphtha (petroleum), hydrocracked heavy arom.;Cracked kerosine;[A complex combination of hydrocarbons obtained by the distillation of hydrocracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 235 oC to 290 oC (455oF to 554oF).] | 309-881-9 | 101316-80-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-418-00-0 | Distillates (petroleum), steam-cracked heavy tar light;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of steam cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF).] | 309-940-9 | 101631-15-6 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-419-00-6 | Distillates (petroleum), alkylate;Kerosine — unspecified;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 205 oC to 320 oC (401oF to 608oF).] | 265-074-0 | 64741-73-7 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-420-00-1 | Extracts (petroleum), heavy naphtha solvent;Kerosine — unspecified;[A complex combination of hydrocarbons obtained as the extract from a solvent extraction process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 220 oC (194oF to 428oF).] | 265-099-7 | 64741-98-6 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-421-00-7 | Distillates (petroleum), chemically neutralized light;Kerosine — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-132-5 | 64742-31-0 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-422-00-2 | Distillates (petroleum), hydrotreated light;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-149-8 | 64742-47-8 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-423-00-8 | Kerosine (petroleum), hydrodesulfurized;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-184-9 | 64742-81-0 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-424-00-3 | Solvent naphtha (petroleum), heavy arom.;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 165 oC to 290 oC (330oF to 554oF).] | 265-198-5 | 64742-94-5 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-425-00-9 | Naphtha (petroleum), heavy coker;Kerosine — unspecified;[A complex combination of hydrocarbons from the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C15 and boiling in the range of approximately 157 oC to 288 oC (315oF to 550oF).] | 269-778-9 | 68333-23-3 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-426-00-4 | Naphtha (petroleum), catalytic reformed hydrodesulfurized heavy, arom. fraction;Kerosine — unspecified;[A complex combination of hydrocarbons produced by fractionation from catalytically reformed hydrodesulfurized naphtha. It consists predominantly of aromatic hydrocarbons having carbon numbers predominently in the range of C7 to C 13 and boiling in the range of approximately 98 oC to 218 oC (208oF to 424oF).] | 285-508-2 | 85116-57-0 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-427-00-X | Kerosine (petroleum), sweetened;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of 130 oC to 290 oC (266oF to 554oF).] | 294-799-5 | 91770-15-9 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-428-00-5 | Kerosine (petroleum), solvent-refined sweetened;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by solvent refining and sweetening and boiling in the range of approximately 150 oC to 260 oC (302oF to 500oF).] | 295-416-4 | 92045-36-8 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-429-00-0 | Hydrocarbons, C9-16, hydrotreated, dearomatized;Kerosine — unspecified;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-854-1 | 93763-35-0 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-430-00-6 | Kerosine (petroleum), solvent-refined hydrodesulfurized;Kerosine — unspecified | 307-033-2 | 97488-94-3 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-431-00-1 | Distillates (petroleum), hydrodesulfurized full-range middle coker;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C16 and boiling in the range of approximately 120 oC to 283 oC (248oF to 541oF).] | 309-864-6 | 101316-58-9 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-432-00-7 | Solvent naphtha (petroleum), hydrodesulfurized heavy arom.;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 180 oC to 240 oC (356oF to 464oF).] | 309-882-4 | 101316-81-8 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-433-00-2 | Solvent naphtha (petroleum), hydrodesulfurized medium;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 175 oC to 220 oC (347oF to 428oF).] | 309-884-5 | 101316-82-9 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-434-00-8 | Kerosine (petroleum), hydrotreated;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from the distillation of petroleum and subsequent hydrotreatment. It consists predominantly of alkanes, cycloalkanes and alkylbenzenes having carbon numbers predominantly in the range of C12 through C16 and boiling in the range of approximately 230 oC to 270 oC (446oF to 518oF).] | 309-944-0 | 101631-19-0 | Asp. Tox. 1 | H304 | GHS08Dgr | H304 | H |
| 649-435-00-3 | Distillates (petroleum), light catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | 265-060-4 | 64741-59-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-436-00-9 | Distillates (petroleum), intermediate catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 oC to 450 oC (401oF to 842oF). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | 265-062-5 | 64741-60-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-437-00-4 | Distillates (petroleum), light hydrocracked;Cracked gasoil;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C10 through C18 and boiling in the range of approximately 160 oC to 320 oC (320oF to 608oF).] | 265-078-2 | 64741-77-1 | Carc. 2 | H351 | GHS08Wng | H351 | H |
| 649-438-00-X | Distillates (petroleum), light thermal cracked;Cracked gasoil;[A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C10 through C22 and boiling in the range of approximately 160 oC to 370 oC (320oF to 698oF).] | 265-084-5 | 64741-82-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-439-00-5 | Distillates (petroleum), hydrodesulfurized light catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons obtained by treating light catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | 269-781-5 | 68333-25-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-440-00-0 | Distillates (petroleum), light steam-cracked naphtha;Cracked gasoil;[A complex combination of hydrocarbons from the multiple distillation of products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C10 through C18.] | 270-662-5 | 68475-80-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-441-00-6 | Distillates (petroleum), cracked steam-cracked petroleum distillates;Cracked gasoil;[A complex combination of hydrocarbons produced by distilling cracked steam cracked distillate and/or its fractionation products. It consists of hydrocarbons having carbon numbers predominently in the range of C10 to low molecular weight polymers.] | 270-727-8 | 68477-38-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-442-00-1 | Gas oils (petroleum), steam-cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by distillation of the products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C9 and boiling in the range of from approximately 205 oC to 400 oC (400oF to 752oF).] | 271-260-2 | 68527-18-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-443-00-7 | Distillates (petroleum), hydrodesulfurized thermal cracked middle;Cracked gasoil;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized themal cracker distillate stocks. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 to C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 285-505-6 | 85116-53-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-444-00-2 | Gas oils (petroleum), thermal-cracked, hydrodesulfurized;Cracked gasoil | 295-411-7 | 92045-29-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-445-00-8 | Residues (petroleum), hydrogenated steam-cracked naphtha;Cracked gasoil;[A complex combination of hydrocarbons obtained as a residual fraction from the distillation of hydrotreated steam-cracked naphtha. It consists predominantly of hydrocarbons boiling in the range of approximately 200 oC to 350 oC (32oF to 662oF).] | 295-514-7 | 92062-00-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-446-00-3 | Residues (petroleum), steam-cracked naphtha distn.;Cracked gasoil;[A complex combination of hydrocarbons obtained as a column bottom from the separation of effluents from steam cracking naphtha at a high temperature. It boils in the range of approximately 147 oC to 300 oC (297oF to 572oF) and produces a finished oil having a viscosity of 18cSt at 50 oC.] | 295-517-3 | 92062-04-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-447-00-9 | Distillates (petroleum), light catalytic cracked, thermally degraded;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 190 oC to 340 oC (374oF to 644oF). This stream is likely to contain organic sulfur compounds.] | 295-991-1 | 92201-60-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-448-00-4 | Residues (petroleum), steam-cracked heat-soaked naphtha;Cracked gasoil;[A complex combination of hydrocarbons obtained as residue from the distillation of steam cracked heat soaked naphtha and boiling in the range of approximately 150 oC to 350 oC (302oF to 662oF).] | 297-905-8 | 93763-85-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-449-00-X | Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distn. residue;Cracked gasoil;[A complex combination of hydrocarbons obtained by solvent dewaxing of a distillation residue from a hydrocracked paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 360 oC to 500 oC (680 oF to 932 oF). It produces a finished oil having a viscosity of 4,5 cSt at approximately 100 oC (212 oF).] | 307-662-2 | 97675-88-2 | Carc. 2 | H351 | GHS08Wng | H351 | H |
| 649-450-00-5 | Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized;Cracked gasoil;[A complex combination of hydrocarbons obtained by catalytic dehydrosulfurization of thermal-cracked light vacuum petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C20 and boiling in the range of approximately 270 oC to 370 oC (518oF to 698oF).] | 308-278-8 | 97926-59-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-451-00-0 | Distillates (petroleum), hydrodesulfurized middle coker;Cracked gasoil;[A complex combination of hydrocarbons by fractionation from hydrodesulfurised coker distillate stocks. Is consists of hydro-carbons having carbon numbers predominantly in the range of C12 through C21 and boiling in the range of approximately 200 oC to 360 oC (392oF to 680oF).] | 309-865-1 | 101316-59-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-452-00-6 | Distillates (petroleum), heavy steam-cracked;Cracked gasoil;[A complex combination of hydrocarbons obtained by distillation of steam cracking heavy residues. It consists predominantly of highly alkylated heavy aromatic hydrocarbons boiling in the range of approximately 250 oC to 400 oC (482oF to 752oF).] | 309-939-3 | 101631-14-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H |
| 649-453-00-1 | Distillates (petroleum), heavy hydrocracked;Baseoil — unspecified;[A complex combination of hydrocarbons from the distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers in the range of C15-C39 and boiling in the range of approximately 260 oC to 600 oC (500oF to 1112oF).] | 265-077-7 | 64741-76-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-454-00-7 | Distillates (petroleum), solvent-refined heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC).] | 265-090-8 | 64741-88-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-455-00-2 | Distillates (petroleum), solvent-refined light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-091-3 | 64741-89-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-456-00-8 | Residual oils (petroleum), solvent deasphalted;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the solvent soluble fraction from C3-C4 solvent deasphalting of a residuum. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-096-0 | 64741-95-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-457-00-3 | Distillates (petroleum), solvent-refined heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt a 40 oC). It contains relatively few normal paraffins.] | 265-097-6 | 64741-96-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-458-00-9 | Distillates (petroleum), solvent-refined light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-098-1 | 64741-97-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-459-00-4 | Residual oils (petroleum,) solvent-refined;Baseoil — unspecified;[A complex combination by hydrocarbons obtained as the solvent insoluble fraction from solvent refining of a residuum using a polar organic solvent such as phenol or furfural. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-101-6 | 64742-01-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-460-00-X | Distillates (petroleum), clay-treated paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-137-2 | 64742-36-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-461-00-5 | Distillates (petroleum), clay-treated light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-138-8 | 64742-37-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-462-00-0 | Residual oils (petroleum), clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treatment of a residual oil with a natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydro-carbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-143-5 | 64742-41-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-463-00-6 | Distillates (petroleum), clay-treated heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-146-1 | 64742-44-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-464-00-1 | Distillates (petroleum), clay-treated light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-147-7 | 64742-45-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-465-00-7 | Distillates (petroleum), hydrotreated heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-155-0 | 64742-52-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-466-00-2 | Distillates (petroleum), hydrotreated light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-156-6 | 64742-53-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-467-00-8 | Distillates (petroleum), hydrotreated heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-157-1 | 64742-54-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-468-00-3 | Distillates (petroleum), hydrotreated light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-158-7 | 64742-55-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-469-00-9 | Distillates (petroleum), solvent-dewaxed light paraffinic;Baseoil — unspecified;[A complex comination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-159-2 | 64742-56-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-470-00-4 | Residual oils (petroleum), hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 oC (752oF).] | 265-160-8 | 64742-57-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-471-00-X | Residual oils (petroleum), solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of long, branched chain hydrocarbons from a residual oil by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 oC (752oF).] | 265-166-0 | 64742-62-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-472-00-5 | Distillates (petroleum), solvent-dewaxed heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 . through C50 and produces a finished oil of not less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-167-6 | 64742-63-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-473-00-0 | Distillates (petroleum), solvent-dewaxed light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-168-1 | 64742-64-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-474-00-6 | Distillates (petroleum), solvent-dewaxed heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity not less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-169-7 | 64742-65-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-475-00-1 | Naphthenic oils (petroleum), catalytic dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-172-3 | 64742-68-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-476-00-7 | Naphthenic oils (petroleum), catalytic dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-173-9 | 64742-69-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-477-00-2 | Paraffin oils (petroleum), catalytic dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC).] | 265-174-4 | 64742-70-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-478-00-8 | Paraffin oils (petroleum), catalytic dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-176-5 | 64742-71-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-479-00-3 | Naphthenic oils (petroleum), complex dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removing straight chain paraffin hydrocarbons as a solid by treatment with an agent such as urea. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-179-1 | 64742-75-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-480-00-9 | Naphthenic oils (petroleum), complex dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-180-7 | 64742-76-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-481-00-4 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil, and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of approximately 112cSt at 40 oC. It contains a relatively large proportion of saturated hydrocarbons.] | 276-736-3 | 72623-85-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-482-00-X | Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil and heavy vacuum gas oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of approximately 15cSt at 40 oC. It contains a relatively large proportion of saturated hydrocabons.] | 276-737-9 | 72623-86-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-483-00-5 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of approximately 32cSt at 40 oC. It contains a relatively large proportion of saturated hydrocarbons.] | 276-738-4 | 72623-87-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-484-00-0 | Lubricating oils;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from solvent extraction and dewaxing processes. It consists predominantly of saturated hydrocarbons having carbon numbers in the range C15 through C50.] | 278-012-2 | 74869-22-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-485-00-6 | Distillates (petroleum), complex dewaxed heavy paraffinci;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by dewaxing heavy paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of equal to or greater than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 292-613-7 | 90640-91-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-486-00-1 | Distillates (petroleum), complex dewaxed light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by dewaxing light paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 292-614-2 | 90640-92-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-487-00-7 | Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating dewaxed heavy paraffinic distillate with neutral or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 292-616-3 | 90640-94-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-488-00-2 | Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons produced by treating dewaxed heavy paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 292-617-9 | 90640-95-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-489-00-8 | Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of dewaxed light paraffinic distillate with natural or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | 292-618-4 | 90640-96-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-490-00-3 | Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons produced by treating a dewaxed light paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | 292-620-5 | 90640-97-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-491-00-9 | Residual oils (petroleum), hydrotreated solvent dewaxed;Baseoil — unspecified | 292-656-1 | 90669-74-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-492-00-4 | Residual oils (petroleum), catalytic dewaxed;Baseoil — unspecified | 294-843-3 | 91770-57-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-493-00-X | Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C25 through C39 and produces a finished oil with a viscosity of approximately 44 cSt at 50 oC.] | 295-300-3 | 91995-39-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-494-00-5 | Distillates (petroleum), dewaxed light paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C21 through C29 and produces a finished oil with a viscosity of approximately 13 cSt at 50 oC.] | 295-301-9 | 91995-40-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-495-00-0 | Distillates (petroleum), hydrocracked solvent-refined, dewaxed;Baseoil — unspecified;[A complex combination of liquid hydrocarbons obtained by recrystallization of dewaxed hydrocracked solvent-refined petroleum distillates.] | 295-306-6 | 91995-45-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-496-00-6 | Distillates (petroleum), solvent-refined light naphthenic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst and removing the aromatic hydrocarbons by solvent extraction. It consists predominantly of naphthenic hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of between 13-15cSt at 40 oC.] | 295-316-0 | 91995-54-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-497-00-1 | Lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated;Baseoil — unspecified | 295-423-2 | 92045-42-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-498-00-7 | Lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined;Baseoil — unspecified | 295-424-8 | 92045-43-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-499-00-2 | Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons produced by solvent removal of paraffins from the residue of the distillation of acid-treated, hydrocracked heavy paraffins and boiling approximately above 380 oC (716oF).] | 295-499-7 | 92061-86-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-500-00-6 | Paraffin oils (petroleum), solvent-refined dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from sulfur-containing paraffinic crude oil. It consists predominantly of a solvent refined deparaffinated lubricating oil with a viscosity of 65cSt at 50 oC.] | 295-810-6 | 92129-09-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-501-00-1 | Lubricating oils (petroleum), base oils, paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by refining of crude oil. It consists predominantly of aromatics, naphthenics and paraffinics and produces a finished oil with a viscosity of 120 SUS at 100oF (23cSt at 40 oC).] | 297-474-6 | 93572-43-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-502-00-7 | Hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed;Baseoil — unspecified | 297-857-8 | 93763-38-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-503-00-2 | Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate;Baseoil — unspecified | 300-257-1 | 93924-61-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-504-00-8 | Distillates (petroleum), solvent-refined hydrotreated heavy;hydrogenated;Baseoil — unspecified | 305-588-5 | 94733-08-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-505-00-3 | Distillates (petroleum), solvent-refined hydrocracked light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent dearomatization of the residue of hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 oC to 450 oC (698oF to 842oF).] | 305-589-0 | 94733-09-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-506-00-9 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent deparaffination of the distillation residue from hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 oC to 550 oC (698oF to 1022oF).] | 305-594-8 | 94733-15-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-507-00-4 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent deparaffination of the hydrogenated raffinate obtained by solvent extraction of a hydrotreated petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 oC to 550 oC (698oF to 1022oF).] | 305-595-3 | 94733-16-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-508-00-X | Hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate;Baseoil — unspecified | 305-971-7 | 95371-04-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-509-00-5 | Hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate;Baseoil — unspecified | 305-972-2 | 95371-05-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-510-00-0 | Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues;Baseoil — unspecified | 305-974-3 | 95371-07-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-511-00-6 | Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues;Baseoil — unspecified | 305-975-9 | 95371-08-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-512-00-1 | Distillates (petroleum), hydrocracked solvent-refined light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by the solvent treatment of a distillate from hydrocracked petroleum distillates. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 oC to 450 oC (698oF to 842oF.] | 307-010-7 | 97488-73-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-513-00-7 | Distillates (petroleum), solvent-refined hydrogenated heavy;Baseoil — unspecified;[A complex combination of hydrocarbons, obtained by the treatment of a hydrogenated petroleum distillate with a solvent. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C19 through C40 and boiling in the range of approximately 390 oC to 550 oC (734oF to 1022oF).] | 307-011-2 | 97488-74-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-514-00-2 | Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed;Baseoil — unspecified | 307-034-8 | 97488-95-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-515-00-8 | Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a solvent deasphalted short residue with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C30 and boiling in the range of approximately 300 oC to 400 oC (572oF to 752oF). It produces a finished oil having a viscosity of 4cSt at approximately 100 oC (212oF).] | 307-661-7 | 97675-87-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-516-00-3 | Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the catalytic hydrotreatment of a solvent deasphalted short residue having a viscosity of 8cSt at approximately 100 oC (212oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C40 and boiling in the range of approximately 300 oC to 500 oC (592oF to 932oF).] | 307-755-8 | 97722-06-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-517-00-9 | Hydrocarbons, C13-27, solvent-extd. light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 9.5cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C27 and boiling in the range of approximately 240 oC to 400 oC (464oF to 752oF.] | 307-758-4 | 97722-09-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-518-00-4 | Hydrocarbons, C14-29, solvent-extd. light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 16cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C29 and boiling in the range of approximately 250 oC to 425 oC (482oF to 797oF).] | 307-760-5 | 97722-10-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-519-00-X | Hydrocarbons, C27-42, dearomatized;Baseoil — unspecified | 308-131-8 | 97862-81-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-520-00-5 | Hydrocarbons, C17-30, hydrotreated distillates, distn. lights;Baseoil — unspecified | 308-132-3 | 97862-82-3 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-521-00-0 | Hydrocarbons, C27-45, naphthenic vacuum distn.;Baseoil — unspecified | 308-133-9 | 97862-83-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-522-00-6 | Hydrocarbons, C27-45, dearomatized;Baseoil — unspecified | 308-287-7 | 97926-68-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-523-00-1 | Hydrocarbons, C20-58, hydrotreated;Baseoil — unspecified | 308-289-8 | 97926-70-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-524-00-7 | Hydrocarbons, C27-42, naphthenic;Baseoil — unspecified | 308-290-3 | 97926-71-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-525-00-2 | Residual oils (petroleum), carbon-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of solvent-dewaxed petroleum residual oils with activated charcoal for the removal of trace polar constituents and impurities.] | 309-710-8 | 100684-37-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-526-00-8 | Residual oils (petroleum), clay-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treatment of solvent-dewaxed petroleum residual oils with bleaching earth for the removal of trace polar constituents and impurities.] | 309-711-3 | 100684-38-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-527-00-3 | Lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of vacuum distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C25 and produces a finished oil with a viscosity in the order of 32cSt to 37cSt at 100 oC (212oF).] | 309-874-0 | 101316-69-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-528-00-9 | Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C32 and produced a finished oil with a viscosity in the order of 17cSt to 23cSt at 40 oC (104oF.] | 309-875-6 | 101316-70-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-529-00-4 | Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C35 and produces a finished oil with a viscosity in the order of 37cSt to 44cSt at 40 oC (104oF).] | 309-876-1 | 101316-71-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-530-00-X | Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C24 through C50 and produces a finished oil with a viscosity in the order of 16cSt to 75cSt at 40 oC (104oF).] | 309-877-7 | 101316-72-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-531-00-5 | Extracts (petroleum), heavy naphthenic distillate solvent, arom. conc.;Distillate aromatic extract (treated);[An aromatic concentrate produced by adding water to heavy naphthenic distillate solvent extract and extraction solvent.] | 272-175-3 | 68783-00-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-532-00-0 | Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from the re-extraction of solvent-refined heavy paraffinic distillate. It consists of saturated and aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 272-180-0 | 68783-04-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-533-00-6 | Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from a solvent extraction of heavy paraffinic distillate.] | 272-342-0 | 68814-89-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-534-00-1 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by treating a heavy naphthenic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 19cSt at 40 oC (100 SUS at 100oF).] | 292-631-5 | 90641-07-9 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-535-00-7 | Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons produced by treating a heavy paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C21 through C33 and boiling in the range of approximately 350 oC to 480 oC (662oF to 896oF). | 292-632-0 | 90641-08-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-536-00-2 | Extracts (petroleum), light paraffinic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons produced by treating a light paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C26 and boiling in the range of approximately 280 oC to 400 oC (536oF to 752oF).] | 292-633-6 | 90641-09-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-537-00-8 | Extracts (petroleum), hydrotreated light paraffinic distillate solvent;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from solvent extraction of intermediate paraffinic top solvent distillate that is treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 295-335-4 | 91995-73-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-538-00-3 | Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by treating the extract, obtained from a solvent extraction process, with hydrogen in the presence of a catalyst under conditions primarily to remove sulfur compounds. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C15 through C30. This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 295-338-0 | 91995-75-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-539-00-9 | Extracts (petroleum), light paraffinic distillate solvent, acid-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction of the distillation of an extract from the solvent extraction of light paraffinic top petroleum distillates that is subjected to a sulfuric acid refining. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 295-339-6 | 91995-76-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-540-00-4 | Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of a light paraffin distillate and treated with hydrogen to convert the organic sulfur to hydrogen sulfide which is eliminated. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C40 and produces a finished oil with a viscosity of greater than 10cSt at 40 oC.] | 295-340-1 | 91995-77-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-541-00-X | Extracts (petroleum), light vacuum gas oil solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons, obtained by solvent extraction from light vacuum petroleum gas oils and treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 295-342-2 | 91995-79-8 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-542-00-5 | Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contact or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50. This stream is likely to contain 5 wt.% or more 4-6 membered ring aromatic hydrocarbons.] | 296-437-1 | 92704-08-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-543-00-0 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 oC.] | 297-827-4 | 93763-10-1 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-544-00-6 | Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained from a solvent dewaxed petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 oC.] | 297-829-5 | 93763-11-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-545-00-1 | Extracts (petroleum), light paraffinic distillate solvent, carbon-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillate treated with activated charcoal to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 309-672-2 | 100684-02-4 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-546-00-7 | Extracts (petroleum), light paraffinic distillate solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillates treated with bleaching earth to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 309-673-8 | 100684-03-5 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-547-00-2 | Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oil treated with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 309-674-3 | 100684-04-6 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-548-00-8 | Extracts (petroleum), light vacuum gas oil solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oils treated with bleaching earth for removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 309-675-9 | 100684-05-7 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-549-00-3 | Foots oil (petroleum);Foots oil;[A complex combination of hydrocarbons obtained as the oil fraction from a solvent deoiling or a wax sweating process. It consists predominantly of branched chain hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 265-171-8 | 64742-67-2 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 649-550-00-9 | Foots oil (petroleum), hydrotreated;Foots oil | 295-394-6 | 92045-12-0 | Carc. 1B | H350 | GHS08Dgr | H350 | H L |
| 650-002-00-6 | turpentine, oil | 232-350-7 | 8006-64-2 | Flam. Liq. 3Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Asp. Tox. 1Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 2 | H226H332H312H302H304H319H315H317H411 | GHS02GHS08GHS07GHS09Dgr | H226H332H312H302H304H319H315H317H411 |
| 650-003-00-1 | fenson (ISO);4-chlorophenyl benzenesulphonate; | 201-274-6 | 80-38-6 | Acute Tox. 4 *Eye Irrit. 2Aquatic Chronic 2 | H302H319H411 | GHS07GHS09Wng | H302H319H411 |
| 650-004-00-7 | norbormide (ISO);5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)bicyclo [2.2.1] hept-5-ene-2,3-dicarboximide | 213-589-6 | 991-42-4 | Acute Tox. 4 * | H302 | GHS07Wng | H302 |
| 650-005-00-2 | (2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one, rotenone | 201-501-9 | 83-79-4 | Acute Tox. 3 *Eye Irrit. 2STOT SE 3Skin Irrit. 2Aquatic Acute 1Aquatic Chronic 1 | H301H319H335H315H400H410 | GHS06GHS09Dgr | H301H319H335H315H410 |
| 650-006-00-8 | benquinox (ISO);p-benzoquinone 1-benzoylhydrazone 4-oxime | 207-807-9 | 495-73-8 | Acute Tox. 3 *Acute Tox. 4 * | H301H312 | GHS06Dgr | H301H312 |
| 650-007-00-3 | chlordimeform (ISO);N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine | 228-200-5 | 6164-98-3 | Carc. 2Acute Tox. 4 *Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H312H302H400H410 | GHS08GHS07GHS09Wng | H351H312H302H410 |
| 650-008-00-9 | drazoxolon (ISO);4-(2-chlorophenylhydrazone)-3-methyl-5-isoxazolone | 227-197-8 | 5707-69-7 | Acute Tox. 3 *Aquatic Acute 1Aquatic Chronic 1 | H301H400H410 | GHS06GHS09Dgr | H301H410 |
| 650-009-00-4 | chlordimeform hydrochloride;N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride;N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine hydorchloride | 243-269-1 | 19750-95-9 | Carc. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H351H302H400H410 | GHS08GHS07GHS09Wng | H351H302H410 |
| 650-010-00-X | benzyl violet 4B;α-[4-(4-dimethylamino-α-{4-[ethyl(3-sodiosulphonatobenzyl)amino] phenyl}benzylidene)cyclohexa-2,5-dienylidene(ethyl)ammonio]toluene-3-sulphonate | 216-901-9 | 1694-09-3 | Carc. 2 | H351 | GHS08Wng | H351 |
| 650-012-00-0 | erionite | — | 12510-42-8 | Carc. 1A | H350 | GHS08Dgr | H350 |
| 650-013-00-6 | asbestos | ——————— | 12001-28-4132207-32-012172-73-577536-66-477536-68-677536-67-512001-29-5 | Carc. 1ASTOT RE 1 | H350H372 ** | GHS08Dgr | H350H372 ** |
| 650-014-00-1 | diethyl 2,4-dihydroxycyclodisiloxane-2,4-diylbis(trimethylene)diphosphonate, tetrasodium salt, reaction products with disodium metasilicate | 401-770-4 | — | Skin Corr. 1BAcute Tox. 4 * | H314H302 | GHS05GHS07Dgr | H314H302 |
| 650-015-00-7 | rosin;colophony | 232-475-7232-484-6277-299-1 | 8050-09-78052-10-673138-82-6 | Skin Sens. 1 | H317 | GHS07Wng | H317 |
| 650-016-00-2 | Mineral wool, with the exception of those specified elsewhere in this Annex;[Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight] | — | — | Carc. 2Skin Irrit. 2 | H351H315 | GHS08GHS07Wng | H351H315 | AQR |
| 650-017-00-8 | Refractory Ceramic Fibres;Special Purpose Fibres, with the exception of those specified elsewhere in this Annex;[Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+ MgO+BaO) content less or equal to 18 % by weight] | — | — | Carc. 1BSkin Irrit. 2 | H350iH315 | GHS08GHS07Dgr | H350iH315 | A R |
| 650-018-00-3 | Reaction product of: acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid | 406-230-1 | — | Flam. Liq. 3Carc. 2Skin Corr. 1BAcute Tox. 4 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H226H351H314H332H317H400H410 | GHS02GHS08GHS05 GHS07GHS09Dgr | H226H351H314H332H317H410 |
| 650-031-00-4 | bis(4-hydroxy-N-methylanilinium) sulphate | 200-237-1 | 55-55-0 | Acute Tox. 4 *STOT RE 2 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H302H373 **H317H400H410 | GHS08GHS07GHS09Wng | H302H373 **H317H410 |
| 650-032-00-X | cyproconazole (ISO);(2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | — | 94361-06-5 | Repr. 2Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H361d ***H302H400H410 | GHS08GHS07 GHS09Wng | H361d ***H302H410 |
| 650-033-00-5 | (S)-α-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate;esfenvalerate | — | 66230-04-4 | Acute Tox. 3 *Acute Tox. 3 *Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H331H301H317H400H410 | GHS06GHS09Dgr | H331H301H317H410 |
| 650-041-00-9 | triasulfuron (ISO) ;1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | — | 82097-50-5 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| 650-042-00-4 | reaction product of: polyethylene-polyamine-(C16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates | 417-450-2 | — | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1Aquatic Chronic 3 | H319H315H317H412 | GHS07Wng | H319H315H317H412 |
| 650-043-00-X | reaction product of: 3,5-bis-tert-butylsalicylic acid and aluminiumsulfate | 420-310-3 | — | Acute Tox. 4 *Aquatic Acute 1Aquatic Chronic 1 | H302H400H410 | GHS07GHS09Wng | H302H410 |
| 650-044-00-5 | mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin | 420-480-9 | 158570-99-1 | Skin Irrit. 2Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H317H400H410 | GHS07GHS09Wng | H315H317H410 |
| 650-045-00-0 | reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate | 417-110-3 | — | Flam. Liq. 2Skin Irrit. 2Eye Dam. 1Aquatic Chronic 2 | H225H315H318H411 | GHS02GHS05GHS09Dgr | H225H315H318H411 |
| 650-046-00-6 | di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates | 416-180-2 | 12222-04-7 | Acute Tox. 4 *STOT RE 2 *Aquatic Chronic 2 | H302H373 **H411 | GHS08GHS07GHS09Wng | H302H373 **H411 |
| 650-047-00-1 | dibenzylphenylsulfonium hexafluoroantimonate | 417-760-8 | 134164-24-2 | STOT RE 1Acute Tox. 4 *Eye Dam. 1Skin Sens. 1Aquatic Chronic 2 | H372 **H302H318H317H411 | GHS08GHS05 GHS07GHS09Dgr | H372 **H302H318H317H411 |
| 650-048-00-7 | reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid | 420-070-1 | — | Org. Perox. D ****Acute Tox. 4 *Acute Tox. 4 *Acute Tox. 4 *Skin Corr. 1AAquatic Acute 1 | H242H332H312H302H314H400 | GHS02GHS05 GHS07GHS09Dgr | H242H332H312H302H314H400 |
| 650-049-00-2 | 2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85 % unsaturated octadecoyl, 0.5 to 10 % saturated octadecoyl, and 2 to 18 % saturated hexadecoyl | 417-960-5 | — | Skin Irrit. 2Eye Dam. 1Skin Sens. 1Aquatic Acute 1Aquatic Chronic 1 | H315H318H317H400H410 | GHS05 GHS07GHS09Dgr | H315H318H317H410 |
| 650-050-00-8 | reaction mass of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate;1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers;1,3-butanediol bis[3-(3',5'-(1,1-dimethylethyl)-4'-hydroxyphenyl)propionate] isomers | 423-600-8 | — | Aquatic Chronic 2 | H411 | GHS09 | H411 |
| 650-055-00-5 | silver sodium zirconium hydrogenphosphate | 422-570-3 | 155925-27-2 | Aquatic Acute 1Aquatic Chronic 1 | H400H410 | GHS09Wng | H410 |
| T+R: 49-25-26-36/37/38-43-48/23S: 53-45 |
| E |
| 004-002-00-2 | beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex | — | — | Carc. Cat. 2; R49T+; R26T; R25-48/23Xi; R36/37/38R43N; R51-53 | T+; NR: 49-25-26-36/37/38-43-48/23-51/53S: 53-45-61 | AE |
| 004-003-00-8 | beryllium oxide | 215-133-1 | 1304-56-9 | Carc. Cat. 2; R49T+; R26T; R25-48/23Xi; R36/37/38R43 | T+R: 49-25-26-36/37/38-43-48/23S: 53-45 | E |
| 005-001-00-X | boron trifluoride | 231-569-5 | 7637-07-2 | R14T+; R26C; R35 | T+; CR: 14-26-35S: (1/2-)9-26-28-36/37/39-45 |
| 005-002-00-5 | boron trichloride | 233-658-4 | 10294-34-5 | R14T+; R26/28C; R34 | T+R: 14-26/28-34S: (1/2-)9-26-28-36/37/39-45 |
| 005-003-00-0 | boron tribromide | 233-657-9 | 10294-33-4 | R14T+; R26/28C; R35 | T+; CR: 14-26/28-35S: (1/2-)9-26-28-36/37/39-45 |
| 005-004-00-6 | trialkylboranes | — | — | F; R17C; R34 | F; CR: 17-34S: (1/2-)7-23-26-36/37/39-43-45 | A |
| 005-005-00-1 | trimethyl borate | 204-468-9 | 121-43-7 | R10Xn; R21 | XnR: 10-21S: (2-)23-25 |
| 005-006-00-7 | dibutyltin hydrogen borate | 401-040-5 | 75113-37-0 | T; R48/25Xn; R21/22Xi; R41R43N; R50-53 | T; NR: 21/22-41-43-48/25-50/53S: (1/2-)22-26-36/37-45-60-61 |
| 005-009-00-3 | tetrabutylammonium butyltriphenylborate | 418-080-4 | 120307-06-4 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-56-61 |
| 005-010-00-9 | N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate | 422-050-6 | 118612-00-3 | Carc. Cat. 3; R40Xn; R22Xi; R38-41 | XnR: 22-38-40-41S: (2-)22-26-36/37/39 |
| 005-012-00-X | diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}ammonium butyltriphenylborate | 418-070-1 | 141714-54-7 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 006-001-00-2 | carbon monoxide | 211-128-3 | 630-08-0 | F+; R12Repr. Cat. 1; R61T; R23-48/23 | F+; TR: 61-12-23-48/23S: 53-45 | E |
| 006-002-00-8 | phosgene;carbonyl chloride | 200-870-3 | 75-44-5 | T+; R26C; R34 | T+R: 26-34S: (1/2-)9-26-36/37/39-45 |
| 006-003-00-3 | carbon disulphide | 200-843-6 | 75-15-0 | F; R11Repr. Cat. 3; R62-63T; R48/23Xi; R36/38 | F; TR: 11-36/38-48/23-62-63S: (1/2-)16-33-36/37-45 | Repr. Cat. 3; R62-63: C ≥ 1 %T; R48/23: C ≥ 1 %Xn; R48/20: 0,2 % ≤C < 1 % |
| 006-004-00-9 | calcium carbide | 200-848-3 | 75-20-7 | F; R15 | FR: 15S: (2-)8-43 |
| 006-005-00-4 | thiram (ISO);tetramethylthiuram disulphide | 205-286-2 | 137-26-8 | Xn; R20/22-48/22Xi; R36/38R43N; R50-53 | Xn; NR: 20/22-36/38-43-48/22-50/53S: (2-)26-36/37-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 006-006-00-X | hydrogen cyanide;hydrocyanic acid | 200-821-6 | 74-90-8 | F+; R12T+; R26N; R50-53 | F+; T+; NR: 12-26-50/53S: (1/2-)7/9-16-36/37-38-45-60-61 |
| 006-006-01-7 | hydrogen cyanide ...%;hydrocyanic acid ...% | 200-821-6 | 74-90-8 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)7/9-36/37-38-45-60-61 | B |
| 006-007-00-5 | salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide | — | — | T+; R26/27/28R32N; R50-53 | T+; NR: 26/27/28-32-50/53S: (1/2-)7-28-29-45-60-61 | A |
| 006-008-00-0 | antu (ISO);1-(1-naphthyl)-2-thiourea | 201-706-3 | 86-88-4 | T+; R28Carc. Cat. 3; R40 | T+R: 28-40S: (1/2-)25-36/37-45 |
| 006-009-00-6 | 1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate;isolan | 204-318-2 | 119-38-0 | T+; R27/28 | T+R: 27/28S: (1/2-)28-36/37/39-45 |
| 006-010-00-1 | 5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate;dimetan | 204-525-8 | 122-15-6 | T; R25 | TR: 25S: (1/2-)36/37-45 |
| 006-011-00-7 | carbaryl (ISO);1-naphthyl methylcarbamate | 200-555-0 | 63-25-2 | Carc. Cat. 3; R40Xn; R22N; R50 | Xn; NR: 22-40-50S: (2-)22-24-36/37-46-61 |
| 006-012-00-2 | ziram (ISO);zinc bis dimethyldithiocarbamate | 205-288-3 | 137-30-4 | T+; R26Xn; R22-48/22Xi; R37-41R43N; R50-53 | T+; NR: 22-26-37-41-43-48/22-50/53S: (1/2-)22-26-28-36/37/39-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 006-013-00-8 | metam-sodium (ISO);sodium methyldithiocarbamate | 205-293-0 | 137-42-8 | Xn; R22R31C; R34R43N; R50-53 | C; NR: 22-31-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 006-014-00-3 | nabam (ISO);disodium ethylenebis(N, N'-dithiocarbamate) | 205-547-0 | 142-59-6 | Xn; R22Xi; R37R43N; R50-53 | Xn; NR: 22-37-43-50/53S: (2-)8-24/25-46-60-61 |
| 006-015-00-9 | diuron (ISO);3-(3,4-dichlorophenyl)-1,1-dimethylurea | 206-354-4 | 330-54-1 | Carc. Cat. 3; R40Xn; R22-48/22N; R50-53 | Xn; NR: 22-40-48/22-50/53S: (2-)13-22-23-37-46-60-61 |
| 006-016-00-4 | propoxur (ISO);2-isopropyloxyphenyl N-methylcarbamate;2-isopropoxyphenyl methylcarbamate | 204-043-8 | 114-26-1 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)37-45-60-61 |
| 006-017-00-X | aldicarb (ISO);2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime | 204-123-2 | 116-06-3 | T+; R26/28T; R24N; R50-53 | T+; NR: 24-26/28-50/53S: (1/2-)22-36/37-45-60-61 |
| 006-018-00-5 | aminocarb (ISO);4-dimethylamino-3-tolyl methylcarbamate | 217-990-7 | 2032-59-9 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 |
| 006-019-00-0 | di-allate (ISO);S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate | 218-961-1 | 2303-16-4 | Carc. Cat. 3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)25-36/37-60-61 |
| 006-020-00-6 | barban (ISO);4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate | 202-930-4 | 101-27-9 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-36/37-60-61 |
| 006-021-00-1 | linuron (ISO);3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | 206-356-5 | 330-55-2 | Repr. Cat. 2; R61Repr. Cat. 3; R62Carc. Cat. 3; R40Xn; R22-48/22N; R50-53 | T; NR: 61-22-40-48/22-62-50/53S: 53-45-60-61 | E |
| 006-022-00-7 | decarbofuran (ISO);2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate | — | 1563-67-3 | T; R23/24/25 | TR: 23/24/25S: (1/2-)13-36/37-45 |
| 006-023-00-2 | mercaptodimethur (ISO);methiocarb (ISO);3,5-dimethyl-4-methylthiophenyl N-methylcarbamate | 217-991-2 | 2032-65-7 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)22-37-45-60-61 |
| 006-024-00-8 | proxan-sodium (ISO);sodium O-isopropyldithiocarbonate | 205-443-5 | 140-93-2 | Xn; R22Xi; R38N; R51-53 | Xn; NR: 22-38-51/53S: (2-)13-61 |
| 006-025-00-3 | allethrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate;bioallethrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [1]S-bioallethrin;(S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [2]esbiothrin;(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] | 209-542-4 [1]249-013-5 [2]- [3] | 584-79-2 [1]28434-00-6 [2]84030-86-4 [3] | Xn; R20/22N; R50-53 | Xn; NR: 20/22-50/53S: (2-)36-60-61 | C |
| 006-026-00-9 | carbofuran (ISO);2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate | 216-353-0 | 1563-66-2 | T+; R26/28N; R50-53 | T+; NR: 26/28-50/53S: (1/2-)36/37-45-60-61 |
| 006-028-00-X | dinobuton (ISO);2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate | 213-546-1 | 973-21-7 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)37-45-60-61 |
| 006-029-00-5 | dioxacarb (ISO);2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate | 230-253-4 | 6988-21-2 | T; R25N; R51-53 | T; NR: 25-51/53S: (1/2-)37-45-61 |
| 006-030-00-0 | EPTC (ISO);S-ethyl dipropylthiocarbamate | 212-073-8 | 759-94-4 | Xn; R22 | XnR: 22S: (2-)23 |
| 006-031-00-6 | formetanate (ISO);3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate | 244-879-0 | 22259-30-9 | T+; R26/28R43N; R50-53 | T+; NR: 26/28-43-50/53S: (1/2-)24-28-37/39-45-60-61 |
| 006-032-00-1 | monolinuron (ISO);3-(4-chlorophenyl)-1-methoxy-1-methylurea | 217-129-5 | 1746-81-2 | Xn; R22-48/22N; R50-53 | Xn; NR: 22-48/22-50/53S: (2-)22-60-61 |
| 006-033-00-7 | metoxuron (ISO);3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea | 243-433-2 | 19937-59-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 006-034-00-2 | pebulate (ISO);N-butyl-N-ethyl-S-propylthiocarbamate | 214-215-4 | 1114-71-2 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)23-61 |
| 006-035-00-8 | pirimicarb (ISO);5,6-dimethyl-2-dimethylamino-pyrimidin-4-yl N,N-dimethylcarbamate | 245-430-1 | 23103-98-2 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)22-37-45-60-61 |
| 006-036-00-3 | benzthiazuron (ISO);1-benzothiazol-2-yl-3-methylurea | 217-685-9 | 1929-88-0 | Xn; R22 | XnR: 22S: (2-)24/25 |
| 006-037-00-9 | promecarb (ISO);3-isopropyl-5-methylphenyl N-methylcarbamate | 220-113-0 | 2631-37-0 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)24-37-45-60-61 |
| 006-038-00-4 | sulfallate (ISO);2-chloroallyl N,N-dimethyldithiocarbamate | 202-388-9 | 95-06-7 | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | E |
| 006-039-00-X | tri-allate (ISO);S-2,3,3-trichloroallyl diisopropylthiocarbamate | 218-962-7 | 2303-17-5 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)24-37-60-61 |
| 006-040-00-5 | 3-methylpyrazol-5-yl-dimethylcarbamate;monometilan | — | 2532-43-6 | T; R23/24/25 | TR: 23/24/25S: (1/2-)13-45 |
| 006-041-00-0 | dimethylcarbamoyl chloride | 201-208-6 | 79-44-7 | Carc. Cat. 2; R45T; R23Xn; R22Xi; R36/37/38 | TR: 45-22-23-36/37/38S: 53-45 | Carc. Cat. 2; R45: C ≥ 0,001 % | E |
| 006-042-00-6 | monuron (ISO);3-(4-chlorophenyl)-1,1-dimethylurea | 205-766-1 | 150-68-5 | Carc. Cat. 3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)36/37-60-61 |
| 006-043-00-1 | 3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate;monuron-TCA | — | 140-41-0 | Xi; R36/38Carc. Cat. 3; R40N; R50-53 | Xn; NR: 36/38-40-50/53S: (2-)36/37-60-61 |
| 006-044-00-7 | isoproturon (ISO);3-(4-isopropylphenyl)-1,1-dimethylurea | 251-835-4 | 34123-59-6 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 006-045-00-2 | methomyl (ISO);1-(methylthio)ethylideneamino N-methylcarbamate | 240-815-0 | 16752-77-5 | T+;R28N; R50-53 | T+; NR: 28-50/53S: (1/2-)22-36/37-45-60-61 |
| 006-046-00-8 | bendiocarb (ISO);2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate | 245-216-8 | 22781-23-3 | T; R23/25Xn; R21N; R50-53 | T; NR: 21-23/25-50/53S: (1/2-)22-36/37-45-60-61 |
| 006-047-00-3 | bufencarb (ISO);reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate | — | 8065-36-9 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 |
| 006-048-00-9 | ethiofencarb (ISO);2-(ethylthiomethyl)phenyl N-methylcarbamate | 249-981-9 | 29973-13-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 006-049-00-4 | dixanthogen;O,O-diethyl dithiobis(thioformate) | 207-944-4 | 502-55-6 | Xn; R22 | XnR: 22S: (2-)24 |
| 006-050-00-X | 1,1-dimethyl-3-phenyluronium trichloroacetate;fenuron-TCA | — | 4482-55-7 | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)60-61 |
| 006-051-00-5 | ferbam (ISO);iron tris(dimethyldithiocarbamate) | 238-484-2 | 14484-64-1 | Xi; R36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)60-61 |
| 006-052-00-0 | formetanate hydrochloride;3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate | 245-656-0 | 23422-53-9 | T+; R26/28R43N; R50-53 | T+; NR: 26/28-43-50/53S: (1/2-)24-28-37/39-45-60-61 |
| 006-053-00-6 | isoprocarb (ISO);2-isopropylphenyl N-methylcarbamate | 220-114-6 | 2631-40-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 006-054-00-1 | mexacarbate (ISO);3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate | 206-249-3 | 315-18-4 | T+; R28Xn; R21N; R50-53 | T+; NR: 21-28-50/53S: (1/2-)36/37-45-60-61 |
| 006-055-00-7 | xylylcarb (ISO);3,4-dimethylphenyl N-methylcarbamate;3,4-xylyl methylcarbamate;MPMC | 219-364-9 | 2425-10-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 006-056-00-2 | metolcarb (ISO);m-tolyl methylcarbamate;MTMC | 214-446-0 | 1129-41-5 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 006-057-00-8 | nitrapyrin (ISO);2-chloro-6-trichloromethylpyridine | 217-682-2 | 1929-82-4 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)24-61 |
| 006-058-00-3 | noruron (ISO);1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea | — | 2163-79-3 | Xn; R22 | XnR: 22S: (2-) |
| 006-059-00-9 | oxamyl (ISO);N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate; | 245-445-3 | 23135-22-0 | T+; R26/28Xn; R21N; R51-53 | T+; NR: 21-26/28-51/53S: (1/2-)36/37-45-61 |
| 006-060-00-4 | oxycarboxin (ISO);2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide | 226-066-2 | 5259-88-1 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 006-061-00-X | S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride;prothiocarb hydrochloride | 243-193-9 | 19622-19-6 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 006-062-00-5 | methyl 3,4-dichlorophenylcarbanilate;SWEP. | — | 1918-18-9 | Xn; R22 | XnR: 22S: (2-) |
| 006-063-00-0 | thiobencarb (ISO);S-4-chlorobenzyl diethylthiocarbamate; | 248-924-5 | 28249-77-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 006-064-00-6 | thiofanox (ISO);3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime; | 254-346-4 | 39196-18-4 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)27-36/37-45-60-61 |
| 006-065-00-1 | 3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime;triamid | — | 15271-41-7 | T+; R28T; R24N; R51-53 | T+; NR: 24-28-51/53S: (1/2-)28-36/37-45-61 |
| 006-066-00-7 | vernolate (ISO);S-propyl dipropylthiocarbamate; | 217-681-7 | 1929-77-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 006-067-00-2 | XMC;3,5-xylyl methylcarbamate | — | 2655-14-3 | Xn; R22 | XnR: 22S: (2-) |
| 006-068-00-8 | diazomethane | 206-382-7 | 334-88-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 006-069-00-3 | thiophanate-methyl (ISO);1,2-di-(3-methoxycarbonyl-2-thioureido)benzene | 245-740-7 | 23564-05-8 | Muta. Cat. 3; R68Xn; R20R43N; R50-53 | Xn; NR: 20-43-50/53-68S: (2-)36/37-46-60-61 |
| 006-070-00-9 | furmecyclox (ISO);N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide; | 262-302-0 | 60568-05-0 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 006-071-00-4 | cyclooct-4-en-1-yl methyl carbonate | 401-620-8 | 87731-18-8 | R43 | XiR: 43S: (2-)24-37 |
| 006-072-00-X | prosulfocarb(ISO);S-benzyl N,N-dipropylthiocarbamate; | 401-730-6 | 52888-80-9 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-37-61 |
| 006-073-00-5 | 3-(dimethylamino)propylurea | 401-950-2 | 31506-43-1 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 006-074-00-0 | 2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate | 402-440-2 | 2094-99-7 | T+; R26C; R34Xn; R48/20R42/43N; R50-53 | T+; NR: 26-34-42/43-48/20-50/53S: (1/2-)7-15-28-36/37/39-38-45-60-61 |
| 006-076-00-1 | mancozeb (ISO) | — | 8018-01-7 | Xi; R37R43 | XiR: 37-43S: (2-)8-24/25-46 |
| 006-077-00-7 | maneb (ISO) | 235-654-8 | 12427-38-2 | Xi; R37R43 | XiR: 37-43S: (2-)8-24/25-46 |
| 006-078-00-2 | zineb (ISO);zinc ethylenebis(dithiocarbamate) (polymeric) | 235-180-1 | 12122-67-7 | Xi; R37R43 | XiR: 37-43S: (2-)8-24/25-46 |
| 006-079-00-8 | disulfiram;tetraethylthiuramdisulfide | 202-607-8 | 97-77-8 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)24-37-60-61 |
| 006-080-00-3 | tetramethylthiuram monosulphide | 202-605-7 | 97-74-5 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-26-37-61 |
| 006-081-00-9 | zinc bis(dibutyldithiocarbamate) | 205-232-8 | 136-23-2 | Xi; R36/37/38R43N; R50-53 | Xi; NR: 36/37/38-43-50/53S: (2-)24-37-60-61 |
| 006-082-00-4 | zinc bis(diethyldithiocarbamate) | 238-270-9 | 14324-55-1 | Xn; R22Xi; R36/37/38R43N; R50-53 | Xn; NR: 22-36/37/38-43-50/53S: (2-)24-37-60-61 |
| 006-083-00-X | butocarboxim (ISO);3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime | 252-139-3 | 34681-10-2 | R10T; R23/24/25Xi; R36N; R50-53 | T; NR: 10-23/24/25-36-50/53S: (1/2-)36/37-45-60-61 |
| 006-084-00-5 | carbosulfan (ISO);2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate; | 259-565-9 | 55285-14-8 | T; R23/25R43N; R50-53 | T; NR: 23/25-43-50/53S: (1/2-)24-37-38-45-60-61 |
| 006-085-00-0 | fenobucarb (ISO);2-butylphenyl methylcarbamate; | 223-188-8 | 3766-81-2 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 006-086-00-6 | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate;fenoxycarb | 276-696-7 | 72490-01-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 006-087-00-1 | 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate;furathiocarb | 265-974-3 | 65907-30-4 | T+; R26T; R25Xn; R48/22Xi; R36/38R43N; R50-53 | T+; NR: 25-26-36/38-43-48/22-50/53S: (1/2-)28-36/37-38-45-60-61 |
| 006-088-00-7 | benfuracarb;ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate | — | 82560-54-1 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)36/37-45-60-61 |
| 006-089-00-2 | chlorine dioxide | 233-162-8 | 10049-04-4 | O; R8R6T+; R26C; R34N; R50 | O; T+; NR: 6-8-26-34-50S: (1/2-)23-26-28-36/37/39-38-45-61 | N; R50: C ≥ 0,02 % | 5 |
| 006-089-01-X | chlorine dioxide . . . % | 233-162-8 | 10049-04-4 | T; R25C; R34N; R50 | T; NR: 25-34-50S: (1/2-)23-26-28-36/37/39-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 3 % ≤ C < 10 %Xi; R36: 0,3 % ≤ C < 3 %N; R50: C ≥ 3 % | B |
| 006-090-00-8 | 2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate | 408-010-0 | 88558-41-2 | Xn; R20Xi; R41R52-53 | XnR: 20-41-52/53S: (2-)22-26-39-61 |
| 007-001-00-5 | ammonia, anhydrous | 231-635-3 | 7664-41-7 | R10 ⊗T; R23C; R34N; R50 | T; NR: 10-23-34-50S: (1/2-)9-16-26-36/37/39-45-61 |
| 007-001-01-2 | ammonia ....% | 215-647-6 | 1336-21-6 | C; R34N; R50 | C; NR: 34-50S: (1/2-)26-36/37/39-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | B |
| 007-002-00-0 | nitrogen dioxide; [1]dinitrogen tetraoxide [2] | 233-272-6 [1]234-126-4 [2] | 10102-44-0 [1]10544-72-6 [2] | T+; R26C; R34 | T+R: 26-34S: (1/2-)9-26-28-36/37/39-45 | T+; R26: C ≥ 10 %T; R23: 1 % ≤ C < 10 %Xn; R20: 0,1 % ≤ C < 1 % | 5 |
| 007-003-00-6 | chlormequat chloride (ISO);2-chloroethyltrimethylammonium chloride | 213-666-4 | 999-81-5 | Xn; R21/22 | XnR: 21/22S: (2-)36/37 |
| 007-004-00-1 | nitric acid ... % | 231-714-2 | 7697-37-2 | O; R8C; R35 | O; CR: 8-35S: (1/2-)23-26-36-45 | C; R35: C ≥ 20 %C; R34: 5 % ≤ C < 20 %Footnote:O; R8: C ≥ 70 % | B |
| 007-006-00-2 | ethyl nitrite | 203-722-6 | 109-95-5 | E; R2Xn; R20/21/22 | E; XnR: 2-20/21/22S: (2-) |
| 007-007-00-8 | ethyl nitrate | 210-903-3 | 625-58-1 | E; R2 ⊗ | ER: 2S: (2-)23-24/25 |
| 007-008-00-3 | hydrazine | 206-114-9 | 302-01-2 | R10Carc. Cat. 2; R45T; R23/24/25C; R34R43N; R50-53 | T; NR: 45-10-23/24/25-34-43-50/53S: 53-45-60-61 | C; R34: C ≥ 10 %Xi; R36/38: 3 % ≤ C < 10 % | E |
| 007-009-00-9 | dicyclohexylammonium nitrite | 221-515-9 | 3129-91-7 | Xn; R20/22 | XnR: 20/22S: (2-)15-41 | Xn; R20/22: C ≥ 10 % |
| 007-010-00-4 | sodium nitrite | 231-555-9 | 7632-00-0 | O; R8T; R25N; R50 | O; T; NR: 8-25-50S: (1/2-)45-61 | T; R25: C ≥ 5 %Xn; R22: 1 % ≤ C < 5 % |
| 007-011-00-X | potassium nitrite | 231-832-4 | 7758-09-0 | O; R8T; R25N; R50 | O; T; NR: 8-25-50S: (1/2-)45-61 | T; R25: C ≥ 5 %Xn; R22: 1 % ≤ C < 5 % |
| 007-012-00-5 | N,N-dimethylhydrazine | 200-316-0 | 57-14-7 | F; R11Carc. Cat. 2; R45T; R23/25C; R34N; R51-53 | F; T; NR: 45-11-23/25-34-51/53S: 53-45-61 | E |
| 007-013-00-0 | 1,2-dimethylhydrazine | — | 540-73-8 | Carc. Cat. 2; R45T; R23/24/25N; R51-53 | T; NR: 45-23/24/25-51/53S: 53-45-61 | Carc. Cat. 2; R45: C ≥ 0,01 % | E |
| 007-014-00-6 | salts of hydrazine | — | — | Carc. Cat. 2; R45T; R23/24/25R43N; R50-53 | T; NR: 45-23/24/25-43-50/53S: 53-45-60-61 | AE |
| 007-015-00-1 | O-ethylhydroxylamine | 402-030-3 | 624-86-2 | F; R11T; R23/24/25-48/23Xi; R36R43N; R50 | F; T; NR: 11-23/24/25-36-43-48/23-50S: (1/2-)16-26-36/37/39-45-60-61 |
| 007-016-00-7 | butyl nitrite | 208-862-1 | 544-16-1 | F; R11T; R23/25 | F; TR: 11-23/25S: (1/2-)16-24-45 |
| 007-017-00-2 | isobutyl nitrite | 208-819-7 | 542-56-3 | F; R11Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20/22 | F; TR: 11-20/22-45-68S: 53-45 | E |
| 007-018-00-8 | sec-butyl nitrite | 213-104-8 | 924-43-6 | F; R11Xn; R20/22 | F; XnR: 11-20/22S: (2-)16-24-46 |
| 007-019-00-3 | tert-butyl nitrite | 208-757-0 | 540-80-7 | F; R11Xn; R20/22 | F; XnR: 11-20/22S: (2-)16-24-46 |
| 007-020-00-9 | pentyl nitrite; [1]’amyl nitrite’, mixed isomers [2] | 207-332-7 [1]203-770-8 [2] | 463-04-7 [1]110-46-3 [2] | F; R11Xn; R20/22 | F; XnR: 11-20/22S: (2-)16-24-46 |
| 007-021-00-4 | hydrazobenzene;1,2-diphenylhydrazine | 204-563-5 | 122-66-7 | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | E |
| 007-022-00-X | hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) | 405-030-1 | — | Carc. Cat. 2; R45Xn; R22C; R34R43R52-53 | TR: 45-22-34-43-52/53S: 53-45-61 | E |
| 007-023-00-5 | sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate | 405-510-0 | — | Xi; R38R43 | XiR: 38-43S: (2-)24-37 |
| 007-024-00-0 | 2-(decylthio)ethylammonium chloride | 405-640-8 | 36362-09-1 | Xn; R48/22Xi; R38-41N; R50-53 | Xn; NR: 38-41-48/22-50/53S: (2-)26-36/37/39-60-61 |
| 007-025-00-6 | (4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride | 406-090-1 | 81880-96-8 | Muta. Cat. 3; R68T; R25-48/25R43N; R50-53 | T; NR: 25-43-48/25-68-50/53S: (1/2-)22-36/37/39-45-60-61 |
| 007-026-00-1 | oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide | 413-230-5 | 122035-71-6 | Xi; R41R43 | XiR: 41-43S: (2-)8-22-24-26-30-37/39 |
| 007-027-00-7 | 1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane | 420-190-2 | 771478-66-1 | C; R34Xn; R21/22-48/21R43N; R50-53 | C; NR: 21/22-34-43-48/21-50/53S: (1/2-)7-26-36/37/39-45-60-61 |
| 008-001-00-8 | oxygen | 231-956-9 | 7782-44-7 | O; R8 | OR: 8S: (2-)17 |
| 008-003-00-9 | hydrogen peroxide solution ... % | 231-765-0 | 7722-84-1 | R5O; R8C; R35Xn; R20/22 | O; CR: 5-8-20/22-35S: (1/2-)17-26-28-36/37/39-45 | Xn; R20: C ≥ 50 %Xn; R22: C ≥ 8 %C; R35: C ≥ 70 %C; R34: 50 % ≤ C < 70 %Xi; R37/38: 35 % ≤ C < 50 %Xi; R41: 8 % ≤ C < 50 %Xi; R36: 5 % ≤ C < 8 %Footnote:O; R8: C ≥ 50 %R5: C ≥ 70 % | B |
| 009-001-00-0 | fluorine | 231-954-8 | 7782-41-4 | R7 ⊗T+; R26C; R35 | T+; CR: 7-26-35S: (1/2-)9-26-36/37/39-45 |
| 009-002-00-6 | hydrogen fluoride | 231-634-8 | 7664-39-3 | T+; R26/27/28C; R35 | T+; CR: 26/27/28-35S: (1/2-)7/9-26-36/37/39-45 |
| 009-003-00-1 | hydrofluoric acid ... % | 231-634-8 | 7664-39-3 | T+; R26/27/28C; R35 | T+; CR: 26/27/28-35S: (1/2-)7/9-26-36/37-45 | C; R35: C ≥ 7 %C; R34: 1 % ≤ C < 7 %Xi; R36: 0,1 % ≤ C < 1 % | B |
| 009-004-00-7 | sodium fluoride | 231-667-8 | 7681-49-4 | T; R25Xi; R36/38R32 | TR: 25-32-36/38S: (1/2-)22-36-45 |
| 009-005-00-2 | potassium fluoride | 232-151-5 | 7789-23-3 | T; R23/24/25 | TR: 23/24/25S: (1/2-)26-45 |
| 009-006-00-8 | ammonium fluoride | 235-185-9 | 12125-01-8 | T; R23/24/25 | TR: 23/24/25S: (1/2-)26-45 |
| 009-007-00-3 | sodium bifluoride;sodium hydrogen difluoride | 215-608-3 | 1333-83-1 | T; R25C; R34 | T; CR: 25-34S: (1/2-)22-26-37-45 | T; R25: C ≥ 10 %Xn; R22: 1 % ≤ C < 10 %C; R34: C ≥ 1 %Xi; R36/38: 0,1 % ≤ C < 1 % |
| 009-008-00-9 | potassium bifluoride;potassium hydrogen difluoride | 232-156-2 | 7789-29-9 | T; R25C; R34 | T; CR: 25-34S: (1/2-)22-26-37-45 | T; R25: C ≥ 10 %Xn; R22: 1 % ≤ C < 10 %C; R34: C ≥ 1 %Xi; R36/38: 0,1 % ≤ C < 1 % |
| 009-009-00-4 | ammonium bifluoride;ammonium hydrogen difluoride | 215-676-4 | 1341-49-7 | T; R25C; R34 | T; CR: 25-34S: (1/2-)22-26-37-45 | T; R25: C ≥ 10 %Xn; R22: 1 % ≤ C < 10 %C; R34: C ≥ 1 %Xi; R36/38: 0,1 % ≤ C < 1 % |
| 009-010-00-X | fluoroboric acid ... % | 240-898-3 | 16872-11-0 | C; R34 | CR: 34S: (1/2-)26-27-45 | C; R34: C ≥ 25 %Xi; R36/38: 10 % ≤ C < 25 % | B |
| 009-011-00-5 | fluorosilicic acid ... % | 241-034-8 | 16961-83-4 | C; R34 | CR: 34S: (1/2-)26-27-45 | B |
| 009-012-00-0 | alkali fluorosilicates(Na); [1]alkali fluorosilicates(K); [2]alkali fluorosilicates(NH4) [3] | 240-934-8 [1]240-896-2 [2]240-968-3 [3] | 16893-85-9 [1]16871-90-2 [2]16919-19-0 [3] | T; R23/24/25 | TR: 23/24/25S: (1/2-)26-45 | T; R23/24/25: C ≥ 10 %Xn; R20/21/22: 1 % ≤ C < 10 % | A |
| 009-013-00-6 | fluorosilicates, with the exception of those specified elsewhere in this annex | — | — | Xn; R22 | XnR: 22S: (2-)13-24/25 | Xn; R22: C ≥ 10 % | A |
| 009-014-00-1 | lead hexafluorosilicate | 247-278-1 | 25808-74-6 | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22R33N; R50-53 | T; NR: 61-62-20/22-33-50/53S: 53-45-60-61 | E1 |
| 009-015-00-7 | sulphuryl difluoride | 220-281-5 | 2699-79-8 | T; R23Xn; R48/20N; R50 | T; NR: 23-48/20-50S: (1/2-)45-63-60-61 |
| 009-016-00-2 | trisodium hexafluoroaluminate;cryolite | 237-410-6239-148-8 | 13775-53-615096-52-3 | T; R48/23/25Xn; R20/22N; R51-53 | T; NR: 20/22-48/23/25-51/53S: (1/2-)22-37-45-61 | C |
| 009-017-00-8 | potassium mu-fluoro-bis(triethylaluminium) | 400-040-2 | 12091-08-6 | F; R11-14/15C; R35Xn; R20 | F; CR: 11-14/15-20-35S: (1/2-)16-30-36/39-43-45 |
| 009-018-00-3 | magnesium hexafluorosilicate | 241-022-2 | 16949-65-8 | T; R25 | TR: 25S: (1/2-)24/25-45 | T; R25: C ≥ 10 %Xn; R22: 1 % ≤ C < 10 % |
| 011-001-00-0 | sodium | 231-132-9 | 7440-23-5 | F; 15R14C; R34 | F; CR: 14/15-34S: (1/2-)5-8-43-45 |
| 011-002-00-6 | sodium hydroxide;caustic soda | 215-185-5 | 1310-73-2 | C; R35 | CR: 35S: (1/2-)26-37/39-45 | C; R35: C ≥ 5 %C; R34: 2 % ≤ C < 5 %Xi; R36/38: 0,5 % ≤ C < 2 % |
| 011-003-00-1 | sodium peroxide | 215-209-4 | 1313-60-6 | O; R8C; R35 | O; CR: 8-35S: (1/2-)8-27-39-45 |
| 011-004-00-7 | sodium azide | 247-852-1 | 26628-22-8 | T+; R28R32N; R50-53 | T+; NR: 28-32-50/53S: (1/2-)28-45-60-61 |
| 011-005-00-2 | sodium carbonate | 207-838-8 | 497-19-8 | Xi; R36 | XiR: 36S: (2-)22-26 |
| 011-006-00-8 | sodium cyanate | 213-030-6 | 917-61-3 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)24/25-61 |
| 011-007-00-3 | propoxycarbazone-sodium | — | 181274-15-7 | N; R50-53 | NR: 50/53S: 60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 012-001-00-3 | magnesium powder (pyrophoric) | 231-104-6 | 7439-95-4 | F; R15-17 | FR: 15-17S: (2-)7/8-43 |
| 012-002-00-9 | magnesium, powder or turnings | 231-104-6 | — | F; R11-15 | FR: 11-15S: (2-)7/8-43 |
| 012-003-00-4 | magnesium alkyls | — | — | R14F; R17C; R34 | F; CR: 14-17-34S: (1/2-)16-43-45 | A |
| 013-001-00-6 | aluminium powder (pyrophoric) | 231-072-3 | 7429-90-5 | F; R15-17 | FR: 15-17S: (2-)7/8-43 |
| 013-002-00-1 | aluminium powder (stabilised) | 231-072-3 | — | F; R15R10 ⊗ | FR: 10-15S: (2-)7/8-43 |
| 013-003-00-7 | aluminium chloride, anhydrous | 231-208-1 | 7446-70-0 | C; R34 | CR: 34S: (1/2-)7/8-28-45 |
| 013-004-00-2 | aluminium alkyls | — | — | R14F; R17C; R34 | F; CR: 14-17-34S: (1/2-)16-43-45 | A |
| 013-005-00-8 | diethyl(ethyldimethylsilanolato)aluminium | 401-160-8 | 55426-95-4 | F; R 15-17R14C; R35 | F; CR: 14/15-17-35S: (1/2-)6-16-30-36/39-43-45 |
| 013-006-00-3 | (ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised | 402-370-2 | — | R10Xi; R41 | XiR: 10-41S: (2-)26-39 |
| 013-007-00-9 | poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) | 403-430-0 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 013-008-00-4 | di-n-octylaluminium iodide | 408-190-0 | 7585-14-0 | R14F; R17C; R34N; R50-53 | F; C; NR: 14-17-34-50/53S: (1/2-)6-16-26-36/37/39-43-45-60-61 |
| 013-009-00-X | sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0.5, y = 1.5 | 418-720-2 | — | F; R11-15-17R14Xn; R20C; R35 | F; CR: 11-14/15-17-20-35S: (1/2-)6-16-26-30-36/37/39-43-45 |
| 014-001-00-9 | trichlorosilane | 233-042-5 | 10025-78-2 | F+; R12R14F; R17Xn; R20/22R29C; R35 | F+; CR: 12-14-17-20/22-29-35S: (2-)7/9-16-26-36/37/39-43-45 | Xn; R20/22: C ≥ 10 %C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 014-002-00-4 | silicon tetrachloride | 233-054-0 | 10026-04-7 | R14Xi; R36/37/38 | XiR: 14-36/37/38S: (2-)7/8-26 |
| 014-003-00-X | dimethyldichlorosilane | 200-901-0 | 75-78-5 | F; R11Xi; R36/37/38 | F; XiR: 11-36/37/38S: (2-) |
| 014-004-00-5 | trichloro(methyl)silane;methyltrichlorosilane | 200-902-6 | 75-79-6 | R14F; R11Xi; R36/37/38 | F; XiR: 11-14-36/37/38S: (2-)26-39 | Xi; R36/37/38: C ≥ 1 % |
| 014-005-00-0 | tetraethyl silicate;ethyl silicate | 201-083-8 | 78-10-4 | R10Xn; R20Xi; R36/37 | XnR: 10-20-36/37S: (2-) |
| 014-006-00-6 | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride | 401-380-4 | — | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 014-007-00-1 | triethoxyisobutylsilane | 402-810-3 | 17980-47-1 | Xi; R38 | XiR: 38S: (2-)24 |
| 014-008-00-7 | (chloromethyl)bis(4-fluorophenyl)methylsilane | 401-200-4 | 85491-26-5 | N; R51-53 | NR: 51/53S: 61 |
| 014-009-00-2 | isobutylisopropyldimethoxysilane | 402-580-4 | 111439-76-0 | R10Xn; R20Xi; R38 | XnR: 10-20-38S: (2-)25-26-36/37 |
| 014-010-00-8 | disodium metasilicate | 229-912-9 | 6834-92-0 | C; R34Xi; R37 | CR: 34-37S: (1/2-)13-24/25-36/37/39-45 |
| 014-011-00-3 | cyclohexyldimethoxymethylsilane | 402-140-1 | 17865-32-6 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)24-61 |
| 014-012-00-9 | bis(3-(trimethoxysilyl)propyl)amine | 403-480-3 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)24-26-39-61 |
| 014-013-00-4 | α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) | 404-920-7 | — | Xn; R21/22C; R34N; R51-53 | C; NR: 21/22-34-51/53S: (1/2-)26-36/37/39-45-61 |
| 014-014-00-X | etacelasil (ISO);6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane; | 253-704-7 | 37894-46-5 | Repr. Cat. 2; R61Xn; R22-48/22 | TR: 61-22-48/22S: 53-45 | E |
| 014-015-00-5 | α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]- co-oxy(dimethylsilane)) | 406-420-4 | 69430-40-6 | R53 | R: 53S: 61 |
| 014-016-00-0 | reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane;1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane | 406-490-6 | — | N; R51-53 | NR: 51/53S: 61 |
| 014-017-00-6 | flusilazole (ISO);bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane | — | 85509-19-9 | Carc. Cat. 3; R40Repr. Cat. 2; R61Xn; R22N; R51-53 | T; NR: 61-22-40-51/53S: 53-45-61 | E |
| 014-018-00-1 | octamethylcyclotetrasiloxane | 209-136-7 | 556-67-2 | Repr. Cat. 3; R62R53 | XnR: 53-62S: (2-)36/37-46-51-61 |
| 014-019-00-7 | reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole;1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | 403-250-2 | — | Carc. Cat. 3; R40Repr. Cat. 2; R61Xn; R22N; R51-53 | T; NR: 61-22-40-51/53S: 53-45-61 | E |
| 014-020-00-2 | bis(1,1-dimethyl-2-propynyloxy)dimethylsilane | 414-960-7 | 53863-99-3 | Xn; R20 | XnR: 20S: (2) |
| 014-021-00-8 | tris(isopropenyloxy)phenyl silane | 411-340-8 | 52301-18-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 014-022-00-3 | reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) | 401-530-9 | — | F; R11T; R39/23/24/25Xn; R20/21/22 | F; TR: 11-20/21/22-39/23/24/25S: (1/2-)16-29-36/37-45 |
| 014-023-00-9 | α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole | 408-160-7 | 125613-45-8 | N; R51-53 | NR: 51/53S: 61 |
| 014-024-00-4 | 1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene | 412-620-2 | 121626-74-2 | N; R51-53 | NR: 51/53S: 61 |
| 014-025-00-X | 4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine | 411-400-3 | 102089-33-8 | Xn; R22-48/21Xi; R38-41R52-53 | XnR: 22-38-41-48/21-52/53S: (2-)26-36/37/39-61 |
| 014-026-00-5 | dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane | 407-180-3 | 770722-36-6 | C; R35 | CR: 35S: (1/2-)26-36/37/39-45 |
| 014-027-00-0 | chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane | 410-270-5 | 770722-46-8 | C; R35 | CR: 35S: (1/2-)8-26-28-36/37/39-45 |
| 014-028-00-6 | α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) | 415-290-8 | 193159-06-7 | R43 | XiR: 43S: (2-)24-37 |
| 014-029-00-1 | O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] | 421-870-1 | 156145-66-3 | Repr. Cat. 3; R62Xn; R22-48/22 | XnR: 22-48/22-62S: (2-)36/37 |
| 014-030-00-7 | [(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium | 422-060-0 | 137390-08-0 | T+; R28 | T+R: 28S: (1/2-)6-22-28-36/37-45 |
| 014-031-00-2 | bis(1-methylethyl)-dimethoxysilane | 421-540-7 | 18230-61-0 | R10Xi; R38R43R52-53 | XiR: 10-38-43-52/53S: (2-)24-37-61 |
| 014-032-00-8 | dicyclopentyldimethoxysilane | 404-370-8 | 126990-35-0 | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 |
| 015-001-00-1 | white phosphorus | 231-768-7 | 12185-10-3 | F; R17T+; R26/28C; R35N; R50 | F; T+; C; NR: 17-26/28-35-50S: (1/2-)5-26-38-45-61 |
| 015-002-00-7 | red phosphorus | 231-768-7 | 7723-14-0 | F; R11R16R52-53 | FR: 11-16-52/53S: (2-)7-43-61 |
| 015-003-00-2 | calcium phosphide;tricalcium diphosphide | 215-142-0 | 1305-99-3 | F; R15/29T+; R28N; R50 | F; T+; NR: 15/29-28-50S: (1/2-)22-43-45-61 |
| 015-004-00-8 | aluminium phosphide | 244-088-0 | 20859-73-8 | F; R15/29T+; R28R32N; R50 | F; T+; NR: 15/29-28-32-50S: (1/2-)3/9/14-30-36/37-45-61 |
| 015-005-00-3 | magnesium phosphide;trimagnesium diphosphide | 235-023-7 | 12057-74-8 | F; R15/29T+; R28N; R50 | F; T+; NR: 15/29-28-50S: (1/2-)22-43-45-61 |
| 015-006-00-9 | trizinc diphosphide;zinc phosphide | 215-244-5 | 1314-84-7 | F; R15/29T+; R28R32N; R50-53 | F; T+; NR: 15/29-28-32-50/53S: (1/2-)3/9/14-30-36/37-45-60-61 |
| 015-007-00-4 | phosphorus trichloride | 231-749-3 | 7719-12-2 | R14T+; R26/28Xn; R48/20C; R35R29 | T+; CR: 14-26/28-35-48/20S: (1/2-)7/8-26-36/37/39-45 |
| 015-008-00-X | phosphorus pentachloride | 233-060-3 | 10026-13-8 | R14T+; R26Xn; R22-48/20C; R34R29 | T+R: 14-22-26-34-48/20S: (1/2-)7/8-26-36/37/39-45 |
| 015-009-00-5 | phosphoryl trichloride | 233-046-7 | 10025-87-3 | R14T+; R26T; R48/23Xn; R22C; R35R29 | T+; CR: 14-22-26-35-48/23S: (1/2-)7/8-26-36/37/39-45 |
| 015-010-00-0 | phosphorus pentoxide | 215-236-1 | 1314-56-3 | C; R35 | CR: 35S: (1/2-)22-26-45 |
| 015-011-00-6 | phosphoric acid ... %, orthophosphoric acid ... % | 231-633-2 | 7664-38-2 | C; R34 | CR: 34S: (1/2-)26-45 | C; R34: C ≥ 25 %Xi; R36/38: 10 % ≤ C < 25 % | B |
| 015-012-00-1 | tetraphosphorus trisulphide;phosphorus sesquisulphid | 215-245-0 | 1314-85-8 | F; R11Xn; R22N; R50 | F; Xn; NR: 11-22-50S: (2-)7-16-24/25-61 |
| 015-013-00-7 | triethyl phosphate | 201-114-5 | 78-40-0 | Xn; R22 | XnR: 22S: (2-)25 |
| 015-014-00-2 | tributyl phosphate | 204-800-2 | 126-73-8 | Carc. Cat. 3; R40Xn; R22Xi; R38 | XnR: 22-38-40S: (2-)36/37-46 |
| 015-015-00-8 | tricresyl phosphate (o—o—o-, o—o—m-, o—o—p-, o—m—m-, o—m—p-, o—p—p-);tritolyl phosphate (o—o—o-, o—o—m-, o—o—p-, o—m—m-, o—m—p-, o—p—p-); | 201-103-5 | 78-30-8 | T; R39/23/24/25N; R51-53 | T; NR: 39/23/24/25-51/53S: (1/2-)20/21-28-45-61 | T; R39/23/24/25: C ≥ 1 %Xn; R68/20/21/22: 0,2 % ≤ C < 1 % | C |
| 015-016-00-3 | tricresyl phosphate (m—m—m-, m—m—p-, m—p—p-, p—p—p-);tritolyl phosphate (m—m—m-, m—m—p-, m—p—p-, p—p—p-); | 201-105-6 | 78-32-0 | Xn; R21/22N; R51-53 | Xn; NR: 21/22-51/53S: (2-)28-61 | Xn; R21/22: C ≥ 5 % | C |
| 015-019-00-X | dichlorvos (ISO);2,2-dichlorovinyl dimethyl phosphate | 200-547-7 | 62-73-7 | T+; R26T; R24/25R43N; R50 | T+; NR: 24/25-26-43-50S: (1/2-)28-36/37-45-61 |
| 015-020-00-5 | mevinphos (ISO);2-methoxycarbonyl-1-methylvinyl dimethyl phosphate | 232-095-1 | 7786-34-7 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)23-28-36/37-45-60-61 | N; R50-53: C ≥ 0,0025 %N; R51-53: 0,00025 % ≤ C < 0,0025 %R52-53: 0,000025 % ≤ C < 0,00025 % |
| 015-021-00-0 | trichlorfon (ISO);dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate | 200-149-3 | 52-68-6 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-022-00-6 | phosphamidon (ISO);2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate | 236-116-5 | 13171-21-6 | T+; R28T; R24Muta. Cat. 3; R68N; R50-53 | T+; NR: 24-28-50/53-68S: (1/2-)23-36/37-45-60-61 |
| 015-023-00-1 | pyrazoxon;diethyl 3-methylpyrazol-5-yl phosphate | — | 108-34-9 | T+; R26/27/28 | T+R: 26/27/28S: (1/2-)13-28-45 |
| 015-024-00-7 | triamiphos (ISO);5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide | — | 1031-47-6 | T+; R27/28 | T+R: 27/28S: (1/2-)22-28-36/37-45 |
| 015-025-00-2 | TEPP (ISO);tetraethyl pyrophosphate | 203-495-3 | 107-49-3 | T+; R27/28N; R50 | T+; NR: 27/28-50S: (1/2-)36/37/39-38-45-61 |
| 015-026-00-8 | schradan (ISO);octamethylpyrophosphoramide | 205-801-0 | 152-16-9 | T+; R27/28 | T+R: 27/28S: (1/2-)36/37-38-45 |
| 015-027-00-3 | sulfotep (ISO);O,O,O,O-tetraethyl dithiopyrophosphate | 222-995-2 | 3689-24-5 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)23-28-36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-028-00-9 | demeton-O (ISO);O,O-diethyl-O-2-ethylthioethyl phosphorothioate | 206-053-8 | 298-03-3 | T+; R27/28N; R50 | T+; NR: 27/28-50S: (1/2-)28-36/37-45-61 |
| 015-029-00-4 | demeton-S (ISO);diethyl-S-2-ethylthioethyl phosphorothioate | 204-801-8 | 126-75-0 | T+; R27/28 | T+R: 27/28S: (1/2-)28-36/37-45 |
| 015-030-00-X | demeton-O-methyl (ISO);O-2-ethylthioethyl O,O-dimethyl phosphorothioate | 212-758-1 | 867-27-6 | T; R25 | TR: 25S: (1/2-)24-36/37-45 |
| 015-031-00-5 | demeton-S-methyl (ISO);S-2-ethylthioethyl dimethyl phosphorothioate | 213-052-6 | 919-86-8 | T; R24/25N; R51-53 | T; NR: 24/25-51/53S: (1/2-)28-36/37-45-61 |
| 015-032-00-0 | prothoate (ISO);O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate | 218-893-2 | 2275-18-5 | T+; R27/28R52-53 | T+R: 27/28-52/53S: (1/2-)28-36/37-45-61 |
| 015-033-00-6 | phorate (ISO);O,O-diethyl ethylthiomethyl phosphorodithioate | 206-052-2 | 298-02-2 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-034-00-1 | parathion (ISO);O,O-diethyl O-4-nitrophenyl phosphorothioate | 200-271-7 | 56-38-2 | T+; R26/28T; R24-48/25N; R50-53 | T+; NR: 24-26/28-48/25-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-035-00-7 | parathion — methyl (ISO);O,O-dimethyl O-4-nitrophenyl phosphorothioate | 206-050-1 | 298-00-0 | R5R10T+; R26/28T; R24Xn; R48/22N; R50-53 | T+; NR: 5-10-24-26/28-48/22-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-036-00-2 | O-ethyl O-4-nitrophenyl phenylphosphonothioate;EPN | 218-276-8 | 2104-64-5 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)22-36/37-45-60-61 |
| 015-037-00-8 | phenkapton (ISO);S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate | 218-892-7 | 2275-14-1 | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 |
| 015-038-00-3 | coumaphos (ISO);O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate | 200-285-3 | 56-72-4 | T+; R28Xn; R21N; R50-53 | T+; NR: 21-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-039-00-9 | azinphos-methyl (ISO);O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate | 201-676-1 | 86-50-0 | T+; R26/28T; R24R43N; R50-53 | T+; NR: 24-26/28-43-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-040-00-4 | diazinon (ISO);O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate | 206-373-8 | 333-41-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-60-61 |
| 015-041-00-X | malathion (ISO);1,2-bis (ethoxycarbonyl) ethyl O,O-dimethyl phosphorodithioate | 204-497-7 | 121-75-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-042-00-5 | chlorthionO-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate | 207-902-5 | 500-28-7 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-043-00-0 | phosnichlor (ISO);O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate | — | 5826-76-6 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)13 |
| 015-044-00-6 | carbophenothion (ISO);4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate | 212-324-1 | 786-19-6 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-045-00-1 | mecarbam (ISO);N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate | 219-993-9 | 2595-54-2 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)36/37-45-60-61 |
| 015-046-00-7 | oxydemeton-methyl;S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate | 206-110-7 | 301-12-2 | T; R24/25N; R50 | T; NR: 24/25-50S: (1/2-)23-36/37-45-61 |
| 015-047-00-2 | ethion (ISO);O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate);diethion | 209-242-3 | 563-12-2 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)25-36/37-45-60-61 | N; R50-53: C ≥ 0,0025 %N; R51-53: 0,00025 % ≤ C < 0,0025 %R52-53: 0,000025 % ≤ C < 0,00025 % |
| 015-048-00-8 | fenthion (ISO);O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate | 200-231-9 | 55-38-9 | Muta. Cat. 3; R68T; R23-48/25Xn; R21/22N; R50-53 | T; NR: 21/22-23-48/25-50/53-68S: (1/2-)36/37-45-60-61 |
| 015-049-00-3 | endothion (ISO);S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate | 220-472-3 | 2778-04-3 | T; R24/25 | TR: 24/25S: (1/2-)36/37-45 |
| 015-050-00-9 | thiometon (ISO);S-2-ethylthioethyl O,O-dimethyl phosphorodithioate | 211-362-6 | 640-15-3 | T; R25Xn; R21 | TR: 21-25S: (1/2-)36/37-45 |
| 015-051-00-4 | dimethoate (ISO);O,O-dimethyl methylcarbamoylmethyl phosphorodithioate | 200-480-3 | 60-51-5 | Xn; R21/22 | XnR: 21/22S: (2-)36/37 |
| 015-052-00-X | fenchlorphos (ISO);O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate | 206-082-6 | 299-84-3 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)25-36/37-60-61 |
| 015-053-00-5 | menazon (ISO);S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O, O-dimethyl phosphorodithioate | 201-123-4 | 78-57-9 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 015-054-00-0 | fenitrothion (ISO);O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate | 204-524-2 | 122-14-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 015-055-00-6 | naled (ISO);1,2-dibromo-2,2-dichloroethyl dimethyl phosphate | 206-098-3 | 300-76-5 | Xn; R21/22Xi; R36/38N; R50 | Xn; NR: 21/22-36/38-50S: (2-)36/37-61 | N; R50: C ≥ 0,025 % |
| 015-056-00-1 | azinphos-ethyl (ISO);O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate | 220-147-6 | 2642-71-9 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-057-00-7 | formothion (ISO);N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate | 219-818-6 | 2540-82-1 | Xn; R21/22 | XnR: 21/22S: (2-)36/37 |
| 015-058-00-2 | morphothion (ISO);O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate | 205-628-0 | 144-41-2 | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 |
| 015-059-00-8 | vamidothion (ISO);O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate | 218-894-8 | 2275-23-2 | T; R25Xn; R21N; R50 | T; NR: 21-25-50S: (1/2-)36/37-45-61 |
| 015-060-00-3 | disulfoton (ISO);O,O-diethyl 2-ethylthioethyl phosphorodithioate | 206-054-3 | 298-04-4 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-061-00-9 | dimefox (ISO);tetramethylphosphorodiamidic fluoride | 204-076-8 | 115-26-4 | T+; R27/28 | T+R: 27/28S: (1/2-)23-28-36/37-38-45 |
| 015-062-00-4 | mipafox (ISO);N,N'- di-isopropylphosphorodiamidic fluoride | 206-742-3 | 371-86-8 | T+; R39/26/27/28 | T+R: 39/26/27/28S: (1/2-)13-45 |
| 015-063-00-X | dioxathion (ISO);1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) | 201-107-7 | 78-34-2 | T+; R26/28T; R24N; R50-53 | T+; NR: 24-26/28-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-064-00-5 | bromophos-ethyl (ISO);O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate | 225-399-0 | 4824-78-6 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-065-00-0 | S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate | — | 2703-37-9 | T+; R26/27/28N; R51-53 | T+; NR: 26/27/28-51/53S: (1/2-)13-28-45-61 |
| 015-066-00-6 | omethoate (ISO);O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate | 214-197-8 | 1113-02-6 | T; R25Xn; R21N; R50 | T; NR: 21-25-50S: (1/2-)23-36/37-45-61 |
| 015-067-00-1 | phosalone (ISO);S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate | 218-996-2 | 2310-17-0 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)36/37-45-60-61 |
| 015-068-00-7 | dichlofenthion (ISO);O-2,4-dichlorophenyl O,O-diethyl phosphorothioate | 202-564-5 | 97-17-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 015-069-00-2 | methidathion (ISO);2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate | 213-449-4 | 950-37-8 | T+; R28Xn; R21N; R50-53 | T+; NR: 21-28-50/53S: (1/2-)22-28-36/37-45-60-61 |
| 015-070-00-8 | cyanthoate (ISO);S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate | 223-099-4 | 3734-95-0 | T+; R28T; R24 | T+R: 24-28S: (1/2-)36/37-45 |
| 015-071-00-3 | chlorfenvinphos (ISO);2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate | 207-432-0 | 470-90-6 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-072-00-9 | monocrotophos (ISO);dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate | 230-042-7 | 6923-22-4 | Muta. Cat. 3; R68T+; R26/28T; R24N; R50-53 | T+; NR: 24-26/28-50/53-68S: (1/2-)36/37-45-60-61 |
| 015-073-00-4 | dicrotophos (ISO);(Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate | 205-494-3 | 141-66-2 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-074-00-X | crufomate (ISO);4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate | 206-083-1 | 299-86-5 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 015-075-00-5 | S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate | — | 2635-50-9 | T; R23/24/25 | TR: 23/24/25S: (1/2-)13-45 |
| 015-076-00-0 | potasan;O, O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate | — | 299-45-6 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)13-28-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-077-00-6 | 2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate | — | 7076-53-1 | T; R23/24/25 | TR: 23/24/25S: (1/2-)13-45 |
| 015-078-00-1 | demeton-S-methylsulphon (ISO);S-2-ethylsulphonylethyl dimethyl phosphorothioate | 241-109-5 | 17040-19-6 | T; R25Xn; R21N; R51-53 | T; NR: 21-25-51/53S: (1/2-)22-28-36/37-45-61 |
| 015-079-00-7 | acephate (ISO);O,S-dimethyl acetylphosphoramidothioate | 250-241-2 | 30560-19-1 | Xn; R22 | XnR: 22S: (2-)36 |
| 015-080-00-2 | amidithion (ISO);2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | — | 919-76-6 | Xn; R22 | XnR: 22S: (2-)24-36 |
| 015-081-00-8 | O,O,O',O'-tetrapropyl dithiopyrophosphate | 221-817-0 | 3244-90-4 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 015-082-00-3 | azothoate (ISO);O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate | 227-419-3 | 5834-96-8 | Xn; R20/22 | XnR: 20/22S: (2-)13 |
| 015-083-00-9 | bensulide (ISO);O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate | 212-010-4 | 741-58-2 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-36-60-61 |
| 015-084-00-4 | chlorpyrifos (ISO);O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate | 220-864-4 | 2921-88-2 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)45-60-61 | N; R50-53: C ≥ 0,0025 %N; R51-53: 0,00025 % ≤ C < 0,0025 %R52-53: 0,000025 % ≤ C < 0,00025 % |
| 015-085-00-X | chlorphonium chloride (ISO);tributyl (2,4-dichlorobenzyl) phosphonium chloride | 204-105-4 | 115-78-6 | T; R25Xn; R21Xi; R36/38 | TR: 21-25-36/38S: (1/2-)36/37/39-45 |
| 015-086-00-5 | coumithoate (ISO);O,O-diethyl O-7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate | — | 572-48-5 | T; R25 | TR: 25S: (1/2-)28-36/37-45 |
| 015-087-00-0 | cyanophos (ISO);O-4-cyanophenyl O,O-dimethyl phosphorothioate | 220-130-3 | 2636-26-2 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 015-088-00-6 | dialifos (ISO);2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate | 233-689-3 | 10311-84-9 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-089-00-1 | ethoate-methyl (ISO);ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | 204-121-1 | 116-01-8 | Xn; R21/22 | XnR: 21/22S: (2-)36/37 |
| 015-090-00-7 | fensulfothion (ISO);O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate | 204-114-3 | 115-90-2 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)23-28-36/37-45-60-61 |
| 015-091-00-2 | fonofos (ISO);O-ethyl phenyl ethylphosphonodithioate | 213-408-0 | 944-22-9 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-092-00-8 | phosacetim (ISO);O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate | 223-874-7 | 4104-14-7 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-093-00-3 | leptophos (ISO);O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate | 244-472-8 | 21609-90-5 | T; R25-39/25Xn; R21N; R50-53 | T; NR: 21-25-39/25-50/53S: (1/2-)25-36/37/39-45-60-61 |
| 015-094-00-9 | mephosfolan (ISO);diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate | 213-447-3 | 950-10-7 | T+; R27/28N; R51-53 | T+; NR: 27/28-51/53S: (1/2-)36/37/39-45-61 |
| 015-095-00-4 | methamidophos (ISO);O,S-dimethyl phosphoramidothioate | 233-606-0 | 10265-92-6 | T+; R26/28T; R24N; R50 | T+; NR: 24-26/28-50S: (1/2-)28-36/37-45-61 |
| 015-096-00-X | oxydisulfoton (ISO);O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate | 219-679-1 | 2497-07-6 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 015-097-00-5 | phenthoate (ISO);ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate | 219-997-0 | 2597-03-7 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)22-36/37-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-098-00-0 | trichloronate (ISO);O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate | 206-326-1 | 327-98-0 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)23-28-36/37-45-60-61 |
| 015-099-00-6 | pirimiphos-ethyl (ISO);O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate | 245-704-0 | 23505-41-1 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)23-36/37-45-60-61 |
| 015-100-00-X | phoxim (ISO);α-(diethoxyphosphinothioylimino) phenylacetonitrile | 238-887-3 | 14816-18-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)36-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-101-00-5 | phosmet (ISO);O,O-dimethyl phthalimidomethyl S-phosphorodithioate | 211-987-4 | 732-11-6 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)22-36/37-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-102-00-0 | tris(2-chloroethyl) phosphate | 204-118-5 | 115-96-8 | Carc. Cat. 3; R40Xn; R22N; R51-53 | Xn; NR: 22-40-51/53S: (2-)36/37-61 |
| 015-103-00-6 | phosphorus tribromide | 232-178-2 | 7789-60-8 | R14C; R34Xi; R37 | CR: 14-34-37S: (1/2-)26-45 |
| 015-104-00-1 | diphosphorus pentasulphide;phosphorus pentasulphide | 215-242-4 | 1314-80-3 | F; R11R29Xn; R20/22N; R50 | F; Xn; NR: 11-20/22-29-50S: (2-)61 |
| 015-105-00-7 | triphenyl phosphite | 202-908-4 | 101-02-0 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: (2-)28-60-61 | Xi; R36/38: C ≥ 5 % |
| 015-106-00-2 | hexamethylphosphoric triamide;hexamethylphosphoramide | 211-653-8 | 680-31-9 | Carc. Cat. 2; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | Carc. Cat. 2; R45: C ≥ 0,01 % |
| 015-107-00-8 | ethoprophos (ISO);ethyl-S,S-dipropyl phosphorodithioate | 236-152-1 | 13194-48-4 | T+; R26/27T; R25R43N; R50-53 | T+; NR: 25-26/27-43-50/53S: (1/2-)27/28-36/37/39-45-60-61 |
| 015-108-00-3 | bromophos (ISO);O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate | 218-277-3 | 2104-96-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-) 46-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-109-00-9 | crotoxyphos (ISO);1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate | 231-720-5 | 7700-17-6 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 015-110-00-4 | cyanofenphos (ISO);O-4-cyanophenyl O-ethyl phenylphosphonothioate | — | 13067-93-1 | T; R25-39/25Xn; R21Xi; R36N; R51-53 | T; NR: 21-25-36-39/25-51/53S: (1/2-)36/37-45-61 |
| 015-111-00-X | phosfolan (ISO);diethyl 1,3-dithiolan-2-ylidenephosphoramidate | 213-423-2 | 947-02-4 | T+; R27/28 | T+R: 27/28S: (1/2-)28-36/37-45 |
| 015-112-00-5 | thionazin (ISO);O,O-diethyl O-pyrazin-2-yl phosphorothioate; | 206-049-6 | 297-97-2 | T+; R27/28 | T+R: 27/28S: (1/2-)36/37/39-38-45 |
| 015-114-00-6 | chlormephos (ISO);S-chloromethyl O,O-diethyl phosphorodithioate | 246-538-1 | 24934-91-6 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-115-00-1 | chlorthiophos (ISO) | 244-663-6 | 21923-23-9 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-116-00-7 | demephion-O (ISO);O,O-dimethyl O-2-methylthioethyl phosphorothioate | 211-666-9 | 682-80-4 | T+; R28T; R24 | T+R: 24-28S: (1/2-)28-36/37-45 |
| 015-117-00-2 | demephion-S (ISO);O,O-dimethyl S-2-methylthioethyl phosphorothioate | 219-971-9 | 2587-90-8 | T+; R28T; R24 | T+R: 24-28S: (1/2-)28-36/37-45 |
| 015-118-00-8 | demeton | — | 8065-48-3 | T+; R27/28N; R50 | T+; NR: 27/28-50S: (1/2-)28-36/37-45-61 |
| 015-119-00-3 | dimethyl 4-(methylthio)phenyl phosphate | — | 3254-63-5 | T+; R27/28 | T+R: 27/28S: (1/2-)28-36/37-45 |
| 015-120-00-9 | ditalimfos (ISO);O,O-diethyl phthalimidophosphonothioate; | 225-875-8 | 5131-24-8 | Xi; R38R43 | XiR: 38-43S: (2-)36/37 |
| 015-121-00-4 | edifenphos (ISO);O-ethyl S,S-diphenyl phosphorodithioate | 241-178-1 | 17109-49-8 | T; R23/25Xn; R21R43N; R50-53 | T; NR: 21-23/25-43-50/53S: (1/2-)36/37-45-60-61 |
| 015-122-00-X | etrimfos (ISO);O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate; | 253-855-9 | 38260-54-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 015-123-00-5 | fenamiphos (ISO);ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate | 244-848-1 | 22224-92-6 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)23-28-36/37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-124-00-0 | fosthietan (ISO);diethyl 1,3-dithietan-2-ylidenephosphoramidate; | 244-437-7 | 21548-32-3 | T+; R27/28 | T+R: 27/28S: (1/2-)36/37-45 |
| 015-125-00-6 | glyphosine (ISO);N,N-bis(phosphonomethyl)glycine | 219-468-4 | 2439-99-8 | Xi; R41 | XiR: 41S: (2-)26 |
| 015-126-00-1 | heptenophos (ISO);7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate | 245-737-0 | 23560-59-0 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)23-28-37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-127-00-7 | iprobenfos (ISO);S-benzyl diisopropyl phosphorothioate | 247-449-0 | 26087-47-8 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 015-128-00-2 | IPSP;S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate | — | 5827-05-4 | T+; R27T; R25N; R50-53 | T+; NR: 25-27-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-129-00-8 | isofenphos (ISO);O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate | 246-814-1 | 25311-71-1 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)36/37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-130-00-3 | isothioate (ISO)S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate; | — | 36614-38-7 | T; R24/25 | TR: 24/25S: (1/2-)28-36/37-45 |
| 015-131-00-9 | isoxathion (ISO);O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | 242-624-8 | 18854-01-8 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 |
| 015-132-00-4 | S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate;methylcarbophenothione | — | 953-17-3 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-133-00-X | piperophos (ISO);S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate | — | 24151-93-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 015-134-00-5 | pirimiphos-methyl (ISO);O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate | 249-528-5 | 29232-93-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 015-135-00-0 | profenofos (ISO);O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | 255-255-2 | 41198-08-7 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)36/37-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-136-00-6 | trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate;isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate;propetamphos (ISO) | 250-517-2 | 31218-83-4 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)37-45-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 015-137-00-1 | pyrazophos (ISO);O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate | 236-656-1 | 13457-18-6 | Xn; R20/22N; R50-53 | Xn; NR: 20/22-50/53S: (2-)36/37-46-60-61 |
| 015-138-00-7 | quinalphos (ISO);O,O-diethyl-O-quinoxalin-2-yl phosphorothioate | 237-031-6 | 13593-03-8 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)22-36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-139-00-2 | terbufos (ISO)S—tert-butylthiomethyl O, O-diethylphosphorodithioate; | 235-963-8 | 13071-79-9 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)36/37-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 015-140-00-8 | triazophos (ISO);O,O-diethyl-O-1-phenyl-1H,2,4-triazol-3-yl phosphorothioate | 245-986-5 | 24017-47-8 | T; R23/25Xn; R21N; R50-53 | T; NR: 21-23/25-50/53S: (1/2-)36/37-45-60-61 |
| 015-141-00-3 | ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers | 400-520-1 | — | C; R34Xn; R22N; R50-53 | C; NR: 22-34-50/53S: (1/2-)24/25-26-28-39-45-60-61 |
| 015-142-00-9 | butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate | 401-100-0 | — | F; R11Xi; R36N; R51-53 | F; Xi; NR: 11-36-51/53S: (2-)7/9-16-26-43-61 |
| 015-143-00-4 | reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, mixture reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers | 401-740-0 | — | Xn; R22 | XnR: 22S: (2-) |
| 015-144-00-X | reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate | 402-090-0 | 87025-52-3 | C; R34 | CR: 34S: (1/2-)26-36/37/39-45 |
| 015-145-00-5 | reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate | 401-520-4 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 015-146-00-0 | S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | 401-850-9 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 015-147-00-6 | reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) | 400-930-0 | — | Xi; R38-41N; R51-53R43 | Xi; NR: 38-41-43-51/53S: (2-)24-26-37/39-61 |
| 015-148-00-1 | 2-(diphosphonomethyl)succinic acid | 403-070-4 | 51395-42-7 | C; R34R43 | CR: 34-43S: (1/2-)26-36/37/39-45 |
| 015-149-00-7 | reaction mass of: hexyldioctylphosphineoxide;dihexyloctylphosphineoxide;trioctylphosphineoxide | 403-470-9 | — | C; R34N; R50-53 | C; NR: 34-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 015-150-00-2 | (2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide | 404-940-6 | 86608-70-0 | Xn; R22Xi; R41R33R52-53 | XnR: 22-33-41-52/53S: (2-)22-26-39-61 |
| 015-151-00-8 | tris(isopropyl/tert-butylphenyl) phosphate | 405-010-2 | — | N; R51-53 | NR: 51/53S: 61 |
| 015-152-00-3 | dioxabenzofos (ISO);2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide; | 223-292-3 | 3811-49-2 | T; R24/25-39/25N; R51-53 | T; NR: 24/25-39/25-51/53S: (1/2-)36/37-38-45-61 |
| 015-153-00-9 | isazofos (ISO);O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate; | 255-863-8 | 42509-80-8 | T+; R26T; R24/25Xn; R48/20R43N; R50-53 | T+; NR: 24/25-26-43-48/20-50/53S: (1/2-)28-36/37-38-45-59-61 |
| 015-154-00-4 | 2-chloroethylphosphonic acid;ethephon | 240-718-3 | 16672-87-0 | Xn; R20/21C; R34R52-53 | CR: 20/21-34-52/53S: (1/2-)26-28-36/37/39-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 015-155-00-X | ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate;glufosinate ammonium | 278-636-5 | 77182-82-2 | Xn; R22 | XnR: 22S: (2-) |
| 015-156-00-5 | methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1]methacrifos (ISO);methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] | 250-366-9 [1]- [2] | 30864-28-9 [1]62610-77-9 [2] | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37-60-61 |
| 015-157-00-0 | phosphonic acid; [1]phosphorous acid [2] | 237-066-7 [1]233-663-1 [2] | 13598-36-2 [1]10294-56-1 [2] | Xn; R22C; R35 | CR: 22-35S: (1/2-)26-36/37/39-45 |
| 015-158-00-6 | (η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) | 402-340-9 | 32760-80-8 | R52-53 | R: 52/53S: 61 |
| 015-159-00-1 | hydroxyphosphonoacetic acid | 405-710-8 | 23783-26-8 | Xn; R22-48/22C; R34R43 | CR: 22-34-43-48/22S: (1/2-)22-26-36/37/39-45 |
| 015-160-00-7 | vanadyl pyrophosphate | 406-260-5 | 58834-75-6 | Xi; R36R43R52-53 | XiR: 36-43-52/53S: (2-)24-26-37-61 |
| 015-161-00-2 | divanadyl pyrophosphate | 407-130-0 | 65232-89-5 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24-26-37/39-61 |
| 015-162-00-8 | vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped | 407-350-7 | — | Xn; R20-48/22Xi; R41N; R51-53 | Xn; NR: 20-41-48/22-51/53S: (2-)22-26-36/39-61 |
| 015-163-00-3 | bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide | 412-010-6 | 145052-34-2 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 015-164-00-9 | calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate | 400-480-5 | 36669-85-9 | R52-53 | R: 52/53S: 61 |
| 015-165-00-4 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate;diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate | 404-986-7 | — | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)15-26-39-60-61 |
| 015-166-00-X | 3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 410-290-4 | 80693-00-1 | R53 | R: 53S: 61 |
| 015-167-00-5 | 3-(hydroxyphenylphosphinyl)propanoic acid | 411-200-6 | 14657-64-8 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 015-168-00-0 | fosthiazate (ISO);(RS)-S—sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate | — | 98886-44-3 | T; R23/25-39Xn; R21Xi; R41R43N; R50-53 | T; NR: 21-23/25-39-41-43-50/53S: (1/2-)53-45-25-26-39-60-61 |
| 015-169-00-6 | tributyltetradecylphosphonium tetrafluoroborate | 413-520-1 | — | Xn; R22-48/22C; R34R43N; R50-53 | C; NR: 22-34-43-48/22-50/53S: (1/2-)26-28-36/37/39-45-60-61 |
| 015-170-00-1 | reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate;1-octane-N,N,N-trimethylammonium di-octylphosphate;1-octane-N,N,N-trimethylammonium octylphosphate | 407-490-9 | — | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-36/37/39-45 |
| 015-171-00-7 | O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate | 406-940-1 | — | N; R51-53 | NR: 51/53S: 61 |
| 015-172-00-2 | reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate;isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate | 406-240-6 | — | R10C; R34N; R51-53 | C; NR: 10-34-51/53S: (1/2-)23-26-28-36/37/39-45-61 |
| 015-173-00-8 | methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate | 414-080-3 | 117291-73-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)23-36-60-61 |
| 015-174-00-3 | 1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine | 411-370-1 | 82857-68-9 | T; R25Xi; R41N; R51-53 | T; NR: 25-41-51/53S: (1/2-)26-37/39-41-45-61 |
| 015-175-00-9 | tert-butyl (triphenylphosphoranylidene) acetate | 412-880-7 | 35000-38-5 | T; R25Xn; R48/22Xi; R36R43N; R51-53 | T; NR: 25-36-43-48/22-51/53S: (1/2-)26-36/37/39-45-61 |
| 015-176-00-4 | P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine | 413-430-2 | 116163-96-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 015-177-00-X | ((4-phenylbutyl)hydroxyphosphoryl)acetic acid | 412-170-7 | 83623-61-4 | Xn; R48/22Xi; R41R43 | XnR: 41-43-48/22S: (2-)22-26-36/37/39 |
| 015-178-00-5 | (R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate | 418-570-8 | 25383-07-7 | Repr. Cat. 3; R62N; R51-53 | Xn; NR: 62-51/53S: (2-)22-36/37-61 |
| 015-179-00-0 | UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine | 422-720-8 | 166242-53-1 | Carc. Cat. 3; R40Xn; R22-48/22C; R34R43N; R50-53 | C; NR: 22-34-40-43-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 015-180-00-6 | [R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt | 415-820-8 | 137590-32-0 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 015-181-00-1 | phosphine | 232-260-8 | 7803-51-2 | F+; R12R17T+; R26C; R34N; R50 | F+; T+; NR: 12-17-26-34-50S: (1/2-)28-36/37-45-61-63 |
| 015-184-00-8 | Salts of glyphosate, with the exception of those specified elsewhere in this Annex | — | — | N; R51-53 | NR: 51/53S: 61 | A |
| 015-186-00-9 | chlorpyrifos-methyl (ISO),O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate | 227-011-5 | 5598-13-0 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)36/37-60-61 | N; R50-53: C ≥ 0,0025 %N; R51-53: 0,00025 % ≤ C < 0,0025 %R52-53: 0,000025 % ≤ C < 0,00025 % |
| 015-187-00-4 | reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide;trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide | 417-540-1 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 015-189-00-5 | phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 423-340-5 | 162881-26-7 | R43R53 | XiR: 43-53S: (2-)22-24-37-61 |
| 016-001-00-4 | hydrogen sulphide | 231-977-3 | 7783-06-4 | F+; R12T+; R26N; R50 | F+; T+; NR: 12-26-50S: (1/2-)9-16-36-38-45-61 |
| 016-002-00-X | barium sulphide | 244-214-4 | 21109-95-5 | R31Xn; R20/22N; R50 | Xn; NR: 20/22-31-50S: (2-)28-61 |
| 016-003-00-5 | barium polysulphides | 256-814-3 | 50864-67-0 | R31Xi; R36/37/38N; R50 | Xi; NR: 31-36/37/38-50S: (2-)28-61 |
| 016-004-00-0 | calcium sulphide | 243-873-5 | 20548-54-3 | R31Xi; R36/37/38N; R50 | Xi; NR: 31-36/37/38-50S: (2-)28-61 |
| 016-005-00-6 | calcium polysulphides | 215-709-2 | 1344-81-6 | R31Xi; R36/37/38N; R50 | Xi; NR: 31-36/37/38-50S: (2-)28-61 |
| 016-006-00-1 | dipotassium sulphide;potassium sulphide | 215-197-0 | 1312-73-8 | R31C; R34N; R50 | C; NR: 31-34-50S: (1/2-)26-45-61 |
| 016-007-00-7 | potassium polysulphides | 253-390-1 | 37199-66-9 | R31C; R34N; R50 | C; NR: 31-34-50S: (1/2-)26-45-61 |
| 016-008-00-2 | ammonium polysulphides | 232-989-1 | 9080-17-5 | R31C; R34N; R50 | C; NR: 31-34-50S: (1/2-)26-45-61 | C; R34: C ≥ 5 %Xi; R36/38: 1 % ≤ C < 5 %R31: C ≥ 1 % |
| 016-009-00-8 | disodium sulphide;sodium sulphide | 215-211-5 | 1313-82-2 | R31C; R34N; R50 | C; NR: 31-34-50S: (1/2-)26-45-61 |
| 016-010-00-3 | sodium polysulphides | 215-686-9 | 1344-08-7 | T; R25R31C; R34N; R50 | T; NR: 25-31-34-50S: (1/2-)26-36/37/39-45-61 |
| 016-011-00-9 | sulphur dioxide | 231-195-2 | 7446-09-5 | T; R23C; R34 | TR: 23-34S: (1/2-)9-26-36/37/39-45 | T; R23: C ≥ 20 %Xn; R20: 5 % ≤ C < 20 % | 5 |
| 016-012-00-4 | disulphur dichloride;sulfur monochloride | 233-036-2 | 10025-67-9 | R14T; R25Xn; R20R29C; R35N; R50 | T; C; NR: 14-20-25-29-35-50S: (1/2-)26-36/37/39-45-61 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 016-013-00-X | sulphur dichloride | 234-129-0 | 10545-99-0 | R14C; R34Xi; R37N; R50 | C; NR: 14-34-37-50S: (1/2-)26-45-61 |
| 016-014-00-5 | sulphur tetrachloride | — | 13451-08-6 | R14C; R34N; R50 | C; NR: 14-34-50S: (1/2-)26-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 016-015-00-0 | thionyl dichloride;thionyl chloride | 231-748-8 | 7719-09-7 | R14Xn; R20/22R29C; R35 | CR: 14-20/22-29-35S: (1/2-)26-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 016-016-00-6 | sulphuryl chloride | 232-245-6 | 7791-25-5 | R14C; R34Xi; R37 | CR: 14-34-37S: (1/2-)26-45 |
| 016-017-00-1 | chlorosulphonic acid | 232-234-6 | 7790-94-5 | R14C; R35Xi; R37 | CR: 14-35-37S: (1/2-)26-45 |
| 016-018-00-7 | fluorosulphonic acid | 232-149-4 | 7789-21-1 | Xn; R20C; R35 | CR: 20-35S: (1/2-)26-45 |
| 016-019-00-2 | oleum ... % SO3 | — | — | R14C; R35Xi; R37 | CR: 14-35-37S: (1/2-)26-30-45 | B |
| 016-020-00-8 | sulphuric acid ... % | 231-639-5 | 7664-93-9 | C; R35 | CR: 35S: (1/2-)26-30-45 | C; R35: C ≥ 15 %Xi; R36/38: 5 % ≤ C < 15 % | B |
| 016-021-00-3 | methanethiol;methyl mercaptan | 200-822-1 | 74-93-1 | F+; R12T; R23N; R50-53 | F+; T; NR: 12-23-50/53S: (2-)16-25-60-61 |
| 016-022-00-9 | ethanethiol;ethyl mercaptan | 200-837-3 | 75-08-1 | F; R11Xn; R20N; R50-53 | F; Xn; NR: 11-20-50/53S: (2-)16-25-60-61 |
| 016-023-00-4 | dimethyl sulphate | 201-058-1 | 77-78-1 | Carc. Cat. 2; R45Muta. Cat. 3; R68T+; R26T; R25C; R34R43 | T+R: 45-25-26-34-43-68S: 53-45 | Car. Cat. 2; R45: C ≥ 0,01 %Muta. Cat. 3, R68: C ≥ 0,01 %C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | E |
| 016-024-00-X | dimexano (ISO);bis(methoxythiocarbonyl) disulphide | 215-993-8 | 1468-37-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 016-025-00-5 | disul (ISO);2-(2,4-dichlorophenoxy)ethyl hydrogensulphate;2,4-DES | 205-259-5 | 149-26-8 | Xn; R22Xi; R38-41 | XnR: 22-38-41S: (2-)26 |
| 016-026-00-0 | sulphamidic acid;sulphamic acid;sulfamic acid | 226-218-8 | 5329-14-6 | Xi; R36/38R52-53 | XiR: 36/38-52/53S: (2-)26-28-61 |
| 016-027-00-6 | diethyl sulphate | 200-589-6 | 64-67-5 | Carc. Cat. 2; R45Muta. Cat. 2; R46Xn; R20/21/22C; R34 | TR: 45-46-20/21/22-34S: 53-45 | E |
| 016-028-00-1 | sodium dithionite;sodium hydrosulphite | 231-890-0 | 7775-14-6 | R7R31Xn; R22 | XnR: 7-22-31S: (2-)7/8-26-28-43 |
| 016-029-00-7 | p-toluenesulphonic acid, containing more than 5 % H2SO4 | — | — | C; R34 | CR: 34S: (1/2-)26-37/39-45 | C; R34: C ≥ 25 %Xi; R36/38: 10 % ≤ C < 25 % |
| 016-030-00-2 | p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) | 203-180-0 | 104-15-4 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)26-37 |
| 016-031-00-8 | tetrahydrothiophene-1,1-dioxide;sulpholane | 204-783-1 | 126-33-0 | Xn; R22 | XnR: 22S: (2-)25 |
| 016-032-00-3 | 1,3-propanesultone;1,2-oxathiolane 2,2-dioxide | 214-317-9 | 1120-71-4 | Carc. Cat. 2; R45Xn; R21/22 | TR: 45-21/22S: 53-45 | Carc. Cat. 2; R45: C ≥ 0,01 % | E |
| 016-033-00-9 | dimethylsulfamoylchloride | 236-412-4 | 13360-57-1 | Carc. Cat. 2; R45T+; R26Xn; R21/22C; R34 | T+R: 45-21/22-26-34S: 53-45 | E |
| 016-034-00-4 | tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) | 400-010-9 | 81898-60-4 | R43 | XiR: 43S: (2-)22-24-37 |
| 016-035-00-X | pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate | 400-120-7 | — | Xi; R36 | XiR: 36S: (2-)22-26 |
| 016-036-00-5 | tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate | 400-130-1 | — | R42N; R51-53 | Xn; NR: 42-51/53S: (2-)22-61 |
| 016-037-00-0 | disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate | 400-350-8 | 85153-93-1 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 016-038-00-6 | disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate | 400-380-1 | 86393-35-3 | R43 | XiR: 43S: (2-)22-24-37 |
| 016-039-00-1 | tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate | 400-430-2 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 016-040-00-7 | reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate | 400-570-4 | — | Xi; R36 | XiR: 36S: (2-)26 |
| 016-041-00-2 | calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate | 400-710-4 | — | Xn; R20 | XnR: 20S: (2-) |
| 016-042-00-8 | tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate | 400-790-0 | 85665-97-0 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)22-24/25-37 |
| 016-043-00-3 | dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate | 401-010-1 | — | R43 | XiR: 43S: (2-)24-37 |
| 016-044-00-9 | disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate | 401-320-7 | — | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 016-045-00-4 | lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate | 401-560-2 | 108624-00-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 016-046-00-X | sodium hydrogensulphate | 231-665-7 | 7681-38-1 | Xi; R41 | XiR: 41S: (2-)24-26 |
| 016-047-00-5 | hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate | 401-650-1 | 85665-96-9 | R43 | XiR: 43S: (2-)22-24-37 |
| 016-048-00-0 | sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate | 401-870-8 | — | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-61 |
| 016-049-00-6 | calcium octadecylxylenesulphonate | 402-040-8 | — | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 016-050-00-1 | potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat | 402-150-6 | — | Xi; R36R43 | XiR: 36-43S: (2-)22-24-26-37 |
| 016-051-00-7 | trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate | 402-170-5 | 106359-91-5 | R43 | XiR: 43S: (2-)22-24-37 |
| 016-052-00-2 | benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate | 402-240-5 | 102561-46-6 | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)22-61 |
| 016-053-00-8 | (C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate | 402-460-1 | — | Xi; R38R43R53 | XiR: 38-43-53S: (2-)24-37-61 |
| 016-054-00-3 | sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate | 400-030-8 | — | T; R23-48/23Xn; R22Xi; R36/37R43 | TR: 22-23-36/37-43-48/23S: (1/2-)22-24-36-45 |
| 016-055-00-9 | tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) | 400-510-7 | — | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 016-056-00-4 | potassium hydrogensulphate | 231-594-1 | 7646-93-7 | C; R34Xi; R37 | CR: 34-37S: (1/2-)26-36/37/39-45 |
| 016-057-00-X | styrene-4-sulfonyl chloride | 404-770-2 | 2633-67-2 | Xi; R38-41R43 | XiR: 38-41-43S: (2-)24-26-37/39 |
| 016-058-00-5 | thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol and C12-14—tert-alkylamine | 404-820-3 | — | Xi; R38R43R52-53 | XiR: 38-43-52/53S: (2-)36/37-61 |
| 016-059-00-0 | N,N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride | 405-300-9 | 17339-60-5 | Xn; R22Xi; R36R43N; R50-53 | Xn; NR: 22-36-43-50/53S: (2-)26-36/37-60-61 |
| 016-060-00-6 | diammonium peroxodisulphate;ammonium persulphate | 231-786-5 | 7727-54-0 | O; R8Xn; R22Xi; R36/37/38R42/43 | O; XnR: 8-22-36/37/38-42/43S: (2-)22-24-26-37 |
| 016-061-00-1 | dipotassium peroxodisulphate;potassium persulphate | 231-781-8 | 7727-21-1 | O; R8Xn; R22Xi; R36/37/38R42/43 | O; XnR: 8-22-36/37/38-42/43S: (2-)22-24-26-37 |
| 016-062-00-7 | bensultap (ISO);1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane | — | 17606-31-4 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 016-063-00-2 | sodium metabisulphite | 231-673-0 | 7681-57-4 | Xn; R22Xi; R41R31 | XnR: 22-31-41S: (2-)26-39-46 |
| 016-064-00-8 | sodium hydrogensulphite . . . %;sodium bisulphite . . . % | 231-548-0 | 7631-90-5 | Xn; R22R31 | XnR: 22-31S: (2-)25-46 | B |
| 016-065-00-3 | sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate | 400-100-8 | 84057-97-6 | N; R51-53 | NR: 51/53S: 61 |
| 016-066-00-9 | tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2- sulfonatobenzylidenehydrazino)benzoate]copper(II) | 404-070-7 | 116912-62-0 | R52-53 | R: 52/53S: 61 |
| 016-067-00-4 | (4-methylphenyl)mesitylene sulfonate | 407-530-5 | 67811-06-7 | R53 | R: 53S: 61 |
| 016-068-00-X | sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate | 407-720-8 | 155160-86-4 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 016-069-00-5 | 3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid | 407-990-7 | 141915-64-2 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 016-070-00-0 | 4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone | 408-220-2 | — | R53 | R: 53S: 61 |
| 016-071-00-6 | trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate | 410-130-3 | 136248-03-8 | R43 | XiR: - 43S: (2-)22-24-37 |
| 016-072-00-1 | 3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide | 411-520-6 | 112195-27-4 | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 |
| 016-073-00-7 | tetrakis(phenylmethyl)thioperoxydi(carbothioamide) | 404-310-0 | 10591-85-2 | R53 | R: 53S: 61 |
| 016-074-00-2 | 6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene | 405-410-7 | — | Xi; R38-41R43N; R51-53 | Xi; NR: 38-41-43-51/53S: (2-)26-36/37/39-61 |
| 016-075-00-8 | 2,2'-diallyl-4,4'-sulfonyldiphenol | 411-570-9 | 41481-66-7 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 016-076-00-3 | 2,3-bis((2-mercaptoethyl)thio)-1-propanethiol | 411-290-7 | 131538-00-6 | Xn; R22-48/22N; R50-53 | Xn; NR: 22-48/22-50/53S: (2-)23-24/25-36-60-61 |
| 016-077-00-9 | 2-chloro-p-toluenesulfochloride | 412-890-1 | 42413-03-6 | C; R34R43R52-53 | CR: 34-43-52/53S: (1/2-)23-26-36/37/39-45-61 |
| 016-078-00-4 | 4-methyl-N,N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide | 413-300-5 | 56187-04-3 | R53 | R: 53S: 61 |
| 016-079-00-X | N,N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide | 412-920-3 | 16695-22-0 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 016-080-00-5 | sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate | 412-320-1 | 31361-99-6 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 016-081-00-0 | hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide | 418-350-1 | — | Muta. Cat. 3; R68Xn; R22Xi; R36R43N; R51-53 | Xn; NR: 22-36-43-68-51/53S: (2-)26-36/37-61 |
| 016-082-00-6 | ethoxysulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea | — | 126801-58-9 | N; R50-53 | NR: 50/53S: 60-61 |
| 016-083-00-1 | acibenzolar-S-methyl;benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester | 420-050-0 | 135158-54-2 | Xi; R36/37/38R43N; R50-53 | Xi; NR: 36/37/38-43-50/53S: (2-)24/25-37-46-59-60-61 |
| 016-084-00-7 | prosulfuron;1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea | — | 94125-34-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 016-085-00-2 | flazasulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea | — | 104040-78-0 | N; R50-53 | NR: 50/53S: 60-61 |
| 016-086-00-8 | tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | 402-590-9 | 109125-56-6 | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 016-087-00-3 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate;diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate;propylene carbonate | 403-490-8 | 104558-95-4 | Xi; R36R43N; R50-53 | Xi; NR: 36-43-50/53S: (2-)24-26-37-60-61 |
| 016-088-00-9 | 4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid | 407-280-7 | 71297-11-5 | R52-53 | R: 52/53S: 61 |
| 016-089-00-4 | reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene | 413-840-1 | — | E; R2F; R11R53 | ER: 2-11-53S: (2-)33-35-40-61 |
| 016-090-00-X | 4-methyl-N-(methylsulfonyl)benzenesulfonamide | 415-040-8 | 14653-91-9 | Xn; R22Xi; R37-41 | XnR: 22-37-41S: (2-)26-39 |
| 016-091-00-5 | C12-14—tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate | 414-110-5 | — | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 016-093-00-6 | reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate);4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) | 414-770-4 | 140698-96-0 | F; R11Carc. Cat. 3; R40 | F; XnR: 11-40S: (2-)7-36/37 |
| 016-095-00-7 | reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2);Reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) | 417-980-4 | — | F; R11Carc. Cat. 3; R40 | F; XnR: 11-40S: (2-)7-36/37 |
| 016-096-00-2 | thifensulfuron-methyl (ISO);methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate | — | 79277-27-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 017-001-00-7 | chlorine | 231-959-5 | 7782-50-5 | T; R23Xi; R36/37/38N; R50 | T; NR: 23-36/37/38-50S: (1/2-)9-45-61 |
| 017-002-00-2 | hydrogen chloride | 231-595-7 | 7647-01-0 | T; R23C; R35 | T; CR: 23-35S: (1/2-)9-26-36/37/39-45 | 5 |
| 017-002-01-X | hydrochloric acid ... % | 231-595-7 | — | C; R34Xi; R37 | CR: 34-37S: (1/2-)26-45 | C; R34-37: C ≥ 25 %Xi; R36/37/38: 10 % ≤ C < 25 % | B |
| 017-003-00-8 | barium chlorate | 236-760-7 | 13477-00-4 | O; R9Xn; R20/22N; R51-53 | O; Xn; NR: 9-20/22-51/53S: (2-)13-27-61 |
| 017-004-00-3 | potassium chlorate | 223-289-7 | 3811-04-9 | O; R9Xn; R20/22N; R51-53 | O; Xn; NR: 9-20/22-51/53S: (2-)13-16-27-61 |
| 017-005-00-9 | sodium chlorate | 231-887-4 | 7775-09-9 | O; R9Xn; R22N; R51-53 | O; Xn; NR: 9-22-51/53S: (2-)13-17-46-61 |
| 017-006-00-4 | perchloric acid ... % | 231-512-4 | 7601-90-3 | R5O; R8C; R35 | O; CR: 5-8-35S: (1/2-)23-26-36-45 | C; R35: C ≥ 50 %C; R34: 10 % ≤ C < 50 %Xi; R36/38: 1 % ≤ C < 10 %FootnoteO; R5-8: C > 50 % | B |
| 017-007-00-X | barium perchlorate | 236-710-4 | 13465-95-7 | O; R9Xn; R20/22 | O; XnR: 9-20/22S: (2-)27 |
| 017-008-00-5 | potassium perchlorate | 231-912-9 | 7778-74-7 | O; R9Xn; R22 | O; XnR: 9-22S: (2-)13-22-27 |
| 017-009-00-0 | ammonium perchlorate | 232-235-1 | 7790-98-9 | O; R9R44 ⊗ | OR: 9-44S: (2-)14-16-27-36/37 | G |
| 017-010-00-6 | sodium perchlorate | 231-511-9 | 7601-89-0 | O; R9Xn; R22 | O; XnR: 9-22S: (2-)13-22-27 |
| 017-011-00-1 | sodium hypochlorite, solution ... % Cl active | 231-668-3 | 7681-52-9 | C; R34R31N; R50 | C; NR: 31-34-50S: (1/2-)28-45-50-61 | R31: C ≥ 5 % | B |
| 017-012-00-7 | calcium hypochlorite | 231-908-7 | 7778-54-3 | O; R8 ⊗Xn; R22R31C; R34N; R50 | O; C; NR: 8-22-31-34-50S: (1/2-)26-36/37/39-45-61 | C; R34: C ≥ 10 %Xi; R37/38-41: 3 % ≤ C < 10 %Xi; R36: 0,5 % ≤ C < 3 % |
| 017-013-00-2 | calcium chloride | 233-140-8 | 10043-52-4 | Xi; R36 | XiR: 36S: (2-)22-24 |
| 017-014-00-8 | ammonium chloride | 235-186-4 | 12125-02-9 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)22 |
| 017-015-00-3 | (2-(aminomethyl)phenyl)acetylchloride hydrochloride | 417-410-4 | 61807-67-8 | Xn; R22C; R35R43 | CR: 22-35-43S: (1/2-)26-36/37/39-45 |
| 017-016-00-9 | methyltriphenylphosphonium chloride | 418-400-2 | 1031-15-8 | Xn; R21/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-51/53S: (2-)22-26-36/37/39-61 |
| 017-017-00-4 | (Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride | 426-210-6 | 120086-58-0 | C; R34N; R50-53 | C; NR: 34-50/53S: (2-)26-36/37/39-45-60-61 |
| 017-018-00-X | N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride | 405-660-7 | — | N; R51-53 | NR: 51/53S: 61 |
| 017-019-00-5 | (R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride | 415-110-8 | 54417-53-7 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 017-020-00-0 | ethyl propoxy aluminium chloride | 421-790-7 | 13014-29-4 | F; R15R 14C; R35 | F; CR: 14/15-35S: (1/2-)16-23-26-30-36/37/39-43-45 |
| 017-021-00-6 | behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride | 423-420-1 | 136920-10-0 | Xi; R41R43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)26-36/37/39-60-61 |
| 019-001-00-2 | potassium | 231-119-8 | 7440-09-7 | F; R15R14C; R34 | F; CR: 14/15-34S: (1/2-)5-8-45 |
| 019-002-00-8 | potassium hydroxide;caustic potash | 215-181-3 | 1310-58-3 | Xn; R22C; R35 | CR: 22-35S: (1/2-)26-36/37/39-45 | C; R35: C ≥ 5 %C; R34: 2 % ≤ C < 5 %Xi; R36/38: 0.5 % ≤ C < 2 % |
| 020-001-00-X | calcium | 231-179-5 | 7440-70-2 | F; R15 | FR: 15S: (2-)8-24/25-43 |
| 020-002-00-5 | calcium cyanide | 209-740-0 | 592-01-8 | T+; R28R32N; R50-53 | T+; NR: 28-32-50/53S: (1/2-)7/8-23-36/37-45-60-61 |
| 020-003-00-0 | reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide;tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide;poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydroxide] | 420-470-4 | — | Xi; R36/38R43 | XiR: 36/38-43S: (2-)24-26-37 |
| 022-001-00-5 | titanium tetrachloride | 231-441-9 | 7550-45-0 | R14C; R34 | CR: 14-34S: (1/2-)7/8-26-36/37/39-45 |
| 022-002-00-0 | titanium(4+) oxalate | 403-260-7 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 022-003-00-6 | bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium | 412-000-1 | 125051-32-3 | F; R11Repr. Cat. 3; R62Xn; R48/22N; R51-53 | F; Xn; NR: 11-48/22-62-51/53S: (2-)7-22-33-36/37-61 |
| 023-001-00-8 | divanadium pentaoxide;vanadium pentoxide | 215-239-8 | 1314-62-1 | Muta. Cat. 3; R68Repr. Cat. 3; R63T; R48/23Xn; R20/22Xi; R37N; R51-53 | T; NR: 20/22-37-48/23-51/53-63-68S: (1/2-)36/37-38-45-61 |
| 024-001-00-0 | chromium (VI) trioxide | 215-607-8 | 1333-82-0 | O; R9Carc. Cat. 1; R45Muta. Cat. 2; R46Repr. Cat. 3; R62T+; R26T; R24/25-48/23C; R35R42/43N; R50-53 | O; T+; NR: 45-46-9-24/25-26-35-42/43-48/23-62-50/53S: 53-45-60-61 | C: R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % | E |
| 024-002-00-6 | potassium dichromate | 231-906-6 | 7778-50-9 | O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; R50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C; R34: C ≥ 10 %:Xi; R36/37/38: 5 % ≤ C < 10 % | E3 |
| 024-003-00-1 | ammonium dichromate | 232-143-1 | 7789-09-5 | E; R2O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; R50-53 | E; T+; NR: 45-46-60-61-2-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 %R42/43: C ≥ 0,2 % | E3 |
| 024-004-00-7 | sodium dichromate anhydrate | 234-190-3 | 10588-01-9 | O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; 50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 %R42/43: C ≥ 0,2 % | E3 |
| 024-004-01-4 | sodium dichromate, dihydrate | 234-190-3 | 7789-12-0 | O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; R50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 %R42/43: C ≥ 0,2 % | E3 |
| 024-005-00-2 | chromyl dichloride;chromic oxychloride | 239-056-8 | 14977-61-8 | O; R8Carc. Cat. 2; R49Muta. Cat. 2; R46C; R35R43N; R50-53 | O; T; C; NR: 49-46-8-35-43-50/53S: 53-45-60-61 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 0,5 % ≤ C < 5 %R43: C ≥ 0,5 % | 3 |
| 024-006-00-8 | potassium chromate | 232-140-5 | 7789-00-6 | Carc. Cat. 2; R49Muta. Cat. 2; R46Xi; R36/37/38R43N; R50-53 | T; NR: 49-46-36/37/38-43-50/53S: 53-45-60-61 | R43: C ≥ 0.5 % | 3 |
| 024-007-00-3 | zinc chromates including zinc potassium chromate | — | — | Carc. Cat. 1; R45Xn; R22R43N; R50-53 | T; NR: 45-22-43-50/53S: 53-45-60-61 | AE |
| 024-008-00-9 | calcium chromate | 237-366-8 | 13765-19-0 | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | E |
| 024-009-00-4 | strontium chromate | 232-142-6 | 7789-06-2 | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | E |
| 024-010-00-X | dichromium tris(chromate);chromium III chromate;chromic chromate | 246-356-2 | 24613-89-6 | O; R8Carc. Cat. 2; R45C; R35R43N; R50-53 | O; T; C; NR: 45-8-35-43-50/53S: 53-45-60-61 |
| 024-011-00-5 | ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) | 400-110-2 | 109125-51-1 | F; R11N; R50-53 | F; NR: 11-50/53S: (2-)33-60-61 |
| 024-012-00-0 | trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) | 400-810-8 | — | Muta. Cat. 3; R68 | XnR: 68S: (2-)22-36/37 |
| 024-013-00-6 | trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) | 402-500-8 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 024-014-00-1 | trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) | 402-870-0 | 93952-24-0 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 024-015-00-7 | disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) | 404-930-1 | — | Xn; R20Xi; R41N; R51-53 | Xn; NR: 20-41-51/53S: (2-)26-39-61 |
| 024-016-00-2 | tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) | 405-110-6 | 88377-66-6 | Xn; R48/22R53 | XnR: 48/22-53S: (2-)22-36-61 |
| 024-017-00-8 | Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex | — | — | Carc. Cat. 2; R49R43N; R50-53 | T; NR: 49-43-50/53S: 53-45-60-61 | A |
| 024-018-00-3 | sodium chromate | 231-889-5 | 7775-11-3 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; R50-53 | T+; NR: 45-46-60-61-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | R42/43: C ≥ 0,2 % | E3 |
| 024-019-00-9 | Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}-{6''-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfamoyl)-3''-sulfonatonaphthalene-2''-azobenzene-1'',2'''-diolato}chromate (III);by-product 1: acetoacetic acid anilide/acetoacetic acid anilide (ATAN-ATAN): trisodium bis{6-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfonyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}chromate (III);by-product 2: 3-amino-1-hydroxybenzene/3-amino-1-hydroxybenzene (MAP-MAP): trisodium bis{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato} chromate (III) | 419-230-1 | — | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 024-020-00-4 | trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate(III) | 418-220-4 | — | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 025-001-00-3 | manganese dioxide | 215-202-6 | 1313-13-9 | Xn; R20/22 | XnR: 20/22S: (2-)25 |
| 025-002-00-9 | potassium permanganate | 231-760-3 | 7722-64-7 | O; R8Xn; R22N; R50-53 | O; Xn; NR: 8-22-50/53S: (2-)60-61 |
| 025-003-00-4 | manganese sulphate | 232-089-9 | 7785-87-7 | Xn; R48/20/22N; R51-53 | Xn; NR: 48/20/22-51/53S: (2-)22-61 |
| 025-004-00-X | bis(N,N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate | 411-760-1 | 116633-53-5 | N; R51-53 | NR: 51/53S: 61 |
| 025-005-00-5 | reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-);tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-);pentasodium [29H,31H-phthalocyanine-C,C,C,C,C-pentasulfonato (6-)-N29,N30,N31,N32] manganate (3-) | 417-660-4 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 026-001-00-6 | (η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate | 407-840-0 | 100011-37-8 | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)22-26-39-61 |
| 026-002-00-1 | (η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate | 407-880-9 | 117549-13-0 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)26-61 |
| 027-001-00-9 | cobalt | 231-158-0 | 7440-48-4 | R42/43R53 | XnR: 42/43-53S: (2-)22-24-37-61 |
| 027-002-00-4 | cobalt oxide | 215-154-6 | 1307-96-6 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 027-003-00-X | cobalt sulphide | 215-273-3 | 1317-42-6 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 027-004-00-5 | cobalt dichloride | 231-589-4 | 7646-79-9 | Carc. Cat. 2; R49Xn; R22R42/43N; R50-53 | T; NR: 49-22-42/43-50/53S: (2-)22-53-45-60-61 | Carc. Cat. 2; R49: C ≥ 0,01 %Xn; R22: C ≥ 2,5 % | E1 |
| 027-005-00-0 | cobalt sulphate | 233-334-2 | 10124-43-3 | Carc. Cat. 2; R49Xn; R22R42/43N; R50-53 | T; NR: 49-22-42/43-50/53S: (2-)22-53-45-60-61 | Carc. Cat. 2; R49: C ≥ 0,01 % | E1 |
| 028-001-00-1 | tetracarbonylnickel;nickel tetracarbonyl | 236-669-2 | 13463-39-3 | F; R11Carc. Cat. 3; R40Repr. Cat. 2; R61T+; R26N; R50-53 | F; T+; NR: 61-11-26-40-50/53S: 53-45-60-61 | E |
| 028-002-00-7 | nickel | 231-111-4 | 7440-02-0 | Carc. Cat. 3; R40R43 | XnR: 40-43S: (2-)22-36 |
| 028-003-00-2 | nickel monoxide | 215-215-7 | 1313-99-1 | Carc. Cat. 1; R49R43R53 | TR: 49-43-53S: 53-45-61 |
| 028-004-00-8 | nickel dioxide | 234-823-3 | 12035-36-8 | Carc. Cat. 1; R49R43R53 | TR: 49-43-53S: 53-45-61 |
| 028-005-00-3 | dinickel trioxide | 215-217-8 | 1314-06-3 | Carc. Cat. 1; R49R43R53 | TR: 49-43-53S: 53-45-61 |
| 028-006-00-9 | nickel sulphide | 240-841-2 | 16812-54-7 | Carc. Cat. 1; R49R43N; R50-53 | T; NR: 49-43-50/53S: 53-45-60-61 |
| 028-007-00-4 | nickel subsulphide;trinickel disulphide | 234-829-6 | 12035-72-2 | Carc. Cat. 1; R49R43N; R51-53 | T; NR: 49-43-51/53S: 53-45-61 |
| 028-008-00-X | nickel dihydroxide | 235-008-5 | 12054-48-7 | Carc. Cat. 3; R40Xn; R20/22R43N; R50-53 | Xn; NR: 20/22-40-43-50/53S: (2-)22-36-60-61 |
| 028-009-00-5 | nickel sulphate | 232-104-9 | 7786-81-4 | Carc. Cat. 3; R40Xn; R22R42/43N; R50-53 | Xn; NR: 22-40-42/43-50/53S: (2-)22-36/37-60-61 |
| 028-010-00-0 | nickel carbonate | 222-068-2 | 3333-67-3 | Carc. Cat. 3; R40Xn; R22R43N; R50-53 | Xn; NR: 22-40-43-50/53S: (2-)22-36/37-60-61 |
| 029-001-00-4 | copper chloride;copper (I) chloride;cuprous chloride | 231-842-9 | 7758-89-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 |
| 029-002-00-X | dicopper oxide;copper (I) oxide | 215-270-7 | 1317-39-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 |
| 029-003-00-5 | Naphthenic acids, copper salts;copper naphthenate | 215-657-0 | 1338-02-9 | R10Xn; R22N; R50-53 | Xn; NR: 10-22-50/53S: (2-)60-61 |
| 029-004-00-0 | copper sulphate | 231-847-6 | 7758-98-7 | Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-50/53S: (2-)22-60-61 |
| 029-005-00-6 | (tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid | 401-260-1 | — | Xi; R36 | XiR: 36S: (2-)26 |
| 029-006-00-1 | tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) | 403-210-4 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)22-26-39-61 |
| 029-007-00-7 | (trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide | 404-670-9 | 89797-01-3 | E; R2R43 | E; XiR: 2-43S: (2-)22-24-35-37 |
| 029-008-00-2 | copper(II) methanesulfonate | 405-400-2 | 54253-62-2 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)26-36/37/39-60-61 |
| 029-009-00-8 | phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex | 413-650-9 | 93971-95-0 | R52-53 | R: 52/53S: 61 |
| 029-010-00-3 | reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II) to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) | 407-700-9 | 101408-30-4 | R43 | XiR: 43S: (2-)24-37 |
| 029-011-00-9 | sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex | 412-730-0 | 150522-10-4 | C; R34 | CR: 34S: (1/2-)22-26-36/37/39-45 |
| 029-012-00-4 | sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) | 407-340-2 | 124719-24-0 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 029-013-00-X | trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) | 407-580-8 | 130201-51-3 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)24-37-61 |
| 030-001-00-1 | zinc powder — zinc dust (pyrophoric) | 231-175-3 | 7440-66-6 | F; R15-17N; R50-53 | F; NR: 15-17-50/53S: (2-)43-46-60-61 |
| 030-001-01-9 | zinc powder — zinc dust (stabilised) | 231-175-3 | 7440-66-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 030-003-00-2 | zinc chloride | 231-592-0 | 7646-85-7 | C; R34Xn; R22N; R50-53 | C; NR: 22-34-50/53S: (1/2-)26-36/37/39-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 030-004-00-8 | dimethylzinc; [1]diethylzinc [2] | 208-884-1 [1]209-161-3 [2] | 544-97-8 [1]557-20-0 [2] | F; R17R14C; R34N; R50-53 | F; C; NR: 14-17-34-50/53S: (1/2-)16-43-45-60-61 |
| 030-005-00-3 | diamminediisocyanatozinc | 401-610-3 | — | Xn; R22Xi; R41R42/43N; R50 | Xn; NR: 22-41-42/43-50S: (2-)22-26-36/37/39-41-61 |
| 030-006-00-9 | zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate); [1]zinc sulphate (anhydrous) [2] | 231-793-3 [1]231-793-3 [2] | 7446-19-7 [1]7733-02-0 [2] | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-46-60-61 |
| 030-007-00-4 | bis(3,5-di-tert-butylsalicylato-O1,O2)zinc | 403-360-0 | 42405-40-3 | F; R11Xn; R22N; R50-53 | F; Xn; NR: 11-22-50/53S: (2-)7-22-60-61 |
| 030-008-00-X | hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) | 403-750-0 | 113036-91-2 | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)22-57-61 |
| 030-011-00-6 | trizinc bis(orthophosphate) | 231-944-3 | 7779-90-0 | N; R50-53 | NR: 50/53S: 60-61 |
| 030-013-00-7 | zinc oxide | 215-222-5 | 1314-13-2 | N; R50-53 | NR: 50/53S: 60-61 |
| 033-001-00-X | arsenic | 231-148-6 | 7440-38-2 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)20/21-28-45-60-61 |
| 033-002-00-5 | arsenic compounds, with the exception of those specified elsewhere in this Annex | — | — | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)20/21-28-45-60-61 | T; R23/25: C ≥ 0,2 %Xn; R20/22: 0,1 % ≤ C < 0,2 % | A1 |
| 033-003-00-0 | diarsenic trioxide;arsenic trioxide | 215-481-4 | 1327-53-3 | Carc. Cat. 1; R45T+; R28C; R34N; R50-53 | T+; NR: 45-28-34-50/53S: 53-45-60-61 | E |
| 033-004-00-6 | diarsenic pentaoxide;arsenic pentoxide;arsenic oxide | 215-116-9 | 1303-28-2 | Carc. Cat. 1; R45T; R23/25N; R50-53 | T; NR: 45-23/25-50/53S: 53-45-60-61 | E |
| 033-005-00-1 | arsenic acid and its salts | — | — | Carc. Cat. 1; R45T; R23/25N; R50-53 | T; NR: 45-23/25-50/53S: 53-45-60-61 | AE |
| 033-006-00-7 | arsine | 232-066-3 | 7784-42-1 | F+; R12T+; R26Xn; R48/20N; R50-53 | F+; T+; NR: 12-26-48/20-50/53S: (1/2-)9-16-28-33-36/37-45-60-61 |
| 033-007-00-2 | tert-butylarsine | 423-320-6 | 4262-43-5 | F; R17T+; R26 | F; T+R: 17-26S: (1/2-)9-28-36/37-43-45 |
| 034-001-00-2 | selenium | 231-957-4 | 7782-49-2 | T; R23/25R33R53 | TR: 23/25-33-53S: (1/2-)20/21-28-45-61 |
| 034-002-00-8 | selenium compounds except cadmium sulphoselenide | — | — | T; R23/25R33N; R50-53 | T; NR: 23/25-33-50/53S: (1/2-)20/21-28-45-60-61 | A |
| 034-003-00-3 | sodium selenite | 233-267-9 | 10102-18-8 | T+; R28T; R23R31R43N; R51-53 | T+; NR: 23-28-31-43-51/53S: (1/2-)28-36/37-45-61 |
| 035-001-00-5 | bromine | 231-778-1 | 7726-95-6 | T+; R26C; R35N; R50 | T+; C; NR: 26-35-50S: (1/2-)7/9-26-45-61 |
| 035-002-00-0 | hydrogen bromide | 233-113-0 | 10035-10-6 | C; R35Xi; R37 | CR: 35-37S: (1/2-)7/9-26-45 |
| 035-002-01-8 | hydrobromic acid ... % | — | — | C; R34Xi; R37 | CR: 34-37S: (1/2-)7/9-26-45 | C; R34: C ≥ 40 %Xi; R36/38: 10 % ≤ C < 40 %Xi; R37: C ≥ 10 % | B |
| 035-003-00-6 | potassium bromate | 231-829-8 | 7758-01-2 | O; R9Carc. Cat. 2; R45T; R25 | T; OR: 45-9-25S: 53-45 | E |
| 035-004-00-1 | 2-hydroxyethylammonium perbromide | 407-440-6 | — | O; R8Xn; R22C; R35R43N; R50 | O; C; NR: 8-22-35-43-50S: (1/2-)3/7-14-26-36/37/39-45-60-61 |
| 040-001-00-3 | zirconium powder (pyrophoric) | 231-176-9 | 7440-67-7 | F; R15-17 | FR: 15-17S: (2-)7/8-43 |
| 040-002-00-9 | zirconium powder (non pyrophoric) | — | — | F; R15 | FR: 15S: (2-)7/8-43 |
| 042-001-00-9 | molybdenum trioxide | 215-204-7 | 1313-27-5 | Xn; R48/20/22Xi; R36/37 | XnR: 36/37-48/20/22S: (2-)22-25 |
| 042-002-00-4 | tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) | 404-760-8 | 117342-25-3 | T; R23Xi; R41R53 | TR: 23-41-53S: (1/2-)26-37/39-45-61 |
| 042-003-00-X | tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) | 404-860-1 | 116810-46-9 | F; R11Xi; R41N; R50-53 | F; Xi; NR: 11-41-50/53S: (2-)26-39-60-61 |
| 042-004-00-5 | Reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) | 412-780-3 | — | Xi; R38R43N; R51-53 | Xi; NR: 38-43-51/53S: 24/25-37-61 |
| 047-001-00-2 | silver nitrate | 231-853-9 | 7761-88-8 | ⊗ C; R34N; R50-53 | C; NR: 34-50/53S: (1/2-)26-45-60-61 |
| 048-001-00-5 | cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex | — | — | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)60-61 | Xn; R20/21/22: C ≥ 0,1 % | A1 |
| 048-002-00-0 | cadmium (non-pyrophoric); [1]cadmium oxide (non-pyrophoric) [2] | 231-152-8 [1]215-146-2 [2] | 7440-43-9 [1]1306-19-0 [2] | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62-63T+; R26T; R48/23/25N; R50-53 | T+; NR: 45-26-48/23/25-62-63-68-50/53S: 53-45-60-61 | E |
| 048-003-00-6 | cadmium diformate;cadmiumformate | 224-729-0 | 4464-23-7 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | T; R23/25: C ≥ 10 %Xn; R20/22: 0,25 % ≤ C < 10 %R33: C ≥ 0,25 % |
| 048-004-00-1 | cadmium cyanide | 208-829-1 | 542-83-6 | T+; R26/27/28R32R33Xn; R68N; R50-53 | T+; NR: 26/27/28-32-33-68-50/53S: (1/2-)7-28-29-45-60-61 | R32: C ≥ 1 %R33: C ≥ 0,1 % |
| 048-005-00-7 | cadmiumhexafluorosilicate(2-);cadmium fluorosilica | 241-084-0 | 17010-21-8 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | T; R23/25: C ≥ 10 %Xn; R20/22: 0,1 % ≤ C < 10 %R33: C ≥ 0.1 % |
| 048-006-00-2 | cadmium fluoride | 232-222-0 | 7790-79-6 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23/25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 %T; R25: C ≥ 10 %Xn; R22: 0,1 % ≤ C < 10 %T; R48/23/25: C ≥ 7 %Xn; R48/20/22: 0,1 % ≤ C < 7 % | E |
| 048-007-00-8 | cadmium iodide | 232-223-6 | 7790-80-9 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | T; R23/25: C ≥ 10 %Xn; R20/22: 0.1 % ≤ C < 10 %R33: C ≥ 0.1 % |
| 048-008-00-3 | cadmium chloride | 233-296-7 | 10108-64-2 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23/25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 %T; R25: C ≥ 10 %Xn; R22: 0,1 % ≤ C < 10 %T; R48/23/25: C ≥ 7 %Xn; R48/20/22: 0,1 % ≤ C < 7 % | E |
| 048-009-00-9 | cadmium sulphate | 233-331-6 | 10124-36-4 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23/25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 %T; R25: C ≥ 10 %Xn; R22: 0,1 % ≤ C < 10 %T; R48/23/25: C ≥ 7 %Xn; R48/20/22: 0,1 % ≤ C < 7 % | E |
| 048-010-00-4 | cadmium sulphide | 215-147-8 | 1306-23-6 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62-63T; R48/23/25Xn; R22R53 | T;R: 45-22-48/23/25-62-63-68-53S: 53-45-61 | Xn; R22: C ≥ 10 %T; R48/23/25: C ≥ 10 %Xn; R48/20/22: 0,1 % ≤ C < 10 % | E1 |
| 048-011-00-X | cadmium (pyrophoric) | 231-152-8 | 7440-43-9 | F; R17Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62-63T+; R26T; R48/23/25N; R50-53 | F; T+; NR: 45-17-26-48/23/25-62-63-68-50/53S: 53-45-7/8-43-60-61 | E |
| 050-001-00-5 | tin tetrachloride;stannic chloride | 231-588-9 | 7646-78-8 | C; R34R52-53 | CR: 34-52/53S: (1/2-)7/8-26-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 050-002-00-0 | cyhexatin (ISO);hydroxytricyclohexylstannane;tri(cyclohexyl)tin hydroxide | 236-049-1 | 13121-70-5 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 |
| 050-003-00-6 | fentin acetate (ISO);triphenyltin acetate | 212-984-0 | 900-95-8 | Carc. Cat. 3; R40Repr. Cat. 3; R63T+; R26T; R24/25-48/23Xi; R37/38-41N; R50-53 | T+; NR: 24/25-26-37/38-40-41-48/23-50/53-63S: (1/2-)26-28-36/37/39-45-60-61 |
| 050-004-00-1 | fentin hydroxide (ISO);triphenyltin hydroxide | 200-990-6 | 76-87-9 | Carc. Cat. 3; R40Repr. Cat. 3; R63T+; R26T; R24/25-48/23Xi; R37/38-41N; R50-53 | T+; NR: 24/25-26-37/38-40-41-48/23-50/53-63S: (1/2-)26-28-36/37/39-45-60-61 |
| 050-005-00-7 | trimethyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)26-27-28-45-60-61 | T+; R26/27/28: C ≥ 0,5 %T; R23/24/25: 0,1 % ≤ C < 0,5 %Xn; R20/21/22: 0,05 % ≤ C < 0,1 % | A1 |
| 050-006-00-2 | triethyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)26-27-28-45-60-61 | T+; R26/27/28: C ≥ 0,5 %T; R23/24/25: 0,1 % ≤ C < 0,5 %Xn; R20/21/22: 0,05 % ≤ C < 0,1 % | A1 |
| 050-007-00-8 | tripropyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)26-27-28-45-60-61 | T; R23/24/25: C ≥ 0,5 %Xn; R20/21/22: 0,1 % ≤ C < 0,5 % | A1 |
| 050-008-00-3 | tributyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | T; R25-48/23/25Xn; R21Xi; R36/38N; R50-53 | T; NR: 21-25-36/38-48/23/25-50/53S: (1/2-)35-36/37/39-45-60-61 | T; R25: C ≥ 1 %Xn; R22: 0,25 % ≤ C < 1 %T; R48/23/25: C ≥ 1 %Xn; R48/20/22: 0,25 % ≤ C < 1 %Xn; R21: C ≥ 1 %Xi; R36/38: C ≥ 1 % | A1 |
| 050-009-00-9 | fluorotripentylstannane; [1]hexapentyldistannoxane [2] | 243-546-7 [1]247-143-7 [2] | 20153-49-5 [1]25637-27-8 [2] | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | Xn; R20/21/22: C ≥ 1 % | 1 |
| 050-010-00-4 | fluorotrihexylstannane | 243-547-2 | 20153-50-8 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | Xn; R20/21/22: C ≥ 1 % | 1 |
| 050-011-00-X | triphenyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)26-27-28-45-60-61 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,25 % ≤ C < 1 % | A1 |
| 050-012-00-5 | tetracyclohexylstannane; [1]chlorotricyclohexylstannane; [2]butyltricyclohexylstannane [3] | 215-910-5 [1]221-437-5 [2]230-358-5 [3] | 1449-55-4 [1]3091-32-5 [2]7067-44-9 [3] | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | Xn; R20/21/22: C ≥ 1 % | A1 |
| 050-013-00-0 | trioctyltin compounds, with the exception of those specified elsewhere in this Annex | — | — | Xi; R36/37/38R53 | XiR: 36/37/38-53S: (2-)61 | Xi; R36/37/38: C ≥ 1 % | A1 |
| 050-017-00-2 | fenbutatin oxide (ISO);bis(tris(2-methyl-2-phenylpropyl)tin)oxide | 236-407-7 | 13356-08-6 | T+; R26Xi; R36/38N; R50-53 | T+; NR: 26-36/38-50/53S: (1/2-)28-36/37-45-60-61 |
| 050-018-00-8 | tin(II) methanesulphonate | 401-640-7 | 53408-94-9 | C; R34Xn; R22R43 | CR: 22-34-43S: (1/2-)22-26-36/37/39-45 |
| 050-019-00-3 | azocyclotin (ISO);1-(tricyclohexylstannyl)-1H-1,2,4-triazole; | 255-209-1 | 41083-11-8 | T+; R26T; R25Xi; R37/38-41N; R50-53 | T+; NR: 25-26-37/38-41-50/53S: (1/2-)26-28-36/37/39-38-45-60-61 |
| 050-020-00-9 | trioctylstannane | 413-320-4 | 869-59-0 | T; R48/25Xi; R38R53 | TR: 38-48/25-53S: (1/2-)23-36/37-45-61 |
| 051-001-00-8 | antimony trichloride | 233-047-2 | 10025-91-9 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 051-002-00-3 | antimony pentachloride | 231-601-8 | 7647-18-9 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-45-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 051-003-00-9 | antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex | — | — | Xn; R20/22N; R51-53 | Xn; NR: 20/22-51/53S: (2-)61 | Xn; R20/22: C ≥ 0,25 % | A1 |
| 051-004-00-4 | antimony trifluoride | 232-009-2 | 7783-56-4 | T; R23/24/25N; R51-53 | T; NR: 23/24/25-51/53S: (1/2-)7-26-45-61 |
| 051-005-00-X | antimony trioxide | 215-175-0 | 1309-64-4 | Carc. Cat. 3; R40 | XnR: 40S: (2-)22-36/37 |
| 051-006-00-5 | diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate | 403-500-0 | — | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 051-007-00-0 | bis(4-dodecylphenyl)iodonium hexafluoroantimonate | 404-420-9 | 71786-70-4 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 053-001-00-3 | iodine | 231-442-4 | 7553-56-2 | Xn; R20/21N; R50 | Xn; NR: 20/21-50S: (2-)23-25-61 |
| 053-002-00-9 | hydrogen iodide | 233-109-9 | 10034-85-2 | C; R35 | CR: 35S: (1/2-)9-26-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 0,2 % ≤ C < 10 %Xi; R36/37/38: 0,02 % ≤ C < 0,2 % | 5 |
| 053-002-01-6 | hydriodic acid ... % | — | — | C; R34 | CR: 34S: (1/2-)26-45 | C; R34: C ≥ 25 %Xi; R36/38: 10 % ≤ C < 25 % | B |
| 053-003-00-4 | iodoxybenzene | — | 696-33-3 | E; R1 ⊗ | ER: 1S: (2-)35 |
| 053-004-00-X | calcium iodoxybenzoate | — | — | E; R1 ⊗ | ER: 1S: (2-)35 | C |
| 053-005-00-5 | (4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate (1-) | 422-960-3 | 178233-72-2 | Xn; R21/22-48/22N; R50-53 | Xn; NR: 21/22-48/22-50/53S: (2-)22-36/37-60-61 |
| 056-001-00-1 | barium peroxide | 215-128-4 | 1304-29-6 | O; R8Xn; R20/22 | O; XnR: 8-20/22S: (2-)13-27 |
| 056-002-00-7 | barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex | — | — | Xn; R20/22 | XnR: 20/22S: (2-)28 | Xn; R20/22: C ≥ 1 % | A1 |
| 056-003-00-2 | barium carbonate | 208-167-3 | 513-77-9 | Xn; R22 | XnR: 22S: (2-)24/25 |
| 056-004-00-8 | barium chloride | 233-788-1 | 10361-37-2 | T; R25Xn; R20 | TR: 20-25S: (1/2-)45 |
| 072-001-00-4 | hafnium tetra-n-butoxide | 411-740-2 | 22411-22-9 | Xi; R41R43 | XiR: 41-43S: (2-)24/25-26-37/39 |
| 074-001-00-X | hexasodium tungstate hydrate | 412-770-9 | 12141-67-2 | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)22-26-39-61 |
| 074-002-00-5 | Reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione | 408-250-6 | — | F; R11Xn; R20C; R34R43N; R50-53 | F; C; NR: 11-20-34-43-50/53S: (1/2-)16-26-29-33-36/37/39-45-60-61 |
| 076-001-00-5 | osmium tetraoxide;osmic acid | 244-058-7 | 20816-12-0 | T+; R26/27/28C; R34 | T+R: 26/27/28-34S: (1/2-)7/9-26-45 |
| 078-001-00-0 | tetrachloroplatinates with the exception of those specified elsewhere in this Annex | — | — | T; R25Xi; R41R42/43 | TR: 25-41-42/43S: (2-)22-26-36/37/39-45 | A |
| 078-002-00-6 | diammonium tetrachloroplatinate | 237-499-1 | 13820-41-2 | T; R25Xi; R38-41R42/43 | TR: 25-38-41-42/43S: (2-)22-26-36/37/39-45 |
| 078-003-00-1 | disodium tetrachloroplatinate | 233-051-4 | 10026-00-3 | T; R25Xi; R38-41R42/43 | TR: 25-38-41-42/43S: (2-)22-26-36/37/39-45 |
| 078-004-00-7 | dipotassium tetrachloroplatinate | 233-050-9 | 10025-99-7 | T; R25Xi; R38-41R42/43 | TR: 25-38-41-42/43S: (2-)22-26-36/37/39-45 |
| 078-005-00-2 | hexachloroplatinates with the exception of those specified elsewhere in this Annex | — | — | T; R25Xi; R41R42/43 | TR: 25-41-42/43S: (1/2-)22-26-36/37/39-45 | A |
| 078-006-00-8 | disodium hexachloroplatinate | 240-983-5 | 16923-58-3 | T; R25Xi; R41R42/43 | TR: 25-41-42/43S: (1/2-)22-26-36/37/39-45 |
| 078-007-00-3 | dipotassium hexachloroplatinate | 240-979-3 | 16921-30-5 | T; R25Xi; R41R42/43 | TR: 25-41-42/43S: (1/2-)22-26-36/37/39-45 |
| 078-008-00-9 | diammonium hexachloroplatinate | 240-973-0 | 16919-58-7 | T; R25Xi; R41R42/43 | TR: 25-41-42/43S: (1/2-)22-26-36/37/39-45 |
| 078-009-00-4 | hexachloroplatinic acid | 241-010-7 | 16941-12-1 | T; R25C; R34R42/43 | TR: 25-34-42/43S: (1/2-)22-26-36/37/39-45 |
| 080-001-00-0 | mercury | 231-106-7 | 7439-97-6 | T; R23R33N; R50-53 | T; NR: 23-33-50/53S: (1/2-)7-45-60-61 |
| 080-002-00-6 | inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex | — | — | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-45-60-61 | T+; R26/27/28: C ≥ 2 %T; R23/24/25: 0,5 % ≤ C < 2 %Xn; R20/21/22: 0,1 % ≤ C < 0,5 %R33: C ≥ 0,1 % | A1 |
| 080-003-00-1 | dimercury dichloride;mercurous chloride;calomel | 233-307-5 | 10112-91-1 | Xn; R22Xi; R36/37/38N; R50-53 | Xn; NR: 22-36/37/38-50/53S: (2-)13-24/25-46-60-61 |
| 080-004-00-7 | organic compounds of mercury with the exception of those specified elsewhere in this Annex | — | — | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-36-45-60-61 | T+; R26/27/28: C ≥ 2 %T; R23/24/25: 0,5 % ≤ C < 2 %Xn; R20/21/22: 0,05 % ≤ C < 0,5 %R33: C ≥ 0,05 % | A1 |
| 080-005-00-2 | mercury difulminate;mercuric fulminate;fulminate of mercury | 211-057-8 | 628-86-4 | E; R3T; R23/24/25R33N; R50-53 | E; T; NR: 3-23/24/25-33-50/53S: (1/2-)3 — 45-60-61 |
| 080-006-00-8 | dimercury dicyanide oxide;mercuric oxycyanide | 215-629-8 | 1335-31-5 | E; R3 ⊗T; R23/24/25R33N; R50-53 | E; T; NR: 3-23/24/25-33-50/53S: (1/2-)28-35-45-60-61 |
| 080-007-00-3 | dimethylmercury; [1]diethylmercury [2] | 209-805-3 [1]211-000-7 [2] | 593-74-8 [1]627-44-1 [2] | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-36-45-60-61 | T+; R26/27/28: C ≥ 0,5 %T; R23/24/25: 0,1 % ≤ C < 0,5 %Xn; R20/21/22: 0,05 % ≤ C < 0,1 %R33: C ≥ 0,05 % | 1 |
| 080-008-00-9 | phenylmercury nitrate; [1]phenylmercury hydroxide; [2]basic phenylmercury nitrate [3] | 200-242-9 [1]202-866-7 [2]- [3] | 55-68-5 [1]100-57-2 [2]8003-05-2 [3] | T; R25-48/24/25C; R34N; R50-53 | T; NR: 25-34-48/24/25-50/53S: (1/2-)23-24/25-37-45-60-61 |
| 080-009-00-4 | 2-methoxyethylmercury chloride | 204-659-7 | 123-88-6 | T; R25-48/25C; R34N; R50-53 | T; NR: 25-34-48/25-50/53S: (1/2-)36/37/39-45-60-61 |
| 080-010-00-X | mercury dichloride;mercuric chloride | 231-299-8 | 7487-94-7 | T+; R28T; R48/24/25C; R34N; R50-53 | T+; NR: 28-34-48/24/25-50/53S: (1/2-)36/37/39-45-60-61 |
| 080-011-00-5 | phenylmercury acetate | 200-532-5 | 62-38-4 | T; R25-48/24/25C; R34N; R50-53 | T; NR: 25-34-48/24/25-50/53S: (1/2-)23-24/25-37-45-60-61 |
| 081-001-00-3 | thallium | 231-138-1 | 7440-28-0 | T+; R26/28R33R53 | T+R: 26/28-33-53S: (1/2-)13-28-45-61 |
| 081-002-00-9 | thallium compounds, with the exception of those specified elsewhere in this Annex | — | — | T+; R26/28R33N; R51-53 | T+; NR: 26/28-33-51/53S: (1/2-)13-28-45-61 | A |
| 081-003-00-4 | dithallium sulphate;thallic sulphate | 231-201-3 | 7446-18-6 | T+; R28T; R48/25Xi; R38N; R51-53 | T+; NR: 28-38-48/25-51/53S: (1/2-)13-36/37-45-61 |
| 082-001-00-6 | lead compounds with the exception of those specified elsewhere in this Annex | — | — | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22R33N; R50-53 | T; NR: 61-20/22-33-62-50/53S: 53-45-60-61 | Repr. Cat. 3; R62: C ≥ 2,5 %Xn; R20/22: C ≥ 1 %R33: C ≥ 0,5 % | AE1 |
| 082-002-00-1 | lead alkyls | — | — | Repr. Cat. 1; R61Repr. Cat. 3; R62T+; R26/27/28R33N; R50-53 | T+; NR: 61-26/27/28-33-62-50/53S: 53-45-60-61 | Repr. Cat. 1; R61: C ≥ 0,1 %T+; R26/27/28: C ≥ 0,25 %T; R23/24/25: 0,1 % ≤ C < 0,25 %Xn; R20/21/22: 0,05 % ≤ C < 0,1 %R33: C ≥ 0,05 % | AE1 |
| 082-003-00-7 | lead diazide;lead azide | 236-542-1 | 13424-46-9 | E; R3Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22R33N; R50-53 | E; T; NR: 61-3-20/22-33-50/53-62S: 53-45-60-61 | E1 |
| 082-004-00-2 | lead chromate | 231-846-0 | 7758-97-6 | Carc. Cat. 3; R40Repr. Cat. 1; R61Repr. Cat. 3; R62R33N; R50-53 | T; NR: 61-33-40-50/53-62S: 53-45-60-61 | 1 |
| 082-005-00-8 | lead di(acetate) | 206-104-4 | 301-04-2 | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R48/22R33N; R50-53 | T; NR: 61-33-48/22-50/53-62S: 53-45-60-61 | E1 |
| 082-006-00-3 | trilead bis(orthophosphate) | 231-205-5 | 7446-27-7 | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R48/22R33N; R50-53 | T; NR: 61-33-48/22-50/53-62S: 53-45-60-61 | E1 |
| 082-007-00-9 | lead acetate, basic; | 215-630-3 | 1335-32-6 | Carc. Cat. 3; R40Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R48/22R33N; R50-53 | T; NR: 61-33-40-48/22-50/53-62S: 53-45-60-61 | E1 |
| 082-008-00-4 | lead(II) methanesulphonate | 401-750-5 | 17570-76-2 | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22-48/20/22Xi; R38-41N; R58R33 | T; NR: 61-62-20/22-33-38-41-48/20/22-58S: 53-45-57-61 | E1 |
| 082-009-00-X | Lead sulfochromate yellow;C.I. Pigment Yellow 34;[This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] | 215-693-7 | 1344-37-2 | Carc. Cat. 3; R40Repr. Cat. 1; R61Repr. Cat. 3; R62R33N; R50-53 | T; NR: 61-33-40-50/53-62S: 53-45-60-61 | 1 |
| 082-010-00-5 | Lead chromate molybdate sulfate red;C.I. Pigment Red 104;[This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] | 235-759-9 | 12656-85-8 | Carc. Cat. 3; R40Repr. Cat. 1; R61Repr. Cat. 3; R62R33N; R50-53 | T; NR: 61-33-40-50/53-62S: 53-45-60-61 | 1 |
| 082-011-00-0 | lead hydrogen arsenate | 232-064-2 | 7784-40-9 | Carc. Cat. 1; R45Repr. Cat. 1; R61Repr. Cat. 3; R62T; R23/25R33N; R50-53 | T; NR: 45-61-23/25-33-50/53-62S: 53-45-60-61 | E1 |
| 092-001-00-8 | uranium | 231-170-6 | 7440-61-1 | T+; R26/28R33R53 | T+R: 26/28-33-53S: (1/2-)20/21-45-61 |
| 092-002-00-3 | uranium compounds | — | — | T+; R26/28R33N; R51-53 | T+; NR: 26/28-33-51/53S: (1/2-)20/21-45-61 | A |
| 601-001-00-4 | methane | 200-812-7 | 74-82-8 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 601-002-00-X | ethane | 200-814-8 | 74-84-0 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 601-003-00-5 | propane | 200-827-9 | 74-98-6 | F+; R12 | F+R: 12S: (2-)9-16 |
| 601-004-00-0 | butane; [1]and isobutane [2] | 203-448-7 [1]200-857-2 [2] | 106-97-8 [1]75-28-5 [2] | F+; R12 | F+R: 12S: (2-)9-16 | C |
| 601-004-01-8 | butane (containing ≥ 0.1 % butadiene (203-450-8)); [1]isobutane (containing ≥ 0.1 % butadiene (203-450-8)) [2] | 203-448-7 [1]200-857-2 [2] | 106-97-8 [1]75-28-5 [2] | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 45-46-12S: 53-45 | CS |
| 601-005-00-6 | 2,2-dimethylpropane;neopentane | 207-343-7 | 463-82-1 | F+; R12N; R51-53 | F+; NR: 12-51/53S: (2-)9-16-33-61 |
| 601-006-00-1 | pentane; [1]isopentane;2-methylbutane [2] | 203-692-4 [1]201-142-8 [2] | 109-66-0 [1]78-78-4 [2] | F+; R12Xn; R65R66R67N; R51-53 | F+; Xn; NR: 12-51/53-65-66-67S: (2-)9-16-29-33-61-62 | C |
| 601-007-00-7 | hexane, reaction mass of isomers (containing < 5 % n-hexane (203-777-6)) | — | — | F; R11Xn; R65Xi; R38R67N; R51-53 | F; Xn; NR: 11-38-51/53-65-67S: (2-)9-16-29-33-61-62 | C |
| 601-008-00-2 | heptane [and isomers] [1] | 205-563-8 [1]203-548-0 [2]207-346-3 [3]209-230-8 [4]209-280-0 [5]209-643-3 [6]209-680-5 [7]209-730-6 [8]210-529-0 [9]250-610-8 [10] | 142-82-5 [1]108-08-7 [2]464-06-2 [3]562-49-2 [4]565-59-3 [5]589-34-4 [6]590-35-2 [7]591-76-4 [8]617-78-7 [9]31394-54-4 [10] | F; R11Xn; R65Xi; R38R67N; R50-53 | F; Xn; NR: 11-38-50/53-65-67S: (2-)9-16-29-33-60-61-62 | C |
| 601-009-00-8 | octane [and isomers] [1] | 203-892-1 [1]208-759-1 [2]209-207-2 [3]209-243-9 [4]209-266-4 [5]209-292-6 [6]209-504-7 [7]209-547-1 [8]209-649-6 [9]209-650-1 [10]209-660-6 [11]209-689-4 [12] | 111-65-9 [1]540-84-1 [2]560-21-4 [3]563-16-6 [4]564-02-3 [5]565-75-3 [6]583-48-2 [7]584-94-1 [8]589-43-5 [9]589-53-7 [10]589-81-1 [11]590-73-8 [12]592-13-2 [13]592-27-8 [14]594-82-1 [15]609-26-7 [16]619-99-8 [17]1067-08-9 [18]26635-64-3 [19] | F; R11Xn; R65Xi; R38R67N; R50-53 | F; Xn; NR: 11-38-50/53-65-67S: (2-)9-16-29-33-60-61-62 | C |
| 209-745-8 [13]209-747-9 [14]209-855-6 [15]210-187-2 [16]210-621-0 [17]213-923-0 [18]247-861-0 [19] |
| 601-010-00-3 | ethylene | 200-815-3 | 74-85-1 | F+; R12R67 | F+R: 12-67S: (2-)9-16-33-45 |
| 601-011-00-9 | propene;propylene | 204-062-1 | 115-07-1 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 601-012-00-4 | but-1-ene; [1]butene, mixed-1-and-2-isomers; [2]2-methylpropene; [3](Z)-but-2-ene; [4](E)-but-2-ene [5] | 203-449-2 [1]203-452-9 [2]204-066-3 [3]209-673-7 [4]210-855-3 [5] | 106-98-9 [1]107-01-7 [2]115-11-7 [3]590-18-1 [4]624-64-6 [5] | F+; R12 | F+R: 12S: (2-)9-16-33 | C |
| 601-013-00-X | 1,3-butadiene;buta-1,3-diene | 203-450-8 | 106-99-0 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 45-46-12S: 53-45 | D |
| 601-014-00-5 | isoprene (stabilised)2-methyl-1,3-butadiene | 201-143-3 | 78-79-5 | F+; R12Carc. Cat. 2; R45Muta. Cat. 3; R68R52-53 | F+; TR: 45-12-68-52/53S: 53-45-61 | D |
| 601-015-00-0 | acetylene;ethyne | 200-816-9 | 74-86-2 | R5R6F+; R12 | F+R: 5-6-12S: (2-)9-16-33 |
| 601-016-00-6 | cyclopropane | 200-847-8 | 75-19-4 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 601-017-00-1 | cyclohexane | 203-806-2 | 110-82-7 | F; R11Xn; R65Xi; R38R67N; R50-53 | F; Xn; NR: 11-38-65-67-50/53S: (2-)9-16-25-33-60-61-62 |
| 601-018-00-7 | methylcyclohexane | 203-624-3 | 108-87-2 | F; R11Xn; R65Xi; R38R67N; R51-53 | F; Xn; NR: 11-38-51/53-65-67S: (2-)9-16-33-61-62 |
| 601-019-00-2 | 1,4-dimethylcyclohexane | 209-663-2 | 589-90-2 | F; R11Xn; R65Xi; R38R67N; R51-53 | F; Xn; NR: 11-38-51/53-65-67S: (2-)9-16-33-61-62 |
| 601-020-00-8 | benzene | 200-753-7 | 71-43-2 | F; R11Carc. Cat. 1; R45Muta. Cat. 2; R46T; R48/23/24/25Xn; R65Xi; R36/38 | F; TR: 45-46-11-36/38-48/23/24/25-65S: 53-45 | E |
| 601-021-00-3 | toluene | 203-625-9 | 108-88-3 | F; R11Repr. Cat. 3; R63Xn; R48/20-65Xi; R38R67 | F; XnR: 11-38-48/20-63-65-67S: (2-)36/37-46-62 |
| 601-022-00-9 | o-xylene; [1]p-xylene; [2]m-xylene; [3]xylene [4] | 202-422-2 [1]203-396-5 [2]203-576-3 [3]215-535-7 [4] | 95-47-6 [1]106-42-3 [2]108-38-3 [3]1330-20-7 [4] | R10Xn; R20/21Xi; R38 | XnR: 10-20/21-38S: (2-)25 | Xn; R20/21: C ≥ 12,5 % | C |
| 601-023-00-4 | ethylbenzene | 202-849-4 | 100-41-4 | F; R11Xn; R20 | F; XnR: 11-20S: (2-)16-24/25-29 |
| 601-024-00-X | cumene; [1]propylbenzene [2] | 202-704-5 [1]203-132-9 [2] | 98-82-8 [1]103-65-1 [2] | R10Xn; R65Xi; R37N; R51-53 | Xn; NR: 10-37-51/53-65S: (2-)24-37-61-62 | C |
| 601-025-00-5 | mesitylene;1,3,5-trimethylbenzene | 203-604-4 | 108-67-8 | R10Xi; R37N; R51-53 | Xi; NR: 10-37-51/53S: (2-)61 | Xi; R37: C ≥ 25 % |
| 601-026-00-0 | styrene | 202-851-5 | 100-42-5 | R10Xn; R20Xi; R36/38 | XnR: 10-20-36/38S: (2-)23 | Xn; R20: C ≥ 12,5 %Xi; R36/38: C ≥ 12,5 % | D |
| 601-027-00-6 | 2-phenylpropene;α-methylstyrene | 202-705-0 | 98-83-9 | R10Xi; R36/37N; R51-53 | Xi; NR: 10-36/37-51/53S: (2-)61 | Xi; R36/37: C ≥ 25 % |
| 601-028-00-1 | 2-methylstyrene;2-vinyltoluene | 210-256-7 | 611-15-4 | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)24-61 |
| 601-029-00-7 | dipentene;limonene; [1](R)-p-mentha-1,8-diene;d-limonene; [2](S)-p-mentha-1,8-diene;l-limonene; [3]trans-1-methyl-4-(1-methylvinyl)cyclohexene; [4](±)-1-methyl-4-(1-methylvinyl)cyclohexene [5] | 205-341-0 [1]227-813-5 [2]227-815-6 [3]229-977-3 [4]231-732-0 [5] | 138-86-3 [1]5989-27-5 [2]5989-54-8 [3]6876-12-6 [4]7705-14-8 [5] | R10Xi; R38R43N; R50-53 | Xi; NR: 10-38-43-50/53S: (2-)24-37-60-61 | C |
| 601-030-00-2 | cyclopentane | 206-016-6 | 287-92-3 | F; R11R52-53 | FR: 11-52/53S: (2-)9-16-29-33-61 |
| 601-031-00-8 | 2,4,4-trimethylpent-1-ene | 203-486-4 | 107-39-1 | F; R11N; R51-53 | F; NR: 11-51/53S: (2-)9-16-29-33-61 |
| 601-032-00-3 | benzo[a]pyrene;benzo[def]chrysene | 200-028-5 | 50-32-8 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61R43N; R50-53 | T; NR: 45-46-60-61-43-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 % |
| 601-033-00-9 | benz[a]anthracene | 200-280-6 | 56-55-3 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 601-034-00-4 | benz[e]acephenanthrylene | 205-911-9 | 205-99-2 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 601-035-00-X | benzo[j]fluoranthene | 205-910-3 | 205-82-3 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 601-036-00-5 | benzo[k]fluoranthene | 205-916-6 | 207-08-9 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 601-037-00-0 | n-hexane | 203-777-6 | 110-54-3 | F; R11Repr. Cat. 3; R62Xn; R65-48/20Xi; R38R67N; R51-53 | F; Xn; NR: 11-38-48/20-62-65-67-51/53S: (2-)9-16-29-33-36/37-61-62 | Xn; R48/20: C ≥ 5 % |
| 601-041-00-2 | dibenz[a,h]anthracene | 200-181-8 | 53-70-3 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 % |
| 601-042-00-8 | biphenyl;diphenyl | 202-163-5 | 92-52-4 | Xi; R36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)23-60-61 |
| 601-043-00-3 | 1,2,4-trimethylbenzene | 202-436-9 | 95-63-6 | R10Xn; R20Xi; R36/37/38N; R51-53 | Xn; NR: 10-20-36/37/38-51/53S: (2-)26-61 |
| 601-044-00-9 | 3a,4,7,7a-tetrahydro-4,7-methanoindene | 201-052-9 | 77-73-6 | F; R11Xn; R20/22Xi; R36/37/38N; R51-53 | F; Xn; NR: 11-20/22-36/37/38-51/53S: (2-)36/37-61 |
| 601-045-00-4 | 1,2,3,4-tetrahydronaphthalene | 204-340-2 | 119-64-2 | R19Xi; R36/38N; R51-53 | Xi; NR: 19-36/38-51/53S: (2-)26-28-61 |
| 601-046-00-X | 7-methylocta-1,6-diene | 404-210-7 | 42152-47-6 | R10N; R50-53 | NR: 10-50/53S: (2-)60-61 |
| 601-047-00-5 | m-mentha-1,3(8)-diene | 404-150-1 | 17092-80-7 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 601-048-00-0 | chrysene | 205-923-4 | 218-01-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68N; R50-53 | T; NR: 45-68-50/53S: 53-45-60-61 |
| 601-049-00-6 | benzo[e]pyrene | 205-892-7 | 192-97-2 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 601-051-00-7 | 4-phenylbut-1-ene | 405-980-7 | 768-56-9 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 601-052-00-2 | naphthalene | 202-049-5 | 91-20-3 | Carc. Cat. 3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)36/37-46-60-61 |
| 601-053-00-8 | nonylphenol; [1]4-nonylphenol, branched [2] | 246-672-0 [1]284-325-5 [2] | 25154-52-3 [1]84852-15-3 [2] | Repr. Cat. 3; R62-63Xn; R22C; R34N; R50-53 | C; NR: 22-34-62-63-50/53S: (1/2-)26-36/37/39-45-46-60-61 |
| 601-054-00-3 | reaction mass of isomers of: dibenzylbenzene;dibenzyl(methyl)benzene;dibenzyl(dimethyl)benzene;dibenzyl(trimethyl)benzene | 405-570-8 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 601-055-00-9 | reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes;di-(2-tetradecyl)naphthalenes;tri-(2-tetradecyl)naphthalenes | 410-190-0 | 132983-41-6 | Xi; R36R53 | XiR: 36-53S: (2-)26-61 |
| 601-056-00-4 | reaction mass of isomers of: methyldiphenylmethane;dimethyldiphenylmethane | 405-470-4 | 73807-39-3 | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)37-60-61 |
| 601-057-00-X | N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate | 421-130-8 | 156679-41-3 | Xi; R41R43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)24-26-37/39-60-61 |
| 601-058-00-5 | di-L-para-menthene | 417-870-6 | 83648-84-4 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)23-24-37-60-61 |
| 601-059-00-0 | methyl 2-benzylidene-3-oxobutyrate | 420-940-9 | 15768-07-7 | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-37/39-61 |
| 601-060-00-6 | 1,2-bis[4-fluoro-6-{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y = 0,245 | 417-610-1 | 155522-09-1 | R43 | XiR: 43S: (2-)22-24-37 |
| 601-061-00-1 | (ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) | 418-960-8 | — | C; R34R43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 601-062-00-7 | reaction mass of: branched triacontane;branched dotriacontane;branched tetratriacontane;branched hexatriacontane | 417-030-9 | 151006-59-6 | R53 | R: 53S: 61 |
| 601-063-00-2 | reaction mass of isomers of branched tetracosane | 417-060-2 | 151006-61-0 | Xn; R20R53 | XnR: 20-53S: (2-)61 |
| 601-064-00-8 | branched hexatriacontane | 417-070-7 | 151006-62-1 | R53 | R: 53S: 61 |
| 601-065-00-3 | reaction mass of: (1'-α,3'-α,6'-α-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane);(1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) | 416-930-9 | — | Xn; R48/22Xi; R41N; R51-53 | Xn; NR: 41-48/22-51/53S: (2-)22-26-37/39-61 |
| 601-066-00-9 | 1-(4-(trans-4-heptylcyclohexyl)phenyl)ethanone | 426-820-2 | 78531-60-9 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 601-067-00-4 | triethyl arsenate | 427-700-2 | 15606-95-8 | Carc. Cat. 1; R45T; R23/25N; R50-53 | T; NR: 45-23/25-50/53S: 53-45-60-61 | E |
| 601-068-00-X | 1,2-diacetoxybut-3-ene | 421-720-5 | 18085-02-4 | Xn; R22 | XnR: 22S: (2-) |
| 601-069-00-5 | 2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide | 422-680-1 | 287933-44-2 | R52-53 | R: 52/53S: 61 |
| 601-071-00-6 | 1-dimethoxymethyl-2-nitro-benzene | 423-830-9 | 20627-73-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 601-073-00-7 | 1-bromo-3,5-difluorobenzene | 416-710-2 | 461-96-1 | R10Xn; R22-48/22Xi; R38R43N; R50-53 | Xn; NR: 10-22-38-43-48/22-50/53S: (2-)24-36/37-60-61 |
| 601-074-00-2 | reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane;1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane;spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan];spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] | 422-040-1 | — | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-37-61 |
| 602-001-00-7 | chloromethane;methyl chloride | 200-817-4 | 74-87-3 | F+; R12Carc. Cat. 3; R40Xn; R48/20 | F+; XnR: 12-40-48/20S: (2-)9-16-33 |
| 602-002-00-2 | bromomethane;methylbromide | 200-813-2 | 74-83-9 | Muta. Cat. 3; R68T; R23/25Xn; R48/20Xi; R36/37/38N; R50N; R59 | T; NR: 23/25-36/37/38-48/20-50-59-68S: (1/2-)15-27-36/39-38-45-59-61 |
| 602-003-00-8 | dibromomethane | 200-824-2 | 74-95-3 | Xn; R20R52-53 | XnR: 20-52/53S: (2-)24-61 | Xn; R20: C ≥ 12,5 % |
| 602-004-00-3 | dichloromethane;methylene chloride | 200-838-9 | 75-09-2 | Carc. Cat. 3; R40 | XnR: 40S: (2-)23-24/25-36/37 |
| 602-005-00-9 | methyl iodide;iodomethane | 200-819-5 | 74-88-4 | Carc. Cat. 3; R40Xn; R21T; R23/25Xi; R37/38 | TR: 21-23/25-37/38-40S: (1/2-)36/37-38-45 |
| 602-006-00-4 | trichloromethane;chloroform | 200-663-8 | 67-66-3 | Xn; R22-48/20/22Xi; R38Carc. Cat. 3; R40 | XnR: 22-38-40-48/20/22S: (2-)36/37 | Xn; R22: C ≥ 5 %Xn; R48/20/22: C ≥ 5 % |
| 602-007-00-X | bromoform;tribromomethane | 200-854-6 | 75-25-2 | T; R23Xi; R36/38N; R51-53 | T; NR: 23-36/38-51/53S: (1/2-)28-45-61 |
| 602-008-00-5 | carbon tetrachloride;tetrachloromethane | 200-262-8 | 56-23-5 | Carc. Cat. 3; R40T; R23/24/25-48/23N; R59R52-53 | T; NR: 23/24/25-40-48/23-59-52/53S: (1/2-)23-36/37-45-59-61 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,2 % ≤ C < 1 %T; R48/23: C ≥ 1 %Xn; R48/20: 0,2 % ≤ C < 1 % |
| 602-009-00-0 | chloroethane | 200-830-5 | 75-00-3 | F+; R12Carc. Cat. 3; R40R52-53 | F+; XnR: 12-40-52/53S: (2-)9-16-33-36/37-61 |
| 602-010-00-6 | 1,2-dibromoethane | 203-444-5 | 106-93-4 | Carc. Cat. 2; R45T; R23/24/25Xi; R36/37/38N; R51-53 | T; NR: 45-23/24/25-36/37/38-51/53S: 53-45-61 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,1 % ≤ C < 1 % | E |
| 602-011-00-1 | 1,1-dichloroethane | 200-863-5 | 75-34-3 | F; R11Xn; R22Xi; R36/37R52-53 | F; XnR: 11-22-36/37-52/53S: (2-)16-23-61 | Xn; R22: C ≥ 12,5 % |
| 602-012-00-7 | 1,2-dichloroethane;ethylene dichloride | 203-458-1 | 107-06-2 | F; R11Carc. Cat. 2; R45Xn; R22Xi; R36/37/38 | F; TR: 45-11-22-36/37/38S: 53-45 | E |
| 602-013-00-2 | 1,1,1-trichloroethane;methyl chloroform | 200-756-3 | 71-55-6 | Xn; R20N; R59 | Xn; NR: 20-59S: (2-)24/25-59-61 | F |
| 602-014-00-8 | 1,1,2-trichloroethane | 201-166-9 | 79-00-5 | Carc. Cat. 3; R40Xn; R20/21/22R66 | XnR: 20/21/22-40-66S: (2-)9-36/37-46 | Xn; R20/21/22: C ≥ 5 % |
| 602-015-00-3 | 1,1,2,2-tetrachloroethane | 201-197-8 | 79-34-5 | T+; R26/27N; R51-53 | T+; NR: 26/27-51/53S: (1/2-)38-45-61 |
| 602-016-00-9 | 1,1,2,2-tetrabromoethane | 201-191-5 | 79-27-6 | T+; R26Xi; R36R52-53 | T+R: 26-36-52/53S: (1/2-)24-27-45-61 |
| 602-017-00-4 | pentachloroethane | 200-925-1 | 76-01-7 | Carc. Cat. 3; R40T; R48/23N; R51-53 | T; NR: 40-48/23-51/53S: (1/2-)23-36/37-45-61 | T; R48/23: C ≥ 1 %Xn; R48/20: 0,2 % ≤ C < 1 % |
| 602-018-00-X | 1-chloropropane; [1]2-chloropropane [2] | 208-749-7 [1]200-858-8 [2] | 540-54-5 [1]75-29-6 [2] | F; R11Xn; R20/21/22 | F; XnR: 11-20/21/22S: (2-)9-29 | C |
| 602-019-00-5 | 1-bromopropane;n-propyl bromide | 203-445-0 | 106-94-5 | F; R11Repr. Cat. 2; R60Repr. Cat. 3; R63Xn; R48/20Xi; R36/37/38R67 | F; TR: 60-11-36/37/38-48/20-63-67S: 53-45 | E |
| 602-020-00-0 | 1,2-dichloropropane;propylene dichloride | 201-152-2 | 78-87-5 | F; R11Xn; R20/22 | F; XnR: 11-20/22S: (2-)16-24 |
| 602-021-00-6 | 1,2-dibromo-3-chloropropane | 202-479-3 | 96-12-8 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 1; R60T; R25Xn; R48/20/22R52-53 | TR: 45-46-60-25-48/20/22-52/53S: 53-45-61 | E |
| 602-022-00-1 | 1-chloropentane; [1]2-chloropentane; [2]3-chloropentane [3] | 208-846-4 [1]210-885-7 [2]210-467-4 [3] | 543-59-9 [1]625-29-6 [2]616-20-6 [3] | F; R11Xn; R20/21/22 | F; XnR: 11-20/21/22S: (2-)9-29 | C |
| 602-023-00-7 | vinyl chloride;chloroethylene | 200-831-0 | 75-01-4 | F+; R12Carc. Cat. 1; R45 | F+; TR: 45-12S: 53-45 | D |
| 602-024-00-2 | bromoethylene | 209-800-6 | 593-60-2 | F+; R12Carc. Cat. 2; R45 | F+; TR: 45-12S: 53-45 |
| 602-025-00-8 | 1,1-dichloroethylene;vinylidene chloride | 200-864-0 | 75-35-4 | F+; R12Carc. Cat. 3; R40Xn; R20 | F+; XnR: 12-20-40S: (2-)7-16-29-36/37-46 | Xn; R20: C ≥ 12,5 % | D |
| 602-026-00-3 | 1,2-dichloroethylene; [1]cis-dichloroethylene; [2]trans-dichloroethylene [3] | 208-750-2 [1]205-859-7 [2]205-860-2 [3] | 540-59-0 [1]156-59-2 [2]156-60-5 [3] | F; R11Xn; R20R52-53 | F; XnR: 11-20-52/53S: (2-)7-16-29-61 | Xn; R20: C ≥ 12,5 % | C |
| 602-027-00-9 | trichloroethylene;trichloroethene | 201-167-4 | 79-01-6 | Carc. Cat. 2; R45Muta. Cat. 3; R68R67Xi; R36/38R52-53 | TR: 45-36/38-52/53-67S: 53-45-61 |
| 602-028-00-4 | tetrachloroethylene | 204-825-9 | 127-18-4 | Carc. Cat. 3; R40N; R51-53 | Xn; NR: 40-51/53S: (2-)23-36/37-61 |
| 602-029-00-X | 3-chloropropene;allyl chloride | 203-457-6 | 107-05-1 | F; R11Carc. Cat. 3; R40Muta. Cat. 3; R68Xn; R20/21/22-48/20Xi; R36/37/38N; R50 | F; Xn; NR: 11-20/21/22-36/37/38-40-48/20-68-50S: (2-)16-25-26-36/37-46-61 | D |
| 602-030-00-5 | 1,3-dichloropropene; [1](Z)-1,3-dichloropropene [2] | 208-826-5 [1]233-195-8 [2] | 542-75-6 [1]10061-01-5 [2] | R10T; R25Xn; R20/21Xi; R36/37/38R43N; R50-53 | T; NR: 10-20/21-25-36/37/38-43-50/53S: (1/2-)36/37-45-60-61 | DC |
| 602-031-00-0 | 1,1-dichloropropene | 209-253-3 | 563-58-6 | F; R11T; R25R52-53 | F; TR: 11-25-52/53S: (1/2-)16-29-33-45-61 |
| 602-032-00-6 | 3-chloro-2-methylpropene | 209-251-2 | 563-47-3 | F; R11Xn; R20/22C; R34R43N; R51-53 | F; C; NR: 11-20/22-34-43-51/53S: (2-)9-16-26-29-36/37/39-45-61 |
| 602-033-00-1 | chlorobenzene | 203-628-5 | 108-90-7 | R10Xn; R20N; R51-53 | Xn; NR: 10-20-51/53S: (2-)24/25-61 | Xn; R20: C ≥ 5 % |
| 602-034-00-7 | 1,2-dichlorobenzene;o-dichlorobenzene | 202-425-9 | 95-50-1 | Xn; R22Xi; R36/37/38N; R50-53 | Xn; NR: 22-36/37/38-50/53S: (2-)23-60-61 | Xn; R22: C ≥ 5 % |
| 602-035-00-2 | 1,4-dichlorobenzene;p-dichlorobenzene | 203-400-5 | 106-46-7 | Carc. Cat. 3; R40Xi; R36N; R50-53 | Xn; NR: 36-40-50/53S: (2-)36/37-46-60-61 |
| 602-036-00-8 | chloroprene (stabilised);2-chlorobuta-1,3-diene (stabilised) | 204-818-0 | 126-99-8 | F; R11Carc. Cat. 2; R45Xn; R20/22-48/20Xi; R36/37/38 | F; TR: 45-11-20/22-36/37/38-48/20S: 53-45 | D E |
| 602-037-00-3 | α-chlorotoluene;benzyl chloride | 202-853-6 | 100-44-7 | Carc. Cat. 2; R45T; R23Xn; R22-48/22Xi; R37/38-41 | TR: 45-22-23-37/38-41-48/22S: 53-45 | E |
| 602-038-00-9 | α, α,α-trichlorotoluene;benzotrichloride | 202-634-5 | 98-07-7 | Carc. Cat. 2; R45T; R23Xn; R22Xi; R37/38-41 | TR: 45-22-23-37/38-41S: 53-45 | E |
| 602-039-00-4 | polychlorobiphenyls;PCB | 215-648-1 | 1336-36-3 | R33N; R50-53 | NR: 33-50/53S: (2-)-60-61 | R33: C ≥ 0,005 % | C |
| 602-040-00-X | 2-chlorotoluene; [1]3-chlorotoluene; [2]4-chlorotoluene; [3]chlorotoluene [4] | 202-424-3 [1]203-580-5 [2]203-397-0 [3]246-698-2 [4] | 95-49-8 [1]108-41-8 [2]106-43-4 [3]25168-05-2 [4] | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)24/25-61 | C |
| 602-041-00-5 | penthachloronaphthalene | 215-320-8 | 1321-64-8 | Xn; R21/22Xi; R36/38N; R50-53 | Xn; NR: 21/22-36/38-50/53S: (2-)-60-61 | C |
| 602-042-00-0 | 1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex | — | — | Carc. Cat. 3; R40T; R25Xn; R21N; R50-53 | T; NR: 21-25-40-50/53S: (1/2-)22-36/37-45-60-61 | A C |
| 602-043-00-6 | lindane (ISO)γ-HCH or γ-BHC;γ-1,2,3,4,5,6-hexachlorocyclohexane; | 200-401-2 | 58-89-9 | T; R25Xn; R20/21-48/22R64N; R50-53 | T; NR: 20/21-25-48/22-64-50/53S: (1/2-)36/37-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 602-044-00-1 | camphechlor (ISO)toxaphene; | 232-283-3 | 8001-35-2 | Carc. Cat. 3; R40T; R25Xn; R21Xi; R37/38N; R50-53 | T; NR: 21-25-37/38-40-50/53S: (1/2-)36/37-45-60-61 |
| 602-045-00-7 | DDT (ISO);clofenotane (INN);dicophane;1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane;dichlorodiphenyltrichloroethane | 200-024-3 | 50-29-3 | T; R25-48/25Carc. Cat. 3; R40N; R50-53 | T; NR: 25-40-48/25-50/53S: (1/2-)22-36/37-45-60-61 |
| 602-046-00-2 | heptachlor (ISO);1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene | 200-962-3 | 76-44-8 | T; R24/25Carc. Cat. 3; R40R33N; R50-53 | T; NR: 24/25-33-40-50/53S: (1/2-)36/37-45-60-61 |
| 602-047-00-8 | chlordane (ISO);1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan | 200-349-0 | 57-74-9 | Carc. Cat. 3; R40Xn; R21/22N; R50-53 | Xn; NR: 21/22-40-50/53S: (2-)36/37-60-61 |
| 602-048-00-3 | aldrin (ISO) | 206-215-8 | 309-00-2 | T; R24/25-48/24/25Carc. Cat. 3; R40N; R50-53 | T; NR: 24/25-40-48/24/25-50/53S: (1/2-)22-36/37-45-60-61 |
| 602-049-00-9 | dieldrin (ISO) | 200-484-5 | 60-57-1 | T+; R27T; R25-48/25Carc. Cat. 3; R40N; R50-53 | T+; NR: 25-27-40-48/25-50/53S: (1/2-)22-36/37-45-60-61 |
| 602-050-00-4 | (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphfthalene;isodrin | 207-366-2 | 465-73-6 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)13-28-45-60-61 |
| 602-051-00-X | endrin (ISO);1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene | 200-775-7 | 72-20-8 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)22-36/37-45-60-61 |
| 602-052-00-5 | endosulfan (ISO);1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethyl sulphite | 204-079-4 | 115-29-7 | T; R24/25Xi; R36N; R50-53 | T; NR: 24/25-36-50/53S: (1/2-)28-36/37-45-60-61 |
| 602-053-00-0 | isobenzan (ISO);1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran | 206-045-4 | 297-78-9 | T+; R27/28N; R50 | T+; NR: 27/28-50S: (1/2-)28-36/37-45-61 |
| 602-054-00-6 | 3-iodpropene;allyl iodide | 209-130-4 | 556-56-9 | R10C; R34 | CR: 10-34S: (1/2-)7-26-45 |
| 602-055-00-1 | bromoethane;ethyl bromide | 200-825-8 | 74-96-4 | F; R11Carc. Cat. 3; R40Xn; R20/22 | F; XnR: 11-20/22-40S: (2-)36/37 |
| 602-056-00-7 | α, α,α-trifluorotoluene;benzotrifluoride | 202-635-0 | 98-08-8 | F; R11N; R51-53 | F; NR: 11-51/53S: (2-)16-23-61 |
| 602-057-00-2 | α-bromotoluene;benzyl bromide | 202-847-3 | 100-39-0 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)39 |
| 602-058-00-8 | α, α-dichlorotoluene;benzylidene chloride;benzal chloride | 202-709-2 | 98-87-3 | Carc. Cat. 3; R40T; R23Xn; R22Xi; R37/38-41 | TR: 22-23-37/38-40-41S: (1/2-)36/37-38-45 |
| 602-059-00-3 | 1-chlorobutane;butyl chloride | 203-696-6 | 109-69-3 | F; R11 | FR: 11S: (2-)9-16-29 |
| 602-060-00-9 | bromobenzene | 203-623-8 | 108-86-1 | R10Xi; R38N; R51-53 | Xi; NR: 10-38-51/53S: (2-)61 |
| 602-061-00-4 | hexafluoropropene;hexafluoropropylene | 204-127-4 | 116-15-4 | Xn; R20Xi; R37 | XnR: 20-37S: (2-)41 |
| 602-062-00-X | 1,2,3-trichloropropane | 202-486-1 | 96-18-4 | Carc. Cat. 2; R45Repr. Cat. 2; R60Xn; R20/21/22 | TR: 45-60-20/21/22S: 53-45 | E D |
| 602-063-00-5 | heptachlor epoxide;2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane | 213-831-0 | 1024-57-3 | T; R25Carc. Cat. 3; R40R33N; R50-53 | T; NR: 25-33-40-50/53S: (1/2-)36/37-45-60-61 |
| 602-064-00-0 | 1,3-dichloro-2-propanol | 202-491-9 | 96-23-1 | Carc. Cat. 2; R45T; R25Xn; R21 | TR: 45-21-25S: 53-45 | E |
| 602-065-00-6 | hexachlorobenzene | 204-273-9 | 118-74-1 | Carc. Cat. 2; R45T; R48/25N; R50-53 | T; NR: 45-48/25-50/53S: 53-45-60-61 | E |
| 602-066-00-1 | tetrachloro-p-benzoquinone | 204-274-4 | 118-75-2 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: (2-)37-60-61 |
| 602-067-00-7 | 1,3-dichlorbenzene | 208-792-1 | 541-73-1 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 602-068-00-2 | ethylene bis(trichloroacetate) | 219-732-9 | 2514-53-6 | Xi; R38 | XiR: 38S: (2-) |
| 602-069-00-8 | dichloroacetylene | — | 7572-29-4 | E; R2Carc. Cat. 3; R40Xn; R48/20 | E; XnR: 2-40-48/20S: (2-)36/37 |
| 602-070-00-3 | 3-chloro-4,5,α, α,α-pentafluorotoluene | 401-930-3 | 77227-99-7 | R10Xn; R20/22N; R50-58 | Xn; NR: 10-20/22-50-58S: (2-)51-60-61 |
| 602-071-00-9 | bromobenzylbromotoluene, reaction mass of isomers | 402-210-1 | 99688-47-8 | Xn; R48/22R43N; R50-53 | Xn; NR: 43-48/22-50/53S: (2-)24-37-41-60-61 |
| 602-072-00-4 | dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers;(dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) | 278-404-3 | 76253-60-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 602-073-00-X | 1,4-dichlorobut-2-ene | 212-121-8 | 764-41-0 | Carc. Cat. 2; R45T+; R26T; R24/25C; R34N; R50-53 | T+; NR: 45-24/25-26-34-50/53S: 53-45-60-61 | Carc. Cat. 2; R45: C ≥ 0,01 %C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | E |
| 602-074-00-5 | pentachlorobenzene | 210-172-0 | 608-93-5 | F; R11Xn; R22N; R50-53 | F; Xn; NR: 11-22-50/53S: (2-)41-46-50-60-61 |
| 602-075-00-0 | 4,4,5,5-tetrachloro-1,3-dioxolan-2-one | 404-060-2 | 22432-68-4 | T+; R26Xn; R22C; R34 | T+R: 22-26-34S: (1/2-)9-26-28-36/37/39-45 |
| 602-076-00-6 | 2,3,4-trichlorobut-1-ene | 219-397-9 | 2431-50-7 | Carc. Cat. 3; R40T; R23Xn; R22Xi; R36/37/38N; R50-53 | T; NR: 22-23-36/37/38-40-50/53S: (1/2-)36/37-45-60-61 | Carc. Cat. 3; R40: C ≥ 0,1 % |
| 602-077-00-1 | dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane;mirex | 219-196-6 | 2385-85-5 | Carc. Cat. 3; R40Repr. Cat. 3; R62-63R64Xn; R21/22N; R50/53 | Xn; NR: 21/22-40-50/53-62-63-64S: (2-)13-36/37-46-60-61 |
| 602-078-00-7 | hexachlorocyclopentadiene | 201-029-3 | 77-47-4 | T+; R26T; R24Xn; R22C; R34N; R50-53 | T+; NR: 22-24-26-34-50/53S: (1/2-)25-39-45-53-60-61 |
| 602-079-00-2 | 2,3-dichloropropene;2,3-dichloropropylene | 201-153-8 | 78-88-6 | F; R11Muta. Cat. 3; R68Xn; R20/21/22Xi; R37/38-41R52-53 | F; XnR: 11-20/21/22-37/38-41-52/53-68S: (2-)9-16-23-26-36/37/39-61 |
| 602-080-00-8 | alkanes, C10-13, chloro | 287-476-5 | 85535-84-8 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)24-36/37-60-61 |
| 602-081-00-3 | 2-chloro-4,5-difluorobenzoic acid | 405-380-5 | — | Xn; R21/22Xi; R41R43 | XnR: 21/22-41-43S: (2-)26-36/37/39 |
| 602-082-00-9 | 2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol | 408-020-5 | 109678-33-3 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-41-61 |
| 602-083-00-4 | diphenyl ether, pentabromo derivative pentabromodiphenyl ether | 251-084-2 | 32534-81-9 | Xn; R48/21/22R64N; R50-53 | Xn; NR: 48/21/22-50/53-64S: (1/2-)36/37-45-60-61 |
| 602-084-00-X | 1,1-dichloro-1-fluoroethane | 404-080-1 | 1717-00-6 | R52-53N; R59 | NR: 52/53-59S: 59-61 |
| 602-085-00-5 | 2-bromopropane | 200-855-1 | 75-26-3 | F; R11Repr. Cat. 1; R60Xn; R48/20R66 | F; TR: 60-11-48/20-66S: 53-45 | E |
| 602-086-00-0 | trifluoroiodomethane;trifluoromethyl iodide | 219-014-5 | 2314-97-8 | Muta. Cat. 3; R68 | XnR: 68S: (2-)36/37 |
| 602-087-00-6 | 1,2,4-trichlorobenzene | 204-428-0 | 120-82-1 | Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-50/53S: (2-)23-37/39-60-61 |
| 602-088-00-1 | 2,3-dibromopropan-1-ol;2,3-dibromo-1-propanol | 202-480-9 | 96-13-9 | Carc. Cat. 2; R45Repr. Cat. 3; R62T; R24Xn; R20/22R52-53 | TR: 45-20/22-24-52/53-62S: 53-45-61 | E |
| 602-089-00-7 | 4-bromo-2-chlorofluorobenzene | 405-580-2 | 60811-21-4 | Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-50/53S: (2-)26-36/37-60-61 |
| 602-090-00-2 | 1-allyl-3-chloro-4-fluorobenzene | 406-630-6 | 121626-73-1 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)23-37-61 |
| 602-091-00-8 | 1,3-dichloro-4-fluorobenzene | 406-160-1 | 1435-48-9 | Xn; R22-48/20/22Xi; R38N; R51-53 | Xn; NR: 22-38-48/20/22-51/53S: (2-)36/37-61 |
| 602-092-00-3 | 1-bromo-3,4,5-trifluorobenzene | 418-480-9 | 138526-69-9 | R10Carc. Cat. 3; R40Xi; R38-41N; R51-53 | Xn; NR: 10-38-40-41-51/53S: (2-)23-26-36/37/39-61 |
| 602-093-00-9 | α, α,α,4-tetrachlorotoluene;p-chlorobenzotrichloride | 226-009-1 | 5216-25-1 | Carc. Cat. 2; R45Repr. Cat. 3; R62T; R48/23Xn; R21/22Xi; R37/38 | TR: 45-21/22-37/38-48/23-62S: 53-45 | E |
| 602-094-00-4 | diphenylether; octabromo derivate | 251-087-9 | 32536-52-0 | Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-62S: 53-45 |
| 602-096-00-5 | malachite green hydrochloride; [1]malachite green oxalate [2] | 209-322-8 [1]219-441-7 [2] | 569-64-2 [1]2437-29-8 [2] | Repr. Cat. 3; R63Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-63-50/53S: (2-)26-36/37-39-46-60-61 |
| 602-097-00-0 | 1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane | 422-850-5 | 148757-89-5 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 603-001-00-X | methanol | 200-659-6 | 67-56-1 | F; R11T; R23/24/25-39/23/24/25 | F; TR: 11-23/24/25-39/23/24/25S: (1/2-)7-16-36/37-45 | T; R23/24/25: C ≥ 20 %Xn; R20/21/22: 3 % ≤ C < 20 %T; R39/23/24/25: C ≥ 10 %Xn; R68/20/21/22: 3 % ≤ C < 10 % |
| 603-002-00-5 | ethanol;ethyl alcohol | 200-578-6 | 64-17-5 | F; R11 | FR: 11S: (2-)7-16 |
| 603-003-00-0 | propan-1-ol;n-propanol | 200-746-9 | 71-23-8 | F; R11Xi; R41R67 | F; XiR: 11-41-67S: (2-)7-16-24-26-39 |
| 603-004-00-6 | butan-1-ol;n-butanol | 200-751-6 | 71-36-3 | R10Xn; R22Xi; R37/38-41R67 | XnR: 10-22-37/38-41-67S: (2-)7/9-13-26-37/39-46 |
| 603-005-00-1 | 2-methylpropan-2-ol;tert-butyl alcohol | 200-889-7 | 75-65-0 | F; R11Xn; R20 | F; XnR: 11-20S: (2-)9-16 |
| 603-006-00-7 | pentanol isomers, with the exception fo those specified elsewhere in this Annex | 250-378-8 | R10Xn; R20Xi; R37R66 | XnR: 10-20-37-66S: (2-)46 | C |
| 603-007-00-2 | 2-methylbutan-2-ol;tert-pentanol | 200-908-9 | 75-85-4 | F; R11Xn; R20Xi; R37/38 | F; XnR: 11-20-37/38S: (2-)46 |
| 603-008-00-8 | 4-methylpentan-2-ol;methyl isobutyl carbinol | 203-551-7 | 108-11-2 | R10Xi; R37 | XiR: 10-37S: (2-)24/25 | Xi; R37: C ≥ 25 % |
| 603-009-00-3 | cyclohexanol | 203-630-6 | 108-93-0 | Xn; R20/22Xi; R37/38 | XnR: 20/22-37/38S: (2-)24/25 |
| 603-010-00-9 | 2-methylcyclohexanol, mixed isomers; [1]cis-2-methylcyclohexanol; [2]trans-2-methylcyclohexanol [3] | 209-512-0 [1]231-187-9 [2]231-186-3 [3] | 583-59-5 [1]7443-70-1 [2]7443-52-9 [3] | Xn; R20 | XnR: 20S: (2-)24/25 | C |
| 603-011-00-4 | 2-methoxyethanol;ethylene glycol monomethyl ether | 203-713-7 | 109-86-4 | R10Repr. Cat. 2; R60-61Xn; R20/21/22 | TR: 60-61-10-20/21/22S: 53-45 | E |
| 603-012-00-X | 2-ethoxyethanol;ethylene glycol monoethyl ether | 203-804-1 | 110-80-5 | R10Repr. Cat. 2; R60-61Xn; R20/21/22 | TR: 60-61-10-20/21/22S: 53-45 | E |
| 603-013-00-5 | 2-isopropoxyethanol;ethylene glycol monoisopropyl ether | 203-685-6 | 109-59-1 | Xn; R20/21Xi; R36 | XnR: 20/21-36S: (2-)24/25 |
| 603-014-00-0 | 2-butoxyethanol;ethylene glycol monobutyl ether;butyl cellosolve | 203-905-0 | 111-76-2 | Xn; R20/21/22Xi; R36/38 | XnR: 20/21/22-36/38S: (2-)36/37-46 |
| 603-015-00-6 | allyl alcohol | 203-470-7 | 107-18-6 | R10T; R23/24/25Xi; R36/37/38N; R50 | T; NR: 10-23/24/25-36/37/38-50S: (1/2-)36/37/39-38-45-61 |
| 603-016-00-1 | 4-hydroxy-4-methylpentan-2-one;diacetone alcohol | 204-626-7 | 123-42-2 | Xi; R36 | XiR: 36S: (2-)24/25 | Xi; R36: C ≥ 10 % |
| 603-018-00-2 | furfuryl alcohol | 202-626-1 | 98-00-0 | Xn; R20/21/22 | XnR: 20/21/22S: (2-) | Xn; R20/21/22: C ≥ 5 % |
| 603-019-00-8 | dimethyl ether | 204-065-8 | 115-10-6 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 603-020-00-3 | ethyl methyl ether | — | 540-67-0 | F+; R12 | F+R: 12S: (2-)9-16-33 |
| 603-021-00-9 | methyl vinyl ether | 203-475-4 | 107-25-5 | F+; R12 | F+R: 12S: (2-)9-16-33 | D |
| 603-022-00-4 | diethyl ether;ether | 200-467-2 | 60-29-7 | F+; R12R19Xn; R22R66R67 | F+; XnR: 12-19-22-66-67S: (2-)9-16-29-33 |
| 603-023-00-X | ethylene oxide;oxirane | 200-849-9 | 75-21-8 | F+; R12 ⊗Carc. Cat. 2; R45Muta. Cat. 2; R46T; R23Xi; R36/37/38 | F+; TR: 45-46-12-23-36/37/38S: 53-45 | E |
| 603-024-00-5 | 1,4-dioxane | 204-661-8 | 123-91-1 | F; R11-19Carc. Cat. 3; R40Xi; R36/37R66 | F; XnR: 11-19-36/37-40-66S: (2-)9-16-36/37-46 | D |
| 603-025-00-0 | tetrahydrofuran | 203-726-8 | 109-99-9 | F; R11-19Xi; R36/37 | F; XiR: 11-19-36/37S: (2-)16-29-33 | Xi; R36/37: C ≥ 25 % |
| 603-026-00-6 | 1-chloro-2,3-epoxypropane;epichlorhydrin | 203-439-8 | 106-89-8 | R10Carc. Cat. 2; R45T; R23/24/25C; R34R43 | TR: 45-10-23/24/25-34-43S: 53-45 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,1 % ≤ C < 1 % | E |
| 603-027-00-1 | ethanediol;ethylene glycol | 203-473-3 | 107-21-1 | Xn; R22 | XnR: 22S: (2-) |
| 603-028-00-7 | 2-chloroethanol;ethylene chlorohydrin | 203-459-7 | 107-07-3 | T+; R26/27/28 | T+R: 26/27/28S: (1/2-)7/9-28-45 |
| 603-029-00-2 | bis(2-chloroethyl) ether | 203-870-1 | 111-44-4 | R10 ⊗Carc. Cat. 3; R40T+; R26/27/28 | T+R: 10-26/27/28-40S: (1/2-)7/9-27-28-36/37-45 |
| 603-030-00-8 | 2-aminoethanol;ethanolamine | 205-483-3 | 141-43-5 | Xn; R20/21/22C; R34 | CR: 20/21/22-34S: (1/2-)26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 603-031-00-3 | 1,2-dimethoxyethane;ethylene glycol dimethyl ether;EGDME | 203-794-9 | 110-71-4 | F; R11R19Repr. Cat. 2; R60Repr. Cat. 2; R61Xn; R20 | F; TR: 60-61-11-19-20S: 53-45 | E |
| 603-032-00-9 | ethylene dinitrate;ethylene glycol dinitrate | 211-063-0 | 628-96-6 | E; R2 ⊗T+; R26/27/28R33 | E; T+R: 2-26/27/28-33S: (1/2-)33-35-36/37-45 |
| 603-033-00-4 | oxydiethylene dinitrate;diethylene glycol dinitrate;digol dinitrate | 211-745-8 | 693-21-0 | E; R3T+; R26/27/28R33R52-53 | E; T+R: 3-26/27/28-33-52/53S: (1/2-)33-35-36/37-45-61 |
| 603-034-00-X | glycerol trinitrate;nitroglycerine | 200-240-8 | 55-63-0 | E; R3T+; R26/27/28R33N; R51-53 | E; T+; NR: 3-26/27/28-33-51/53S: (1/2-)33-35-36/37-45-61 |
| 603-035-00-5 | pentaerythritol tetranitrate;P.E.T.N. | 201-084-3 | 78-11-5 | E; R3 | ER: 3S: (2-)35 |
| 603-036-00-0 | mannitol hexanitrate;nitromannite | 239-924-6 | 15825-70-4 | E; R3 | ER: 3S: (2-)35 |
| 603-037-00-6 | cellulose nitrate;nitrocellulose, containing more than 12,6 % nitrogen | — | — | E; R3 ⊗R1 | ER: 1-3S: (2-)35 |
| 603-037-01-3 | cellulose nitrate;nitrocellulose, containing a maximum of 12,6 % nitrogen | — | — | F; R11 ⊗ | FR: 11S: (2-)16-33-37/39 |
| 603-038-00-1 | allyl glycidyl ether;allyl 2,3-epoxypropyl ether;prop-2-en-1-yl 2,3-epoxypropyl ether | 203-442-4 | 106-92-3 | R10Carc. Cat. 3; R40Muta. Cat. 3; R68Repr. Cat. 3; R62Xn; R20/22Xi; R37/38-41R43R52-53 | XnR: 10-20/22-37/38-40-41-43-52/53-62-68S: (2-)24/25-26-36/37/39-61 |
| 603-039-00-7 | butyl glycidyl ether;butyl 2,3-epoxypropyl ether | 219-376-4 | 2426-08-6 | R10Carc. Cat. 3; R40Muta. Cat. 3; R68Xn; R20/22Xi; R37R43R52-53 | XnR: 10-20/22-37-40-43-52/53-68S: (2-)24/25-36/37-61 |
| 603-040-00-2 | sodium methanolate;sodium methoxide; [1]potassium methanolate;potassium methoxide; [2]lithium methanolate;lithium methoxide [3] | 204-699-5 [1]212-736-1 [2]212-737-7 [3] | 124-41-4 [1]865-33-8 [2]865-34-9 [3] | F; R11C; R34R14 | F; CR: 11-14-34S: (1/2-)8-16-26-43-45 |
| 603-041-00-8 | potassium ethanolate;potassium ethoxide; [1]sodium ethanolate;sodium ethoxide [2] | 213-029-0 [1]205-487-5 [2] | 917-58-8 [1]141-52-6 [2] | F; R11C; R34R14 | F; CR: 11-14-34S: (1/2-)8-16-26-43-45 |
| 603-042-00-3 | aluminium-tri-isopropoxide | 209-090-8 | 555-31-7 | F; R11 | FR: 11S: (2-)8-16 |
| 603-043-00-9 | triarimol (ISO);2,4-dichloro-α-(pyrimidin-5-yl) benzhydryl alcohol | — | 26766-27-8 | Xn; R22 | XnR: 22S: (2-) |
| 603-044-00-4 | dicofol (ISO);2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol | 204-082-0 | 115-32-2 | Xn; R21/22Xi; R38R43N; R50-53 | Xn; NR: 21/22-38-43-50/53S: (2-)36/37-60-61 |
| 603-045-00-X | diisopropyl ether; [1]dipropyl ether [2] | 203-560-6 [1]203-869-6 [2] | 108-20-3 [1]111-43-3 [2] | F; R11R19R66R67 | FR: 11-19-66-67S: (2-)9-16-29-33 | C |
| 603-046-00-5 | bis (chloromethyl) ether;oxybis(chloromethane) | 208-832-8 | 542-88-1 | R10 ⊗Carc. Cat. 1; R45T+; R26T; R24Xn; R22 | T+R: 45-10-22-24-26S: 53-45 | Carc. Cat. 1; R45: C ≥ 0,001 % | E |
| 603-047-00-0 | 2-dimethylaminoethanol;N,N-dimethylethanolamine | 203-542-8 | 108-01-0 | R10Xn; R20/21/22C; R34 | CR: 10-20/21/22-34S: (1/2-)25-26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 603-048-00-6 | 2-diethylaminoethanol;N,N-diethylethanolamine | 202-845-2 | 100-37-8 | R10Xn; R20/21/22C; R34 | CR: 10-20/21/22-34S: (1/2-)25-26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 603-049-00-1 | chlorfenethol (ISO);1,1-bis (4-chlorophenyl) ethanol | 201-246-3 | 80-06-8 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)36-61 |
| 603-050-00-7 | 1-(2-Butoxypropoxy)propan-2-ol | 246-011-6 | 24083-03-2 | Xn; R21/22 | XnR: 21/22S: (2-) |
| 603-051-00-2 | 2-ethylbutan-1-ol | 202-621-4 | 97-95-0 | Xn; R21/22 | XnR: 21/22S: (2-) |
| 603-052-00-8 | 3-butoxypropan-2-ol;propylene glycol monobutyl ether | 225-878-4 | 5131-66-8 | Xi; R36/38 | XiR: 36/38S: (2-) |
| 603-053-00-3 | 2-methylpentane-2,4-diol | 203-489-0 | 107-41-5 | Xi; R36/38 | XiR: 36/38S: (2-) | Xi; R36/38: C ≥ 10 % |
| 603-054-00-9 | di-n-butyl ether;dibutyl ether | 205-575-3 | 142-96-1 | R10Xi; R36/37/38R52-53 | XiR: 10-36/37/38-52/53S: (2-)61 | Xi; R36/37/38: C ≥ 10 % |
| 603-055-00-4 | propylene oxide;1,2-epoxypropane;methyloxirane | 200-879-2 | 75-56-9 | F+; R12Carc. Cat. 2; R45Muta. Cat. 2; R46Xn; R20/21/22Xi; R36/37/38 | F+; TR: 45-46-12-20/21/22-36/37/38S: 53-45 | E |
| 603-056-00-X | [(p-tolyloxy)methyl]oxirane; [1][(m-tolyloxy)methyl]oxirane; [2]2,3-epoxypropyl o-tolyl ether; [3][(tolyloxy)methyl]oxirane;cresyl glycidyl ether [4] | 218-574-8 [1]218-575-3 [2]218-645-3 [3]247-711-4 [4] | 2186-24-5 [1]2186-25-6 [2]2210-79-9 [3]26447-14-3 [4] | Muta. Cat. 3; R68Xi; R38R43N; R51-53 | Xn; NR: 38-43-51/53-68S: (2-)36/37-61 | C |
| 603-057-00-5 | benzyl alcohol | 202-859-9 | 100-51-6 | Xn; R20/22 | XnR: 20/22S: (2-)26 |
| 603-058-00-0 | 1,3-propylene oxide | 207-964-3 | 503-30-0 | F; R11Xn; R20/21/22 | F; XnR: 11-20/21/22S: (2-)9-16-26-29 |
| 603-059-00-6 | hexan-1-ol | 203-852-3 | 111-27-3 | Xn; R22 | XnR: 22S: (2-)24/25 |
| 603-060-00-1 | 2,2'-bioxirane;1,2:3,4-diepoxybutane | 215-979-1 | 1464-53-5 | Carc. Cat. 2; R45Muta. Cat. 2; R46T+; R26T; R24/25C; R34 | T+R: 45-46-24/25-26-34S: 53-45 | E |
| 603-061-00-7 | tetrahydro-2-furylmethanol;tetrahydrofurfuryl alcohol | 202-625-6 | 97-99-4 | Xi; R36 | XiR: 36S: (2-)39 | Xi; R36: C ≥ 10 % |
| 603-062-00-2 | tetrahydrofuran-2,5-diyldimethanol | 203-239-0 | 104-80-3 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)39 | Xi; R36/37/38: C ≥ 10 % |
| 603-063-00-8 | 2,3-epoxypropan-1-ol;glycidol;oxiranemethanol | 209-128-3 | 556-52-5 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 2; R60T; R23Xn; R21/22Xi; R36/37/38 | TR: 45-60-21/22-23-36/37/38-68S: 53-45 | E |
| 603-064-00-3 | 1-methoxy-2-propanol;monopropylene glycol methyl ether | 203-539-1 | 107-98-2 | R10 | R: 10S: (2-)24 |
| 603-065-00-9 | resorcinol diglycidyl ether;1,3-bis(2,3-epoxypropoxy)benzene | 202-987-5 | 101-90-6 | Carc. Cat. 3; R40Muta. Cat. 3; R68Xn; R21/22Xi; R36/38R43R52-53 | XnR: 21/22-36/38-40-43-52/53-68S: (2-)23-36/37-61 |
| 603-066-00-4 | 1,2-epoxy-4-epoxyethylcyclohexane;vinylcyclohexane diepoxide | 203-437-7 | 106-87-6 | T; R23/24/25Xn; R68 | TR: 23/24/25-68S: (1/2-)23-24-45 | T; R23/24/25: C ≥ 1 %:Xn; R20/21/22: 0,1 % ≤ C < 1 % |
| 603-067-00-X | phenyl glycidyl ether;2,3-epoxypropyl phenyl ether;1,2-epoxy-3-phenoxypropane | 204-557-2 | 122-60-1 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20Xi; R37/38R43R52-53 | TR: 45-20-37/38-43-68-52/53S: 53-45-61 | E |
| 603-068-00-5 | 2,3-epoxypropyl-2-ethylcyclohexyl ether;ethylcyclohexylglycidyl ether | — | 130014-35-6 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)26-28-37/39 |
| 603-069-00-0 | 2,4,6-tris(dimethylaminomethyl)phenol | 202-013-9 | 90-72-2 | Xn; R22Xi; R36/38 | XnR: 22-36/38S: (2-)26-28 |
| 603-070-00-6 | 2-amino-2-methylpropanol | 204-709-8 | 124-68-5 | Xi; R36/38R52-53 | XiR: 36/38-52/53S: (2-)61 | Xi; R36/38: C ≥ 10 % |
| 603-071-00-1 | 2,2'-iminodiethanol;diethanolamine | 203-868-0 | 111-42-2 | Xn; R22-48/22Xi; R38-41 | XnR: 22-38-41-48/22S: (2-)26-36/37/39-46 |
| 603-072-00-7 | 1,4-bis(2,3 epoxypropoxy)butane;butanedioldiglycidyl ether | 219-371-7 | 2425-79-8 | Xn; R20/21Xi; R36/38R43 | XnR: 20/21-36/38-43S: (2-)26-28-37/39 |
| 603-073-00-2 | bis-[4-(2,3-epoxipropoxi)phenyl]propane | 216-823-5 | 1675-54-3 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)28-37/39 | Xi; R36/38: C ≥ 5 % |
| 603-074-00-8 | reaction product: bisphenol-A-(epichlorhydrin);epoxy resin (number average molecular weight ≤ 700) | 500-033-5 | 25068-38-6 | Xi; R36/38R43N; R51-53 | Xi; NR: 36/38-43-51/53S: (2-)28-37/39-61 | Xi; R36/38: C ≥ 5 % |
| 603-075-00-3 | chlormethyl methyl ether;chlorodimethyl ether | 203-480-1 | 107-30-2 | F; R11Carc. Cat. 1; R45Xn; R20/21/22 | F; TR: 45-11-20/21/22S: 53-45 | E |
| 603-076-00-9 | but-2-yne-1,4-diol;2-butyne-1,4-diol | 203-788-6 | 110-65-6 | C; R34T; R23/25Xn; R21-48/22R43 | C; TR: 21-23/25-34-43-48/22S: (1/2-)25-26-36/37/39-45-46 | C; R34: C ≥ 50 %Xi; R36/38: 25 % ≤ C < 50 % | D |
| 603-077-00-4 | 1-dimethylaminopropan-2-ol;dimepranol (INN) | 203-556-4 | 108-16-7 | R10Xn; R22C; R34 | CR: 10-22-34S: (1/2-)23-26-36-45 |
| 603-078-00-X | prop-2-yn-1-ol;propargyl alcohol | 203-471-2 | 107-19-7 | R10T; R23/24/25C; R34N; R51-53 | T; NR: 10-23/24/25-34-51/53S: (1/2-)26-28-36-45-61 |
| 603-079-00-5 | 2,2'-(methylimino)diethanol;N-methyldiethanolamine | 203-312-7 | 105-59-9 | Xi; R36 | XiR: 36S: (2-)24 |
| 603-080-00-0 | 2-methylaminoethanol;N-methylethanolamine;N-methyl-2-ethanolamine;N-methyl-2-amino ethanol;2-(methylamino)ethanol | 203-710-0 | 109-83-1 | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 603-081-00-6 | 2,2'-thiodiethanol;thiodiglycol | 203-874-3 | 111-48-8 | Xi; R36 | XiR: 36S: (2-) |
| 603-082-00-1 | 1-aminopropan-2-ol;isopropanolamine | 201-162-7 | 78-96-6 | C; R34 | CR: 34S: (1/2-)23-26-36-45 |
| 603-083-00-7 | 1,1'-iminodipropan-2-ol;di-isopropanolamine | 203-820-9 | 110-97-4 | Xi; R36 | XiR: 36S: (2-)26 |
| 603-084-00-2 | styrene oxide;(epoxyethyl)benzene;phenyloxirane | 202-476-7 | 96-09-3 | Carc. Cat. 2; R45Xn; R21Xi; R36 | TR: 45-21-36S: 53-45 | E |
| 603-085-00-8 | bronopol (INN);2-bromo-2-nitropropane-1,3-diol | 200-143-0 | 52-51-7 | Xn; R21/22Xi; R37/38-41N; R50 | Xn; NR: 21/22-37/38-41-50S: (2-)26-37/39-61 |
| 603-086-00-3 | ethirimol (ISO);5-butyl-2-ethylamino-6-methylpyrimidin-4-ol | 245-949-3 | 23947-60-6 | Xn; R21 | XnR: 21S: (2-)36/37 |
| 603-087-00-9 | 2-ethylhexane-1,3-diol;octylene glycol;ethoexadiol | 202-377-9 | 94-96-2 | Xi; R41 | XiR: 41S: (2-)25-26-39-46 |
| 603-088-00-4 | 2-(octylthio)ethanol;2-hydroxyethyl octyl sulphide | 222-598-4 | 3547-33-9 | Xi; R41 | XiR: 41S: (2-)26 |
| 603-089-00-X | 7,7-dimethyl-3-oxa-6-azaoctan-1-ol | 400-390-6 | — | C; R35Xn; R22 | CR: 22-35S: (1/2-)26-28-36/37/39-45 |
| 603-090-00-5 | 2-(2-bromoethoxy)anisole | 402-010-4 | 4463-59-6 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 603-091-00-0 | exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol | 402-470-6 | 87172-89-2 | Xn; R22Xi; R41 | XnR: 22-41S: (2-)26-39 |
| 603-092-00-6 | 2-methyl-4-phenylpentanol | 402-770-7 | 92585-24-5 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 603-093-00-1 | cinmethylin (ISO)exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane | 402-410-9 | 87818-31-3 | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)23-61 |
| 603-094-00-7 | 1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane | 241-536-7 | 17557-23-2 | Xi; R38R43 | XiR: 38-43S: (2-)24-37 |
| 603-095-00-2 | 2-(propyloxy)ethanol;EGPE | 220-548-6 | 2807-30-9 | Xn; R21Xi; R36 | XnR: 21-36S: (2-)26-36/37-46 |
| 603-096-00-8 | 2-(2-butoxyethoxy)ethanol;diethylene glycol monobutyl ether | 203-961-6 | 112-34-5 | Xi; R36 | XiR: 36S: (2-)24-26 |
| 603-097-00-3 | 1,1',1''-nitrilotripropan-2-ol;triisopropanolamine | 204-528-4 | 122-20-3 | Xi; R36R52-53 | XiR: 36-52/53S: (2-)26-61 |
| 603-098-00-9 | 2-phenoxyethanol | 204-589-7 | 122-99-6 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)26 |
| 603-099-00-4 | 3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride | 403-440-5 | 93633-79-5 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 603-100-00-8 | 1,2-dimethoxypropane | 404-630-0 | 7778-85-0 | F; R11-19 | FR: 11-19S: (2-)9-16-24/25-33 |
| 603-101-00-3 | tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) | 405-040-6 | — | Xi; R36 | XiR: 36S: (2-)25-26 |
| 603-102-00-9 | 1,2-epoxybutane | 203-438-2 | 106-88-7 | F; R11Carc. Cat. 3; R40Xn; R20/21/22Xi; R36/37/38R52-53 | F; XnR: 11-20/21/22-36/37/38-40-52/53S: (2-)9-16-29-36/37-61 |
| 603-103-00-4 | oxirane, mono[(C12-14-alkyloxy)methyl] derivs. | 271-846-8 | 68609-97-2 | Xi; R38R43 | XiR: 38-43S: (2-)24-37 |
| 603-104-00-X | fenarimol (ISO);2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol | 262-095-7 | 60168-88-9 | Repr. Cat. 3; R62-63R64N; R51-53 | Xn; NR: 51/53-62-63-64S: (2-)36/37-61 |
| 603-105-00-5 | furan | 203-727-3 | 110-00-9 | F+; R12R19Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20/22-48/22Xi; R38R52-53 | F+; TR: 45-12-19-20/22-38-48/22-68-52/53S: 53-45-61 | E |
| 603-106-00-0 | 2-methoxypropanol | 216-455-5 | 1589-47-5 | R10Repr. Cat. 2; R61Xi; R37/38-41 | TR: 61-10-37/38-41S: 53-45 |
| 603-107-00-6 | 2-(2-methoxyethoxy)ethanol;diethylene glycol monomethyl ether | 203-906-6 | 111-77-3 | Repr. Cat. 3; R63 | XnR: 63S: (2-)36/37 |
| 603-108-00-1 | 2-methylpropan-1-ol;iso-butanol | 201-148-0 | 78-83-1 | R10Xi; R37/38-41R67 | XiR: 10-37/38-41-67S: (2-)7/9-13-26-37/39-46 |
| 603-117-00-0 | propan-2-ol;isopropyl alcohol;isopropanol | 200-661-7 | 67-63-0 | F; R11Xi; R36R67 | F; XiR: 11-36-67S: (2-)7-16-24/25-26 |
| 603-118-00-6 | 6-dimethylaminohexan-1-ol | 404-680-3 | 1862-07-3 | Xn; R22C; R34R52-53 | CR: 22-34-52/53S: (1/2-)26-36/37/39-45-61 |
| 603-119-00-1 | 1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) | 405-840-5 | — | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 603-120-00-7 | 2-methyl-5-phenylpentanol | 405-890-8 | 25634-93-9 | Xi; R36/38 | XiR: 36/38S: (2-)26-37 |
| 603-121-00-2 | 4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone | 406-057-1 | 114565-66-1 | Carc. Cat. 3; R40R43R53 | XnR: 40-43-53S: (2-)36/37-61 |
| 603-122-00-8 | sodium 2-ethylhexanolate | 406-150-7 | 38411-13-1 | F; R11C; R34R52-53 | F; CR: 11-34-52/53S: (1/2-)7-26-36/37/39-45-61 |
| 603-123-00-3 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol | 406-330-5 | 122760-84-3 | Xi; R38R43N; R51-53 | Xi; NR: 38-43-51/53S: (2-)24-37-61 |
| 603-124-00-9 | 1,4-bis[2-(vinyloxy)ethoxy]benzene | 406-900-3 | 84563-49-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 603-125-00-4 | 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol | 407-850-5 | 89544-40-1 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)26-39-61 |
| 603-126-00-X | 2-((4-methyl-2-nitrophenyl)amino)ethanol | 408-090-7 | 100418-33-5 | Xn; R22R43R52-53 | XnR: 22-43-52/53S: (2-)36/37-61 |
| 603-127-00-5 | butan-2-ol; [1](S)-butan-2-ol; [2](R)-butan-2-ol; [3](±)-butan-2-ol [4] | 201-158-5 [1]224-168-1 [2]238-967-8 [3]240-029-8 [4] | 78-92-2 [1]4221-99-2 [2]14898-79-4 [3]15892-23-6 [4] | R10Xi; R36/37R67 | XiR: 10-36/37-67S: (2-)7/9-13-24/25-26-46 | C |
| 603-128-00-0 | 2-(phenylmethoxy)naphthalene | 405-490-3 | 613-62-7 | R53 | R: 53S: 61 |
| 603-129-00-6 | 1-tert-butoxypropan-2-ol | 406-180-0 | 57018-52-7 | R10Xi; R41 | XiR: 10-41S: (2-)26-39 |
| 603-130-00-1 | reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) | 406-325-8 | — | Xn; R22R52-53 | XnR: 22-52/53S: (2-)39-61 |
| 603-131-00-7 | reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol;1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) | 407-290-1 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 603-132-00-2 | 2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane | 408-200-3 | 63187-91-7 | Xi; R38-41R52-53 | XiR: 38-41-52/53S: (2-)26-37/39-61 |
| 603-133-00-8 | reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol;3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) | 408-240-1 | — | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-36-61 |
| 603-134-00-3 | reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produced by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6. Linear C12 and C14, 50/50 used. | 410-450-3 | — | R53 | R: 53S: 61 |
| 603-135-00-9 | bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium | 410-500-4 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 603-136-00-4 | 3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol | 410-910-3 | 104226-19-9 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 603-137-00-X | reaction mass of: 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol;1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol | 411-130-6 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 603-138-00-5 | 3-(2,2-dimethyl-3-hydroxypropyl)toluene;(alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol | 403-140-4 | 103694-68-4 | R52-53 | R: 52/53S: 61 |
| 603-139-00-0 | bis(2-methoxyethyl) ether | 203-924-4 | 111-96-6 | R10R19Repr. Cat. 2; R60-61 | TR: 60-61-10-19S: 53-45 |
| 603-140-00-6 | 2,2' -oxybisethanol;diethylene glycol | 203-872-2 | 111-46-6 | Xn; R22 | XnR: 22S: (2-)46 |
| 603-141-00-1 | reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane;dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane | 413-780-6 | — | R52-53 | R: 52/53S: 61 |
| 603-142-00-7 | 2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane | 407-360-1 | 116230-20-7 | Xn; R21/22-48/20Xi; R38-41 | XnR: 21/22-38-41-48/20S: (2-)26-36/37/39 |
| 603-143-00-2 | R-2,3-epoxy-1-propanol | 404-660-4 | 57044-25-4 | E; R2Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 2; R60T; R23Xn; R21/22C; R34 | E; TR: 45-60-2-21/22-23-34-68S: 53-45 | E |
| 603-144-00-8 | reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol;6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol | 413-530-6 | 111850-00-1 | N; R51-53 | NR: 51/53S: 61 |
| 603-145-00-3 | 2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane | 406-970-5 | 129228-11-1 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)36/37-61 |
| 603-146-00-9 | 2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol | 406-080-7 | 83016-70-0 | Xn; R22C; R34R52-53 | CR: 22-34-52/53S: (1/2-)23-26-36/37/39-45-61 |
| 603-147-00-4 | (-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | 406-030-4 | 105812-81-5 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-24-26-37/39-61 |
| 603-148-00-X | 1,4-bis[(vinyloxy)methyl]cyclohexane | 413-370-7 | 17351-75-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 603-149-00-5 | reaction mass of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane | 407-640-3 | 63767-86-2 | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-37-61 |
| 603-150-00-0 | (±) trans-3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol | 411-580-3 | 107898-54-4 | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)24/25-37-60-61 |
| 603-151-00-6 | (±)-2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol | 413-570-4 | — | R52-53 | R: 52/53S: 61 |
| 603-152-00-1 | 2-(4-tert-butylphenyl)ethanol | 410-020-5 | 5406-86-0 | Repr. Cat. 3; R62Xn; R48/22Xi; R41N; R51-53 | Xn; NR: 41-48/22-62-51/53S: (2-)26-36/37/39-61 |
| 603-153-00-7 | 3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol | 410-010-0 | 104333-00-8 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 603-154-00-2 | 1-[(2-tert-butyl)cyclohexyloxy]-2-butanol | 412-300-2 | 139504-68-0 | N; R51-53 | NR: 51/53S: 61 |
| 603-155-00-8 | Reaction products of 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-hydroxyphenol with ((C10-16, rich in C12-13 alkyloxy)methyl)oxyrane | 410-560-1 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 603-156-00-3 | 2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane | 411-210-0 | 89544-48-9 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 603-157-00-9 | 6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol | 411-450-6 | 143747-72-2 | R53 | R: 53S: 61 |
| 603-158-00-4 | reaction mass of 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene | 412-460-3 | — | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 603-159-00-X | 2-cyclododecylpropan-1-ol | 411-410-8 | 118562-73-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 603-160-00-5 | 1,2-diethoxypropane | 412-180-1 | 10221-57-5 | F; R11R19 | FR: 11-19S: (2-)9-16-24-33 |
| 603-161-00-0 | 1,3-diethoxypropane | 413-140-6 | 3459-83-4 | R10 | R: 10S: (2-)9-24 |
| 603-162-00-6 | α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-ω-(nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] | 413-420-8 | 144736-29-8 | C; R34R43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 603-163-00-1 | 2-phenyl-1,3-propanediol | 411-810-2 | 1570-95-2 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 603-164-00-7 | 2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole | 412-420-5 | 133909-99-6 | R53 | R: 53S: 61 |
| 603-165-00-2 | reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol;4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol;4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol;4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol | 417-470-1 | — | Muta. Cat. 3; R68R43 | XnR: 43-68S: (2-)36/37 |
| 603-166-00-8 | R-1-chloro-2,3-epoxypropane | 424-280-2 | 51594-55-9 | R10Carc. Cat. 2; R45T; R23/24/25C; R34R43 | TR: 45-10-23/24/25-34-43S: 53-45 | E |
| 603-167-00-3 | 3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol | 407-920-5 | 6390-69-8 | R53 | R: 53S: 61 |
| 603-168-00-9 | 3-(2-ethylhexyloxy)propane-1,2-diol | 408-080-2 | 70445-33-9 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 603-169-00-4 | (±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | 415-550-0 | 109887-53-8 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-26-39-61 |
| 603-170-00-X | reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol;2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol;2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol | 415-990-3 | 67739-11-1 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 603-171-00-5 | 5-thiazolylmethanol | 414-780-9 | 38585-74-9 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 603-172-00-0 | mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate | 415-180-1 | 773058-82-5 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-26-39-61 |
| 603-173-00-6 | 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane | 421-750-9 | 57280-22-5 | Xi; R36R43 | XiR: 36-43S: (2-)26-36/37 |
| 603-174-00-1 | 4-cyclohexyl-2-methyl-2-butanol | 420-630-3 | 83926-73-2 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 603-175-00-7 | 2-(2-hexyloxyethoxy)ethanol;DEGHE;diethylene glycol monohexyl ether;3,6-dioxa-1-dodecanol;hexyl carbitol;3,6-dioxadodecan-1-ol | 203-988-3 | 112-59-4 | Xn; R21Xi; R41 | XnR: 21-41S: (2-)26-36/37/39-46 |
| 603-176-00-2 | 1,2-bis(2-methoxyethoxy)ethane;TEGDME;triethylene glycol dimethyl ether;triglyme | 203-977-3 | 112-49-2 | R19Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-19-62S: 53-45 |
| 603-177-00-8 | 1-ethoxypropan-2-ol;2PG1EE;1-ethoxy-2-propanol;propylene glycol monoethyl ether; [1]2-ethoxy-1-methylethyl acetate;2PG1EEA [2] | 216-374-5 [1]259-370-9 [2] | 1569-02-4 [1]54839-24-6 [2] | R10R67 | R: 10-67S: (2-)24 |
| 603-178-00-3 | 2-hexyloxyethanol;ethylene glycol monohexyl ether;n-hexylglycol | 203-951-1 | 112-25-4 | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-36/37/39-45 |
| 603-179-00-9 | ergocalciferol (ISO);Vitamin D2 | 200-014-9 | 50-14-6 | T+; R26T; R24/25-48/25 | T+R: 24/25-26-48/25S: (1/2-)28-36/37-45 |
| 603-180-00-4 | colecalciferol;Vitamin D3 | 200-673-2 | 67-97-0 | T+; R26T; R24/25-48/25 | T+R: 24/25-26-48/25S: (1/2-)28-36/37-45 |
| 603-181-00-X | tert-butyl methyl ether;MTBE;2-methoxy-2-methylpropane | 216-653-1 | 1634-04-4 | F; R11Xi; R38 | F; XiR: 11-38S: (2-)9-16-24 |
| 603-183-00-0 | 2-[2-(2-butoxyethoxy)ethoxy]ethanol;TEGBE;triethylene glycol monobutyl ether;butoxytriethylene glycol | 205-592-6 | 143-22-6 | Xi; R41 | XiR: 41S: (2-)26-39-46 | Xi; R41: C ≥ 30 %Xi; R36: 20 % ≤ C < 30 % |
| 603-184-00-6 | 2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol | 416-380-1 | 146925-83-9 | N; R50-53 | NR: 50/53S: 60-61 |
| 603-185-00-1 | 2,4-dichloro-3-ethyl-6-nitrophenol | 420-740-1 | 99817-36-4 | T; R25Xi; R41R43N; R50-53 | T; NR: 25-41-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 603-186-00-7 | trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol | 419-050-3 | 79944-37-9 | R43 | XiR: 43S: (2-)22-24/25-26-37 |
| 603-187-00-2 | 2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride | 419-360-9 | 163661-77-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 603-189-00-3 | reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol | 405-250-8 | — | N; R51-53 | NR: 51/53S: 61 |
| 603-191-00-4 | 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol | 419-740-4 | 137658-79-8 | R53 | R: 53S: 61 |
| 603-195-00-6 | 2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol | 430-810-3 | 154825-62-4 | R52-53 | R: 52/53S: 61 |
| 603-196-00-1 | 2-(7-ethyl-1H-indol-3-yl)ethanol | 431-020-1 | 41340-36-7 | Xn; 22-48/22N; R51-53 | Xn; NR: 22-48/22-51/53S: (2-)36/37/39-61 |
| 603-197-00-7 | tebuconazole (ISO);1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol | 403-640-2 | 107534-96-3 | Repr. Cat. 3; R63Xn; R22N; R51-53 | Xn; NR: 22-51/53-63S: (2-)22-36/37-61 |
| 603-199-00-8 | etoxazol (ISO);(RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole | — | 153233-91-1 | N; R50-53 | NR: 50/53S: 60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 604-001-00-2 | phenol;carbolic acid;monohydroxybenzene;phenylalcohol | 203-632-7 | 108-95-2 | Muta. Cat. 3; R68T; R23/24/25Xn; R48/20/21/22C; R34 | T;R: 23/24/25-34-48/20/21/22-68S: (1/2-)24/25-26-28-36/37/39-45 | T; R23/24/25: C ≥ 10 %Xn; R20/21/22: 3 % ≤ C < 10 %C; R34: C ≥ 3 %Xi; R36/38: 1 % ≤ C < 3 % |
| 604-002-00-8 | pentachlorophenol | 201-778-6 | 87-86-5 | Carc. Cat. 3; R40T+; R26T; R24/25Xi; R36/37/38N; R50-53 | T+; NR: 24/25-26-36/37/38-40-50/53S: (1/2-)22-36/37-45-52-60-61 |
| 604-003-00-3 | sodium pentachlorophenolate; [1]potassium pentachlorophenolate [2] | 205-025-2 [1]231-911-3 [2] | 131-52-2 [1]7778-73-6 [2] | Carc. Cat. 3; R40T+; R26T; R24/25Xi; R36/37/38N; R50-53 | T+; NR: 24/25-26-36/37/38-40-50/53S: (1/2-)22-28-36/37-45-52-60-61 |
| 604-004-00-9 | m-cresol; [1]o-cresol; [2]p-cresol; [3]mix-cresol [4] | 203-577-9 [1]202-423-8 [2]203-398-6 [3]215-293-2 [4] | 108-39-4 [1]95-48-7 [2]106-44-5 [3]1319-77-3 [4] | T; R24/25C; R34 | TR: 24/25-34S: (1/2-)36/37/39-45 | T; R24/25: C ≥ 5 %Xn; R21/22: 1 % ≤ C < 5 %C; R34: C ≥ 5 %Xi; R36/38: 1 % ≤ C < 5 % | C |
| 604-005-00-4 | 1,4-dihydroxybenzene;hydroquinone;quinol | 204-617-8 | 123-31-9 | Carc. Cat. 3; R40Muta. Cat. 3; R68Xn; R22Xi; R41R43N; R50 | Xn; NR: 22-40-41-43-50-68S: (2-)26-36/37/39-61 |
| 604-006-00-X | 3,4-xylenol; [1]2,5-xylenol; [2]2,4-xylenol; [3]2,3-xylenol; [4]2,6-xylenol; [5]xylenol; [6]2,4(or 2,5)-xylenol [7] | 202-439-5 [1]202-461-5 [2]203-321-6 [3]208-395-3 [4]209-400-1 [5]215-089-3 [6]276-245-4 [7] | 95-65-8 [1]95-87-4 [2]105-67-9 [3]526-75-0 [4]576-26-1 [5]1300-71-6 [6]71975-58-1 [7] | T; R24/25C; R34N; R51-53 | T; NR: 24/25-34-51/53S: (1/2-)26-36/37/39-45-61 | C |
| 604-007-00-5 | 2-naphthol | 205-182-7 | 135-19-3 | Xn; R20/22N; R50 | Xn; NR: 20/22-50S: (2-)24/25-61 |
| 604-008-00-0 | 2-chlorophenol; [1]4-chlorophenol; [2]3-chlorophenol; [3]chlorophenol [4] | 202-433-2 [1]203-402-6 [2]203-582-6 [3]246-691-4 [4] | 95-57-8 [1]106-48-9 [2]108-43-0 [3]25167-80-0 [4] | Xn; R20/21/22N; R51-53 | Xn; NR: 20/21/22-51/53S: (2-)28-61 | C |
| 604-009-00-6 | pyrogallol;1,2,3-trihydroxybenzene | 201-762-9 | 87-66-1 | Muta. Cat. 3; R68Xn; R20/21/22R52-53 | XnR: 20/21/22-68-52/53S: (2-)36/37-61 | Xn; R20/21/22: C ≥ 10 % |
| 604-010-00-1 | resorcinol;1,3-benzenediol | 203-585-2 | 108-46-3 | Xn; R22Xi; R36/38N; R50 | Xn; NR: 22-36/38-50S: (2-)26-61 | Xn; R22: C ≥ 10 % |
| 604-011-00-7 | 2,4-dichlorophenol | 204-429-6 | 120-83-2 | T; R24Xn; R22C; R34N; R51-53 | T; NR: 22-24-34-51/53S: (1/2-)26-36/37/39-45-61 |
| 604-012-00-2 | 4-chloro-o-cresol;4-chloro-2-methyl phenol | 216-381-3 | 1570-64-5 | T; R23C; R35N; R50 | T; C; NR: 23-35-50S: (1/2-)26-36/37/39-45-61 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 604-013-00-8 | 2,3,4,6-tetrachlorophenol | 200-402-8 | 58-90-2 | T; R25Xi; R36/38N; R50-53 | T; NR: 25-36/38-50/53S: (1/2-)26-28-37-45-60-61 | T; R25: C ≥ 5 %Xn; R22: 0,5 % ≤ C < 5 %Xi; R36/38: C ≥ 5 % |
| 604-014-00-3 | chlorocresol;4-chloro-m-cresol;4-chloro-3-methylphenol | 200-431-6 | 59-50-7 | Xn; R21/22Xi; R41R43N; R50 | Xn; NR: 21/22-41-43-50S: (2-)26-36/37/39-61 | Xn; R21/22: C ≥ 10 % |
| 604-015-00-9 | 2,2'-methylenebis-(3,4,6-trichlorophenol);hexachlorophene | 200-733-8 | 70-30-4 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)20-37-45-60-61 | T; R24/25: C ≥ 2 %Xn; R21/22: 0,2 % ≤ C < 2 % |
| 604-016-00-4 | 1,2-dihydroxybenzene;pyrocatechol | 204-427-5 | 120-80-9 | Xn; R21/22Xi; R36/38 | XnR: 21/22-36/38S: (2-)22-26-37 |
| 604-017-00-X | 2,4,5-trichlorophenol | 202-467-8 | 95-95-4 | Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-50/53S: (2-)26-28-60-61 | Xn; R22: C ≥ 20 %Xi; R36/38: C ≥ 5 % |
| 604-018-00-5 | 2,4,6-trichlorophenol | 201-795-9 | 88-06-2 | Carc. Cat. 3; R40Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-40-50/53S: (2-)36/37-60-61 |
| 604-019-00-0 | dichlorophen (ISO) | 202-567-1 | 97-23-4 | Xn; R22Xi; R36N; R50-53 | Xn; NR: 22-36-50/53S: (2-)26-60-61 |
| 604-020-00-6 | 2-phenylphenol (ISO);biphenyl-2-ol;2-hydroxybiphenyl; | 201-993-5 | 90-43-7 | Xi; R36/37/38N; R50 | Xi; NR: 36/37/38-50S: (2-)22-61 |
| 604-021-00-1 | sodium 2-biphenylate;2-phenylphenol, sodium salt | 205-055-6 | 132-27-4 | Xn; R22Xi; R37/38-41N; R50 | Xn; NR: 22-37/38-41-50S: (2-)22-26-61 |
| 604-022-00-7 | 2,2-dimethyl-1,3-benzodioxol-4-ol | 400-900-7 | 22961-82-6 | Xi; R41 | XiR: 41S: (2-)24-26-39 |
| 604-023-00-2 | 2,4-dichloro-3-ethylphenol | 401-060-4 | — | C; R34N; R50-53 | C; NR: 34-50/53S: (1/2-)26-36/39-45-60-61 |
| 604-024-00-8 | 4,4-isobutylethylidenediphenol | 401-720-1 | 6807-17-6 | Repr. Cat. 2; R60Xi; R36N; R50-53 | T; NR: 60-36-50/53S: 53-45-60-61 |
| 604-025-00-3 | 2,5-bis(1,1-dimethylbutyl)hydroquinone | 400-220-0 | — | N; R51-53 | NR: 51/53S: 61 |
| 604-026-00-9 | 2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) | 400-270-3 | — | N; R51-53 | NR: 51/53S: 61 |
| 604-027-00-4 | 2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone | 400-530-6 | — | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24/25-26-37-61 |
| 604-028-00-X | 4-amino-3-fluorophenol | 402-230-0 | 399-95-1 | Carc. Cat. 2; R45Xn; R22R43N; R51-53 | T; NR: 45-22-43-51/53S: 53-45-61 | E |
| 604-029-00-5 | 1-naphtol | 201-969-4 | 90-15-3 | Xn; R21/22Xi; R37/38-41 | XnR: 21/22-37/38-41S: (2-)22-26-37/39 |
| 604-030-00-0 | bisphenol A;4,4'-isopropylidenediphenol | 201-245-8 | 80-05-7 | Repr. Cat. 3; R62Xi; R37-41R43 | XnR: 37-41-43-62S: (2-)26-36/37-39-46 |
| 604-031-00-6 | guaiacol | 201-964-7 | 90-05-1 | Xn; R22Xi; R36/38 | XnR: 22-36/38S: (2-)26 |
| 604-032-00-1 | thymol | 201-944-8 | 89-83-8 | Xn; R22C; R34N; R51-53 | C; NR: 22-34-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 604-033-00-7 | isobutyl but-3-enoate | 401-170-2 | 24342-03-8 | R10 | R: 10S: (2-) |
| 604-034-00-2 | 4,4'-thiodi-o-cresol | 403-330-7 | 24197-34-0 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 604-035-00-8 | 4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol | 404-160-6 | — | R43R53 | XR: 43-53S: (2-)24-37-61 |
| 604-036-00-3 | 4,4'-oxybis(ethylenethio)diphenol | 404-590-4 | 90884-29-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 604-037-00-9 | 3,5-xylenol;3,5-dimethylphenol | 203-606-5 | 108-68-9 | T; R24/25C; R34 | TR: 24/25-34S: (1/2-)26-28-36/37/39-45 |
| 604-038-00-4 | 4-chloro-3,5-dimethylphenol; [1]chloroxylenol [2] | 201-793-8 [1]215-316-6 [2] | 88-04-0 [1]1321-23-9 [2] | Xn; R22Xi; R36/38R43 | XnR: 22-36/38-43S: (2-)24-37 |
| 604-039-00-X | ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate;fenoxaprop-ethyl | 266-362-9 | 66441-23-4 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 604-040-00-5 | fomesafen (ISO);5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide | 276-439-9 | 72178-02-0 | Xn; R22 | XnR: 22S: (2-) |
| 604-041-00-0 | acifluorfen (ISO);5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid [1]sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate;acifluorfen-sodium [2] | 256-634-5 [1]263-560-7 [2] | 50594-66-6 [1]62476-59-9 [2] | Xn; R22Xi; R38-41N; R50-53 | Xn; NR: 22-38-41-50/53S: (2-)24-39-60-61 |
| 604-042-00-6 | 4-nitrosophenol | 203-251-6 | 104-91-6 | Muta. Cat. 3; R68Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53-68S: (2-)26-36/37/39-47-49-61 |
| 604-043-00-1 | monobenzone;4-hydroxyphenyl benzyl ether;hydroquinone monobenzyl ether | 203-083-3 | 103-16-2 | Xi; R36R43 | XiR: 36-43S: (2-)24/25-26-37 |
| 604-044-00-7 | mequinol;4-methoxyphenol;hydroquinone monomethyl ether | 205-769-8 | 150-76-5 | Xn; R22Xi; R36R43 | XnR: 22-36-43S: (2-)24/25-26-37/39-46 |
| 604-045-00-2 | 2,3,5-trimethylhydroquinone | 211-838-3 | 700-13-0 | Xn; R20Xi; R37/38-41R43N; R50-53 | Xn; NR: 20-37/38-41-43-50/53S: (2-)24-26-37/39-60-61 |
| 604-046-00-8 | 4-(4-isopropoxyphenylsulfonyl)phenol | 405-520-5 | 95235-30-6 | N; R51-53 | NR: 51/53S: 61 |
| 604-047-00-3 | 4-(4-tolyloxy)biphenyl | 405-730-7 | 51601-57-1 | Xn; R48/22R53 | XnR: 48/22-53S: (2-)22-36-61 |
| 604-048-00-9 | 4,4',4''-(ethan-1,1,1-triyl)triphenol | 405-800-7 | 27955-94-8 | N; R51-53 | NR: 51/53S: 61 |
| 604-049-00-4 | 4-4'-methylenebis(oxyethylenethio)diphenol | 407-480-4 | 93589-69-6 | N; R51-53 | NR: 51/53S: 61 |
| 604-051-00-5 | 3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol | 401-110-5 | 87113-78-8 | R52-53 | R: 52/53S: 61 |
| 604-052-00-0 | 2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) | 403-800-1 | 103597-45-1 | R53 | R: 53S: 61 |
| 604-053-00-6 | 2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol | 410-760-9 | 157661-93-3 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 604-054-00-1 | reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol;4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol | 412-020-0 | — | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 604-055-00-7 | 2,2'-((3,3',5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane | 413-900-7 | 85954-11-6 | Muta. Cat. 3; R68 | XnR: 68S: (2-)22-36-37 |
| 604-056-00-2 | 2-(2-hydroxy-3,5-dinitroanilino)ethanol | 412-520-9 | 99610-72-7 | F; R11Repr. Cat. 3; R62Xn; R22 | F; XnR: 11-22-62S: (2-)22-33-36/37 |
| 604-057-00-8 | reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol;isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol;isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n=5 or 6 | 401-680-5 | — | N; R51-53 | NR: 51/53S: 61 |
| 604-058-00-3 | 1,2-bis(3-methylphenoxy)ethane | 402-730-9 | 54914-85-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 604-059-00-9 | 2-n-hexadecylhydroquinone | 406-400-5 | — | Xn; R48/22Xi; R38R43R53 | XnR: 38-43-48/22-53S: (2-)22-36/37-61 |
| 604-060-00-4 | 9,9-bis(4-hydroxyphenyl)fluorene | 406-950-6 | 3236-71-3 | Xi; R36-38N; R50-53 | Xi; NR: 36/38-50/53S: (2-)26-37-60-61 |
| 604-061-00-X | reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl= 1-methyltridecyl;1-ethyldodecyl;1-propylundecyl;1-butyldecyl;1-pentylnonyl;1-hexyloctyl | 407-740-7 | — | Xi; R38R43R52-53 | XiR: 38-43-52/53S: (2-)24-37-61 |
| 604-062-00-5 | 2,4-dimethyl-6-(1-methyl-pentadecyl)phenol | 411-220-5 | — | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 604-063-00-0 | 5,6-dihydroxyindole | 412-130-9 | 3131-52-0 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-26-36/37/39-61 |
| 604-064-00-6 | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol | 411-380-6 | 147315-50-2 | R53 | R: 53S: 61 |
| 604-065-00-1 | 4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) | 407-460-5 | 111850-25-0 | N; R51-53 | NR: 51/53S: 61 |
| 604-066-00-7 | reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-compound);2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol and 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol;2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol and 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol | 414-550-8 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 604-067-00-2 | reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol];formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2);formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) | 414-520-4 | — | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 |
| 604-068-00-8 | (±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride | 415-170-5 | 90274-24-1 | Xn; R20/22R43 | XnR: 20/22-43S: (2-)24-26-37 |
| 604-069-00-3 | 2-(1-methylpropyl)-4-tert-butylphenol | 421-740-4 | 51390-14-8 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-36/37/39-45-61 |
| 604-070-00-9 | triclosan;2,4,4'-trichloro-2'-hydroxy-diphenyl-ether;5-chloro-2-(2,4-dichlorophenoxy)phenol | 222-182-2 | 3380-34-5 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: 26-39-46-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 605-001-00-5 | formaldehyde ...% | 200-001-8 | 50-00-0 | Carc. Cat. 3; R40T; R23/24/25C; R34R43 | TR: 23/24/25-34-40-43S: (1/2-)26-36/37/39-45-51 | T; R23/24/25: C ≥25 %Xn; R20/21/22: 5 % ≤ C < 25 %C; R34: C ≥25 %Xi; R36/37/38: 5 % ≤ C < 25 %R43: C ≥ 0,2 % | B D |
| 605-002-00-0 | 1,3,5-trioxan;trioxymethylene | 203-812-5 | 110-88-3 | F; R11Repr. Cat. 3; R63Xi; R37 | F; XnR: 11-37-63S: (2-)36/37-46 |
| 605-003-00-6 | acetaldehyde;ethanal | 200-836-8 | 75-07-0 | F+; R12Carc. Cat. 3; R40Xi; R36/37 | F+; XnR: 12-36/37-40S: (2-)16-33-36/37 |
| 605-004-00-1 | 2,4,6-trimethyl-1,3,5-trioxan;paraldehyde | 204-639-8 | 123-63-7 | F; R11 ⊗ | FR: 11S: (2-)9-16-29-33 |
| 605-005-00-7 | 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane;metaldehyde | 203-600-2 | 108-62-3 | R10 ⊗Xn; R22 | XnR: 10-22S: (2-)13-25-46 |
| 605-006-00-2 | butyraldehyde | 204-646-6 | 123-72-8 | F; R11 | FR: 11S: (2-)9-29-33 |
| 605-007-00-8 | 1,1-dimethoxyethane;dimethyl acetal | 208-589-8 | 534-15-6 | F; R11 | FR: 11S: (2-)9-16-33 |
| 605-008-00-3 | acrylaldehyde;acrolein;prop-2-enal | 203-453-4 | 107-02-8 | F; R11T+; R26T; R24/25C; R34N; R50 | F; T+; NR: 11-24/25-26-34-50S: 23-26-28-36/37/39-45-61 | D |
| 605-009-00-9 | crotonaldehyde;2-butenal; [1](E)-2-butenal;(E)-crotonaldehyde [2] | 224-030-0 [1]204-647-1 [2] | 4170-30-3 [1]123-73-9 [2] | F; R11Muta. Cat. 3; R68T+; R26T; R24/25Xn; R48/22Xi; R37/38-41N; R50 | F; T+; NR: 11-24/25-26-37/38-41-48/22-50-68S: (1/2-)26-28-36/37/39-45-61 |
| 605-010-00-4 | 2-furaldehyde | 202-627-7 | 98-01-1 | Carc. Cat. 3; R40T; R23/25Xn; R21Xi; R36/37 | TR: 21-23/25-36/37-40S: (1/2-)26-36/37/39-45 | T; R23/25: C ≥ 5 %Xn; R20/22: 1 % ≤ C < 5 % |
| 605-011-00-X | 2-chlorobenzaldehyde;o-chlorobenzaldehyde | 201-956-3 | 89-98-5 | C; R34 | CR: 34S: (1/2-)26-45 |
| 605-012-00-5 | benzaldehyde | 202-860-4 | 100-52-7 | Xn; R22 | XnR: 22S: (2-)24 |
| 605-013-00-0 | chloralose (INN);(R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose;glucochloralose;anhydroglucochloral | 240-016-7 | 15879-93-3 | Xn; R20/22 | XnR: 20/22S: (2-)16-24/25-28 |
| 605-014-00-6 | chloral hydrate;2,2,2-trichloroethane-1,1-diol | 206-117-5 | 302-17-0 | T; R25Xi; R36/38 | TR: 25-36/38S: (1/2-)25-45 |
| 605-015-00-1 | 1,1-diethoxyethane;acetal | 203-310-6 | 105-57-7 | F; R11Xi; R36/38 | F; XiR: 11-36/38S: (2-)9-16-33 | Xi; R36/38: C ≥ 10 % |
| 605-016-00-7 | glyoxal...%;ethandial...% | 203-474-9 | 107-22-2 | Muta. Cat. 3; R68Xn; R20Xi; R36/38R43 | XnR: 20-36/38-43-68S: (2-)36/37 | Xn; R20: C ≥ 10 %Xi; R36/38: C ≥ 10 % | B |
| 605-017-00-2 | 1,3-dioxolane | 211-463-5 | 646-06-0 | F; R11 | FR: 11S: (2-)16 |
| 605-018-00-8 | propanal;propionaldehyde | 204-623-0 | 123-38-6 | F; R11Xi; R36/37/38 | F; XiR: 11-36/37/38S: (2-)9-16-29 |
| 605-019-00-3 | citral | 226-394-6 | 5392-40-5 | Xi; R38R43 | XiR: 38-43S: (2-)24/25-37 |
| 605-020-00-9 | safrole;5-allyl-1,3-benzodioxole | 202-345-4 | 94-59-7 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R22 | TR: 45-22-68S: 53-45 | E |
| 605-021-00-4 | formaldehyde, reaction products with butylphenol | 294-145-9 | 91673-30-2 | R43 | XiR: 43S: (2-)24-37 |
| 605-022-00-X | glutaral;glutaraldehyde;1,5-pentanedial | 203-856-5 | 111-30-8 | T; R23/25C; R34R42/43N; R50 | T; NR: 23/25-34-42/43-50S: (1/2-)26-36/37/39-45-61 | T; R25: C ≥ 50 %Xn; R22: 2 % ≤ C < 50 %T; R23: C ≥ 25 %Xn; R20: 2 % ≤ C < 25 %C; R34: C ≥ 10 %Xi; R37/38-41: 2 % ≤ C < 10 %Xi; R36/37/38: 0,5 % ≤ C < 2 %R43: C ≥ 0,5 % |
| 605-025-00-6 | chloroacetaldehyde | 203-472-8 | 107-20-0 | Carc. Cat. 3; R40T+; R26T; R24/25C; R34N; R50 | T+; NR: 24/25-26-34-40-50S: (1/2-)26-28-36/37/39-45-61 |
| 605-026-00-1 | 2,5,7,7-tetramethyloctanal | 405-690-0 | 114119-97-0 | Xi; R38R43N; R51-53 | Xi; NR: 38-43-51/53S: (2-)24-37-61 |
| 605-027-00-7 | reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde;3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde | 410-480-7 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 605-028-00-2 | β-methyl-3-(1-methylethyl)-benzenepropanal | 412-050-4 | 125109-85-5 | N; R51-53 | NR: 51/53S: 61 |
| 605-029-00-8 | 2-cyclohexylpropanal | 412-270-0 | 2109-22-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 605-030-00-3 | 1-(p-methoxyphenyl)acetaldehyde oxime | 411-510-1 | 3353-51-3 | R43 | XiR: 43S: (2-)24-37 |
| 605-031-00-9 | reaction mass of: 2,2-dimethoxyethanal [(this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70.4 % hydrate;water(Including free water and water in hydrated 2,2-dimethoxyethanal)] | 421-890-0 | — | R43 | XiR: 43S: (2-)24-37 |
| 606-001-00-8 | acetone;propan-2-one;propanone | 200-662-2 | 67-64-1 | F; R11Xi; R36R66R67 | F; XiR: 11-36-66-67S: (2-)9-16-26 |
| 606-002-00-3 | butanone;ethyl methyl ketone | 201-159-0 | 78-93-3 | F; R11Xi; R36R66R67 | F; XiR: 11-36-66-67S: (2-)9-16 |
| 606-003-00-9 | heptan-3-one;butyl ethyl ketone | 203-388-1 | 106-35-4 | R10Xn; R20Xi; R36 | XnR: 10-20-36S: (2-)24 |
| 606-004-00-4 | 4-methylpentan-2-one;isobutyl methyl ketone | 203-550-1 | 108-10-1 | F; R11Xn; R20Xi; R36/37R66 | F; XnR: 11-20-36/37-66S: (2-)9-16-29 |
| 606-005-00-X | 2,6-dimethylheptan-4-one;di-isobutyl ketone | 203-620-1 | 108-83-8 | R10Xi; R37 | XiR: 10-37S: (2-)24 | Xi; R37: C ≥ 10 % |
| 606-006-00-5 | pentan-3-one;diethyl ketone | 202-490-3 | 96-22-0 | F; R11Xi; R37R66R67 | F; XiR: 11-37-66-67S: (2-)9-16-25-33 |
| 606-007-00-0 | 3-methylbutan-2-one;methyl isopropyl ketone | 209-264-3 | 563-80-4 | F; R11 | FR: 11S: (2-)9-16-33 |
| 606-009-00-1 | 4-methylpent-3-en-2-one;mesityl oxide | 205-502-5 | 141-79-7 | R10Xn; R20/21/22 | XnR: 10-20/21/22S: (2-)25 | Xn; R20/21/22: C ≥ 5 % |
| 606-010-00-7 | cyclohexanone | 203-631-1 | 108-94-1 | R10Xn; R20 | XnR: 10-20S: (2-)25 |
| 606-011-00-2 | 2-methylcyclohexanone | 209-513-6 | 583-60-8 | R10Xn; R20 | XnR: 10-20S: (2-)25 |
| 606-012-00-8 | 3,5,5-trimethylcyclohex-2-enone;isophorone | 201-126-0 | 78-59-1 | Carc. Cat. 3; R40Xn; R21/22Xi; R36/37 | XnR: 21/22-36/37-40S: (2-)13-23-36/37/39-46 | Xi; R36/37: C ≥ 10 % |
| 606-013-00-3 | p-benzoquinone;quinone | 203-405-2 | 106-51-4 | T; R23/25Xi; R36/37/38N; R50 | T; NR: 23/25-36/37/38-50S: (1/2-)26-28-45-61 |
| 606-014-00-9 | chlorophacinone (ISO);2-(2-(4-chlorophenyl)phenylacetyl)indan-1,3-dione | 223-003-0 | 3691-35-8 | T+; R27/28T; R23-48/24/25N; R50-53 | T+; NR: 23-27/28-48/24/25-50/53S: (1/2-)36/37-45-60-61 |
| 606-016-00-X | pindone (ISO);2-pivaloylindan-1,3-dione | 201-462-8 | 83-26-1 | T; R25-48/25N; R50-53 | T; NR: 25-48/25-50/53S: (1/2-)37-45-60-61 |
| 606-017-00-5 | diketene;diketen | 211-617-1 | 674-82-8 | R10Xn; R20 | XnR: 10-20S: (2-)3 | D |
| 606-018-00-0 | dichlone (ISO);2,3-dichloro-1,4-naphthoquinone | 204-210-5 | 117-80-6 | Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-50/53S: (2-)26-60-61 |
| 606-019-00-6 | chlordecone (ISO);perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one;decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one | 205-601-3 | 143-50-0 | Carc. Cat. 3; R40T; R24/25N; R50-53 | T; NR: 24/25-40-50/53S: (1/2-)22-36/37-45-60-61 |
| 606-020-00-1 | 5-methylheptan-3-one | 208-793-7 | 541-85-5 | R10Xi; R36/37 | XiR: 10-36/37S: (2-)23 | Xi; R36/37: C ≥ 10 % |
| 606-021-00-7 | N-methyl-2-pyrrolidone | 212-828-1 | 872-50-4 | Xi; R36/38 | XiR: 36/38S: (2-)41 | Xi; R36/38: C ≥ 10 % |
| 606-022-00-2 | 1-phenyl-3-pyrazolidone | 202-155-1 | 92-43-3 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 606-023-00-8 | 4-methoxy-4-methylpentan-2-one | 203-512-4 | 107-70-0 | R10Xn; R20 | XnR: 10-20S: (2-)23-24/25 |
| 606-024-00-3 | heptan-2-one;methyl amyl ketone | 203-767-1 | 110-43-0 | R10Xn; R20/22 | XnR: 10-20/22S: (2-)24/25 |
| 606-025-00-9 | cyclopentanone | 204-435-9 | 120-92-3 | R10Xi; R36/38 | XiR: 10-36/38S: (2-)23 |
| 606-026-00-4 | 5-methylhexan-2-one;isoamyl methyl ketone | 203-737-8 | 110-12-3 | R10Xn; R20 | XnR: 10-20S: (2-)23-24/25 |
| 606-027-00-X | heptan-4-one;di-n-propyl ketone | 204-608-9 | 123-19-3 | R10Xn; R20 | XnR: 10-20S: (2-)24/25 |
| 606-028-00-5 | 2,4-dimethylpentan-3-one;di-isopropyl ketone | 209-294-7 | 565-80-0 | F; R11Xn; R20 | F; XnR: 11-20S: (2-)9-16-24/25 |
| 606-029-00-0 | pentane-2,4-dione;acetylacetone | 204-634-0 | 123-54-6 | R10Xn; R22 | XnR: 10-22S: (2-)21-23-24/25 |
| 606-030-00-6 | hexan-2-one;methyl butyl ketone;butyl methyl ketone;methyl-n-butyl ketone | 209-731-1 | 591-78-6 | R10Repr. Cat. 3; R62T; R48/23R67 | TR: 10-48/23-62-67S: (1/2-)36/37-45 |
| 606-031-00-1 | 3-propanolide;1,3-propiolactone | 200-340-1 | 57-57-8 | Carc. Cat. 2; R45T+; R26Xi; R36/38 | T+R: 45-26-36/38S: 53-45 | E |
| 606-032-00-7 | hexachloroacetone | 204-129-5 | 116-16-5 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)24/25-61 |
| 606-033-00-2 | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione;methazole | 243-761-6 | 20354-26-1 | Xn; R21/22Xi; R36/38N; R51-53 | Xn; NR: 21/22-36/38-51/53S: (2-)36/37-61 |
| 606-034-00-8 | metribuzin (ISO);4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one;4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one | 244-209-7 | 21087-64-9 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 606-035-00-3 | chloridazon (ISO);5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one;pyrazon | 216-920-2 | 1698-60-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 606-036-00-9 | quinomethionate;chinomethionat (ISO);6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one | 219-455-3 | 2439-01-2 | Repr. Cat. 3; R62Xn; R20/21/22-48/22Xi; R36R43N; R50-53 | Xn; NR: 20/21/22-36-43-48/22-50/53-62S: (2-)24-37-60-61 |
| 606-037-00-4 | triadimefon (ISO);1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone | 256-103-8 | 43121-43-3 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-37-61 |
| 606-038-00-X | diphacinone (ISO);2-diphenylacetylindan-1,3-dione | 201-434-5 | 82-66-6 | T+; R28T; R48/23/24/25 | T+R: 28-48/23/24/25S: (1/2-)36/37-45 |
| 606-039-00-5 | 5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one | 400-680-2 | — | Xn; R20N; R50-53 | Xn; NR: 20-50/53S: (2-)60-61 |
| 606-040-00-0 | (N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride | 401-840-4 | 55845-90-4 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 606-041-00-6 | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 400-600-6 | 71868-10-5 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 |
| 606-042-00-1 | acetophenone | 202-708-7 | 98-86-2 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)26 |
| 606-043-00-7 | 2,4-di-tert-butylcyclohexanone | 405-340-7 | 13019-04-0 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 606-044-00-2 | 2,4,6-trimethylbenzophenone | 403-150-9 | 954-16-5 | Xn; R22Xi; R36N; R50-53 | Xn; NR: 22-36-50/53S: (2-)26-60-61 |
| 606-045-00-8 | oxadiazon (ISO);3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | 243-215-7 | 19666-30-9 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-046-00-3 | reaction mass of cis- and trans-cyclohexadec-8-en-1-one | 401-700-2 | 3100-36-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-047-00-9 | 2-benzyl-2-dimethylamino-4-morpholinobutyrophenone | 404-360-3 | 119313-12-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-048-00-4 | 2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one | 406-480-1 | — | R53 | R: 53S: 61 |
| 606-049-00-X | 4-(trans-4-propylcyclohexyl)acetophenone | 406-700-6 | 78531-61-0 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 606-050-00-5 | 6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione | 412-480-2 | 72453-58-8 | N; R51-53 | NR: 51/53S: 61 |
| 606-051-00-0 | 4-pentylcyclohexanone | 406-670-4 | 61203-83-6 | N; R51-53 | NR: 51/53S: 61 |
| 606-052-00-6 | 4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone | 410-410-5 | 54574-82-2 | R52-53 | R: 52/53S: 61 |
| 606-053-00-1 | flurtamone (ISO);(RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one | — | 96525-23-4 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-054-00-7 | isoxaflutole (ISO);5-cyclopropyl-1,2-oxazol-4-yl α, α,α-trifluoro-2-mesyl-p-tolyl ketone | — | 141112-29-0 | Repr. Cat. 3; R63N; R50-53 | Xn; NR: 50/53-63S: (2-)36/37-60-61 |
| 606-055-00-2 | 1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone | 411-180-9 | 92836-10-7 | Xn; R22-48/22N; R51-53 | Xn; NR: 22-48/22-51/53S: (2-)24-36-61 |
| 606-056-00-8 | 4-chloro-3',4'-dimethoxybenzophenone | 404-610-1 | 116412-83-0 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-057-00-3 | 4-propylcyclohexanone | 406-810-4 | 40649-36-3 | Xi; R38R52-53 | XiR: 38-52/53S: (2-)25-37-61 |
| 606-058-00-9 | 4'-fluoro-2,2-dimethoxyacetophenone | 407-500-1 | 21983-80-2 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 606-059-00-4 | 2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride | 412-390-3 | 86386-75-6 | Xn; R22Xi; R41R43 | XnR: 22-41-43S: (2-)22-26-36/37/39 |
| 606-060-00-X | reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane;cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane | 412-950-7 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 606-061-00-5 | (3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone | 423-290-4 | 66938-41-8 | Muta. Cat. 3; R68N; R50-53 | Xn; NR: 68-50/53S: (2-)22-36/37-60-61 |
| 606-062-00-0 | tetrahydrothiopyran-3-carboxaldehyde | 407-330-8 | 61571-06-0 | Repr. Cat. 2; R61Xi; R41R52-53 | TR: 61-41-52/53S: 53-45-61 |
| 606-063-00-6 | (E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal | 410-980-5 | 112704-51-5 | Xi; R36R43 | XiR: 36-43S: (2-)24-26-37 |
| 606-064-00-1 | pregn-5-ene-3,20-dione bis(ethylene ketal) | 407-450-0 | 7093-55-2 | R53 | R: 53S: 61 |
| 606-065-00-7 | 1-(4-morpholinophenyl)butan-1-one | 413-790-0 | — | N; R51-53 | NR: 51/53S: 61 |
| 606-066-00-2 | (E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone | 410-440-9 | 164058-20-2 | N; R51-53 | NR: 51/53S: 61 |
| 606-067-00-8 | reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone;1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone;1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone;1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanone | 414-870-8 | 96792-67-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-068-00-3 | 2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al | 415-770-7 | 1638-05-7 | Xn; R48/22R43R52-53 | XnR: 43-48/22-52/53S: (2-)22-36/37-61 |
| 606-069-00-9 | spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] | 415-460-1 | 154171-76-3 | N; R51-53 | NR: 51/53S: 24-61 |
| 606-070-00-4 | butroxydim (ISO);5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one | 414-790-3 | 138164-12-2 | Repr. Cat. 3; R62-63Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-62-63-50/53S: (2-)22-36/37-60-61 |
| 606-071-00-X | 17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one | 421-050-3 | 13258-43-0 | N; R50-53 | NR: 50/53S: 22-60-61 |
| 606-072-00-5 | 3-acetyl-1-phenyl-pyrrolidine-2,4-dione | 421-600-2 | 719-86-8 | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)22-36/37-61 |
| 606-073-00-0 | 4,4'-bis(dimethylamino)benzophenone;Michler's ketone | 202-027-5 | 90-94-8 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xi; R41 | TR: 45-41-68S: 53-45 |
| 606-075-00-1 | 1-benzyl-5-ethoxyimidazolidine-2,4-dione | 417-340-4 | 65855-02-9 | Xn; R22 | XnR: 22S: (2-)22 |
| 606-076-00-7 | 1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione | 418-630-3 | 136465-99-1 | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 |
| 606-077-00-2 | (3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone | 418-650-2 | 104872-06-2 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-078-00-8 | 1-octylazepin-2-one | 420-040-6 | 59227-88-2 | C; R34R43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-36/37/39-45-61 |
| 606-079-00-3 | 2-n-butyl-benzo[d]isothiazol-3-one | 420-590-7 | 4299-07-4 | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 606-080-00-9 | Reaction product of: 3-hydroxy-5,7-di-tert-butylbenzofuran-2-one with o-xylene | 417-100-9 | — | R53 | R: 53S: 61 |
| 606-081-00-4 | (3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one | 419-790-7 | 4229-69-0 | R43R52-53 | XiR: 43-52/53S: (2-)22-36/37-61 |
| 606-082-00-X | reaction mass of: butan-2-one oxime;syn-O,O'-di(butan-2-one oxime)diethoxysilane | 406-930-7 | T; R48/25R43R52-53 | TR: 43-48/25-52/53S: (1/2-)25-36/37-45-61 |
| 606-083-00-5 | 2-chloro-5-sec-hexadecylhydroquinone | 407-750-1 | 137193-60-3 | Xi; R36/38R43R52-53 | XiR: 36/38-43-52/53S: (2-)24-26-37-61 |
| 606-084-00-0 | 1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione | 414-540-3 | 484-33-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-085-00-6 | (1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one | 418-530-1 | 79200-56-9 | Xn; R22Xi; R41R43 | XnR: 22-41-43S: (2-)24-26-37/39 |
| 606-086-00-1 | 1-(3,3-dimethylcyclohexyl)pent-4-en-1-one | 422-330-8 | 56973-87-6 | N; R51-53 | NR: 51/53S: 61 |
| 606-087-00-7 | 6-ethyl-5-fluoro-4(3H)-pyrimidone | 422-460-5 | 137234-87-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 606-088-00-2 | 2,4,4,7-tetramethyl-6-octen-3-one | 422-520-0 | 74338-72-0 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 606-089-00-8 | reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone;1,4-diamino-2,3-bis-phenoxyanthraquinone | 423-220-2 | 12223-77-7 | R53 | R: 53S: 61 |
| 606-091-00-9 | 6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one | 421-320-0 | 118289-55-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 606-092-00-4 | reaction mass of: (E)-oxacyclohexadec-12-en-2-one;(E)-oxacyclohexadec-13-en-2-one;a) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one | 422-320-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-001-00-0 | formic acid ... % | 200-579-1 | 64-18-6 | C; R35 | CR: 35S: (1/2-)23-26-45 | C; R35: C ≥ 90 %C; R34: 10 % ≤ C < 90 %Xi; R36/38: 2 % ≤ C < 10 % | B |
| 607-002-00-6 | acetic acid ... % | 200-580-7 | 64-19-7 | R10C; R35 | CR: 10-35S: (1/2-)23-26-45 | C; R35: C ≥ 90 %C; R34: 25 % ≤ C < 90 %Xi; R36/38: 10 % ≤ C < 25 % | B |
| 607-003-00-1 | chloroacetic acid | 201-178-4 | 79-11-8 | T; R25C; R34N; R50 | T; NR: 25-34-50S: (1/2-)23-37-45-61 |
| 607-004-00-7 | TCA (ISO);trichloroacetic acid | 200-927-2 | 76-03-9 | C; R35N; R50-53 | C; NR: 35-50/53S: (1/2-)26-36/37/39-45-60-61 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 607-005-00-2 | TCA-sodium (ISO);sodium trichloroacetate | 211-479-2 | 650-51-1 | Xi; R37N; R50-53 | Xi; NR: 37-50/53S: (2-)46-60-61 |
| 607-006-00-8 | oxalic acid | 205-634-3 | 144-62-7 | Xn; R21/22 | XnR: 21/22S: (2-)24/25 | Xn; R21/22: C ≥ 5 % |
| 607-007-00-3 | salts of oxalic acid | — | — | Xn; R21/22 | XnR: 21/22S: (2-)24/25 | Xn; R21/22: C ≥ 5 % | A |
| 607-008-00-9 | acetic anhydride | 203-564-8 | 108-24-7 | R10Xn; R20/22C; R34 | CR: 10-20/22-34S: (1/2-)26-36/37/39-45 | C; R34: C ≥ 25 %Xi; R37/38-41: 5 % ≤ C < 25 %Xi; R36: 1 % ≤ C < 5 % |
| 607-009-00-4 | phthalic anhydride | 201-607-5 | 85-44-9 | Xn; R22Xi; R37/38-41R42/43 | XnR: 22-37/38-41-42/43S: (2-)23-24/25-26-37/39-46 |
| 607-010-00-X | propionic anhydride | 204-638-2 | 123-62-6 | C; R34 | CR: 34S: (1/2-)26-45 | C; R34: C ≥ 25 %Xi; R36/38: 10 % ≤ C < 25 % |
| 607-011-00-5 | acetyl chloride | 200-865-6 | 75-36-5 | F; R11R14C; R34 | F; CR: 11-14-34S: (1/2-)9-16-26-45 |
| 607-012-00-0 | benzoyl chloride | 202-710-8 | 98-88-4 | C; R34 | CR: 34S: (1/2-)26-45 |
| 607-013-00-6 | dimethyl carbonate | 210-478-4 | 616-38-6 | F; R11 | FR: 11S: (2-)9-16 |
| 607-014-00-1 | methyl formate | 203-481-7 | 107-31-3 | F+; R12Xn; R20/22Xi; R36/37 | F+; XnR: 12-20/22-36/37S: (2-)9-16-24-26-33 |
| 607-015-00-7 | ethyl formate | 203-721-0 | 109-94-4 | F; R11Xn; R20/22Xi; R36/37 | F; XnR: 11-20/22-36/37S: (2-)9-16-24-26-33 |
| 607-016-00-2 | propyl formate; [1]isopropyl formate [2] | 203-798-0 [1]210-901-2 [2] | 110-74-7 [1]625-55-8 [2] | F; R11Xi; R36/37R67 | F; XiR: 11-36/37-67S: (2-)9-16-24-33 | C |
| 607-017-00-8 | butyl formate; [1]tert-butyl formate; [2]isobutyl formate [3] | 209-772-5 [1]212-105-0 [2]208-818-1 [3] | 592-84-7 [1]762-75-4 [2]542-55-2 [3] | F; R11Xi; R36/37 | F; XiR: 11-36/37S: (2-)9-16-24-33 | C |
| 607-018-00-3 | isopentyl formate; [1]pentyl formate; [2]2-methylbutyl formate [3] | 203-769-2 [1]211-340-6 [2]252-343-2 [3] | 110-45-2 [1]638-49-3 [2]35073-27-9 [3] | R10Xi; R36/37 | XiR: 10-36/37S: (2-)24 | C |
| 607-019-00-9 | methyl chloroformate | 201-187-3 | 79-22-1 | F; R11T+; R26Xn; R21/22C; R34 | F; T+R: 11-21/22-26-34S: (1/2-)14-26-28-36/37/39-45-46-63 |
| 607-020-00-4 | ethyl chloroformate | 208-778-5 | 541-41-3 | F; R11T+; R26Xn; R22C; R34 | F; T+R: 11-22-26-34S: (1/2-)9-16-26-28-33-36/37/39-45 |
| 607-021-00-X | methyl acetate | 201-185-2 | 79-20-9 | F; R11Xi; R36R66R67 | F; XiR: 11-36-66-67S: (2-)16-26-29-33 |
| 607-022-00-5 | ethyl acetate | 205-500-4 | 141-78-6 | F; R11Xi; R36R66R67 | F; XiR: 11-36-66-67S: (2-)16-26-33 |
| 607-023-00-0 | vinyl acetate | 203-545-4 | 108-05-4 | F; R11 | FR: 11S: (2-)16-23-29-33 | D |
| 607-024-00-6 | propyl acetate; [1]isopropyl acetate [2] | 203-686-1 [1]203-561-1 [2] | 109-60-4 [1]108-21-4 [2] | F; R11Xi; R36R66R67 | F; XiR: 11-36-66-67S: (2-)16-26-29-33 | C |
| 607-025-00-1 | n-butyl acetate | 204-658-1 | 123-86-4 | R10R66R67 | R: 10-66-67S: (2-)25 |
| 607-026-00-7 | sec-butyl acetate; [1]isobutyl acetate; [2]tert-butyl acetate [3] | 203-300-1 [1]203-745-1 [2]208-760-7 [3] | 105-46-4 [1]110-19-0 [2]540-88-5 [3] | F; R11R66 | FR: 11-66S: (2-)16-23-25-29-33 | C |
| 607-027-00-2 | methyl propionate | 209-060-4 | 554-12-1 | F; R11Xn; R20 | F; XnR: 11-20S: (2-)16-24-29-33 |
| 607-028-00-8 | ethyl propionate | 203-291-4 | 105-37-3 | F; R11 | FR: 11S: (2-)16-23-24-29-33 |
| 607-029-00-3 | n-butyl propionate; [1]sec-butyl propionate; [2]tert-butyl propionate; [3]iso-butyl propionate [4] | 209-669-5 [1]- [2]- [3]208-746-0 [4] | 590-01-2 [1]591-34-4 [2]20487-40-5 [3]540-42-1 [4] | R10 | R: 10S: (2-) | C |
| 607-030-00-9 | propyl propionate | 203-389-7 | 106-36-5 | R10Xn; R20 | XnR: 10-20S: (2-)24 |
| 607-031-00-4 | butyl butyrate | 203-656-8 | 109-21-7 | R10 | R: 10S: (2-) | C |
| 607-032-00-X | ethyl acrylate | 205-438-8 | 140-88-5 | F; R11Xn; R20/21/22Xi; R36/37/38R43 | F; XnR: 11-20/21/22-36/37/38-43S: (2-)9-16-33-36/37 | Xi; 36/37/38: C ≥ 5 % | D |
| 607-033-00-5 | n-butyl methacrylate | 202-615-1 | 97-88-1 | R10Xi; R36/37/38R43 | XiR: 10-36/37/38-43S: (2-) | D |
| 607-034-00-0 | methyl acrylate;methyl propenoate | 202-500-6 | 96-33-3 | F; R11Xn; R20/21/22Xi; R36/37/38R43 | F; XnR: 11-20/21/22-36/37/38-43S: (2-)9-25-26-33-36/37-43 | D |
| 607-035-00-6 | methyl methacrylate;methyl 2-methylprop-2-enoate;methyl 2-methylpropenoate | 201-297-1 | 80-62-6 | F; R11Xi; R37/38R43 | F; XiR: 11-37/38-43S: (2-)24-37-46 | D |
| 607-036-00-1 | 2-methoxyethyl acetate;methylglycol acetate | 203-772-9 | 110-49-6 | Repr. Cat. 2; R60-61Xn; R20/21/22 | TR: 60-61-20/21/22S: 53-45 | E |
| 607-037-00-7 | 2-ethoxyethyl acetate;ethylglycol acetate | 203-839-2 | 111-15-9 | ⊗ Repr. Cat. 2; R60-61Xn; R20/21/22 | TR: 60-61-20/21/22S: 53-45 | E |
| 607-038-00-2 | 2-butoxyethyl acetate;butylglycol acetate | 203-933-3 | 112-07-2 | Xn; R20/21 | XnR: 20/21S: (2-)24 |
| 607-039-00-8 | 2,4-D (ISO);2,4-dichlorophenoxyacetic acid | 202-361-1 | 94-75-7 | Xn; R22Xi; R37-41R43R52-53 | XnR: 22-37-41-43-52/53S: (2-)24/25-26-36/37/39-46-61 |
| 607-040-00-3 | salts of 2,4-D | — | — | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24/25-26-36/37/39-46-61 | A |
| 607-041-00-9 | 2,4,5-T (ISO);2,4,5-trichlorophenoxy acetic acid | 202-273-3 | 93-76-5 | Xn; R22Xi; R36/37/38N; R50-53 | Xn; NR: 22-36/37/38-50/53S: (2-)24-60-61 |
| 607-042-00-4 | salts and esters of 2,4,5-T;salts and esters of 2,4,5-trichlorophenoxy acetic acid | — | — | Xn; R22Xi; R36/37/38N; R50-53 | Xn; NR: 22-36/37/38-50/53S: (2-)24-60-61 | A |
| 607-043-00-X | dicamba (ISO);2,5-dichloro-6-methoxybenzoic acid;3,6-dichloro-2-methoxybenzoic acid | 217-635-6 | 1918-00-9 | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)26-61 |
| 607-044-00-5 | 3,6-dichloro-o-anisic acid, compound with dimethylamine (1:1); [1]potassium 3,6-dichloro-o-anisate [2] | 218-951-7 [1]233-002-7 [2] | 2300-66-5 [1]10007-85-9 [2] | Xi; R36R52-53 | XiR: 36-52/53S: (2-)26-61 |
| 607-045-00-0 | dichlorprop (ISO);2-(2,4-dichlorophenoxy) propionic acid | 204-390-5 | 120-36-5 | Xn; R21/22Xi; R38-41 | XnR: 21/22-38-41S: (2-)26-36/37 |
| 607-046-00-6 | salts of dichlorprop | — | — | Xn; R20/21/22 | XnR: 20/21/22S: (2-)13 | A |
| 607-047-00-1 | fenoprop (ISO);2-(2,4,5-trichlorophenoxy)propionic acid | 202-271-2 | 93-72-1 | Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-50/53S: (2-)37-60-61 |
| 607-048-00-7 | salts of fenoprop;salts of 2-(2,4,5-trichlorophenoxy)propionic acid | — | — | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 | A |
| 607-049-00-2 | mecoprop (ISO);2-(4-chloro-o-tolyloxy) propionic acid;(RS)-2-(4-chloro-o-tolyloxy)propionic acid; [1]2-(4-chloro-2-methylphenoxy)propionic acid [2] | 230-386-8 [1]202-264-4 [2] | 7085-19-0 [1]7085-19-0 [2] | Xn; R22Xi; R38-41N; R50-53 | Xn; NR: 22-38-41-50/53S: (2-)13-26-37/39-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 607-050-00-8 | salts of mecoprop | — | — | Xn; R22Xi; R38-41N; R50-53 | Xn; NR: 22-38-41-50/53S: (2-)13-26-37/39-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % | A |
| 607-051-00-3 | MCPA (ISO);4-chloro-o-tolyloxyacetic acid | 202-360-6 | 94-74-6 | Xn; R22Xi; R38-41 | XnR: 22-38-41S: (2-)26-37-39 |
| 607-052-00-9 | salts and esters of MCPA | — | — | Xn; R20/21/22 | XnR: 20/21/22S: (2-)13 | A |
| 607-053-00-4 | MCPB (ISO);4-(4-chloro-o-tolyloxy) butyric acid | 202-365-3 | 94-81-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-054-00-X | salts and esters of MCPB | — | — | Xn; R22 | XnR: 22S: (2-)24/25 | A |
| 607-055-00-5 | endothal-sodium (ISO);disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate | 204-959-8 | 129-67-9 | T; R25Xn; R21Xi; R36/37/38 | TR: 21-25-36/37/38S: (1/2-)36/37/39-45 |
| 607-056-00-0 | warfarin (ISO); [1](S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone; [2](R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] | 201-377-6 [1]226-907-3 [2]226-908-9 [3] | 81-81-2 [1]5543-57-7 [2]5543-58-8 [3] | Repr. Cat. 1; R61T; R48/25R52-53 | TR: 61-48/25-52/53S: 53-45-61 | E |
| 607-057-00-6 | coumachlor (ISO);3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin | 201-378-1 | 81-82-3 | Xn; R48/22R52-53 | XnR: 48/22-52/53S: (2-)37-61 |
| 607-058-00-1 | coumafuryl (ISO);fumarin;(RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin;4-hydroxy-3-[3-oxo-1-(2-furyl) butyl]coumarin | 204-195-5 | 117-52-2 | T; R25-48/25R52-53 | TR: 25-48/25-52/53S: (1/2-)37-45-61 |
| 607-059-00-7 | coumatetralyl;4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin | 227-424-0 | 5836-29-3 | T+; R27/28T; R48/24/25R52-53 | T+R: 27/28-48/24/25-52/53S: (1/2-)28-36/37-45-61 |
| 607-060-00-2 | dicoumarol;4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) | 200-632-9 | 66-76-2 | T; R48/25Xn; R22N; R51-53 | T; NR: 22-48/25-51/53S: (1/2-)37-45-61 |
| 607-061-00-8 | acrylic acid;prop-2-enoic acid | 201-177-9 | 79-10-7 | R10Xn; R20/21/22C; R35N; R50 | C; NR: 10-20/21/22-35-50S: (1/2-)26-36/37/39-45-61 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % | D |
| 607-062-00-3 | n-butyl acrylate | 205-480-7 | 141-32-2 | R10Xi; R36/37/38R43 | XiR: 10-36/37/38-43S: (2-)9 | D |
| 607-063-00-9 | isobutyric acid | 201-195-7 | 79-31-2 | Xn; R21/22 | XnR: 21/22S: (2-) |
| 607-064-00-4 | benzyl chloroformate | 207-925-0 | 501-53-1 | C; R34N; R50-53 | C; NR: 34-50/53S: (1/2-)26-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 607-065-00-X | bromoacetic acid | 201-175-8 | 79-08-3 | T; R23/24/25C; R35N; R50 | T; C; NR: 23/24/25-35-50S: (1/2-)26-36/37/39-45-61 |
| 607-066-00-5 | dichloroacetic acid | 201-207-0 | 79-43-6 | C; R35N; R50 | C; NR: 35-50S: (1/2-)26-45-61 |
| 607-067-00-0 | dichloroacetyl chloride | 201-199-9 | 79-36-7 | C; R35N; R50 | C; NR: 35-50S: (1/2-)9-26-45-61 |
| 607-068-00-6 | iodoacetic acid | 200-590-1 | 64-69-7 | T; R25C; R35 | T; CR: 25-35S: (1/2-)22-36/37/39-45 |
| 607-069-00-1 | ethyl bromoacetate | 203-290-9 | 105-36-2 | T+; R26/27/28 | T+R: 26/27/28S: (1/2-)7/9-26-45 |
| 607-070-00-7 | ethyl chloroacetate | 203-294-0 | 105-39-5 | T; R23/24/25N; R50 | T; NR: 23/24/25-50S: (1/2-)7/9-45-61 |
| 607-071-00-2 | ethyl methacrylate | 202-597-5 | 97-63-2 | F; R11Xi; R36/37/38R43 | F; XiR: 11-36/37/38-43S: (2-)9-16-29-33 | D |
| 607-072-00-8 | 2-hydroxyethyl acrylate | 212-454-9 | 818-61-1 | T; R24C; R34R43N; R50 | T; NR: 24-34-43-50S: (1/2-)26-36/39-45-61 | T; R24: C ≥ 2 %Xn; R21: 0,2 % ≤ C < 2 %R43: C ≥ 0,2 % | D |
| 607-073-00-3 | 4-CPA (ISO);4-chlorophenoxyacetic acid | 204-581-3 | 122-88-3 | Xn; R22 | XnR: 22S: (2-) |
| 607-074-00-9 | chlorfenac (ISO);2,3,6-trichlorophenylacetic acid | 201-599-3 | 85-34-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)36-61 |
| 607-075-00-4 | chlorfenprop-methyl;methyl 2-chloro-3-(4-chlorophenyl)propionate | 238-413-5 | 14437-17-3 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 607-076-00-X | dodine (ISO);;dodecylguanidinium acetate | 219-459-5 | 2439-10-3 | Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-50/53S: (2-)26-60-61 |
| 607-077-00-5 | erbon (ISO);2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate | — | 136-25-4 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 607-078-00-0 | fluenetil (ISO);2-fluoroethyl biphenyl-4-ylacetate | — | 4301-50-2 | T+; R27/28 | T+R: 27/28S: (1/2-)28-36/37-45 |
| 607-079-00-6 | kelevan (ISO);ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate;ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate | — | 4234-79-1 | T; R24Xn; R22N; R51-53 | T; NR: 22-24-51/53S: (1/2-)36/37-45-61 |
| 607-080-00-1 | chloroacetyl chloride | 201-171-6 | 79-04-9 | R14R29T; R23/24/25-48/23C; R35N; R50 | T; C; NR: 14-23/24/25-29-35-48/23-50S: (1/2-)7/8-9-26-36/37/39-45-61 |
| 607-081-00-7 | fluoroacetic acid | 205-631-7 | 144-49-0 | T+; R28N; R50 | T+; NR: 28-50S: (1/2-)20-22-26-45-61 |
| 607-082-00-2 | fluoroacetates, soluble | — | — | T+; R28N; R50 | T+; NR: 28-50S: (1/2-)20-22-26-45-61 | A |
| 607-083-00-8 | 2,4-DB (ISO);4-(2,4-dichlorophenoxy)butyric acid | 202-366-9 | 94-82-6 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)25-29-46-61 |
| 607-084-00-3 | salts of 2,4-DB | — | — | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)26-29-39-46-61 | A |
| 607-085-00-9 | benzyl benzoate | 204-402-9 | 120-51-4 | Xn; R22 | XnR: 22S: (2-)25 |
| 607-086-00-4 | diallyl phthalate | 205-016-3 | 131-17-9 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-60-61 |
| 607-088-00-5 | methacrylic acid;2-methylpropenoic acid | 201-204-4 | 79-41-4 | Xn; R21/22C; R35 | CR: 21/22-35S: (1/2-)26-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % | D |
| 607-089-00-0 | propionic acid ... % | 201-176-3 | 79-09-4 | C; R34 | CR: 34S: (1/2-)23-36-45 | C; R34: C ≥ 25 %Xi; R36/37/38: 10 % ≤ C < 25 % | B |
| 607-090-00-6 | thioglycolic acid | 200-677-4 | 68-11-1 | T; R23/24/25C; R34 | TR: 23/24/25-34S: (1/2-)25-27-28-45 | T; R23/24/25: C ≥ 2 %Xn; R20/21/22: 0,2 % ≤ C < 2 % |
| 607-091-00-1 | trifluoroacetic acid . . . % | 200-929-3 | 76-05-1 | Xn; R20C; R35R52-53 | CR: 20-35-52/53S: (1/2-)9-26-27-28-45-61 | Xn; R20: C ≥ 10 % | B |
| 607-092-00-7 | methyl lactate; [1]methyl (±)-lactate; [2]methyl (R)-lactate; [3]methyl (S)-(-)-lactate [4] | 208-930-0 [1]218-449-8 [2]241-420-6 [3]248-704-9 [4] | 547-64-8 [1]2155-30-8 [2]17392-83-5 [3]27871-49-4 [4] | R10Xi; R36/37 | XiR: 10-36/37S: (2-)24 | C |
| 607-093-00-2 | propionyl chloride | 201-170-0 | 79-03-8 | F; R11R14C; R34 | F; CR: 11-14-34S: (1/2-)9-16-26-45 | B D |
| 607-094-00-8 | peracetic acid . . . % | 201-186-8 | 79-21-0 | R10O; R7Xn; R20/21/22C; R35N; R50 | O; C; NR: 7-10-20/21/22-35-50S: (1/2-)3/7-14-36/37/39-45-61 | Xn; R20/21/22: C ≥ 10 %C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % | B D |
| 607-095-00-3 | maleic acid | 203-742-5 | 110-16-7 | Xn; R22Xi; R36/37/38 | XnR: 22-36/37/38S: (2-)26-28-37 |
| 607-096-00-9 | maleic anhydride | 203-571-6 | 108-31-6 | Xn; R22C; R34R42/43 | CR: 22-34-42/43S: (2-)22-26-36/37/39-45 |
| 607-097-00-4 | benzene-1,2,4-tricarboxylic acid 1,2-anhydride;trimellitic anhydride | 209-008-0 | 552-30-7 | Xi; R37-41R42/43 | XnR: 37-41-42/43S: (2-)22-26-36/37/39 |
| 607-098-00-X | benzene-1,2:4,5-tetracarboxylic dianhydride;benzene-1,2:4,5-tetracarboxylic dianhydride;pyromellitic dianhydride | 201-898-9 | 89-32-7 | Xi; R41R42/43 | XnR: 41-42/43S: (2-)22-24-26-37/39 |
| 607-099-00-5 | 1,2,3,6-tetrahydrophthalic anhydride; [1]cis-1,2,3,6-tetrahydrophthalic anhydride; [2]3,4,5,6-tetrahydrophthalic anhydride; [3]tetrahydrophthalic anhydride [4] | 201-605-4 [1]213-308-7 [2]219-374-3 [3]247-570-9 [4] | 85-43-8 [1]935-79-5 [2]2426-02-0 [3]26266-63-7 [4] | Xi; R41R42/43R52-53 | XnR: 41-42/43-52/53S: (2-)22-24-26-37/39-61 | C |
| 607-100-00-9 | benzophenone-3,3',4,4'-tetracarboxylic dianhydride;4,4'-carbonyldi(phthalic anhydride) | 219-348-1 | 2421-28-5 | Xi; R36/37 | XiR: 36/37S: (2-)25 | Xi; R36/37: C ≥ 1 % |
| 607-101-00-4 | 1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylic anhydride chlorendic anhydride | 204-077-3 | 115-27-5 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)25 | Xi; R36/37/38: C ≥ 1 % |
| 607-102-00-X | cyclohexane-1,2-dicarboxylic anhydride; [1]cis-cyclohexane-1,2-dicarboxylic anhydride; [2]trans-cyclohexane-1,2-dicarboxylic anhydride [3] | 201-604-9 [1]236-086-3 [2]238-009-9 [3] | 85-42-7 [1]13149-00-3 [2]14166-21-3 [3] | Xi; R41R42/43 | XnR: 41-42/43S: (2-)23-24-26-37/39 | C |
| 607-103-00-5 | succinic anhydride | 203-570-0 | 108-30-5 | Xi; R36/37 | XiR: 36/37S: (2-)25 | Xi; R36/37: C ≥ 1 % |
| 607-104-00-0 | cyclopentane-1,2,3,4-tetracarboxylic dianhydride | 227-964-7 | 6053-68-5 | Xi; R36/37 | XiR: 36/37S: (2-)25 | Xi; R36/37: C ≥ 1 % |
| 607-105-00-6 | 8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride; [1]1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; [2](1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] | 204-957-7 [1]212-557-9 [2]220-384-5 [3] | 129-64-6 [1]826-62-0 [2]2746-19-2 [3] | Xi; R41R42/43 | XnR: 41-42/43S: (2-)22-24-26-37/39 | C |
| 607-106-00-1 | 8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride | — | 123748-85-6 | Xn; R22Xi; R36/37/38R42 | XnR: 22-36/37/38-42S: (2-)39 | Xi; R36/37/38: C ≥ 10 % | C |
| 607-107-00-7 | 2-ethylhexyl acrylate | 203-080-7 | 103-11-7 | Xi; R37/38R43 | XiR: 37/38-43S: (2-)36/37-46 | D |
| 607-108-00-2 | 2-hydroxy-1-methylethylacrylate; [1]2-hydroxypropylacrylate; [2]acrylic acid, monoester with propane-1,2-diol [3] | 220-852-9 [1]213-663-8 [2]247-118-0 [3] | 2918-23-2 [1]999-61-1 [2]25584-83-2 [3] | T; R23/24/25C; R34R43 | TR: 23/24/25-34-43S: (1/2-)26-36/37/39-45 | T; R23/24/25: C ≥ 2 %Xn; R20/21/22: 0,2 % ≤ C < 2 %R43: C ≥ 0,2 % | C D |
| 607-109-00-8 | hexamethylene diacrylate;hexane-1,6-diol diacrylate | 235-921-9 | 13048-33-4 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)39 | D |
| 607-110-00-3 | pentaerythritol triacrylate | 222-540-8 | 3524-68-3 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)39 | D |
| 607-111-00-9 | 2,2-bis(acryloyloxymethyl)butyl acrylate;trimethylolpropane triacrylate | 239-701-3 | 15625-89-5 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)39 | D |
| 607-112-00-4 | 2,2-dimethyltrimethylene diacrylate;neopentyl glycol diacrylate | 218-741-5 | 2223-82-7 | T; R24Xi; R36/38R43 | TR: 24-36/38-43S: (1/2-)28-39-45 | T; R24: C ≥ 5 %Xn; R21: 0,2 % ≤ C < 5 % | D |
| 607-113-00-X | isobutyl methacrylate | 202-613-0 | 97-86-9 | R10Xi; R36/37/38R43N; R50 | Xi; NR: 10-36/37/38-43-50S: (2-)24-37-61 | D |
| 607-114-00-5 | ethylene dimethacrylate | 202-617-2 | 97-90-5 | Xi; R37R43 | XiR: 37-43S: (2-)24-37 | Xi; R37: C ≥ 10 % | D |
| 607-115-00-0 | isobutyl acrylate | 203-417-8 | 106-63-8 | R10Xn; R20/21Xi; R38R43 | XnR: 10-20/21-38-43S: (2-)9-24-37 | Xi; R38: C ≥ 10 % | D |
| 607-116-00-6 | cyclohexyl acrylate | 221-319-3 | 3066-71-5 | Xi; R37/38N; R51-53 | Xi; NR: 37/38-51/53S: (2-)61 | Xi; R37/38: C ≥ 10 % | D |
| 607-117-00-1 | 2,3-epoxypropyl acrylate;glycidyl acrylate | 203-440-3 | 106-90-1 | T; R23/24/25C; R34R43 | TR: 23/24/25-34-43S: (1/2-)26-36/37/39-45 | T; R23/24/25: C ≥ 2 %Xn; R20/21/22: 0,2 % ≤ C < 2 %R43: C ≥ 0,2 % | D |
| 607-118-00-7 | 1-methyltrimethylene diacrylate;1,3-butylene glycol diacrylate | 243-105-9 | 19485-03-1 | Xn; R21C; R34R43 | CR: 21-34-43S: (1/2-)26-36/37/39-45 | D |
| 607-119-00-2 | tetramethylene diacrylate;1,4-butyleneglycol diacrylate | 213-979-6 | 1070-70-8 | Xn; R21C; R34R43 | CR: 21-34-43S: (1/2-)26-36/37/39-45 | D |
| 607-120-00-8 | 2,2'-oxydiethyl diacrylate;diethylene glycol diacrylate | 223-791-6 | 4074-88-8 | T; R24Xi; R36/38R43 | TR: 24-36/38-43S: (1/2-)28-39-45 | T; R24: C ≥ 2 %Xn; R21: 0,2 % ≤ C < 2 %R43: C ≥ 0,2 % | D |
| 607-121-00-3 | 8,9,10-trinorborn-2-yl acrylate | — | 10027-06-2 | Xn; R21Xi; R38R43 | XnR: 21-38-43S: (2-)28 | Xi; R38: C ≥ 10 % | D |
| 607-122-00-9 | pentaerythritol tetraacrylate | 225-644-1 | 4986-89-4 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)26-39 | D |
| 607-123-00-4 | 2,3-epoxypropyl methacrylate;glycidyl methacrylate | 203-441-9 | 106-91-2 | Xn; R20/21/22Xi; R36/38R43 | XnR: 20/21/22-36/38-43S: (2-)26-28 | Xi; R36/38: C ≥ 10 % | D |
| 607-124-00-X | 2-hydroxyethyl methacrylate | 212-782-2 | 868-77-9 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)26-28 | D |
| 607-125-00-5 | 2-hydroxypropyl methacrylate; [1]3-hydroxypropyl methacrylate [2] | 213-090-3 [1]220-426-2 [2] | 923-26-2 [1]2761-09-3 [2] | Xi; R36R43 | XiR: 36-43S: (2-)24/25-26-37/39 | C D |
| 607-126-00-0 | 2,2'-(ethylenedioxy)diethyl diacrylate;triethylene glycol diacrylate | 216-853-9 | 1680-21-3 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)26-28 | D |
| 607-127-00-6 | 2-diethylaminoethyl methacrylate | 203-275-7 | 105-16-8 | Xn; R20Xi; R36/38R43 | XnR: 20-36/38-43S: (2-)26 | Xi; R36/38: C ≥ 10 % | D |
| 607-128-00-1 | 2-tert-butylaminoethyl methacrylate | 223-228-4 | 3775-90-4 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)26 | D |
| 607-129-00-7 | ethyl lactate;ethyl DL-lactate; [1]ethyl (S)-2-hydroxypropionate;ethyl L-lactate;ethyl-(S)-lactate [2] | 202-598-0 [1]211-694-1 [2] | 97-64-3 [1]687-47-8 [2] | R10Xi; R37-41 | XiR: 10-37-41S: (2-)24-26-39 | C |
| 607-130-00-2 | pentyl acetate; [1]isopentyl acetate; [2]1-methylbutyl acetate; [3]2-methylbutyl acetat; [4]2(or 3)-methylbutyl acetate [5] | 211-047-3 [1]204-662-3 [2]210-946-8 [3]210-843-8 [4]282-263-3 [5] | 628-63-7 [1]123-92-2 [2]626-38-0 [3]624-41-9 [4]84145-37-9 [5] | R10R66 | R: 10-66S: (2-)23-25 | C |
| 607-131-00-8 | isopentyl propionate; [1]pentyl propionate; [2]2-methylbutyl propionate [3] | 203-322-1 [1]210-852-7 [2]219-449-0 [3] | 105-68-0 [1]624-54-4 [2]2438-20-2 [3] | R10 | R: 10S: (2-)23-24 | C |
| 607-132-00-3 | 2-dimethylaminoethyl methacrylate | 220-688-8 | 2867-47-2 | Xn; R21/22Xi; R36/38R43 | XnR: 21/22-36/38-43S: (2-)26-28 | Xi; R36/38: C ≥ 10 % | D |
| 607-133-00-9 | monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex | — | — | Xi; R36/37/38N; R51-53 | Xi; NR: 36/37/38-51/53S: (2-)26-28-61 | Xi; R36/37/38: C ≥ 10 % | A |
| 607-134-00-4 | monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex | — | — | Xi; R36/37/38 | XiR: 36/37/38S: (2-)26-28 | Xi; R36/37/38: C ≥ 10 % | A |
| 607-135-00-X | butyric acid | 203-532-3 | 107-92-6 | C; R34 | CR: 34S: (1/2-)26-36-45 |
| 607-136-00-5 | butyryl chloride | 205-498-5 | 141-75-3 | F; R11C; R34 | F; CR: 11-34S: (1/2-)16-23-26-36-45 |
| 607-137-00-0 | methyl acetoacetate | 203-299-8 | 105-45-3 | Xi; R36 | XiR: 36S: (2-)26 |
| 607-138-00-6 | butyl chloroformate;chloroformic acid butyl ester | 209-750-5 | 592-34-7 | R10T; R23C; R34 | TR: 10-23-34S: (1/2-)26-36-45 |
| 607-139-00-1 | 2-chloropropionic acid | 209-952-3 | 598-78-7 | Xn; R22C; R35 | CR: 22-35S: (1/2-)23-26-28-36-45 |
| 607-140-00-7 | isobutyryl chloride | 201-194-1 | 79-30-1 | F; R11C; R35 | F; CR: 11-35S: (1/2-)16-23-26-36-45 |
| 607-141-00-2 | oxydiethylene bis(chloroformate) | 203-430-9 | 106-75-2 | Xn; R22Xi; R38-41N; R51-53 | Xn; NR: 22-38-41-51/53S: (2-)23-26-61 |
| 607-142-00-8 | propyl chloroformate;chloroformic acid propylester;n-propyl chloroformate | 203-687-7 | 109-61-5 | R10 ⊗T; R23C; R34 | TR: 10-23-34S: (1/2-)26-36-45 |
| 607-143-00-3 | valeric acid | 203-677-2 | 109-52-4 | C; R34R52-53 | CR: 34-52/53S: (1/2-)26-36-45-61 |
| 607-144-00-9 | adipic acid | 204-673-3 | 124-04-9 | Xi; R36 | XiR: 36S: (2-) |
| 607-145-00-4 | methanesulphonic acid | 200-898-6 | 75-75-2 | C; R34 | CR: 34S: (1/2-)26-36-45 |
| 607-146-00-X | fumaric acid | 203-743-0 | 110-17-8 | Xi; R36 | XiR: 36S: (2-)26 |
| 607-147-00-5 | oxalic acid diethylester;diethyl oxalate | 202-464-1 | 95-92-1 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)23 |
| 607-148-00-0 | guanidinium chloride;guanadine hydrochloride | 200-002-3 | 50-01-1 | Xn; R22Xi; R36/38 | XnR: 22-36/38S: (2-)22 |
| 607-149-00-6 | urethane (INN);ethyl carbamate | 200-123-1 | 51-79-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 607-150-00-1 | endothal (ISO);7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid | 205-660-5 | 145-73-3 | T; R25Xn; R21Xi; R36/37/38 | TR: 21-25-36/37/38S: (1/2-)36/37/39-45 |
| 607-151-00-7 | propargite (ISO);2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite | 219-006-1 | 2312-35-8 | Carc. Cat. 3; R40T; R23Xi; R38-41N; R50-53 | T; NR: 23-38-40-41-50/53S: (1/2-)26-36/37/39-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 607-152-00-2 | 2,3,6-TBA (ISO);2,3,6-trichlorobenzoic acid | 200-026-4 | 50-31-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 607-153-00-8 | benazolin (ISO);4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid | 223-297-0 | 3813-05-6 | Xi; R36/38R52-53 | XiR: 36/38-52/53S: (2-)22-61 |
| 607-154-00-3 | ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate;benzoylprop-ethyl (ISO) | 244-845-5 | 22212-55-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-60-61 |
| 607-155-00-9 | 3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid;blasticidin-s | — | 2079-00-7 | T+; R28 | T+R: 28S: (1/2-)24/25-36/37-45 |
| 607-156-00-4 | chlorfenson (ISO);4-chlorophenyl 4-chlorobenzenesulfonate | 201-270-4 | 80-33-1 | Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-50/53S: (2-)37-60-61 |
| 607-157-00-X | 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin;difenacoum | 259-978-4 | 56073-07-5 | T+; R28T; R48/25N; R50-53 | T+; NR: 28-48/25-50/53S: (1/2-)36/37-45-60-61 |
| 607-158-00-5 | sodium salt of chloroacetic acid;sodium chloroacetate | 223-498-3 | 3926-62-3 | T; R25Xi; R38N; R50 | T; NR: 25-38-50S: (1/2-)22-37-45-61 |
| 607-159-00-0 | chlorobenzilate (ISO);ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate;ethyl 4,4'-dichlorobenzilate | 208-110-2 | 510-15-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 607-160-00-6 | isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate;clofop-isobutyl (ISO) | — | 51337-71-4 | Xn; R22 | XnR: 22S: (2-) |
| 607-161-00-1 | diethanolamine salt of 4-CPA | — | — | Xn; R22 | XnR: 22S: (2-) |
| 607-162-00-7 | 2,2-dichloropropionic acid;dalapon | 200-923-0 | 75-99-0 | Xn; R22Xi; R38-41R52-53 | XnR: 22-38-41-52/53S: (2-)26-39-61 |
| 607-163-00-2 | 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione;dehydracetic acid | 208-293-9 | 520-45-6 | Xn; R22 | XnR: 22S: (2-) |
| 607-164-00-8 | sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate;sodium dehydracetate | 224-580-1 | 4418-26-2 | Xn; R22 | XnR: 22S: (2-) |
| 607-165-00-3 | diclofop-methyl (ISO);methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate;methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate; | 257-141-8 | 51338-27-3 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 607-166-00-9 | medinoterb acetate (ISO);6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate | 219-634-6 | 2487-01-6 | T; R25Xn; R21 | TR: 21-25S: (1/2-)36/37-45 |
| 607-167-00-4 | sodium 3-chloroacrylate | — | 4312-97-4 | Xn; R21/22 | XnR: 21/22S: (2-)36/37 |
| 607-168-00-X | dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate;propylisome | — | 83-59-0 | T; R24Xn; R22N; R50-53 | T; NR: 22-24-50/53S: (1/2-)36/37-45-60-61 |
| 607-169-00-5 | sodium fluoroacetate | 200-548-2 | 62-74-8 | T+; R26/27/28N; R50 | T+; NR: 26/27/28-50S: (1/2-)13-22-36/37-45-61 |
| 607-170-00-0 | bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate;thiocyclam-oxalate | 250-859-2 | 31895-22-4 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-46-60-61 |
| 607-172-00-1 | 4-hydroxy-3-(3-(4'-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin;brodifacoum | 259-980-5 | 56073-10-0 | T+; R27/28T; R48/24/25N; R50-53 | T+; NR: 27/28-48/24/25-50/53S: (1/2-)36/37-45-60-61 |
| 607-173-00-7 | dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate | 400-460-6 | — | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 607-174-00-2 | reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate | 400-580-9 | — | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)28-61 |
| 607-175-00-8 | methyl 2-(2-nitrobenzylidene)acetoacetate | 400-650-9 | 39562-27-1 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-176-00-3 | reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) | 400-830-7 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)36/37-61 |
| 607-177-00-9 | methyl 2-(3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)3-methylureidosulphonyl)benzoate | 401-190-1 | 101200-48-0 | R43 | XiR: 43S: (2-)22-24-37 |
| 607-178-00-4 | methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate | 401-340-6 | 83055-99-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-179-00-X | (benzothiazol-2-ylthio)succinic acid | 401-450-4 | 95154-01-1 | R43 | XiR: 43S: (2-)24-37 |
| 607-180-00-5 | potassium 2-hydroxycarbazole-1-carboxylate | 401-630-2 | 96566-70-0 | Xn; R22Xi; R36/37R52-53 | XnR: 22-36/37-52/53S: (2-)22-26-61 |
| 607-181-00-0 | 3,5-dichloro-2,4-difluorobenzoyl fluoride | 401-800-6 | 101513-70-6 | T; R23C; R34Xn; R22R29R43R52-53 | T; CR: 22-23-29-34-43-52/53S: (1/2-)26-36/37/39-45-61 |
| 607-182-00-6 | methyl 3-sulphamoyl-2-thenoate | 402-050-2 | — | R43 | XiR: 43S: (2-)24-37 |
| 607-183-00-1 | zinc 2-hydroxy-5-C13-18alkylbenzoate | 402-280-3 | — | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-61 |
| 607-184-00-7 | S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate | 402-290-8 | 85702-90-5 | R10R42/43 | XnR: 10-42/43S: (2-)23-24-37 |
| 607-185-00-2 | ethyl trans-3-dimethylaminoacrylate | 402-650-4 | 1117-37-9 | R43 | XiR: 43S: (2-)24-37 |
| 607-186-00-8 | quinclorac (ISO);3,7-dichloroquinoline-8-carboxylic acid | 402-780-1 | 84087-01-4 | R43 | XiR: 43S: (2-)24-37 |
| 607-187-00-3 | bis(2,2,6,6-tetramethyl-4-piperidyl) succinate | 402-940-0 | 62782-03-0 | Xi; R36R52-53 | XiR: 36-52/53S: (2-)26-61 |
| 607-188-00-9 | hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate | 402-970-4 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-189-00-4 | trimethylenediaminetetraacetic acid | 400-400-9 | 1939-36-2 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-60-61 |
| 607-190-00-X | methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) | 401-890-7 | 77402-03-0 | Carc. Cat. 2; R45Muta. Cat. 2; R46Xn; R22Xi; R36 | TR: 45-46-22-36S: 53-45 | E |
| 607-191-00-5 | isobutyl 3,4-epoxybutyrate | 401-920-9 | 100181-71-3 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-28-36/37-60-61 |
| 607-192-00-0 | disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate | 402-360-8 | 92511-22-3 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-194-00-1 | propylene carbonate | 203-572-1 | 108-32-7 | Xi; R36 | XiR: 36S: (2-) |
| 607-195-00-7 | 2-methoxy-1-methylethyl acetate | 203-603-9 | 108-65-6 | R10Xi; R36 | XiR: 10-36S: (2-)25 |
| 607-196-00-2 | heptanoic acid | 203-838-7 | 111-14-8 | C; R34 | CR: 34S: (1/2-)26-28-36/37/39-45 |
| 607-197-00-8 | nonanoic acid | 203-931-2 | 112-05-0 | C; R34 | CR: 34S: (1/2-)26-28-36/37/39-45 |
| 607-198-00-3 | propyl 3,4,5-trihydroxybenzoate | 204-498-2 | 121-79-9 | Xn; R22R43 | XnR: 22-43S: (2-)24-37 |
| 607-199-00-9 | octyl 3,4,5-trihydroxybenzoate | 213-853-0 | 1034-01-1 | Xn; R22R43 | XnR: 22-43S: (2-)24-37 |
| 607-200-00-2 | dodecyl 3,4,5-trihydroxybenzoate | 214-620-6 | 1166-52-5 | R43 | XiR: 43S: (2-)24-37 |
| 607-201-00-8 | thiocarbonyl chloride | 207-341-6 | 463-71-8 | T; R23Xn; R22Xi; R36/37/38 | TR: 22-23-36/37/38S: (1/2-)7-9-36/37-45 |
| 607-203-00-9 | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | 279-452-8 | 80387-97-9 | Repr. Cat. 2; R61R43R52-53 | TR: 61-43-52/53S: 53-45-61 |
| 607-204-00-4 | (chlorophenyl)(chlorotolyl)methane, mixed isomers | 400-140-6 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 607-205-00-X | methyl chloroacetate | 202-501-1 | 96-34-4 | R10T; R23/25Xi; R37/38-41 | TR: 10-23/25-37/38-41S: (1/2-)26-37/39-45 |
| 607-206-00-5 | isopropyl chloroacetate | 203-301-7 | 105-48-6 | R10T; R25Xi; R36/37/38 | TR: 10-25-36/37/38S: (1/2-)26-37/39-45 |
| 607-207-00-0 | haloxyfop-etotyl (ISO)2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate;haloxyfop-(2-ethoxyethyl) | 402-560-5 | 87237-48-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-36-60-61 |
| 607-208-00-6 | 4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers | 403-000-2 | 91853-67-7 | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)37/39-60-61 |
| 607-209-00-1 | reaction mass of O,O'-diisopropyl (pentathio)dithioformate and O,O'-diisopropyl (trithio)dithioformate and O,O'-diisopropyl (tetrathio)dithioformate | 403-030-6 | — | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37-60-61 |
| 607-210-00-7 | methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) | 403-230-3 | 77402-05-2 | Carc. Cat. 2; R45Muta. Cat. 2; R46C; R34R43 | TR: 45-46-34-43S: 53-45 |
| 607-211-00-2 | methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate | 403-270-1 | 6386-39-6 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)36-61 |
| 607-212-00-8 | poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate | 403-300-3 | — | R43 | XiR: 43S: (2-)24-37 |
| 607-213-00-3 | ethyl 3,3-bis(tert-pentylperoxy)butyrate | 403-320-2 | 67567-23-1 | E; R2 ⊗O; R7R10N; R51-53 | E; NR: 2-7-10-51/53S: (2-)3/7-14-33-36/37/39-61 |
| 607-214-00-9 | N,N-hydrazinodiacetic acid | 403-510-5 | 19247-05-3 | T; R25Xn; R48/22R43R52-53 | TR: 25-43-48/22-52/53S: (1/2-)26-36/37/39-45-61 |
| 607-215-00-4 | 3-(3-tert-butyl-4-hydroxyphenyl)propionic acid | 403-920-4 | 107551-67-7 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)25-26-36 |
| 607-216-00-X | glutamic acid, reaction products with N-(C12-14alkyl)propylenediamine | 403-950-8 | — | T+; R26Xn; R22C; R34N; R50-53 | T+; NR: 22-26-34-50/53S: (1/2-)26-36/37/39-38-45-60-61 |
| 607-217-00-5 | 2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate | 403-960-2 | — | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 607-218-00-0 | dichlorprop-P (ISO);(+)-R-2-(2,4-dichlorophenoxy)propionic acid | 403-980-1 | 15165-67-0 | Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43S: (2-)24-26-37/39 |
| 607-219-00-6 | bis(2-ethylhexyl) dithiodiacetate | 404-510-8 | 62268-47-7 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24/25-37-61 |
| 607-221-00-7 | 6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid | 404-550-6 | — | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 607-222-00-2 | 6-(2,3-dimethylmaleimido)hexyl methacrylate | 404-870-6 | 63740-41-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-223-00-8 | transfluthrin (ISO);2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate | 405-060-5 | 118712-89-3 | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)36/37-60-61 |
| 607-224-00-3 | methyl 2-(3-nitrobenzylidene)acetoacetate | 405-270-7 | 39562-17-9 | Xi; R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 607-225-00-9 | 3-azidosulfonylbenzoic acid | 405-310-3 | 15980-11-7 | E; R2Xn; R48/22Xi; R41R43 | E; XnR: 2-41-43-48/22S: (2-)22-26-35-36/37/39 |
| 607-226-00-4 | reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate | 405-360-6 | — | Xi; R38-41R43R52-53 | XiR: 38-41-43-52/53S: (2-)24-26-37/39-61 |
| 607-227-00-X | potassium 2-amino-2-methylpropionate octahydrate | 405-560-3 | 120447-91-8 | Xn; R22C; R35 | CR: 22-35S: (1/2-)26-28-36/37/39-45 |
| 607-228-00-5 | bis(2-methoxyethyl) phthalate | 204-212-6 | 117-82-8 | Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-62S: 53-45 |
| 607-229-00-0 | diethylcarbamoyl chloride | 201-798-5 | 88-10-8 | Carc. Cat. 3; R40Xn; R20/22Xi; R36/37/38 | XnR: 20/22-36/37/38-40S: (2-)26-36/37 |
| 607-230-00-6 | 2-ethylhexanoic acid | 205-743-6 | 149-57-5 | Repr. Cat. 3; R63 | XnR: 63S: (2-)36/37 |
| 607-231-00-1 | 3,6-dichloropyridine-2-carboxylic acid;clopyralid | 216-935-4 | 1702-17-6 | Xi; R41N; R51-53 | X; NR: 41-51/53S: (2-)26-39-61 |
| 607-232-00-7 | pyridate (ISO);O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate | 259-686-7 | 55512-33-9 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 607-233-00-2 | hexyl acrylate | 219-698-5 | 2499-95-8 | Xi; R36/37/38R43N; R51-53 | Xi; NR: 36/37/38-43-51/53S: (2-)24-26-37-61 |
| 607-234-00-8 | flurenol (ISO);9-hydroxy-9H-fluorene-9-carboxylic acid | 207-397-1 | 467-69-6 | N; R51-53 | NR: 51/53S: 61 |
| 607-235-00-3 | mecrilate;methyl 2-cyanoacrylate | 205-275-2 | 137-05-3 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)23-24/25-26 | Xi; R36/37/38: C ≥ 10 % |
| 607-236-00-9 | ethyl 2-cyanoacrylate | 230-391-5 | 7085-85-0 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)23-24/25-26 | Xi; R36/37/38: C ≥ 10 % |
| 607-237-00-4 | benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate;flurazole | 276-942-3 | 72850-64-7 | N; R51-53 | NR: 51/53S: 61 |
| 607-238-00-X | tau-fluvalinate (ISO);cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate | — | 102851-06-9 | Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-50/53S: (2-)24-59-61 |
| 607-239-00-5 | fenpropathrin (ISO);α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate; | 254-485-0 | 39515-41-8 | T+; R26T; R25Xn; R21N; R50-53 | T+; NR: 21-25-26-50/53S: (1/2-)28-36/37-38-45-60-61 |
| 607-240-00-0 | cis-1,2,3,6-tetrahydro-4-methylphthalic anhydride; [1]1,2,3,6-tetrahydro-4-methylphthalic anhydride; [2]1,2,3,6-tetrahydro-3-methylphthalic anhydride; [3]tetrahydromethylphthalic anhydride; [4]1,2,3,6-tetrahydromethylphthalic anhydride; [5]tetrahydro-4-methylphthalic anhydride; [6]2,3,5,6-tetrahydro-2-methylphthalic anhydride [7] | 216-906-6 [1]222-323-8 [2]226-247-6 [3]234-290-7 [4]247-830-1 [5]251-823-9 [6]255-853-3 [7] | 1694-82-2 [1]3425-89-6 [2]5333-84-6 [3]11070-44-3 [4]26590-20-5 [5]34090-76-1 [6]42498-58-8 [7] | Xi; R41R42/43 | XnR: 41-42/43S: (2-)22-24-26-37/39 | C |
| 607-241-00-6 | hexahydro-4-methylphthalic anhydride; [1]hexahydromethylphthalic anhydride; [2]hexahydro-1-methylphthalic anhydride; [3]hexahydro-3-methylphthalic anhydride [4] | 243-072-0 [1]247-094-1 [2]256-356-4 [3]260-566-1 [4] | 19438-60-9 [1]25550-51-0 [2]48122-14-1 [3]57110-29-9 [4] | Xi; R41R42/43 | XnR: 41-42/43S: (2-)22-24-26-37/39 | C |
| 607-242-00-1 | tetrachlorophthalic anhydride | 204-171-4 | 117-08-8 | Xi; R41R42/43N; R50-53 | Xn; NR: 41-42/43-50/53S: (2-)22-24-26-37/39-60-61 |
| 607-243-00-7 | sodium 3,6-dichloro-o-anisate; [1]3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1); [2]3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] | 217-846-3 [1]246-590-5 [2]258-527-9 [3] | 1982-69-0 [1]25059-78-3 [2]53404-28-7 [3] | R52-53 | R: 52/53S: 61 |
| 607-244-00-2 | isooctyl acrylate | 249-707-8 | 29590-42-9 | Xi; R36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)26-28-60-61 | Xi; R36/37/38: C ≥ 10 % |
| 607-245-00-8 | tert-butyl acrylate | 216-768-7 | 1663-39-4 | F; R11Xn; R20/21/22Xi; R37/38R43N; R52-53 | F; XnR: 11-20/21/22-37/38-43-52/53S: (2-)16-25-37-61 | D |
| 607-246-00-3 | allyl methacrylate;2-methyl-2-propenoic acid 2-propenyl ester | 202-473-0 | 96-05-9 | R10T; R23Xn; R21/22N; R50 | T; NR: 10-21/22-23-50S: (1/2-)36/37-45-61 |
| 607-247-00-9 | dodecyl methacrylate | 205-570-6 | 142-90-5 | Xi; 36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)26-28-60-61 | Xi; R36/37/38: C ≥ 10 % |
| 607-248-00-4 | naptalam-sodium (ISO);;sodium N-naphth-1-ylphthalamate | 205-073-4 | 132-67-2 | Xn; R22 | XnR: 22S: (2-) |
| 607-249-00-X | (1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate | 256-032-2 | 42978-66-5 | Xi; R36/37/38R43N; R51-53 | Xi; NR: 36/37/38-43-51/53S: (2-)24-37-61 | Xi; R36/37/38: C ≥ 10 % |
| 607-250-00-5 | 4H-3,1-benzoxazine-2,4(1H)-dione | 204-255-0 | 118-48-9 | Xi; R36R43 | XiR: 36-43S: (2-)24-26-37 |
| 607-251-00-0 | 2-methoxypropyl acetate | 274-724-2 | 70657-70-4 | R10Repr. Cat. 2; R61Xi; R37 | TR: 61-10-37S: 53-45 |
| 607-252-00-6 | lambda-cyhalothrin (ISO);reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate (1:1) | 415-130-7 | 91465-08-6 | T+; R26T; R25Xn; R21N; R50-53 | T+; NR: 21-25-26-50/53S: (1/2-)28-36/37/39-38-45-60-61 |
| 607-253-00-1 | α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate;cyfluthrin | 269-855-7 | 68359-37-5 | T+; R28T; R23N; R50-53 | T+; NR: 23-28-50/53S: (1/2-)36/37/39-45-60-61 |
| 607-254-00-7 | α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate;beta-cyfluthrin | 269-855-7 | 68359-37-5 | T+; R26/28N; R50-53 | T+; NR: 26/28-50/53S: (1/2-)36/37/39-45-60-61 |
| 607-255-00-2 | fluroxypyr (ISO);4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid | — | 69377-81-7 | R52-53 | R: 52/53S: 61 |
| 607-256-00-8 | azoxystrobin (ISO);methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylate | — | 131860-33-8 | T; R23N; 50-53 | T; NR: 23-50/53S: (1/2-)22-45-60-61 |
| 607-257-00-3 | isopropyl propionate | 211-300-8 | 637-78-5 | F; R11 | FR: 11S: (2-)16-23-24-29-33 |
| 607-258-00-9 | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate | 403-990-6 | 70950-45-7 | R53 | R: 53S: 61 |
| 607-259-00-4 | methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate | 404-130-2 | 105560-93-8 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 607-260-00-X | ethyl 2-(3-nitrobenzylidene)acetoacetate | 404-490-0 | 39562-16-8 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 607-261-00-5 | iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate | 404-800-4 | 118832-72-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-262-00-0 | 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 405-050-0 | 86393-33-1 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 607-263-00-6 | potassium iron(III) 1,3-propanediamine-N,N,N',N'-tetraacetate hemihydrate | 405-680-6 | — | E; R2N; R51-53 | E; NR: 2-51/53S: (2-)35-61 |
| 607-264-00-1 | 2-chloro-4-(methylsulfonyl)benzoic acid | 406-520-8 | 53250-83-2 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-265-00-7 | ethyl-2-chloro-2,2-diphenylacetate | 406-580-5 | 52460-86-3 | Xi; R38R52-53 | XiR: 38-52/53S: (2-)37-61 |
| 607-266-00-2 | reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate];3,5-di-tert-butyl-salicylic acid | 406-890-0 | 130296-87-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 |
| 607-267-00-8 | tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate | 407-620-4 | 33610-13-8 | R42/43R52-53 | XnR: 42/43-52/53S: (2-)22-24-37-61 |
| 607-268-00-3 | 2-methylpropyl (R)-2-hydroxypropanoate | 407-770-0 | 61597-96-4 | Xi; R36 | XiR: 36S: (2-)26 |
| 607-269-00-9 | (R)-2-(4-hydroxyphenoxy)propanoic acid | 407-960-3 | 94050-90-5 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-270-00-4 | 3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecane | 410-730-5 | 90498-90-1 | Xn; R21 | XnR: 21S: (2-)36/37 |
| 607-271-00-X | 2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane | 417-420-9 | 156324-82-2 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 607-272-00-5 | fluroxypyr-meptyl (ISO);methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate; [1]fluroxypyr-butometyl (ISO);2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] | 279-752-9 [1]- [2] | 81406-37-3 [1]154486-27-8 [2] | N; R50-53 | NR: 50/53S: 60-61 |
| 607-273-00-0 | ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate | 404-520-2 | — | R52-53 | R: 52/53S: 61 |
| 607-274-00-6 | 2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate | 405-350-1 | 54527-73-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-275-00-1 | sodium benzoyloxybenzene-4-sulfonate | 405-450-5 | 66531-87-1 | R43 | XiR: 43S: (2-)24-37 |
| 607-276-00-7 | bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex | 405-635-0 | — | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 |
| 607-277-00-2 | reaction mass of: 2-(hexylthio)ethylamine hydrochloride;sodium propionate | 405-720-2 | — | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24-26-37/39-61 |
| 607-278-00-8 | reaction mass of isomers of: sodium phenethylnaphthalenesulfonate;sodium naphthylethylbenzenesulfonate | 405-760-0 | — | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 607-279-00-3 | reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate);n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate | 405-960-8 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-280-00-9 | sodium 4-chloro-1-hydroxybutane-1-sulfonate | 406-190-5 | 54322-20-2 | Xn; R22Xi; R36R43 | XnR: 22-36-43S: (2-)22-26-36/37 |
| 607-281-00-4 | reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates | 407-000-3 | 127519-17-9 | N; R51-53 | NR: 51/53S: 61 |
| 607-282-00-X | 2-acetoxymethyl-4-benzyloxybut-1-yl acetate | 407-140-5 | 131266-10-9 | R52-53 | R: 52/53S: 61 |
| 607-283-00-5 | E-ethyl-4-oxo-4-phenylcrotonate | 408-040-4 | 15121-89-8 | Xn; R21/22Xi; R38-41R43N; R50-53 | Xn; NR: 21/22-38-41-43-50/53S: (2-)26-36/37/39-60-61 |
| 607-284-00-0 | reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate);lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triphenodioxazinedisulfonate (9:1) | 410-040-4 | 136213-76-8 | N; R51-53 | NR: 51/53S: 61 |
| 607-285-00-6 | reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid;sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate;potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate | 410-065-0 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 607-286-00-1 | reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate | 410-070-8 | 141880-36-6 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 607-287-00-7 | O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate | 410-140-8 | — | R52-53 | R: 52/53S: 61 |
| 607-288-00-2 | Tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a,b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively | 410-160-7 | 148732-74-5 | Xi; R36R43R52-53 | XiR: 36-43-52/53S: (2-)22-26-36/37-61 |
| 607-289-00-8 | 3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid | 410-370-9 | 105488-33-3 | R53 | R: 53S: 61 |
| 607-290-00-3 | reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate;ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate | 410-540-2 | — | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 607-291-00-9 | dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate | 410-630-1 | 104051-92-5 | R53 | R: 53S: 61 |
| 607-292-00-4 | reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid;[1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid | 410-640-6 | — | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 |
| 607-293-00-X | reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate;N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate | 410-650-0 | — | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)26-36/37/39-61 |
| 607-294-00-5 | sodium 2-benzoyloxy-1-hydroxyethane-sulfonate | 410-680-4 | — | R43 | XiR: 43S: (2-)24-37 |
| 607-295-00-0 | reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate;hexasodium phosphonobutane-1,2,3,4-tetracarboxylate | 410-800-5 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-296-00-6 | reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid | 410-830-9 | — | R53 | R: 53S: 61 |
| 607-297-00-1 | (E—E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) | 410-960-6 | 92761-26-7 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-298-00-7 | 2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate | 411-010-3 | — | R43 | XiR: 43S: (2-)22-36/37 |
| 607-299-00-2 | methyl 3-(acetylthio)-2-methyl-propanoate | 411-040-7 | 97101-46-7 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 607-300-00-6 | trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprate(II) where a=1,2,3,4 b=8,9,10,11 c=15,16,17,18 d=22,23,24,25 | 411-430-7 | — | Xi; R41R43 | XiR: 41-43S: (2-)26-36/37/39 |
| 607-301-00-1 | reaction mass of: dodecanoic acid;poly(1-7)lactate esters of dodecanoic acid | 411-860-5 | — | R43N; R51-53 | Xi; NR: 38-41-43-51/53S: (2-)24-26-37/39-61 |
| 607-302-00-7 | reaction mass of: tetradecanoic acid;poly(1-7)lactate esters of tetradecanoic acid | 411-910-6 | — | Xi; R38-41R43N; R51-53 | Xi; NR: 38-41-43-51/53S: (2-)24-26-37/39-61 |
| 607-303-00-2 | 1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 413-760-7 | 93107-30-3 | Repr. Cat. 3; R62R52-53 | XnR: 62-52/53S: (2-)22-36/37-61 |
| 607-304-00-8 | fluazifop-butyl (ISO);butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | 274-125-6 | 69806-50-4 | Repr. Cat. 2; R61N; R50-53 | T; NR: 61-50/53S: 53-45-60-61 |
| 607-305-00-3 | fluazifop-P-butyl (ISO);butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | — | 79241-46-6 | Repr. Cat. 3; R63N; R50-53 | Xn; NR: 50/53-63S: (2-)29-36/37-46-60-61 |
| 607-306-00-9 | chlozolinate (ISO);ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate | 282-714-4 | 84332-86-5 | Carc. Cat. 3; R40N; R51-53 | Xn; NR: 40-51/53S: (2-)36/37-61 |
| 607-307-00-4 | vinclozolin (ISO);N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione | 256-599-6 | 50471-44-8 | Carc. Cat. 3; R40Repr. Cat. 2; R60-61R43N; R51-53 | T; NR: 60-61-40-43-51/53S: 53-45-61 |
| 607-308-00-X | esters of 2,4-D | — | — | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)26-29-36/37-46-60-61 | A |
| 607-309-00-5 | carfentrazone-ethyl (ISO);ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate | — | 128639-02-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-310-00-0 | kresoxim-methyl (ISO);methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate | — | 143390-89-0 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 607-311-00-6 | benazolin-ethyl;ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate | 246-591-0 | 25059-80-7 | N; R51-53 | NR: 51/53S: 61 |
| 607-312-00-1 | methoxyacetic acid | 210-894-6 | 625-45-6 | Repr. Cat. 2; R60-61Xn; R22C; R34 | TR: 60-61-22-34S: 53-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | E |
| 607-313-00-7 | neodecanoyl chloride | 254-875-0 | 40292-82-8 | T+; R26Xn; R22C; R34 | T+R: 22-26-34S: (1/2-)26-28-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 607-314-00-2 | ethofumesate (ISO);(±)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | 247-525-3 | 26225-79-6 | N; R51-53 | NR: 51/53S: 61 |
| 607-315-00-8 | glyphosate (ISO);N-(phosphonomethyl)glycine | 213-997-4 | 1071-83-6 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 607-316-00-3 | glyphosate-trimesium;glyphosate-trimethylsulfonium | — | 81591-81-3 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)36/37-46-61 |
| 607-317-00-9 | bis(2-ethylhexyl) phthalate;di-(2-ethylhexyl) phthalate;DEHP | 204-211-0 | 117-81-7 | Repr. Cat. 2; R60-61 | TR: 60-61S: 53-45 |
| 607-318-00-4 | dibutyl phthalate;DBP | 201-557-4 | 84-74-2 | Repr. Cat. 2; R61Repr. Cat. 3; R62N; R50 | T; NR: 61-50-62S: 53-45-61 |
| 607-319-00-X | deltamethrin (ISO);(S)-α-cyano-3-phenoxybenzyl (1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate | 258-256-6 | 52918-63-5 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)24-28-36/37/39-38-45-60-61 |
| 607-320-00-5 | bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate | 413-930-0 | 130066-57-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 607-321-00-0 | (S)-methyl-2-chloropropionate | 412-470-8 | 73246-45-4 | R10Xn; R48/22Xi; R36 | XnR: 10-36-48/22S: (2-)23-26-36 |
| 607-322-00-6 | 4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid | 413-120-7 | 107144-30-9 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 |
| 607-323-00-1 | 2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate | 413-850-6 | 123968-25-2 | R53 | R: 53S: 61 |
| 607-324-00-7 | reaction mass of: N,N-di(hydrogenated alkyl C14-C18)phtalamic acid;dihydrogenated alkyl (C14-C18)amine | 413-800-3 | — | R53 | R: 53S: 61 |
| 607-325-00-2 | (S)-2-chloropropionic acid | 411-150-5 | 29617-66-1 | Xn; R21/22C; R35 | CR: 21/22-35S: (1/2-)23-26-28-36/37/39-45 |
| 607-326-00-8 | reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate;isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate | 410-720-0 | 141847-13-4 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 607-327-00-3 | 2-(2-iodoethyl)-1,3-propanediol diacetate | 411-780-0 | 127047-77-2 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)36-61 |
| 607-328-00-9 | methyl 4-bromomethyl-3-methoxybenzoate | 410-310-1 | 70264-94-7 | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)26-36/37/39-60-61 |
| 607-329-00-4 | reaction mass of: sodium 2-(C12-18—n-alkyl)amino-1,4-butandioate;sodium 2-octadecenyl-amino-1,4-butandioate | 411-250-9 | — | R43 | XiR: 43S: (2-)24-26-37/39 |
| 607-330-00-X | (S)-2,3-dihydro-1H-indole-2-carboxylic acid | 410-860-2 | 79815-20-6 | Repr. Cat. 3; R62Xn; R48/22R43 | XnR: 43-48/22-62S: (2-)22-25-26-36/37 |
| 607-331-00-5 | reaction mass of: bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decanedioate;1,8-bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]octane | 406-750-9 | — | R53 | R: 53S: 23-61 |
| 607-332-00-0 | cyclopentyl chloroformate | 411-460-0 | 50715-28-1 | R10T; R23Xn; R22-48/22Xi; R41R43 | TR: 10-22-23-41-43-48/22S: (1/2-)26-36/37/39-45 |
| 607-333-00-6 | reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate;tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate | 405-670-1 | — | Xn; R22-48/22C; R34N; R50-53 | C; NR: 22-34-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 607-334-00-1 | ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate | 405-880-3 | 100501-62-0 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 607-335-00-7 | methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate | 406-250-0 | 72619-32-0 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 607-336-00-2 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate | 406-560-6 | 122760-85-4 | Xi; R38R43N; R51-53 | Xi; NR: 38-43-51/53S: (2-)36/37-61 |
| 607-337-00-8 | di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate | 406-052-4 | 125078-60-6 | R10Xn; R22Xi; R38-41N; R51-53 | Xn; NR: 10-22-38-41-51/53S: (2-)26-37/39-61 |
| 607-338-00-3 | 2-methylpropyl 2-hydroxy-2-methylbut-3-enoate | 406-235-9 | 72531-53-4 | Xi; R36/38 | XiR: 36/38S: (2-)26-37 |
| 607-339-00-9 | 2,3,4,5-tetrachlorobenzoylchloride | 406-760-3 | 42221-52-3 | Xn; R22C; R34R43 | CR: 22-34-43S: (1/2-)26-36/37/39-45 |
| 607-340-00-4 | 1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate | 406-990-4 | — | N; R51-53 | NR: 51/53S: 61 |
| 607-341-00-X | (9S)-9-amino-9-deoxyerythromycin | 406-790-7 | 26116-56-3 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 607-342-00-5 | 4-chlorobutyl veratrate | 410-950-1 | 69788-75-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 607-343-00-0 | 4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) | 407-410-2 | — | R53 | R: 53S: 61 |
| 607-344-00-6 | reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid;N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate;3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propionate | 407-810-7 | — | Xn; R48/22 | XnR: 48/22S: (2-)21-22-36/37 |
| 607-345-00-1 | potassium 2-(2,4-dichlorophenoxy)-(R)-propionate | 413-580-9 | 113963-87-4 | Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43S: (2-)24-26-37/39 |
| 607-346-00-7 | 3-icosyl-4-henicosylidene-2-oxetanone | 401-210-9 | 83708-14-9 | R53 | R: 53S: 61 |
| 607-347-00-2 | sodium (R)-2-(2,4-dichlorophenoxy)propionate | 413-340-3 | 119299-10-4 | Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43S: (2-)22-26-36/37/39 |
| 607-348-00-8 | magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) | 413-360-2 | — | Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43S: (2-)22-26-36/37/39 |
| 607-349-00-3 | mono-(tetrapropylammonium) hydrogen 2,2'-dithiobisbenzoate | 411-270-8 | — | R52-53 | R: 52/53S: 61 |
| 607-350-00-9 | bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane | 412-060-9 | 136210-32-7 | R43R52-53 | XiR: 43-52/53S: (2-)36/37-61 |
| 607-351-00-4 | methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate | 407-550-4 | 69184-17-4 | N; R51-53 | NR: 51/53S: 20/21-61 |
| 607-352-00-X | 4,4'-oxydiphthalic anhydride | 412-830-4 | 1823-59-2 | R52-53 | R: 52/53S: 61 |
| 607-353-00-5 | reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate;ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate | 407-520-0 | 80657-64-3 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 607-354-00-0 | ethyl 2-cyclohexylpropionate | 412-280-5 | 2511-00-4 | N; R51-53 | NR: 51/53S: 61 |
| 607-355-00-6 | p-tolyl 4-chlorobenzoate | 411-530-0 | 15024-10-9 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 607-356-00-1 | ethyl trans-2,2,6-trimethylcyclohexanecarboxylate | 412-540-8 | — | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 607-357-00-7 | reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran;cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran | 412-450-9 | 131766-73-9 | R43 | XiR: 43S: (2-)24-37 |
| 607-358-00-2 | (1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate | 412-670-5 | 54275-93-3 | R42 | XnR: 42S: (2-)22 |
| 607-359-00-8 | (1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate | 412-800-0 | 76109-32-5 | R42 | XnR: 42S: (2-)22 |
| 607-360-00-3 | sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate | 411-680-7 | 133167-77-8 | R43 | XiR: 43S: (2-)24-37 |
| 607-361-00-9 | methyl (R)-2-(4-hydroxyphenoxy)propionate | 411-950-4 | 96562-58-2 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 607-362-00-4 | reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)tetradec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoate;(3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoate | 413-500-2 | — | Xi; R38-41N; R51-53 | Xi; NR: 38-41-51/53S: (2-)26-37/39-61 |
| 607-363-00-X | methyl-3-methoxyacrylate | 412-900-4 | 5788-17-0 | R43 | XiR: 43S: (2-)24-37 |
| 607-364-00-5 | 3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione | 413-330-9 | 134724-55-3 | R53 | R: 53S: 61 |
| 607-365-00-0 | 2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride | 410-620-7 | 119154-86-8 | Xn; R22C; R34R43 | CR: 22-34-43S: (1/2-)22-26-36/37/39-45 |
| 607-366-00-6 | 3,5-dimethylbenzoyl chloride | 413-010-9 | 6613-44-1 | C; R34R43 | CR: 34-43S: (1/2-)26-36/37/39-45 |
| 607-367-00-1 | potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N,O,O,N)-ferrate-(1-) monohydrate | 411-640-9 | 153352-59-1 | Xn; R22 | XnR: 22S: (2-)37 |
| 607-368-00-7 | 1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole | 411-650-3 | 110895-43-7 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)37-38-45-60-61 |
| 607-369-00-2 | reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid;cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid | 411-660-8 | 147027-04-1 | Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43S: (2-)22-24-26-37/39 |
| 607-370-00-8 | 2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol | 412-210-3 | 41620-33-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-371-00-3 | 3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate | 413-410-3 | 88150-62-3 | R53 | R: 53S: 61 |
| 607-372-00-9 | ethoxylated bis phenol A di-(norbornene carboxylate) | 412-410-0 | — | R52-53 | R: 52/53S: 61 |
| 607-373-00-4 | (±) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate | 414-200-4 | 119738-06-6 | Muta. Cat. 3; R68Repr. Cat. 2; R61Repr. Cat. 3; R62Xn; R22-48/22N; R50-53 | T; NR: 61-22-48/22-62-68-50/53S: 53-45-60-61 | E |
| 607-374-00-X | 5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride | 417-220-1 | 37441-29-5 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-36/37-61 |
| 607-375-00-5 | reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin;trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin | 421-960-0 | 90035-08-8 | T+; R26/27/28T; R48/23/24/25N; R50-53 | T+; NR: 26/27/28-48/23/24/25-50/53S: (1/2-)28-36/37/39-45-60-61 |
| 607-376-00-0 | benzyl 2,4-dibromobutanoate | 420-710-8 | 23085-60-1 | Repr. Cat. 3; R62Xi; R38R43N; R50-53 | Xn; NR: 38-43-62-50/53S: (2-)23-36/37-41-60-61 |
| 607-377-00-6 | trans-4-cyclohexyl-L-proline monohydrochloride | 419-160-1 | 90657-55-9 | Repr. Cat. 3; R62Xn; R22Xi; R38-41R43 | XnR: 22-38-41-43-62S: (2-)22-26-36/37/39 |
| 607-378-00-1 | ammonium (Z)-α-methoxyimino-2-furylacetate | 405-990-1 | 97148-39-5 | F; R11 | FR: 11S: (2-)22-43 |
| 607-379-00-7 | reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate;sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate;sodium [bis(2-hydroxyethyl)amino]methylsulfonate;N,N-bis(2-hydroxyethyl)stearamide | 401-230-8 | R52-53 | R: 52/53S: 61 |
| 607-380-00-2 | reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate;ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate;ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate | 407-320-3 | — | Xi; R38-41R52-53 | XiR: 38-41-52/53S: (2-)26-37/39-61 |
| 607-381-00-8 | reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid | 413-710-4 | — | R53 | R: 53S: 61 |
| 607-382-00-3 | 2-((4-amino-2-nitrophenyl)amino)benzoic acid | 411-260-3 | 117907-43-4 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 607-383-00-9 | reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate;2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate | 415-430-8 | 86403-32-9 | Xi; R41R43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)24-26-37/39-60-61 |
| 607-384-00-4 | reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid;C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate;C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate | 413-750-2 | 171090-93-0 | R53 | R: 53S: 61 |
| 607-385-00-X | Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate | 414-590-6 | 125229-74-5 | N; R51-53 | NR: 51/53S: 61 |
| 607-386-00-5 | reaction mass of: tetradecanoic acid (42.5-47.5 %);poly(1-7)lactate esters of tetradecanoic acid (52.5-57.5 %) | 412-580-6 | 174591-51-6 | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 |
| 607-387-00-0 | reaction mass of: dodecanoic acid (35-40 %);poly(1-7)lactate esters of dodecanoic acid (60-65 %) | 412-590-0 | 58856-63-6 | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 |
| 607-388-00-6 | 4-ethylamino-3-nitrobenzoic acid | 412-090-2 | 2788-74-1 | Xn; R22R43R52-53 | XnR: 22-43-52/53S: (2-)22-24-37-61 |
| 607-389-00-1 | trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate | 414-130-4 | 119710-96-2 | Xn; R22 | XnR: 22S: (2-)22 |
| 607-390-00-7 | 1,2,3,4-tetrahydro-6-nitro-quinoxaline | 414-270-6 | 41959-35-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 |
| 607-391-00-2 | dimethylcyclopropane-1,1-dicarboxylate | 414-240-2 | 6914-71-2 | R52-53 | R: 52/53S: 61 |
| 607-392-00-8 | 2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate | 414-260-1 | 88938-37-8 | R53 | R: 53S: 61 |
| 607-393-00-3 | 3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 415-750-8 | 106447-44-3 | R43 | XiR: 43S: (2-)22-24-37 |
| 607-394-00-9 | 5-methylpyrazine-2-carboxylic acid | 413-260-9 | 5521-55-1 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-395-00-4 | reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate;sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate | 410-230-7 | — | C; R34R43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-36/37/39-45-61 |
| 607-396-00-X | bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate | 414-840-4 | 147783-69-5 | N; R50-53 | NR: 50/53S: 22-60-61 |
| 607-397-00-5 | reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated);Ca phenates (branched C10-14 and C18-30 alkylated);Ca sulfurized phenates (branched C10-14 and C18-30 alkylated) | 415-930-6 | — | R43 | XiR: 43S: (2-)36/37 |
| 607-398-00-0 | ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate | 414-820-5 | 125630-94-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-399-00-6 | 2,2-dimethyl 3-methyl-3-butenyl propanoate | 415-610-6 | 104468-21-5 | Xi; R38R52-53 | XiR: 38-52/53S: (2-)37-61 |
| 607-400-00-X | methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate | 414-400-1 | 32750-89-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-401-00-5 | ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate | 414-450-4 | 88805-65-6 | Xi; R38-41R43 | XiR: 38-41-43S: (2-)24-26-37/39 |
| 607-402-00-0 | methyl N-(phenoxycarbonyl)-L-valinate | 414-500-5 | 153441-77-1 | R52-53 | R: 52/53S: 61 |
| 607-403-00-6 | reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate;isopropyl alcohol | 414-810-0 | — | Xn; R48/22Xi; R41N; R50-53 | Xn; NR: 41-48/22-50/53S: (2-)22-26-36/39-60-61 |
| 607-404-00-1 | reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid;di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate;di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate;(Z)-3,7-dimethyl-2,6-octadienyl butandioate;((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid | 415-190-4 | — | R43 | XiR: 43S: (2-)24-37 |
| 607-405-00-7 | 2-hexyldecyl-p-hydroxybenzoate | 415-380-7 | 148348-12-3 | N; R51-53 | NR: 51/53S: 61 |
| 607-406-00-2 | potassium 2,5-dichlorobenzoate | 415-700-5 | 184637-62-5 | Xn; R22Xi; R41 | XnR: 22-41S: (2-)26-39 |
| 607-407-00-8 | ethyl 2-carboxy-3-(2-thienyl)propionate | 415-680-8 | 143468-96-6 | Xi; R38-41R43 | XiR: 38-41-43S: (2-)24-26-37/39 |
| 607-408-00-3 | potassium N-(4-fluorophenyl)glycinate | 415-710-1 | 184637-63-6 | Xn; R48/22Xi; R41R43R52-53 | XnR: 41-43-48/22-52/53S: (2-)22-26-36/37/39-61 |
| 607-409-00-9 | reaction mass of: (3R)-[1S-(1α, 2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid;inert biomass from Aspergillus terreus | 415-840-7 | — | R43R52-53 | XiR: 43-52/53S: (2-)36/37-61 |
| 607-410-00-4 | mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate | 415-880-5 | 779343-34-9 | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 |
| 607-411-00-X | oxiranemethanol, 4-methylbenzene-sulfonate, (S)- | 417-210-7 | 70987-78-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xi; R41R43N; R51-53 | T; NR: 45-41-43-68-51/53S: 53-45-61 |
| 607-412-00-5 | ethyl 2-(1-cyanocyclohexyl)acetate | 415-970-4 | 133481-10-4 | Xn; R22-48/22R52-53 | XnR: 22-48/22-52/53S: (2-)36/37-61 |
| 607-413-00-0 | trans-4-phenyl-L-proline | 416-020-1 | 96314-26-0 | Repr. Cat. 3; R62R43 | XnR: 43-62S: (2-)22-36/37 |
| 607-414-00-6 | tris(2-ethylhexyl)-4,4',4''-(1,3,5-triazine-2,4,6-triyltriimino)tribenzoate | 402-070-1 | 88122-99-0 | R53 | R: 53S: 61 |
| 607-415-00-1 | poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) | 419-590-1 | — | F; R11R43 | F; XiR: 11-43S: (2-)24-37-43 |
| 607-416-00-7 | 4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide | 420-730-7 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 607-418-00-8 | 2-ethylhexyl 4-aminobenzoate | 420-170-3 | 26218-04-2 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-419-00-3 | (3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid | 422-240-9 | 166596-68-5 | Xi; R41R43 | XiR: 41-43S: (2-)26-36/37/39 |
| 607-420-00-9 | 2,2-bis(hydroxymethyl)butanoic acid | 424-090-1 | 10097-02-6 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 607-421-00-4 | cypermethrin cis/trans +/- 40/60;(RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 257-842-9 | 52315-07-8 | Xn; R20/22Xi; R37N; R50-53 | Xn; NR: 20/22-37-50/53S: (2-)24-36/37/39-60-61 |
| 607-422-00-X | α-cypermethrin | 257-842-9 | 67375-30-8 | T; R25Xn; R48/22Xi; R37N; R50-53 | T; NR: 25-37-48/22-50/53S: (2-)36/37/39-45-60-61 |
| 607-423-00-5 | esters of mecoprop and of mecoprop-P | — | — | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)13-36/37-60-61 | A |
| 607-424-00-0 | trifloxystrobin (ISO);(E,E)-α-methoxyimino-{2-[[[[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetic acid methyl ester | — | 141517-21-7 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-46-60-61 |
| 607-425-00-6 | metalaxyl (ISO);methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate | 260-979-7 | 57837-19-1 | Xn; R22R43R52-53 | XnR: 22-43-52/53S: (2-)13-24-37-46-61 |
| 607-426-00-1 | 1,2-benzenedicarboxylic acid, dipentylester, branched and linear; [1]n-pentyl-isopentylphthalate; [2]di-n-pentyl phthalate; [3]diisopentylphthalate [4] | 284-032-2 [1]- [2]205-017-9 [3]210-088-4 [4] | 84777-06-0 [1]- [2]131-18-0 [3]605-50-5 [4] | Repr. Cat. 2; R60-61N; R50 | T; NR: 60-61-50S: 53-45-61 |
| 607-427-00-7 | bromoxynil heptanoate (ISO);2,6-dibromo-4-cyanophenyl heptanoate | 260-300-4 | 56634-95-8 | Repr. Cat. 3; R63Xn; R20/22R43N; R50-53 | Xn; NR: 20/22-43-63-50/53S: (2-)36/37-46-60-61 |
| 607-430-00-3 | BBP;benzyl butyl phthalate | 201-622-7 | 85-68-7 | Repr. Cat. 2; R61Repr. Cat. 3; R62N; R50-53 | T; NR: 61-62-50/53S: 53-45-60-61 |
| 607-431-00-9 | prallethrin (ISO);ETOC;2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | 245-387-9 | 23031-36-9 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)45-60-61 |
| 607-432-00-4 | S-metolachlor;reaction mass of (S)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (80-100 %); [1](R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20 %) [2] | - [1]- [2] | 87392-12-9 [1]178961-20-1 [2] | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 607-433-00-X | cypermethrin cis/trans +/- 80/20;(RS)-α-cyano-3-phenoxybenzyl (1RS; 3RS; 1RS, 3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 257-842-9 | 52315-07-8 | Xn; R22Xi; R37/38R43N; R50-53 | Xn; NR: 22-37/38-43-50/53S: (2-)36/37/39-60-61 |
| 607-434-00-5 | mecoprop-P [1] and its salts;(R)-2-(4-chloro-2-methylphenoxy)propionic acid | 240-539-0 | 16484-77-8 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)13-26-37/39-46-61 |
| 607-435-00-0 | 2S-isopropyl-5R-methyl-1R-cyclohexyl 2,2-dihydroxyacetate | 416-810-6 | 111969-64-3 | Xn; R48/22Xi; R41N; R51-53 | Xn; NR: 41-48/22-51/53S: (2-)22-26-36/39-61 |
| 607-436-00-6 | 2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate | 417-350-9 | — | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-28-37/39-60-61 |
| 607-437-00-1 | 3-(4-aminophenyl)-2-cyano-2-propenoic acid | 417-480-6 | 252977-62-1 | R43 | XiR: 43S: (2-)22-24-37 |
| 607-438-00-7 | methyl-2-[(aminosulfonyl)methyl]benzoate | 419-010-5 | 112941-26-1 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)22-26 |
| 607-439-00-2 | methyl tetrahydro-2-furancarboxylate | 420-670-1 | 37443-42-8 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-440-00-8 | methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate | 421-220-7 | 144740-59-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 607-441-00-3 | 3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionic acid | 421-490-6 | 167684-63-1 | R53 | R: 53S: 57-61 |
| 607-442-00-9 | benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate | 416-050-5 | 87460-09-1 | Xi; R41 | XiR: 41S: (2-)26-36/39 |
| 607-443-00-4 | bis(2,4-di-tert-butyl-6-methylphenyl)ethyl phosphate | 416-140-4 | 145650-60-8 | R53 | R: 53S: 61 |
| 607-444-00-X | reaction mass of: cis-1,4-dimethylcyclohexyl dibenzoate;trans-1,4-dimethylcyclohexyl dibenzoate | 416-230-3 | 35541-81-2 | R53 | R: 53S: 61 |
| 607-445-00-5 | Iron (III) tris(4-methylbenzenesulfonate) | 420-960-8 | 77214-82-5 | Xi; R41 | XiR: 41S: (2-)24-26-39 |
| 607-446-00-0 | methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate | 416-240-8 | 155522-12-6 | R43R53 | XiR: 43-53S: (2-)22-24-37-61 |
| 607-447-00-6 | sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate | 416-370-5 | 156738-27-1 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 607-448-00-1 | 2,3,5,6-tetrafluorobenzoic acid | 416-800-1 | 652-18-6 | Xi; R38-41 | XiR: 38-41S: (2-)22-26-37/39 |
| 607-449-00-7 | reaction mass of: 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate];4,4',4'',4'''-[[5,5'-[carbonylbis[imino(1,5,5-trimethyl-3,1-cyclohexanediyl)methylene]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,1',3,3'-tetrayl]tetrakis[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]tetrakisbenzenediazoniumtetra[bis(2-methylpropyl)naphthalenesulfonate] | 417-080-1 | — | E; R2R43N; R50-53 | E; Xi; NR: 2-43-50/53S: (2-)24-37-60-61 |
| 607-450-00-2 | 2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate | 419-040-9 | 89604-92-2 | R53 | R: 53S: 61 |
| 607-451-00-8 | 4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzenesulfonic acid, sodium salt | 417-640-5 | 161935-19-9 | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 607-453-00-9 | 4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) | 418-100-1 | 172964-15-7 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 607-454-00-4 | reaction mass of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid;cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid | 418-170-3 | 116193-72-7 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)25-26-39-61 |
| 607-455-00-X | 1-amino-4-(3-[4-chloro-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, sodium/lithiumsalt | 419-520-8 | 172890-93-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 607-456-00-5 | 3-amino-4-chlorobenzoic acid, hexadecyl ester | 419-700-6 | 143269-74-3 | N; R51-53 | NR: 51/53S: 61 |
| 607-457-00-0 | tetrasodium dihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{6-[4-(2-aminoethyl)piperazin-1-yl]}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) | 420-350-1 | 172277-97-3 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 607-458-00-6 | reaction mass of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate;2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate;2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)oxy]ethanol]] | 420-850-1 | — | N; R51-53 | NR: 51/53S: 61 |
| 607-459-00-1 | isopentyl 4-{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}benzoate | 418-930-4 | — | R53 | R: 53S: 61 |
| 607-460-00-7 | 3-tridecyloxy-propyl-ammonium 9-octadecenoate | 418-990-1 | 778577-53-0 | Xn; R48/22Xi; R36/38N; R50-53 | Xn; NR: 36/38-48/22-50/53S: (2-)23-26-37/39-60-61 |
| 607-461-00-2 | reaction mass of: pentasodium 2-{4-{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}-benzene-1,4-disulfonate;pentasodium 2-{4-{3-methyl-4-[7-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}-benzene-1,4-disulfonate | 421-160-1 | — | R52-53 | R: 52/53S: 61 |
| 607-462-00-8 | reaction mass of: 1-hexyl acetate;2-methyl-1-pentyl acetate;3-methyl-1-pentyl acetate;4-methyl-1-pentyl acetate;other mixed linear and branched C6-alkyl acetates | 421-230-1 | 88230-35-7 | N; R51-53 | NR: 51/53S: 61 |
| 607-463-00-3 | 3-(phenothiazin-10-yl)propionic acid | 421-260-5 | 362-03-8 | N; R51-53 | NR: 51/53S: 24/25-61 |
| 607-464-00-9 | reaction mass of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid;5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid | 421-280-4 | R52-53 | R: 52/53S: 61 |
| 607-465-00-4 | tris(2-hydroxyethyl)ammonium 7-{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}naphthalene-1,3-disulfonate | 421-440-3 | 778583-04-3 | R52-53 | R: 52/53S: 61 |
| 07-466-00-X | reaction mass of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate;phenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate;phenyl 3-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate | 421-480-1 | — | N; R51-53 | NR: 51/53S: 37/39-61 |
| 607-467-00-5 | 1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate | 419-430-9 | 56533-00-7 | Xn; R21/22-48/22C; R34N; R50-53 | C; NR: 21/22-34-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 607-468-00-0 | reaction mass of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;disodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;trisodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate;tetrasodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate | 419-450-8 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 607-469-00-6 | disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate | 419-460-2 | 120029-06-3 | R52-53 | R: 52/53S: 61 |
| 607-470-00-1 | potassium sodium 6,13-dichloro-3,10-bis{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | 414-100-0 | 154336-20-6 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)39-22-26-61 |
| 607-472-00-2 | ammonium iron(III) trimethylenediaminetetraacetate hemihydrate | 400-660-3 | 111687-36-6 | N; R51-53 | NR: 51/53S: 61 |
| 607-474-00-3 | (4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | 410-430-4 | 117573-89-4 | R53 | R: 53S: 61 |
| 607-475-00-9 | reaction mass of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate;tetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate (1:1) | 412-940-2 | 148878-18-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 607-476-00-4 | trisodium N,N-bis(carboxymethyl)-β-alanine | 414-070-9 | 129050-62-0 | C; R34R52-53 | CR: 34-52/53S: (1/2-)26-36/37/39-45-61 |
| 607-478-00-5 | tetramethylammonium hydrogen phthalate | 416-900-5 | 79723-02-7 | T; R25Xn; R48/22N; R50 | T; NR: 25-48/22-50S: (1/2-)25-36-45-61 |
| 607-479-00-0 | hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate | 418-550-9 | 168689-49-4 | R53 | R: 53S: 61 |
| 607-480-00-6 | 1,2-benzenedicarboxylic acid;di-C7-11-branched and linear alkylesters | 271-084-6 | 68515-42-4 | Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-62S: 53-45 |
| 607-487-00-4 | reaction mass of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate;trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | 402-660-9 | — | Repr. Cat. 2; R61R52-53 | TR: 61-52/53S: 53-45-61 |
| 607-488-00-X | ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate | 414-210-9 | 147379-38-2 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-489-00-5 | reaction mass of: 2-ethylhexyl linolenate, linoleate and oleate;2-ethylhexyl epoxyoleate;2-ethylhexyl diepoxylinoleate;2-ethylhexyl triepoxylinolenate | 414-890-7 | 71302-79-9 | R43 | XiR: 43S: (2-)24-37 |
| 607-490-00-0 | N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methyl glycinate | 415-060-7 | — | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 |
| 607-492-00-1 | 2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | 415-490-5 | 141773-73-1 | N; R51-53 | NR: 51/53S: 61 |
| 607-493-00-7 | methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate | 415-670-3 | 78850-37-0 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 607-494-00-2 | bis(2-ethylhexyl)octylphosphonate | 417-170-0 | 52894-02-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-495-00-8 | sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate | 417-550-6 | 168151-92-6 | R43 | XiR: 43S: (2-)24-37 |
| 607-496-00-3 | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 418-310-3 | 126050-54-2 | R53 | R: 53S: 61 |
| 607-497-00-9 | cerium oxide isostearate | 419-760-3 | — | R53 | R: 53S: 61 |
| 607-498-00-4 | (E)-3,7-dimethyl-2,6-octadienylhexadecanoate | 421-370-3 | 3681-73-0 | Xi; R38R53 | XiR: 38-53S: (2-)37-61 |
| 607-499-00-X | bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) | 421-660-1 | — | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 |
| 607-500-00-3 | calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate | 421-670-4 | — | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)37-60-61 |
| 607-501-00-9 | reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives | 421-820-9 | 192268-65-8 | R53 | R: 53S: 61 |
| 607-502-00-4 | (N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate | 422-200-0 | 178277-55-9 | C; R34Xn; R22N; R51-53 | C; NR: 22-34-51/53S: (1/2-)26-36/37/39-45-61 |
| 607-503-00-X | 2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane | 422-210-5 | 68957-94-8 | C; R34 | CR: 34S: (1/2-)26-36/37/39-45 |
| 607-505-00-0 | pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate | 422-930-1 | R52-53 | R: 52/53S: 22-61 |
| 607-506-00-6 | reaction mass of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate;disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate | 422-970-8 | N; R51-53 | NR: 51/53S: 22-61 |
| 607-507-00-1 | potassium,sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate | 422-980-2 | 187026-95-5 | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 607-508-00-7 | disodium 3,3'-[iminobis[sulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] | 423-110-4 | — | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 607-512-00-9 | trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate | 423-970-0 | 182926-43-8 | R52-53 | R: 52/53S: 22-61 |
| 607-513-00-4 | reaction mass of: Trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate;5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid sodium salt;5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid | 423-200-3 | — | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)22-26-36/37/39-61 |
| 607-515-00-5 | reaction mass of: disodium hexyldiphenyl ether disulphonate;disodium dihexyldiphenyl ether disulphonate | 429-650-7 | 147732-60-3 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 607-516-00-0 | N,N'-bis(trifluoroacetyl)-S,S'-bis-L-homocysteine | 429-670-6 | 105996-54-1 | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 |
| 607-517-00-6 | (S)-α-(acetylthio)benzenepropanoic acid | 430-300-0 | 76932-17-7 | Xn; R22Xi; R41R43 | XnR: 22-41-43S: (2-)22-26-36/37/39 |
| 607-526-00-5 | cartap (ISO);1,3-bis(carbamoylthio)-2-(dimethylamino)propane | — | 15263-53-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 607-527-00-0 | reaction mass of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-tridecafluorooctyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heptdecafluorodecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-pentacosafluorotetradecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heptadecafluorodecyl)dodecanedioate;1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate | 423-180-6 | — | Xn; R48/22 | XnR: 48/22S: (2-)36 |
| 608-001-00-3 | acetonitrile;cyanomethane | 200-835-2 | 75-05-8 | F; R11Xn; R20/21/22Xi; R36 | F; XnR: 11-20/21/22-36S: (2-)16-36/37 |
| 608-002-00-9 | trichloroacetonitrile | 208-885-7 | 545-06-2 | T; R23/24/25N; R51-53 | T; NR: 23/24/25-51/53S: (1/2-)45-61 |
| 608-003-00-4 | acrylonitrile | 203-466-5 | 107-13-1 | F; R11Carc. Cat. 2; R45T; R23/24/25Xi; R37/38-41R43N; R51-53 | F; T; NR: 45-11-23/24/25-37/38-41-43-51/53S: - 53-45-61 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,2 % ≤ C < 1 % | D E |
| 608-004-00-X | 2-hydroxy-2-methylpropionitrile;2-cyanopropan-2-ol;acetone cyanohydrin | 200-909-4 | 75-86-5 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)7/9-27-45-60-61 |
| 608-005-00-5 | n-butyronitrile | 203-700-6 | 109-74-0 | R10 ⊗T; R23/24/25 | TR: 10-23/24/25S: (1/2-)45 |
| 608-006-00-0 | bromoxynil (ISO)3,5-dibromo-4-hydroxybenzonitrile;bromoxynil phenol | 216-882-7 | 1689-84-5 | Repr. Cat. 3; R63T+; R26T; R25R43N; R50-53 | T+; NR: 25-26-43-63-50/53S: (1/2-)27/28-36/37-45-63-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 608-007-00-6 | ioxynil (ISO)4-hydroxy-3,5-diiodobenzonitrile | 216-881-1 | 1689-83-4 | Repr. Cat. 3; R63T; R23/25Xn; R21-48/22Xi; R36N; R50-53 | T; NR: 21-23/25-36-48/22-63-50/53S: (1/2-)36/37-45-60-61-63 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 608-008-00-1 | chloroacetonitrile | 203-467-0 | 107-14-2 | T; R23/24/25N; R51-53 | T; NR: 23/24/25-51/53S: (1/2-)45-61 |
| 608-009-00-7 | malononitrile | 203-703-2 | 109-77-3 | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)23-27-45-60-61 |
| 608-010-00-2 | methacrylonitrile;2-methyl-2-propene nitrile | 204-817-5 | 126-98-7 | F; R11T; R23/24/25R43 | F; TR: 11-23/24/25-43S: (1/2-)9-16-18-29-45 | T; R23/24/25: C ≥ 1 %Xn; R20/21/22: 0,2 % ≤ C < 1 %R43: C ≥ 0,2 % | D |
| 608-011-00-8 | oxalonitrile;cyanogen | 207-306-5 | 460-19-5 | F; R11 ⊗T; R23N; R50-53 | F; T; NR: 11-23-50/53S: (1/2-)23-45-60-61 |
| 608-012-00-3 | benzonitrile | 202-855-7 | 100-47-0 | Xn; R21/22 | XnR: 21/22S: (2-)23 |
| 608-013-00-9 | 2-chlorobenzonitrile | 212-836-5 | 873-32-5 | Xn; R21/22Xi; R36 | XnR: 21/22-36S: (2-)23 |
| 608-014-00-4 | chlorothalonil (ISO);tetrachloroisophthalonitrile | 217-588-1 | 1897-45-6 | Carc. Cat. 3; R40T+; R26Xi; R41Xi; R37R43N; R50-53 | T+; NR: 26-37-40-41-43-50/53S: (2-)28-36/37/39-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 608-015-00-X | dichlobenil (ISO);2,6-dichlorobenzonitrile | 214-787-5 | 1194-65-6 | Xn; R21N; R51-53 | Xn; NR: 21-51/53S: (2-)36/37-61 |
| 608-016-00-5 | 1,4-Dicyano-2,3,5,6-tetra-chloro-benzene | 401-550-8 | 1897-41-2 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 608-017-00-0 | bromoxynil octanoate (ISO);2,6-dibromo-4-cyanophenyl octanoate | 216-885-3 | 1689-99-2 | Repr. Cat. 3; R63T; R23Xn; R22R43N; R50-53 | T; NR: 22-23-43-63-50/53S: (1/2-)36/37-45-63-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 608-018-00-6 | ioxynil octanoate (ISO);4-cyano-2,6-diiodophenyl octanoate | 223-375-4 | 3861-47-0 | Repr. Cat. 3; R63T; R25Xi; R36R43N; R50-53 | T; NR: 25-36-43-63-50/53S: (1/2-)26-36/37-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 608-019-00-1 | 2,2'-dimethyl-2,2'-azodipropiononitrile;ADZN | 201-132-3 | 78-67-1 | E; R2F; R11Xn; R20/22R52-53 | E; XnR: 2-11-20/22-52/53S: (2-)39-41-47-61 |
| 608-021-00-2 | 3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile | 403-710-2 | 76823-93-3 | Xn; R22R43 | XnR: 22-43S: (2-)22-24-37 |
| 608-022-00-8 | 3,7-dimethyloctanenitrile | 403-620-3 | 40188-41-8 | Xi; R38R43N; R51-53 | Xi; NR: 38-43-51/53S: (2-)36/37-61 |
| 608-023-00-3 | fenbuconazole (ISO)4-(4-chlorophenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butanenitrile | 406-140-2 | 114369-43-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 608-024-00-9 | 2-(4-(N-butyl-N-phenethylamino)phenyl)ethylene-1,1,2-tricarbonitrile | 407-650-8 | 97460-76-9 | R53 | R: 53S: 61 |
| 608-025-00-4 | 2-nitro-4,5-bis(benzyloxy)phenylacetonitrile | 410-970-0 | 117568-27-1 | R53 | R: 53S: 61 |
| 608-026-00-X | 3-cyano-3,5,5-trimethylcyclohexanone | 411-490-4 | 7027-11-4 | Xn; R22-48/22R43R52-53 | XnR: 22-43-48/22-52/53S: (2-)36/37-61 |
| 608-027-00-5 | reaction mass of: 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;3-(2-ethylphenyl)-2,2-dimethylpropanenitrile;3-(3-ethylphenyl)-2,2-dimethylpropanenitrile | 412-660-0 | — | N; R51-53 | NR: 51/53S: 61 |
| 608-028-00-0 | 4-(2-cyano-3-phenylamino-acryloyloxymethyl)-cyclohexyl-methyl 2-cyano-3-phenylamino)-acrylate | 413-510-7 | 147374-67-2 | Xn; R48/20/21R43N; R51-53 | Xn; NR: 43-48/20/21-51/53S: (2-)36/37-61 |
| 608-029-00-6 | 1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridinecarbonitrile | 411-990-2 | 68612-94-2 | R43 | XiR: 43S: (2-)24-37 |
| 608-030-00-1 | N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthyazol-5-yl-methylene)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamide | 412-340-0 | 147741-93-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 608-031-00-7 | 2-benzyl-2-methyl-3-butenitrile | 407-870-4 | 97384-48-0 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 608-033-00-8 | N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide | 407-970-8 | 75511-91-0 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 608-034-00-3 | chlorfenapyr;4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile | — | 122453-73-0 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)13-36/37-45-60-61 |
| 608-035-00-9 | (±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile | 419-290-9 | — | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 608-036-00-4 | 3-(2-{4-[2-(4-cyanophenyl)vinyl]phenyl}vinyl)benzonitrile | 419-060-8 | 79026-02-1 | R53 | R: 53S: 61 |
| 608-037-00-X | reaction mass of: (E)-2,12-tridecadiennitrile;(E)-3,12-tridecadiennitrile;(Z)-3,12-tridecadiennitrile | 422-190-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 608-038-00-5 | 2,2,4-trimethyl-4-phenyl-butane-nitrile | 422-580-8 | 75490-39-0 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 608-039-00-0 | 2-phenylhexanenitrile | 423-460-8 | 3508-98-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)23-60-61 |
| 608-040-00-6 | 4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) | 423-490-1 | 130755-46-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 608-041-00-1 | 4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-ene-3-yl)methyl)(1,1'-biphenyl)-2-carbonitrile | 423-500-4 | 138401-24-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 608-043-00-2 | 3-(cis-3-hexenyloxy)propanenitril | 415-220-6 | 142653-61-0 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)13-36/37-45-60-61 |
| 608-065-00-2 | salts of bromoxynil with the exception of those specified elsewhere in this Annex | — | — | Repr. Cat. 3; R63T+; R26T; R25R43N; R50-53 | T+; NR: 25-26-43-50/53S: (1/2-)27/28-36/37-45-63-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % | A |
| 608-066-00-8 | salts of ioxynil with the exception of those specified elsewhere in this Annex | — | — | Repr. Cat. 3; R63T; R23/25Xn; R21-48/22Xi; R36N; R50-53 | T; NR: 21-23/25-36-48/22-63-50/53S: (1/2-)36/37-45-63-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % | A |
| 609-001-00-6 | 1-nitropropane | 203-544-9 | 108-03-2 | R10Xn; R20/21/22 | XnR: 10-20/21/22S: (2-)9 | Xn; R20/21/22: C ≥ 5 % |
| 609-002-00-1 | 2-nitropropane | 201-209-1 | 79-46-9 | R10Carc. Cat. 2; R45Xn; R20/22 | TR: 45-10-20/22S: 53-45 | E |
| 609-003-00-7 | nitrobenzene | 202-716-0 | 98-95-3 | Carc. Cat. 3; R40Repr. Cat. 3; R62T; R23/24/25-48/23/24N; R51-53 | T; NR: 23/24/25-40-48/23/24-51/53-62S: (1/2-)28-36/37-45-61 |
| 609-004-00-2 | dinitrobenzene; [1]1,4-dinitrobenzene; [2]1,3-dinitrobenzene; [3]1,2-dinitrobenzene [4] | 246-673-6 [1]202-833-7 [2]202-776-8 [3]208-431-8 [4] | 25154-54-5 [1]100-25-4 [2]99-65-0 [3]528-29-0 [4] | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)28-36/37-45-60-61 |
| 609-005-00-8 | 1,3,5-trinitrobenzene | 202-752-7 | 99-35-4 | E; R2 ⊗T+; R26/27/28R33N; R50-53 | E; T+; NR: 2-26/27/28-33-50/53S: (1/2-)35-45-60-61 |
| 609-006-00-3 | 4-nitrotoluene | 202-808-0 | 99-99-0 | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-37-45-61 |
| 609-007-00-9 | 2,4-dinitrotoluene;dinitrotoluene, technical grade; [1]dinitrotoluene [2] | 204-450-0 [1]246-836-1 [2] | 121-14-2 [1]25321-14-6 [2] | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S: 53-45-61 | E |
| 609-008-00-4 | 2,4,6-trinitrotoluene;TNT | 204-289-6 | 118-96-7 | E; R2T; R23/24/25R33N; R51-53 | E; T; NR: 2-23/24/25-33-51/53S: (1/2-)35-45-61 |
| 609-009-00-X | 2,4,6-trinitrophenol;picric acid | 201-865-9 | 88-89-1 | E; R2 ⊗R4T; R23/24/25 | E; TR: 2-4-23/24/25S: (1/2-)28-35-37-45 |
| 609-010-00-5 | salts of picric acid | — | — | E; R3T; R23/24/25 | E; TR: 3-23/24/25S: (1/2-)28-35-37-45 | A |
| 609-011-00-0 | 2,4,6-trinitroanisole | — | 606-35-9 | E; R2Xn; R20/21/22N; R51-53 | E; Xn; NR: 2-20/21/22-51/53S: (2-)35-61 |
| 609-012-00-6 | 2,4,6-trinitro-m-cresol | 210-027-1 | 602-99-3 | E; R2R4Xn; R20/21/22 | E; XnR: 2-4-20/21/22S: (2-)35 |
| 609-013-00-1 | 2,4,6-trinitro-m-xylene | 211-187-5 | 632-92-8 | E; R2Xn; R20/21/22R33 | E; XnR: 2-20/21/22-33S: (2-)35 |
| 609-015-00-2 | 4-nitrophenol;p-nitrophenol | 202-811-7 | 100-02-7 | Xn; R20/21/22R33 | XnR: 20/21/22-33S: (2-)28 |
| 609-016-00-8 | dinitrophenol (reaction mass of isomers); [1]2,4(or 2,6)-dinitrophenol [2] | 247-096-2 [1]275-732-9 [2] | 25550-58-7 [1]71629-74-8 [2] | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-37-45-60-61 |
| 609-018-00-9 | 2,4,6-trinitroresorcinol;styphnic acid | 201-436-6 | 82-71-3 | E; R2 ⊗R4Xn; R20/21/22 | E; XnR: 2-4-20/21/22S: (2-)35 |
| 609-019-00-4 | lead 2,4,6-trinitro-m-phenylene dioxide;lead 2,4,6-trinitroresorcinoxide;lead styphnate | 239-290-0 | 15245-44-0 | E; R3Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22R33N; R50-53 | E; T; NR: 61-3-20/22-33-50/53-62S: 53-45-60-61 | E1 |
| 609-020-00-X | DNOC (ISO);4,6-dinitro-o-cresol | 208-601-1 | 534-52-1 | Muta. Cat. 3; R68T+; R26/27/28Xi; R38-41R43R44N; R50-53 | T+; NR: 26/27/28-38-41-43-44-50/53-68S: (1/2-)36/37-45-60-61 |
| 609-021-00-5 | sodium salt of DNOC;sodium 4,6-dinitro-o-cresolate; [1]potassium salt of DNOC;potassium 4,6-dinitro-o-cresolate [2] | 219-007-7 [1][2] | 2312-76-7 [1]5787-96-2 [2] | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)13-45-60-61 |
| 609-022-00-0 | ammonium salt of DNOC;ammonium 4,6-dinitro-o-tolyl oxide | 221-037-0 | 2980-64-5 | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-45-60-61 |
| 609-023-00-6 | dinocap (ISO) | 254-408-0 | 39300-45-3 | Repr. Cat. 2; R61Xn; R20-48/22Xi; R38R43N; R50-53 | T; NR: 61-20-22-38-43-48/22-50/53S: 53-45-60-61 | E |
| 609-024-00-1 | binapacryl (ISO);2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate | 207-612-9 | 485-31-4 | Repr. Cat. 2; R61Xn; R21/22N; R50-53 | T; NR: 61-21/22-50/53S: 53-45-60-61 | E |
| 609-025-00-7 | dinoseb (ISO);6-sec-butyl-2,4-dinitrophenol | 201-861-7 | 88-85-7 | R44T; R24/25Repr. Cat. 2; R61Repr. Cat. 3; R62Xi; R36N; R50-53 | T; NR: 61-62-24/25-36-44-50/53S: 53-45-60-61 | E |
| 609-026-00-2 | salts and esters of dinoseb, with the exception of those specified elsewhere in this Annex | — | — | R44Repr. Cat. 2; R61Repr. Cat. 3; R62T; R24/25Xi; R36N; R50-53 | T; NR: 61-62-24/25-36-44-50/53S: 53-45-60-61 | AE |
| 609-027-00-8 | dinocton;reaction mass of isomers: methyl 2-octyl-4,6-dinitrophenyl carbonate, methyl 4-octyl-2,6-dinitrophenyl carbonate | — | 63919-26-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 609-028-00-3 | dinex (ISO);2-cyclohexyl-4,6-dinitrophenol | 205-042-5 | 131-89-5 | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 |
| 609-029-00-9 | salts and esters of dinex | — | — | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 | A |
| 609-030-00-4 | dinoterb (ISO);2-tert-butyl-4,6-dinitrophenol | 215-813-8 | 1420-07-1 | Repr. Cat. 2; R61T+; R28T; R24R44N; R50-53 | T+; NR: 61-24-28-44-50/53S: 53-45-60-61 | E |
| 609-031-00-X | salts and esters of dinoterb | — | — | Repr. Cat. 2; R61T+; R28T; R24N; R50-53 | T+; NR: 61-24-28-50/53S: 45-53-60-61 | AE |
| 609-032-00-5 | bromofenoxim (ISO);3,5-dibromo-4-hydroxybenzaldehyde-O-(2,4-dinitrophenyl)-oxime | 236-129-6 | 13181-17-4 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)25-60-61 |
| 609-033-00-0 | dinosam (ISO);2-(1-methylbutyl)-4,6-dinitrophenol | — | 4097-36-3 | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 |
| 609-034-00-6 | salts and esters of dinosam | — | — | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)13-45-60-61 | A |
| 609-035-00-1 | nitroethane | 201-188-9 | 79-24-3 | R10Xn; R20/22 | XnR: 10-20/22S: (2-)9-25-41 | Xn; R20/22: C ≥ 12,5 % |
| 609-036-00-7 | nitromethane | 200-876-6 | 75-52-5 | R5-10Xn; R22 | XnR: 5-10-22S: (2-)41 | Xn; R22: C ≥ 12,5 % |
| 609-037-00-2 | 5-nitroacenaphthene | 210-025-0 | 602-87-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 609-038-00-8 | 2-nitronaphthalene | 209-474-5 | 581-89-5 | Carc. Cat. 2; R45N; R51-53 | T; NR: 45-51/53S: 53-45-61 |
| 609-039-00-3 | 4-nitrobiphenyl | 202-204-7 | 92-93-3 | Carc. Cat. 2; R45N; R51-53 | T; NR: 45-51/53S: 53-45-61 |
| 609-040-00-9 | nitrofen (ISO);2,4-dichlorophenyl 4-nitrophenyl ether | 217-406-0 | 1836-75-5 | Carc. Cat. 2; R45Repr. Cat. 2; R61Xn; R22N; R50-53 | T; NR: 45-61-22-50/53S: 53-45-60-61 | E |
| 609-041-00-4 | 2,4-dinitrophenol | 200-087-7 | 51-28-5 | T; R23/24/25R33N; R50 | T; NR: 23/24/25-33-50S: (1/2-)28-37-45-61 |
| 609-042-00-X | pendimethalin (ISO);N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | 254-938-2 | 40487-42-1 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-29-37-60-61 |
| 609-043-00-5 | quintozene (ISO);pentachloronitrobenzene | 201-435-0 | 82-68-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)13-24-37-60-61 |
| 609-044-00-0 | tecnazene (ISO);1,2,4,5-tetrachloro-3-nitrobenzene | 204-178-2 | 117-18-0 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 609-045-00-6 | reaction mass of: 4,6-dinitro-2-(3-octyl)phenyl methyl carbonate and 4,6-dinitro-2-(4-octyl)phenyl methyl carbonate;dinocton-6 | — | 8069-76-9 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 609-046-00-1 | trifluralin (ISO) (containing < 0.5 ppm NPDA);α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine (containing < 0.5 ppm NPDA);2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline (containing < 0.5 ppm NPDA);N,N-dipropyl-2,6-dinitro-4-trifluoromethylaniline (containing < 0.5 ppm NPDA) | 216-428-8 | 1582-09-8 | Xi; R36R43N; R50-53 | Xi; NR: 36-43-50/53S: (2-)24-37-60-61 |
| 609-047-00-7 | 2-nitroanisole | 202-052-1 | 91-23-6 | Carc. Cat. 2; R45Xn; R22 | TR: 45-22S: 53-45 | E |
| 609-048-00-2 | sodium 3-nitrobenzenesulphonate | 204-857-3 | 127-68-4 | Xi; R36R43 | XiR: 36-43S: (2-)24-26-37 |
| 609-049-00-8 | 2,6-dinitrotoluene | 210-106-0 | 606-20-2 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22R52-53 | TR: 45-23/24/25-48/22-62-68-52/53S: 53-45-61 | E |
| 609-050-00-3 | 2,3-dinitrotoluene | 210-013-5 | 602-01-7 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R50-53 | T; NR: 45-23/24/25-48/22-62-68-50/53S: 53-45-60-61 | E |
| 609-051-00-9 | 3,4-dinitrotoluene | 210-222-1 | 610-39-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S: 53-45-61 | E |
| 609-052-00-4 | 3,5-dinitrotoluene | 210-566-2 | 618-85-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22R52-53 | TR: 45-23/24/25-48/22-62-68-52/53S: 53-45-61 | E |
| 609-053-00-X | hydrazine-trinitromethane | 414-850-9 | — | E; R3O; R8Carc. Cat. 2; R45T; R23/25R43 | E; TR: 45-3-8-23/25-43S: 53-45 | E |
| 609-054-00-5 | 2,3-dinitrophenol; [1]2,5-dinitrophenol; [2]2,6-dinitrophenol; [3]3,4-dinitrophenol; [4]salts of dinitrophenol [5] | 200-628-7 [1]206-348-1 [2]209-357-9 [3]209-415-3 [4][5] | 66-56-8 [1]329-71-5 [2]573-56-8 [3]577-71-9 [4][5] | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51S: (1/2-)28-37-45-61 |
| 609-055-00-0 | 2,5-dinitrotoluene | 210-581-4 | 619-15-8 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S: 53-45-61 | E |
| 609-056-00-6 | 2,2-dibromo-2-nitroethanol | 412-380-9 | 69094-18-4 | E; R2Carc. Cat. 3; R40Xn; R22-48/22C; R35R43N; R50-53 | E; C; NR: 2-22-35-40-43-48/22-50/53S: (1/2-)23-26-36/37/39-45-60-61 | Xn; R22: C ≥ 10 %C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 609-057-00-1 | 3-chloro-2,4-difluoronitrobenzene | 411-980-8 | 3847-58-3 | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (1/2-)22-26-28-36/37/39-45-60-61 |
| 609-058-00-7 | 2-nitro-2-phenyl-1,3-propanediol | 410-360-4 | 5428-02-4 | T; R39-48/25Xn; R21/22Xi; R41R43N; R51-53 | T; NR: 21/22-39-41-43-48/25-51/53S: 53-45-61 |
| 609-059-00-2 | 2-chloro-6-(ethylamino)-4-nitrophenol | 411-440-1 | 131657-78-8 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)22-24-37/39-61 |
| 609-060-00-8 | 4-[(3-hydroxypropyl)amino]-3-nitrophenol | 406-305-9 | 92952-81-3 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 609-061-00-3 | (E,Z)-4-chlorophenyl(cyclopropyl)ketone O-(4-nitrophenylmethyl)oxime | 406-100-4 | 94097-88-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 609-062-00-9 | 2-bromo-2-nitropropanol | 407-030-7 | 24403-04-1 | T; R24Xn; R22-48/22C; R34R43N; R50-53 | T; NR: 22-24-34-43-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 609-063-00-4 | 2-[(4-chloro-2-nitrophenyl)amino]ethanol | 413-280-8 | 59320-13-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 |
| 609-064-00-X | mesotrione (ISO);2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | — | 104206-82-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 609-065-00-5 | 2-nitrotoluene | 201-853-3 | 88-72-2 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 3; R62Xn; R22N; R51-53 | T; NR: 45-46-22-62-51/53S: 53-45-61 | E |
| 609-066-00-0 | lithium sodium 3-amino-10-{4-(10-amino-6,13-dichloro-4,11-disulfonatobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-3-ylamino)-6-[methyl(2-sulfonato-ethyl)amino]-1,3,5-triazin-2-ylamino}-6,13-dichlorobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | 418-870-9 | 154212-58-5 | Xn; R20/21/22-68/20/21/22 | XnR: 20/21/22-68/20/21/22S: (2-)36/37 |
| 609-067-00-6 | sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine | 416-280-6 | 156769-97-0 | R43 | XiR: 43S: (2-)22-24-37 |
| 609-068-00-1 | musk xylene;5-tert-butyl-2,4,6-trinitro-m-xylene | 201-329-4 | 81-15-2 | E; R2Carc. Cat. 3; R40N; R50-53 | E; Xn; NR: 2-40-50/53S: (2-)36/37-46-60-61 |
| 609-070-00-2 | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene | 415-580-4 | 130841-23-5 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37/39-60-61 |
| 609-071-00-8 | reaction mass of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine;2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol | 423-520-3 | 156137-33-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 610-001-00-3 | trichloronitromethane;chloropicrin | 200-930-9 | 76-06-2 | Xn; R22T+; R26Xi; R36/37/38 | T+R: 22-26-36/37/38S: (1/2-)36/37-38-45 |
| 610-002-00-9 | 1,1-dichloro-1-nitroethane | 209-854-0 | 594-72-9 | T; R23/24/25 | TR: 23/24/25S: (1/2-)26-45 |
| 610-003-00-4 | chlorodinitrobenzene | — | — | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-36/37-45-60-61 | C |
| 610-004-00-X | 2-chloro-1,3,5-trinitrobenzene | 201-864-3 | 88-88-0 | E; R2T+; R26/27/28N; R50-53 | E; T+; NR: 2-26/27/28-50/53S: (1/2-)28-36/37-45-60-61 |
| 610-005-00-5 | 1-chloro-4-nitrobenzene | 202-809-6 | 100-00-5 | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R23/24/25Xn; R48/20/21/22N; R51-53 | T; NR: 23/24/25-40-48/20/21/22-68-51/53S: (1/2-)28-36/37-45-61 |
| 610-006-00-0 | chloronitroanilines with the exception of those specified elsewhere in this Annex | — | — | T+; R26/27/28R33N; R51-53 | T+; NR: 26/27/28-33-51/53S: (1/2-)28-36/37-45-61 | A C |
| 610-007-00-6 | 1-chloro-1-nitropropane | 209-990-0 | 600-25-9 | Xn; R20/22 | XnR: 20/22S: (2-) | Xn; R20/22: C ≥ 5 % |
| 610-008-00-1 | 2,6-dichloro-4-nitroanisole | 403-350-6 | 17742-69-7 | T; R25N; R51-53 | T; NR: 25-51/53S: (1/2-)36/37-45-61 |
| 610-009-00-7 | 2-chloro-4-nitroaniline | 204-502-2 | 121-87-9 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-24-61 |
| 610-010-00-2 | 2-bromo-1-(2-furyl)-2-nitroethylene | 406-110-9 | 35950-52-8 | Xn; R22-48/22C; R34R43N; R50-53 | C; NR: 22-34-43-48/22-50/53S: (1/2-)22-26-36/37/39-45-60-61 |
| 611-001-00-6 | azobenzene | 203-102-5 | 103-33-3 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20/22-48/22N; R50-53 | T; NR: 45-20/22-48/22-68-50/53S: 53-45-60-61 | E |
| 611-002-00-1 | azoxybenzene | 207-802-1 | 495-48-7 | Xn; R20/22 | XnR: 20/22S: (2-)28 |
| 611-003-00-7 | fenaminosulf (ISO);sodium 4-dimethylaminobenzenediazosulphonate | 205-419-4 | 140-56-7 | T; R25Xn; R21R52-53 | TR: 21-25-52/53S: (1/2-)36/37-45-61 |
| 611-004-00-2 | methyl-ONN-azoxymethyl acetate;methyl azoxy methyl acetate | 209-765-7 | 592-62-1 | Carc. Cat. 2; R45Repr. Cat. 2; R61 | TR: 45-61S: 53-45 |
| 611-005-00-8 | disodium {5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}cuprate(2-);CI Direct Brown 95 | 240-221-1 | 16071-86-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 611-006-00-3 | 4-o-tolylazo-o-toluidine;4-amino-2',3-dimethylazobenzene;fast garnet GBC base;AAT;o-aminoazotoluene | 202-591-2 | 97-56-3 | Carc. Cat. 2; R45R43 | TR: 45-43S: 53-45 |
| 611-007-00-9 | tricyclazole (ISO);5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazole | 255-559-5 | 41814-78-2 | Xn; R22 | XnR: 22S: (2-) |
| 611-008-00-4 | 4-aminoazobenzene;4-phenylazoaniline | 200-453-6 | 60-09-3 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 611-009-00-X | sodium (1-(5-(4-(4-anilino-3-sulphophenylazo)-2-methyl-5-methylsulphonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulphonato-2-naphtholato)iron(II) | 401-220-3 | — | Xn; R20R52-53 | XnR: 20-52/53S: (2-)61 |
| 611-010-00-5 | 2'-(2-cyano-4,6-dinitrophenylazo)-5'-(N,N-dipropylamino)propionanilide | 403-010-7 | 106359-94-8 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 611-011-00-0 | N,N,N',N'-tetramethyl-3,3'-(propylenebis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridine-3,1-diyl)))di(propylammonium) dilactate | 403-340-1 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 611-012-00-6 | reaction mass of 2,2-iminodiethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and 2-methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and N,N-diethylpropane-1,3-diamine 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate | 403-410-1 | 114565-65-0 | R43 | XiR: 43S: (2-)22-24-26-37 |
| 611-013-00-1 | trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalene-3-sulfonate | 403-650-7 | 117409-78-6 | E; R2N; R51-53 | E; NR: 2-51/53S: (2-)35-61 |
| 611-014-00-7 | (tetrasodium 1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium) hydroxide | 404-250-5 | 115099-55-3 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-015-00-2 | tetrasodium 4-amino-5-hydroxy-6-(4-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate | 404-320-5 | 116889-78-2 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-016-00-8 | reaction mass of 1,1'-((dihydroxyphenylene)bis(azo-3,1-phenylenazo(1-(3-dimethylaminopropyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))dipyridinium dichloride dihydrochloride, mixed isomers and 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(or2,6 or3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride | 404-540-1 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-017-00-3 | 2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramide | 404-910-2 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 611-018-00-9 | tetraammonium 5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalate | 405-130-5 | — | R43 | XiR: 43S: (2-)24-37 |
| 611-019-00-4 | tetralithium 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | 405-150-4 | 106028-58-4 | R43 | XiR: 43S: (2-)24-37 |
| 611-020-00-X | tetrakis(tetramethylammonium) 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | 405-170-3 | 116340-05-7 | T; R25R43R52-53 | TR: 25-43-52/53S: (1/2-)22-24-37-45-61 |
| 611-021-00-5 | 2-(4-(4-cyano-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethyl acetate | 405-480-9 | — | Xn; R22-48/22Xi; R38R53 | XnR: 22-38-48/22-53S: (2-)22-36/37-61 |
| 611-022-00-0 | 4-dimethylaminobenzenediazonium 3-carboxy-4-hydroxybenzenesulfonate | 404-980-4 | — | E; R2T; R23/25Xn; R21-48/22Xi; R41R43N; R50/53 | E; T; NR: 2-21-23/25-41-43-48/22-50/53S: (1/2-)3-12-26-35-36/37/39-45-61 |
| 611-023-00-6 | disodium 7-(4,6-dichloro-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalene-2-sulfonate | 404-600-7 | — | R43 | XR: 43S: (2-)22-24-37 |
| 611-024-00-1 | Benzidine based azo dyes;4,4'-diarylazobiphenyl dyes, with the exception of those specified elsewhere in this Annex | — | — | Carc. Cat. 2; R45 | TR: 45S: 53-45 | A |
| 611-025-00-7 | disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate;C.I. Direct Black 38 | 217-710-3 | 1937-37-7 | Carc. Cat. 2; R45Repr. Cat. 3; R63 | TR: 45-63S: 53-45 |
| 611-026-00-2 | tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate];C.I. Direct Blue 6 | 220-012-1 | 2602-46-2 | Carc. Cat. 2; R45Repr. Cat. 3; R63 | TR: 45-63S: 53-45 |
| 611-027-00-8 | disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate);C.I. Direct Red 28 | 209-358-4 | 573-58-0 | Carc. Cat. 2; R45Repr. Cat. 3; R63 | TR: 45-63S: 53-45 |
| 611-028-00-3 | C,C'-azodi(formamide) | 204-650-8 | 123-77-3 | R42R44 ⊗ | XnR: 42-44S: (2-)22-24-37 |
| 611-029-00-9 | o-dianisidine based azo dyes;4,4'-diarylazo-3,3'-dimethoxybiphenyl dyes with the exception of those mentioned elsewhere in this Annex | — | — | Carc. Cat. 2; R45 | TR: 45S: 53-45 | A H |
| 611-030-00-4 | o-tolidine based dyes;4,4'-diarylazo-3,3'-dimethylbiphenyl dyes, with the exception of those mentioned elsewhere in this Annex | — | — | Carc. Cat. 2; R45 | TR: 45S: 53-45 | A H |
| 611-031-00-X | 4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride;C.I. Basic Red 9 | 209-321-2 | 569-61-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 611-032-00-5 | 1,4,5,8-tetraaminoanthraquinone;C.I. Disperse Blue 1 | 219-603-7 | 2475-45-8 | Carc. Cat. 2; R45Xi; R38-41R43 | TR: 45-38-41-43S: 53-45 |
| 611-033-00-0 | hexasodium [4,4''-azoxybis(2,2'-disulfonatostilbene-4,4'-diylazo)]-bis[5'-sulfonatobenzene-2,2'- diolato-O(2),O(2),N(1)]-copper(II) | 400-020-3 | 82027-60-9 | N; R51-53 | NR: 51/53S: 61 |
| 611-034-00-6 | N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide | 402-430-8 | 105076-77-5 | R53 | R: 53S: 61 |
| 611-035-00-1 | tetralithium 6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalene-2,7-disulfonate | 403-660-1 | 107246-80-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 611-036-00-7 | 2-(4-(5,6(or 6,7)-dichloro-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethyl acetate | 405-440-0 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-037-00-2 | 3(or 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazolium methylsulphate | 406-055-0 | 124584-00-5 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)22-24-26-37/39-61 |
| 611-038-00-8 | trisodium 1-hydroxynaphthalene-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzene)- 2',2'',4-trisulfonate | 406-820-9 | — | Xi; R36 | XiR: 36S: (2-)25-26 |
| 611-039-00-3 | 7-[((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalene-2-sulfonic acid | 407-050-6 | 117715-57-8 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-040-00-9 | 3-(5-acetylamino-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalenesulfonic acid | 407-670-7 | 115099-58-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 611-041-00-4 | 2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazine-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamide | 407-680-1 | 98809-11-1 | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 |
| 611-042-00-X | trisodium 5-amino-3-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalene-2,7-disulfonate | 411-770-6 | 136213-71-3 | R52-53 | R: 52/53S: 61 |
| 611-043-00-5 | reaction mass of: trisodium N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))-chromate;trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate;trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate (2:1:1) | 402-850-1 | — | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 611-044-00-0 | reaction mass of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-);tert-alkyl(C12-C14)ammonium [[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-);tert-alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-);tert-alkyl(C12-C14)ammonium ((1-(4(or 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromate(1-) | 403-720-7 | 117527-94-3 | N; R51-53 | NR: 51/53S: 61 |
| 611-045-00-6 | 2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophene | 404-830-8 | — | R53 | R: 53S: 61 |
| 611-046-00-1 | 4,4'-diamino-2-methylazobenzene | 407-590-2 | 43151-99-1 | T; R25Xn; R48/22R43N; R50-53 | T; NR: 25-43-48/22-50/53S: (1/2-)22-28-36/37-45-60-61 |
| 611-047-00-7 | reaction mass of: 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole;2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 407-890-3 | 111381-11-4 | R53 | R: 53S: 61 |
| 611-048-00-2 | reaction mass of: 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole;2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 407-900-6 | 111381-12-5 | R53 | R: 53S: 61 |
| 611-049-00-8 | reaction mass of 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)-naphthalene-2-sulfonate, acetic acid, lactic acid (2:1:1) | 408-000-6 | 118658-98-3 | Xn; R48/22R43R52-53 | XnR: 43-48/22-52/53S: (2-)22-36/37-61 |
| 611-051-00-9 | 2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methyl-benzothiazolium chloride | 411-110-7 | 136213-74-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 611-052-00-4 | monosodium aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonate], iron complex | 400-720-9 | — | R52-53 | R: 52/53S: 61 |
| 611-053-00-X | 2,2'-azobis[2-methylpropionamidine] dihydrochloride | 221-070-0 | 2997-92-4 | Xn; R22R43 | XnR: 22-43S: (2-)24-37 |
| 611-055-00-0 | C.I. Disperse Yellow 3;N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamide | 220-600-8 | 2832-40-8 | Carc. Cat. 3; R40R43 | XnR: 40-43S: (2-)22-36/37-46 |
| 611-056-00-6 | C.I. Solvent Yellow 14;1-phenylazo-2-naphthol | 212-668-2 | 842-07-9 | Carc. Cat. 3; R40Muta. Cat. 3; R68R43R53 | XnR: 40-43-53-68S: (2-)22-36/37-46-61 |
| 611-057-00-1 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | 400-340-3 | 85136-74-9 | Carc. Cat. 2; R45R53 | TR: 45-53S: 53-45-61 |
| 611-058-00-7 | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | 402-060-7 | 108225-03-2 | Carc. Cat. 2; R45Xi; R41N; R51-53 | T; NR: 45-41-51/53S: 53-45-61 |
| 611-059-00-2 | octasodium 2-(6-(4-chloro-6-(3-(N-methyl-N-(4-chloro-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalene-1,5-disulfonate | 412-960-1 | 148878-21-1 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)22-24-26-37/39-61 |
| 611-060-00-8 | reaction mass of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate;ammonium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate;5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonaphthalen-2-ylazo]-isophthalic acid | 413-180-4 | 187285-15-0 | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 611-061-00-3 | disodium 5-[5-[4-(5-chloro-2,6-difluoropyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonate | 412-530-3 | — | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 611-062-00-9 | octasodium 2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalene-1,5-disulfonate | 413-550-5 | — | Xi; R38-41 | XiR: 38-41S: (2-)22-26-37/39 |
| 611-063-00-4 | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) | 413-590-3 | 164058-22-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 611-064-00-X | 4-(3,4-dichlorophenylazo)-2,6-di-sec-butyl-phenol | 410-600-8 | 124719-26-2 | Xn; R48/22Xi; R38N; R50-53 | Xn; NR: 38-48/22-50/53S: (2-)23-25-36/37-60-61 |
| 611-065-00-5 | 4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol | 410-610-2 | 111850-24-9 | Xn; R48/22Xi; R36/38R43N; R50-53 | Xn; NR: 36/38-43-48/22-50/53S: (2-)23-26-36/37-60-61 |
| 611-066-00-0 | tetrasodium 5-[4-chloro-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | 411-540-5 | 130201-57-9 | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)22-24-26-37/39-61 |
| 611-067-00-6 | reaction mass of: bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate;bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate | 406-910-8 | — | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)26-36/39-61 |
| 611-068-00-1 | tetrasodium 4-amino-3,6-bis(5-[4-chloro-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | 400-690-7 | 85665-98-1 | N; R51-53 | NR: 51/53S: 61 |
| 611-069-00-7 | N,N-di-[poly(oxyethylene)-co-poly(oxypropylene)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylaniline | 413-380-1 | — | N; R51-53 | NR: 51/53S: 61 |
| 611-070-00-2 | reaction mass of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-);trisodium bis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromate(1-) | 405-665-4 | — | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 611-071-00-8 | tris(tetramethylammonium) 5-hydroxy-1-(4-sulphonatophenyl)-4-(4-sulphonatophenylazo)pyrazole-3-carboxylate | 406-073-9 | 131013-81-5 | T; R25R52-53 | TR: 25-52/53S: (1/2-)37-45-61 |
| 611-072-00-3 | 2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzene, dihydrochloride | 407-010-8 | 118208-02-9 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)26-39-61 |
| 611-073-00-9 | dimethyl 3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionate | 407-310-9 | 122630-55-1 | R53 | R: 53S: 61 |
| 611-074-00-4 | reaction mass of: sodium/potassium (3-(4-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II);sodium/potassium (3-(4-(5-(5-chloro-4,6-difluoropyrimidin-2-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II) | 407-100-7 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-075-00-X | reaction mass of: tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(2-amino-4-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate;tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(4-amino-2-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate (2:1) | 406-000-0 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 611-076-00-5 | 3-(2,6-dichloro-4-nitrophenylazo)-1-methyl-2-phenylindole | 406-280-4 | 117584-16-4 | N; R50-53 | NR: 50/53S: 60-61 |
| 611-077-00-0 | dilithium disodium (5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenebisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalene-2,7-disulfonato(8)))dicuprate(2-) | 407-230-4 | 126637-70-5 | Xn; R22R43 | XnR: 22-43S: (2-)22-24-37 |
| 611-078-00-6 | (2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dicopper(II) acetate lactate | 407-240-9 | 159604-94-1 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 611-079-00-1 | disodium 7-[4-chloro-6-(N-ethyl-o-toluidino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalenesulfonate | 410-390-8 | 147703-64-8 | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 611-080-00-7 | sodium 3-(2-acetamido-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzenesulfonate | 410-150-2 | 147703-65-9 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-081-00-2 | tetrasodium [7-(2,5-dihydroxy-KO2-7-sulfonato-6-[4-(2,5,6-trichloro-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-KO8-naphthalene-1,3,5-trisulfonato(6-)]cuprate(II) | 411-470-5 | 141048-13-7 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 611-082-00-8 | reaction mass of: pentasodium bis(1-(3(or 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrate(1-);pentasodium [(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)-(5-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato]ferrate(1-) | 407-570-3 | — | N; R51-53 | NR: 51/53S: 61 |
| 611-083-00-3 | reaction mass of: 2-[N-ethyl-4-[(5,6-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate;2-[N-ethyl-4-[(6,7-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate (1:1) | 411-560-4 | — | T; R48/25R43N; R51-53 | T; NR: 43-48/25-51/53S: (1/2-)22-36/37-45-61 |
| 611-084-00-9 | reaction mass of: N-(4-chlorophenyl)-4-(2,5-dichloro-4-(dimethylsulfamoyl)phenylazo)-3-hydroxy-2-naphthalenecarboxamide;N-(4-chlorophenyl)-4-(2,5-dichloro-4-(methylsulfamoyl)phenylazo)-3-hydroxy-2-naphthalenecarboxamide | 412-550-2 | — | R53 | R: 53S: 61 |
| 611-085-00-4 | reaction mass of: 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-amino-4-methyl-6-[3-(3-hydroxypropoxy)propylamino]pyridine;3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-amino-4-methyl-2-[3-(3-methoxypropoxy)propylamino]pyridine | 411-880-4 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 611-086-00-X | monolithium 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalenesulfonate], iron complex, monohydrate | 411-360-7 | — | R52-53 | R: 52/53S: 61 |
| 611-087-00-5 | reaction mass of: 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxyl-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-phenoxyethane;3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) | 411-710-9 | — | R53 | R: 53S: 61 |
| 611-088-00-0 | reaction mass of: trilithium 4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate;trilithium 4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate | 411-890-9 | — | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)22-26-39-61 |
| 611-089-00-6 | 2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium methylsulfate | 411-100-2 | 136213-73-5 | Xn; R48/22R43N; R50-53 | Xn; NR: 43-48/22-50/53S: (2-)22-36/37-60-61 |
| 611-090-00-1 | 2,5-dibutoxy-4-(morpholin-4-yl)benzenediazonium 4-methylbenzenesulfonate | 413-290-2 | 93672-52-7 | F; R11Xn; R22Xi; R41R43R52-53 | F; XnR: 11-22-41-43-52/53S: (2-)12-22-24-26-37/39-47-61 |
| 611-091-00-7 | sodium (1.0-1.95)/lithium (0.05-1) 5-((5-((5-chloro-6-fluoro-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinemethylsulfonate | 413-470-0 | 134595-59-8 | R43 | XiR: 43S: (2-)22-24/25-37 |
| 611-092-00-2 | tert-(dodecyl/tetradecyl)-ammonium bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzenesulfonamidato)chromate | 413-210-6 | — | N; R51-53 | NR: 51/53S: 61 |
| 611-093-00-8 | sodium 2-(4-(4-fluoro-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzene-1-sulfonate | 410-770-3 | 146177-84-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-094-00-3 | reaction mass of: 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichloro-1,3-benzothiazole;2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichloro-1,3-benzotriazole (1:1) | 411-600-0 | 143145-93-1 | R53 | R: 53S: 61 |
| 611-095-00-9 | hexasodium 1,1'-[(1-amino-8-hydroxy-3,6-disulfonate-2,7-naphthalenediyl)bis(azo(4-sulfonate-1,3-phenyl)imino[6-[(4-chloro-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxide | 412-240-7 | 89797-03-5 | N; R51-53 | NR: 51/53S: 22-61 |
| 611-096-00-4 | methyl N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinate | 413-040-2 | 149850-30-6 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-097-00-X | reaction mass of iron complexes of: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)benzene and: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]benzene (n=2,5,6) | 414-150-3 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 611-098-00-5 | tetrakis(tetramethylammonium)3,3'-(6-(2-hydroxyethylamino)1,3,5-triazine-2,4-diylbisimino(2-methyl-4,1-phenyleneazo))bisnaphthalene-1,5-disulfonate | 405-950-3 | 131013-83-7 | T; R25R52-53 | TR: 25-52/53S: (1/2-)37-45-61 |
| 611-099-00-0 | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | 401-500-5 | 118658-99-4 | Carc. Cat. 2; R45N; R51-53 | T; NR: 45-51/53S: 53-45-61 |
| 611-100-00-4 | potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazine-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate | 403-810-6 | 140876-13-7 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 611-101-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide | 405-200-5 | 104366-25-8 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-103-00-0 | trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) | 407-110-1 | — | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 |
| 611-104-00-6 | reaction mass of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-);trisodium bis(2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)ferrate(1-);trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(4-nitro-2-sulfonatophenylazo)phenolato)ferrate(1-);trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(3-sulfonatophenylazo)phenolato)ferrate(1-);disodium 3,3'-(2,4-dihydroxy-1,3(or 1,5 or 3,5)-phenylenediazo)dibenzenesulfonate | 406-870-1 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 611-105-00-1 | sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate | 407-800-2 | 136213-75-7 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 611-106-00-7 | hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate | 410-180-6 | 157627-99-1 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 611-107-00-2 | potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate | 412-490-7 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-108-00-8 | disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate | 413-600-6 | 6527-62-4 | R52-53 | R: 52/53S: 61 |
| 611-109-00-3 | Reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazine (2:1) | 407-710-3 | — | N; R51-53 | NR: 51/53S: 61 |
| 611-110-00-9 | tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene | 408-210-8 | 124605-82-9 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-28-37-61 |
| 611-111-00-4 | disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydroxy-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) | 414-230-8 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-112-00-X | tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate | 413-070-6 | — | R43 | XiR: 43S: (2-)22-24-37 |
| 611-113-00-5 | lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) | 414-280-0 | 149626-00-6 | N; R51-53 | NR: 51/53S: 24/25-61 |
| 611-114-00-0 | lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3-)) chromate(2-) | 414-250-7 | 149564-66-9 | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)22-26-39-61 |
| 611-115-00-6 | trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) | 414-290-5 | 149564-65-8 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 611-116-00-1 | reaction mass of: trisodium 5-{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate;trisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | 414-620-8 | — | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 611-117-00-7 | 1,3-bis{6-fluoro-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}propane lithium-, sodium salt | 415-100-3 | 149850-29-3 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-118-00-2 | sodium 1,2-bis[4-[4-{4-(4-sulfophenylazo)-2-sulfophenylazo}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt | 413-990-8 | R43 | XiR: 43S: (2-)22-24-37 |
| 611-119-00-8 | tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | 415-400-4 | 148878-22-2 | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 611-120-00-3 | 5-{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfo-naphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt | 418-340-7 | 157707-94-3 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)22-26-39-61 |
| 611-121-00-9 | Main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)phenylazo]naphthalene-2-ol;Main component 8 (isomer): asym. 1:2 Cr-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)-naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalene-2-ol | 417-280-9 | 30785-74-1 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 611-122-00-4 | hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel | 417-250-5 | 151436-99-6 | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 611-123-00-X | 3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammonium lactate | 424-310-4 | 178452-66-9 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 611-124-00-5 | reaction mass of: pentasodium 5-amino-3-(5-{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate;pentasodium 5-amino-6-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-3-(5-{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate;tetrasodium 5-amino-3-[5-{4-chloro-6-[4-(vinylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo]-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate | 424-320-9 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 611-125-00-0 | reaction mass of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex;Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(2-hydroxyethylsulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex | 423-940-7 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 611-126-00-6 | 2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride | 424-120-1 | 174514-06-8 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 611-127-00-1 | pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate | 423-790-2 | — | R5Xi; R41R43R52-53 | XiR: 5-41-43-52/53S: (2-)22-26-36/37/39-41-61 |
| 611-128-00-7 | N,N'-bis{6-chloro-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt | 419-500-9 | 171599-85-2 | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 |
| 611-129-00-2 | reaction mass of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid;5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid | 418-230-9 | 163879-69-4 | E; R2Repr. Cat. 3; R62Xn; R48/22R43N; R51-53 | E; Xn; NR: 2-43-48/22-62-51/53S: (2-)26-35-36/37-61 |
| 611-130-00-8 | tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate | 418-520-5 | 183130-96-3 | Xi; R36N; R50-53 | Xi; NR: 36-50/53S: (2-)26-39-60-61 |
| 611-131-00-3 | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | 420-580-2 | 151798-26-4 | Repr. Cat. 2; R61R53 | TR: 61-53S: 53-45-61 |
| 611-132-00-9 | pentasodium bis{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato} chromate (III) | 419-210-2 | 178452-71-6 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 611-133-00-4 | Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1-hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt | 419-260-5 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 |
| 611-134-00-X | trisodium 2-{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino}-4-sulfonatobenzoate, copper complex | 423-770-3 | — | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)22-26-39-61 |
| 611-135-00-5 | Reaction product of: 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative,mixed potassium/sodium salt | 424-250-9 | — | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 |
| 611-136-00-0 | 2-{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-2-aminopropyl formate | 424-260-3 | — | Repr. Cat. 3; R62Xi; R41N; R51-53 | Xn; NR: 41-62-51/53S: (2-)22-26-36/37/39-61 |
| 611-137-00-6 | 6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole | 419-870-1 | 159038-16-1 | R53 | R: 53S: 61 |
| 611-138-00-1 | 2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole | 415-910-7 | 152828-25-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 611-140-00-2 | azafenidin (ISO)2-(2,4-dichloro-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one | — | 68049-83-2 | Repr. Cat. 2; R61Repr. Cat. 3; R62Xn; R48/22N; R50-53 | T; NR: 61-48/22-62-50/53S: 53-45-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % | E |
| 612-001-00-9 | mono-methylamine; [1]di-methylamine; [2]tri-methylamine [3] | 200-820-0 [1]204-697-4 [2]200-875-0 [3] | 74-89-5 [1]124-40-3 [2]75-50-3 [3] | F+; R12Xn; R20Xi; R37/38-41 | F+; XnR: 12-20-37/38-41S: (2-)16-26-39 | Xn; R20: C ≥ 5 %Xi; R37/38-41: C ≥ 5 %Xi; R36: 0,5 % ≤ C < 5 % | 5 |
| 612-001-01-6 | mono-methylamine ... %; [1]di-methylamine ... %; [2]tri-methylamine ... % [3] | 200-820-0 [1]204-697-4 [2]200-875-0 [3] | 74-89-5 [1]124-40-3 [2]75-50-3 [3] | F+; R12Xn; R20/22C; R34 | F+; CR: 12-20/22-34S: (1/2-)3-16-26-29-36/37/39-45 | Xn; R20/22: C ≥ 15 %C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | B |
| 612-002-00-4 | ethylamine | 200-834-7 | 75-04-7 | F+; R12Xi; R36/37 | F+; XiR: 12-36/37S: (2-)16-26-29 |
| 612-003-00-X | diethylamine | 203-716-3 | 109-89-7 | F; R11Xn; R20/21/22C; R35 | F; CR: 11-20/21/22-35S: (1/2-)3-16-26-29-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 612-004-00-5 | triethylamine | 204-469-4 | 121-44-8 | F; R11Xn; R20/21/22C; R35 | F; CR: 11-20/21/22-35S: (1/2-)3-16-26-29-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 612-005-00-0 | butylamine | 203-699-2 | 109-73-9 | F; R11Xn; R20/21/22C; R35 | F; CR: 11-20/21/22-35S: (1/2-)3-16-26-29-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 612-006-00-6 | ethylenediamine;1,2-diaminoethane | 203-468-6 | 107-15-3 | R10Xn; R21/22C; R34R42/43 | CR: 10-21/22-34-42/43S: (1/2-)23-26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/38: 2 % ≤ C < 10 % |
| 612-007-00-1 | 2-aminopropane;isopropylamine | 200-860-9 | 75-31-0 | F+; R12Xi; R36/37/38 | F+; XiR: 12-36/37/38S: (2-)16-26-29 |
| 612-008-00-7 | aniline | 200-539-3 | 62-53-3 | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R23/24/25-48/23/24/25Xi; R41R43N; R50 | T; NR: 23/24/25-40-41-43-48/23/24/25-68-50S: (1/2-)26-27-36/37/39-45-46-61-63 | T; R23/24/25: C ≥ 25 %Xn; R20/21/22: 1 % ≤ C < 25 %T; R48/23/24/25: C ≥ 1 %Xn; R48/20/21/22: 0,2 % ≤ C < 1 % |
| 612-009-00-2 | salts of aniline | — | — | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R23/24/25-48/23/24/25Xi; R41R43N; R50 | T; NR: 23/24/25-40-41-43-48/23/24/25-68-50S: (1/2-)26-27-36/37/39-45-61-63 | T; R23/24/25: C ≥ 25 %Xn; R20/21/22: 1 % ≤ C < 25 %T; R48/23/24/25: C ≥ 1 %Xn; R48/20/21/22: 0,2 % ≤ C < 1 % | A |
| 612-010-00-8 | chloroanilines, with exception of those specified elsewhere in this Annex | — | — | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-36/37-45-60-61 | C |
| 612-011-00-3 | 4-nitrosoaniline | 211-535-6 | 659-49-4 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)25-28 |
| 612-012-00-9 | o-nitroaniline; [1]m-nitroaniline; [2]p-nitroaniline [3] | 201-855-4 [1]202-729-1 [2]202-810-1 [3] | 88-74-4 [1]99-09-2 [2]100-01-6 [3] | T; R23/24/25R33R52-53 | TR: 23/24/25-33-52/53S: (1/2-)28-36/37-45-61 | C |
| 612-013-00-4 | 3-aminobenzene sulphonic acid;metanilic acid | 204-473-6 | 121-47-1 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)25-28 |
| 612-014-00-X | sulphanilic acid;4-aminobenzenesulphonic acid | 204-482-5 | 121-57-3 | Xi; R36/38R43 | XiR: 36/38-43S: (2-)24-37 |
| 612-015-00-5 | N-methylaniline | 202-870-9 | 100-61-8 | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-36/37-45-60-61 |
| 612-016-00-0 | N,N-dimethylaniline | 204-493-5 | 121-69-7 | Carc. Cat. 3; R40T; R23/24/25N; R51-53 | T; NR: 23/24/25-40-51/53S: (1/2-)28-36/37-45-61 |
| 612-017-00-6 | N-methyl-N,2,4,6-tetranitroaniline;tetryl | 207-531-9 | 479-45-8 | E; R2 ⊗T; R23/24/25R33 | E; TR: 2-23/24/25-33S: (1/2-)35-45 |
| 612-018-00-1 | bis(2,4,6-trinitrophenyl)amine;hexyl | 205-037-8 | 131-73-7 | E; R2 ⊗T+; R26/27/28R33N; R51-53 | E; T+; NR: 2-26/27/28-33-51/53S: (1/2-)35-36-45-61 |
| 612-019-00-7 | dipicrylamine, ammonium salt | 220-639-0 | 2844-92-0 | E ⊗R1T+; R26/27/28R33N; R51-53 | E; T+; NR: 1-26/27/28-33-51/53S: (1/2-)28-36/37-45-61 |
| 612-020-00-2 | 1-naphthylamine | 205-138-7 | 134-32-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)24-61 |
| 612-022-00-3 | 2-naphthylamine | 202-080-4 | 91-59-8 | Carc. Cat. 1; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | Carc. Cat. 1; R45: C ≥ 0,01 % | E |
| 612-023-00-9 | phenylhydrazine; [1]phenylhydrazinium chloride; [2]phenylhydrazine hydrochloride; [3]phenylhydrazinium sulphate (2:1) [4] | 202-873-5 [1]200-444-7 [2]248-259-0 [3]257-622-2 [4] | 100-63-0 [1]59-88-1 [2]27140-08-5 [3]52033-74-6 [4] | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R23/24/25-48/23/24/25Xi; R36/38R43N; R50 | T; NR: 45-23/24/25-36/38-43-48/23/24/25-68-50S: 53-45-61 | E |
| 612-024-00-4 | m-toluidine;3-aminotoluene | 203-583-1 | 108-44-1 | T; R23/24/25R33N; R50 | T; NR: 23/24/25-33-50S: (1/2-)28-36/37-45-61 |
| 612-025-00-X | nitrotoluidines, with the exception of those specified elsewhere in this Annex | — | — | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-36/37-45-61 | C |
| 612-026-00-5 | diphenylamine | 204-539-4 | 122-39-4 | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-36/37-45-60-61 |
| 612-027-00-0 | xylidines with the exception of those specified elsewhere in this Annex;dimethyl anilines with the exception of those specified elsewhere in this Annex | — | — | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-36/37-45-61 | C |
| 612-028-00-6 | p-phenylenediamine | 203-404-7 | 106-50-3 | T; R23/24/25Xi; R36R43N; R50-53 | T+; NR: 23/24/25-36-43-50/53S: (1/2-)28-36/37-45-60-61 |
| 612-029-00-1 | benzene-1,4-diamine dihydrochloride;p-phenylenediamine dihydrochloride | 210-834-9 | 624-18-0 | T; R23/24/25Xi; R36R43N; R50-53 | T; NR: 23/24/25-36-43-50/53S: (1/2-)28-36/37-45-60-61 |
| 612-030-00-7 | 2-methyl-p-phenylenediamine sulphate [1] | 210-431-8 [1]228-871-4 [2] | 615-50-9 [1]6369-59-1 [2] | T; R25Xn; R20/21R43N; R51-53 | T; NR: 20/21-25-43-51/53S: (1/2-)24-37-45-61 |
| 612-031-00-2 | N,N-dimethylbenzene-1,3-diamine; [1]4-amino-N,N-dimethylaniline;3-amino-N,N'-dimethylaniline [2] | 220-623-3 [1]202-807-5 [2] | 2836-04-6 [1]99-98-9 [2] | T; R23/24/25 | TR: 23/24/25S: (1/2-)28-45 | C |
| 612-032-00-8 | N,N,N',N'-tetramethyl-p-phenylenediamine | 202-831-6 | 100-22-1 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)28 |
| 612-033-00-3 | 2-aminophenol | 202-431-1 | 95-55-6 | Xn; R20/22Muta. Cat. 3; R68 | XnR: 20/22-68S: (2-)28-36/37 |
| 612-034-00-9 | 2-amino-4,6-dinitrophenol;picramic acid | 202-544-6 | 96-91-3 | E; R1 ⊗Xn; R20/21/22R52-53 | E; XnR: 1-20/21/22-52/53S: (2-)35-61 |
| 612-035-00-4 | 2-methoxyaniline;o-anisidine | 201-963-1 | 90-04-0 | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R23/24/25 | TR: 45-23/24/25-68S: 53-45 | E |
| 612-036-00-X | 3,3'-dimethoxybenzidine;o-dianisidine | 204-355-4 | 119-90-4 | Carc. Cat. 2; R45Xn; R22 | TR: 45-22S: 53-45 | E |
| 612-037-00-5 | salts of 3,3'-dimethoxybenzidine;salts of o-dianisidine | — | — | Carc. Cat. 2; R45Xn; R22 | TR: 45-22S: 53-45 | AE |
| 612-038-00-0 | 2-nitro-p-anisidine;4-methoxy-2-nitroaniline | 202-547-2 | 96-96-8 | T+; R26/27/28R33R52-53 | T+R: 26/27/28-33-52/53S: (1/2-)28-36/37-45-61 |
| 612-039-00-6 | 2-ethoxyaniline;o-phenetidine | 202-356-4 | 94-70-2 | T; R23/24/25R33 | TR: 23/24/25-33S: (1/2-)28-36/37-45 |
| 612-040-00-1 | 2,4-dinitroaniline | 202-553-5 | 97-02-9 | T+; R26/27/28R33N; R51-53 | T+; NR: 26/27/28-33-51/53S: (1/2-)28-36/37-45-61 |
| 612-041-00-7 | 4,4'-bi-o-toluidine | 204-358-0 | 119-93-7 | Carc. Cat. 2; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | E |
| 612-042-00-2 | benzidine;1,1'-biphenyl-4,4'-diamine;4,4'-diaminobiphenyl;biphenyl-4,4'-ylenediamine | 202-199-1 | 92-87-5 | Carc. Cat. 1; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | Carc. Cat. 1; R45: C ≥ 0,01 % | E |
| 612-043-00-8 | N,N'-dimethylbenzidine | — | 2810-74-4 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)22-36 |
| 612-044-00-3 | N,N'-diacetylbenzidine | 210-338-2 | 613-35-4 | Xn; R20/21/22 | XnR: 20/21/22S: (2-)22-36 |
| 612-046-00-4 | allylamine | 203-463-9 | 107-11-9 | F; R11T; R23/24/25N; R51-53 | F; T; NR: 11-23/24/25-51/53S: (1/2-)9-16-24/25-45-61 |
| 612-047-00-X | benzylamine | 202-854-1 | 100-46-9 | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-36/37/39-45 |
| 612-048-00-5 | dipropylamine | 205-565-9 | 142-84-7 | F; R11Xn; R20/21/22C; R35 | F; CR: 11-20/21/22-35S: (1/2-)16-26-36/37/39-45 | C; R35: C ≥ 10 %C; R34: 5 % ≤ C < 10 %Xi; R36/37/38: 1 % ≤ C < 5 % |
| 612-049-00-0 | di-n-butylamine; [1]di-sec-butylamine [2] | 203-921-8 [1]210-937-9 [2] | 111-92-2 [1]626-23-3 [2] | R10Xn; R20/21/22 | XnR: 10-20/21/22S: (2-) |
| 612-050-00-6 | cyclohexylamine | 203-629-0 | 108-91-8 | R10Xn; R21/22C; R34 | CR: 10-21/22-34S: (1/2-)36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/38: 2 % ≤ C < 10 % |
| 612-051-00-1 | 4,4'-diaminodiphenylmethane;4,4'-methylenedianiline | 202-974-4 | 101-77-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R39/23/24/25Xn; R48/20/21/22R43N; R51-53 | T; NR: 45-39/23/24/25-43-48/20/21/22-68-51/53S: 53-45-61 | E |
| 612-052-00-7 | (S)-sec-butylamine;(S)-2-aminobutane; [1](R)-sec-butylamine;(R)-2-aminobutane; [2]sec-butylamine;2-aminobutane [3] | 208-164-7 [1]236-232-6 [2]237-732-7 [3] | 513-49-5 [1]13250-12-9 [2]13952-84-6 [3] | F; R11Xn; R20/22C; R35N; R50 | F; C; NR: 11-20/22-35-50S: (1/2-)9-16-26-28-36/37/39-45-61 | C |
| 612-053-00-2 | N-ethylaniline | 203-135-5 | 103-69-5 | T; R23/24/25R33 | TR: 23/24/25-33S: (1/2-)28-37-45 |
| 612-054-00-8 | N,N-diethylaniline | 202-088-8 | 91-66-7 | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-37-45-61 | T; R23/24/25: C ≥ 5 %Xn; R20/21/22: 1 % ≤ C < 5 % |
| 612-055-00-3 | N-methyl-o-toluidine; [1]N-methyl-m-toluidine; [2]N-methyl-p-toluidine [3] | 210-260-9 [1]211-795-0 [2]210-769-6 [3] | 611-21-2 [1]696-44-6 [2]623-08-5 [3] | T; R23/24/25R33R52-53 | TR: 23/24/25-33-52/53S: (1/2-)28-36/37-45-61 | C |
| 612-056-00-9 | N,N-dimethyl-p-toluidine; [1]N,N-dimethyl-m-toluidine; [2]N,N-dimethyl-o-toluidine [3] | 202-805-4 [1]204-495-6 [2]210-199-8 [3] | 99-97-8 [1]121-72-2 [2]609-72-3 [3] | T; R23/24/25R33R52-53 | TR: 23/24/25-33-52/53S: (1/2-)28-36/37-45-61 | T; R23/24/25: C ≥ 5 %Xn; R20/21/22: 1 % ≤ C < 5 % | C |
| 612-057-00-4 | piperazine | 203-808-3 | 110-85-0 | C; R34R42/43R52-53 | CR: 34-42/43-52/53S: (1/2-)22-26-36/37/39-45-61 |
| 612-058-00-X | 2,2'-iminodiethylamine;diethylenetriamine | 203-865-4 | 111-40-0 | Xn; R21/22C; R34R43 | CR: 21/22-34-43S: (1/2-)26-36/37/39-45 |
| 612-059-00-5 | 3,6-diazaoctanethylenediamin;triethylenetetramine | 203-950-6 | 112-24-3 | Xn; R21C; R34R43R52-53 | CR: 21-34-43-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-060-00-0 | 3,6,9-triazaundecamethylenediamine;tetraethylenepentamine | 203-986-2 | 112-57-2 | Xn; R21/22C; R34R43N; R51-53 | C; NR: 21/22-34-43-51/53S: (1/2-)26-36/37/39-45-61 |
| 612-061-00-6 | 3-aminopropyldimethylamine;N,N-dimethyl-1,3-diaminopropane | 203-680-9 | 109-55-7 | R10Xn; R22C; R34R43 | CR: 10-22-34-43S: (1/2-)26-36/37/39-45 |
| 612-062-00-1 | 3-aminopropyldiethylamine;N,N-diethyl-1,3-diaminopropane | 203-236-4 | 104-78-9 | R10Xn; R21/22C; R34R43 | CR: 10-21/22-34-43S: (1/2-)26-36/37/39-45 |
| 612-063-00-7 | 3,3'-iminodi(propylamine);dipropylenetriamine | 200-261-2 | 56-18-8 | T+; R26T; R24Xn; R22C; R35R43 | T+; CR: 22-24-26-35-43S: (1/2-)26-28-36/37/39-45 |
| 612-064-00-2 | 3,6,9,12-tetra-azatetradecamethylenediamine;pentacthylenehexamine | 223-775-9 | 4067-16-7 | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-065-00-8 | polyethlyenepolyamines with the exception of those specified elsewhere in this Annex | — | — | Xn; R21/22C; R34R43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-066-00-3 | dicyclohexylamine | 202-980-7 | 101-83-7 | Xn; R22C; R34N; R50-53 | C; NR: 22-34-50/53S: (1/2-)26-36/37/39-45-60-61 | C; R34: C ≥ 10 %Xi; R36/38: 2 % ≤ C < 10 % |
| 612-067-00-9 | 3-aminomethyl-3,5,5-trimethylcyclohexylamine | 220-666-8 | 2855-13-2 | Xn; R21/22C; R34R43R52-53 | CR: 21/22-34-43-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-068-00-4 | 3,3'-dichlorobenzidine;3,3'-dichlorobiphenyl-4,4'-ylenediamine | 202-109-0 | 91-94-1 | Carc. Cat. 2; R45Xn; R21R43N; R50-53 | T; NR: 45-21-43-50/53S: 53-45-60-61 | E |
| 612-069-00-X | salts of 3,3'-dichlorobenzidine;salts of 3,3'-dichlorobiphenyl-4,4'-ylenediamine | ——— | ——— | Carc. Cat. 2; R45Xn; R21R43N; R50-53 | T; NR: 45-21-43-50/53S: 53-45-60-61 | AE |
| 612-070-00-5 | salts of benzidine [ | 208-519-6208-520-1244-236-4252-984-8 | 531-85-1531-86-221136-70-936341-27-2 | Carc. Cat. 1; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | AE |
| 612-071-00-0 | salts of 2-naphthylamine | 209-030-0210-313-6 | 553-00-4612-52-2 | Carc. Cat. 1; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | AE |
| 612-072-00-6 | biphenyl-4-ylamine;xenylamine;4-aminobiphenyl | 202-177-1 | 92-67-1 | Carc. Cat. 1; R45Xn; R22 | TR: 45-22S: 53-45 | E |
| 612-073-00-1 | salts of biphenyl-4-ylamine;salts of xenylamine;salts of 4-aminobiphenyl | — | — | Carc. Cat. 1; R45Xn; R22 | TR: 45-22S: 53-45 | AE |
| 612-074-00-7 | benzyldimethylamine | 203-149-1 | 103-83-3 | R10Xn; R20/21/22C; R34R52-53 | CR: 10-20/21/22-34-52/53S: (1/2-)26-36-45-61 |
| 612-075-00-2 | 2-aminoethyldimethylamine;2-dimethylaminoethylamine | 203-541-2 | 108-00-9 | F; R11Xn; R21/22C; R35 | F; CR: 11-21/22-35S: (1/2-)16-23-26-28-36-45 |
| 612-076-00-8 | ethyldimethylamine | 209-940-8 | 598-56-1 | F+; R12 ⊗Xn; R20/22C; R34 | F+; CR: 12-20/22-34S: (1/2-)3-16-26-36-45 |
| 612-077-00-3 | dimethylnitrosoamine;N-nitrosodimethylamine | 200-549-8 | 62-75-9 | Carc. Cat. 2; R45T+; R26T; R25-48/25N; R51-53 | T+; NR: 45-25-26-48/25-51/53S: 53-45-61 | Carc. Cat. 2; R45: C ≥ 0,001 % | E |
| 612-078-00-9 | 2,2'-dichloro-4,4'-methylenedianiline;4,4'-methylene bis(2-chloroaniline) | 202-918-9 | 101-14-4 | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | E |
| 612-079-00-4 | salts of 2,2'-dichloro-4,4'-methylenedianiline;salts of 4,4'-methylenebis(2-chloroaniline) | — | — | Carc. Cat. 2; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | AE |
| 612-080-00-X | 4-amino-N,N-diethylaniline;N,N-diethyl-p-phenylendiamine | 202-214-1 | 93-05-0 | T; R25C; R34 | TR: 25-34S: (1/2-)26-36-45 |
| 612-081-00-5 | salts of 4,4'-bi-o-toluidine;salts of 3,3'-dimethylbenzidine;salts of o-tolidine | 210-322-5265-294-7277-985-0 | 612-82-864969-36-474753-18-7 | Carc. Cat. 2; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | AE |
| 612-082-00-0 | thiourea;thiocarbamide | 200-543-5 | 62-56-6 | Carc. Cat. 3; R40Repr. Cat. 3; R63Xn; R22N; R51-53 | Xn; NR: 22-40-51/53-63S: (2-)36/37-61 |
| 612-083-00-6 | 1-methyl-3-nitro-1-nitrosoguanidine | 200-730-1 | 70-25-7 | Carc. Cat. 2; R45Xn; R20Xi; R36/38N; R51-53 | T; NR: 45-20-36/38-51/53S: 53-45-61 | Carc. Cat. 2; R45: C ≥ 0,01 % | E |
| 612-084-00-1 | dapsone;4,4'-diamino diphenyl sulfone | 201-248-4 | 80-08-0 | Xn; R22 | XnR: 22S: (2-)22 |
| 612-085-00-7 | 4,4'-methylenedi-o-toluidine | 212-658-8 | 838-88-0 | Carc. Cat. 2; R45Xn; R22R43N; R50-53 | T; NR: 45-22-43-50/53S: 53-45-60-61 | E |
| 612-086-00-2 | amitraz (ISO);N,N-bis(2,4-xylyliminomethyl) methylamine | 251-375-4 | 33089-61-1 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)22-24-60-36/37-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 612-087-00-8 | guazatine (ISO) | 108173-90-6 | T+; R26Xn; R21/22Xi; R37/38-41N; R50-53 | T+; NR: 21/22-26-37/38-41-50/53S: (1/2-)26-28-36/37/39-38-45-46-60-61-63 |
| 612-088-00-3 | simazine (ISO);6-chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine | 204-535-2 | 122-34-9 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-46-60-61 |
| 612-089-00-9 | 1,5-naphthylenediamine | 218-817-8 | 2243-62-1 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 612-090-00-4 | 2,2'-(nitrosoimino)bisethanol | 214-237-4 | 1116-54-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 |
| 612-091-00-X | o-toluidine;2-aminotoluene | 202-429-0 | 95-53-4 | Carc. Cat. 2; R45T; R23/25Xi; R36N; R50 | T; NR: 45-23/25-36-50S: 53-45-61 | E |
| 612-092-00-5 | N,N'-(2,2-dimethylpropylidene)hexamethylenediamine | 401-660-6 | 1000-78-8 | Xi; R38R43 | XiR: 38-43S: (2-)24-37 |
| 612-093-00-0 | 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline | 401-790-3 | 104147-32-2 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-26-57-60-61 |
| 612-094-00-6 | 4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride | 402-190-4 | — | T; R48/25Xn; R22-48/20Xi; R41R43N; R50-53 | T; NR: 22-41-43-48/20-48/25-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-095-00-1 | benzyl-2-hydroxydodecyldimethylammonium benzoate | 402-610-6 | 113694-52-3 | C; R34Xn; R22N; R50-53 | C; NR: 22-34-50/53S: (1/2-)26-28-36/37/39-45-60-61 |
| 612-096-00-7 | 4,4'-carbonimidoylbis[N,N-dimethylaniline] | 207-762-5 | 492-80-8 | Carc. Cat. 3; R40Xn; R22Xi; R36N; R51-53 | Xn; NR: 22-36-40-51/53S: (2-)36/37-61 |
| 612-097-00-2 | salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] | — | — | Carc. Cat. 3; R40Xn; R22Xi; R36N; R51-53 | Xn; NR: 22-36-40-51/53S: (2-)36/37-61 | A |
| 612-098-00-8 | nitrosodipropylamine | 210-698-0 | 621-64-7 | Carc. Cat. 2; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | Carc. Cat. 2; R45: C ≥ 0,001 % | E |
| 612-099-00-3 | 4-methyl-m-phenylenediamine;2,4-toluenediamine | 202-453-1 | 95-80-7 | Carc. Cat. 2; R45T; R25Xn; R21Xi; R36R43N; R51-53 | T; NR: 45-21-25-36-43-51/53S: 53-45-61 | E |
| 612-100-00-7 | propylenediamine | 201-155-9 | 78-90-0 | R10Xn; R21/22C; R35 | CR: 10-21/22-35S: (1/2-)26-37/39-45 |
| 612-101-00-2 | methenamine;hexamethylenetetramine | 202-905-8 | 100-97-0 | F; R11R42/43 | F; XnR: 11-42/43S: (2-)16-22-24-37 |
| 612-102-00-8 | N,N-bis(3-aminopropyl)methylamine | 203-336-8 | 105-83-9 | T; R23/24Xn; R22C; R34 | TR: 22-23/24-34S: (1/2-)26-36/37/39-45 |
| 612-103-00-3 | N,N,N',N'-tetramethylethylenediamine | 203-744-6 | 110-18-9 | F; R11Xn; R20/22C; R34 | F; CR: 11-20/22-34S: (1/2-)16-26-36/37/39-45 |
| 612-104-00-9 | hexamethylenediamine | 204-679-6 | 124-09-4 | Xn; R21/22Xi; R37C; R34 | CR: 21/22-34-37S: (1/2-)22-26-36/37/39-45 |
| 612-105-00-4 | 2-piperazin-1-ylethylamine | 205-411-0 | 140-31-8 | Xn; R21/22C; R34R43R52-53 | CR: 21/22-34-43-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-106-00-X | 2,6-diethylaniline | 209-445-7 | 579-66-8 | Xn; R22 | XnR: 22S: (2-)23-24 |
| 612-107-00-5 | 1-phenylethylamine; [1]Dl-α-methylbenzylamine [2] | 202-706-6 [1]210-545-8 [2] | 98-84-0 [1]618-36-0 [2] | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-28-36/37/39-45 |
| 612-108-00-0 | 3-aminopropyltriethoxysilane | 213-048-4 | 919-30-2 | Xn; R22C; R34 | CR: 22-34S: (1/2-)26-36/37/39-45 |
| 612-109-00-6 | bis(2-dimethylaminoethyl)(methyl)amine | 221-201-1 | 3030-47-5 | T; R24Xn; R22C; R34 | TR: 22-24-34S: (1/2-)26-36/37/39-45 |
| 612-110-00-1 | 2,2'-dimethyl-4,4'-methylenebis(cyclohexylamine) | 229-962-1 | 6864-37-5 | T; R23/24Xn; R22C; R35N; R51-53 | T; C; NR: 22-23/24-35-51/53S: (1/2-)26-36/37/39-45-61 |
| 612-111-00-7 | 2-methyl-m-phenylenediamine;2,6-toluenediamine | 212-513-9 | 823-40-5 | Muta. Cat. 3; R68Xn; R21/22R43N; R51-53 | Xn; NR: 21/22-43-51/53-68S: (2-)24-36/37-61 |
| 612-112-00-2 | p-anisidine;4-methoxyaniline | 203-254-2 | 104-94-9 | T+; R26/27/28R33N; R50 | T+; NR: 26/27/28-33-50S: (1/2-)28-36/37-45-61 |
| 612-113-00-8 | 6-methyl-2,4-bis(methylthio)phenylene-1,3-diamine | 403-240-8 | 106264-79-3 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 612-114-00-3 | R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamide hydrogen 2,3-bis(benzoyloxy)succinate | 404-390-7 | — | F; R11R43R52-53 | F; XiR: 11-43-52/53S: (2-)24-37-61 |
| 612-115-00-9 | dimethyldioctadecylammonium hydrogen sulfate | 404-050-8 | 123312-54-9 | Xi; R36R53 | XiR: 36-53S: (2-)26-39-61 |
| 612-116-00-4 | C8-18alkylbis(2-hydroxyethyl)ammonium bis(2-ethylhexyl)phosphate | 404-690-8 | 68132-19-4 | T; R23C; R34R43N; R50-53 | T; NR: 23-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-117-00-X | C12-14-tert-alkylamine, methylphosphonic acid salt | 404-750-3 | 119415-07-5 | Xn; R22C; R34N; R51-53 | C; NR: 22-34-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 612-118-00-5 | A reaction mass of: (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium 4-toluenesulfonate; (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromide | 405-080-4 | — | Xi; R41N; R50-53 | X; NR: 41-50/53S: (2-)22-26-39-60-61 |
| 612-119-00-0 | benzyldimethyloctadecylammonium 3-nitrobenzenesulfonate | 405-330-2 | — | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 |
| 612-120-00-6 | aclonifen (ISO);2-chloro-6-nitro-3-phenoxyaniline | 277-704-1 | 74070-46-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 612-121-00-1 | amines, polyethylenepoly-;HEPA | 268-626-9 | 68131-73-7 | Xn; R21/22C; R34R43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-122-00-7 | hydroxylamine | 232-259-2 | 7803-49-8 | R5 ⊗Xn; R22-48/22Xi; R37/38-41R43N; R50 | Xn; NR: 5-22-37/38-41-43-48/22-50S: (2-)22-26-36/37/39-61 |
| 612-123-00-2 | hydroxylammonium chloride;hydroxylamine hydrochloride; [1]bis(hydroxylammonium) sulphate;hydroxylamine sulphate (2:1); [2]hydroxylammonium hydrogensulphate;hydroxylamine sulphate (1:1) [3] | 226-798-2 [1]233-118-8 [2]233-154-4 [3] | 5470-11-1 [1]10039-54-0 [2]10046-00-1 [3] | ⊗ Xn; R22-48/22Xi; R36/38R43N; R50 | Xn; NR: 22-36/38-43-48/22-50S: (2-)22-24-37-61 |
| 612-124-00-8 | N,N,N-trimethylanilinium chloride | 205-319-0 | 138-24-9 | T; R24/25 | TR: 24/25S: (1/2-)25-39-45-53 |
| 612-125-00-3 | 2-methyl-p-phenylenediamine;2,5-toluenediamine | 202-442-1 | 95-70-5 | T; R25Xn; R20/21R43N; R51-53 | T; NR: 20/21-25-43-51/53S: (1/2-)24-37-45-61 |
| 612-126-00-9 | toluene-2,4-diammonium sulphate;4-methyl-m-phenylenediamine sulfate | 265-697-8 | 65321-67-7 | Carc. Cat. 2; R45T; R25Xn; R21Xi; R36R43N; R51-53 | T; NR: 45-21-25-36-43-51/53S: 53-45-61 | E |
| 612-127-00-4 | 3-aminophenol | 209-711-2 | 591-27-5 | Xn; R20/22N; R51-53 | Xn; NR: 20/22-51/53S: (2-)28-61 |
| 612-128-00-X | 4-aminophenol | 204-616-2 | 123-30-8 | Muta. Cat. 3; R68Xn; R20/22N; R50-53 | Xn; NR: 20/22-50/53-68S: (2-)28-36/37-60-61 |
| 612-129-00-5 | diisopropylamine | 203-558-5 | 108-18-9 | F; R11Xn; R20/22C; R34 | F; CR: 11-20/22-34S: (1/2-)16-26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 612-130-00-0 | 2,6-diamino-3,5-diethyltoluene;4,6-diethyl-2-methyl-1,3-benzenediamine; [1]2,4-diamino-3,5-diethyltoluene;2,4-diethyl-6-methyl-1,3-benzenediamine; [2]diethylmethylbenzenediamine [3] | 218-255-3 [1]218-256-9 [2]270-877-4 [3] | 2095-01-4 [1]2095-02-5 [2]68479-98-1 [3] | Xn; R21/22-48/22Xi; R36N; R50-53 | Xn; NR: 21/22-36-48/22-50/53S: (2-)26-28-36/37/39-60-61 | C |
| 612-131-00-6 | didecyldimethylammonium chloride | 230-525-2 | 7173-51-5 | Xn; R22C; R34 | CR: 22-34S: (2-)26-36/37/39-45 |
| 612-132-00-1 | N,N'-diphenyl-p-phenylenediamine;N,N'-diphenyl-1,4-benzenediamine | 200-806-4 | 74-31-7 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 612-133-00-7 | (4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammonium sulphate;4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulphate | 247-162-0 | 25646-77-9 | T; R25Xn; R48/22R43N; R50-53 | T; NR: 25-43-48/22-50/53S: (1/2-)24-37-45-60-61 |
| 612-134-00-2 | N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methanesulphonamide sesquisulphate;4-(N-ethyl-N-2-methanesulphonylaminoethyl)-2-methylphenylenediamine sesquisulphate monohydrate | 247-161-5 | 25646-71-3 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 612-135-00-8 | N-2-naphthylaniline;N-phenyl-2-naphthylamine | 205-223-9 | 135-88-6 | Carc. Cat. 3; R40Xi; R36/38R43N; R51-53 | Xn; NR: 36/38-40-43-51/53S: (2-)26-36/37-61 |
| 612-136-00-3 | N-isopropyl-N'-phenyl-p-phenylenediamine | 202-969-7 | 101-72-4 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 | R43: C ≥ 0,1 % |
| 612-137-00-9 | 4-chloroaniline | 203-401-0 | 106-47-8 | Carc. Cat. 2; R45T; R23/24/25R43N; R50-53 | T; NR: 45-23/24/25-43-50/53S: 53-45-60-61 | E |
| 612-138-00-4 | furalaxyl (ISO);methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-Dl-alaninate | 260-875-1 | 57646-30-7 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)36/37/39-61 |
| 612-139-00-X | mefenacet (ISO);2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide | 277-328-8 | 73250-68-7 | N; R51-53 | NR: 51/53S: 61 |
| 612-140-00-5 | quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides | 264-151-6 | 63449-41-2 | Xn; R21/22C; R34N; R50 | C; NR: 21/22-34-50S: (2-)36/37/39-45-61 |
| 612-141-00-0 | 4,4'-methylenebis(2-ethylaniline);4,4'-methylenebis(2-ethylbenzeneamine) | 243-420-1 | 19900-65-3 | Carc. Cat. 3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)36/37-60-61 |
| 612-142-00-6 | biphenyl-2-ylamine | 201-990-9 | 90-41-5 | Carc. Cat. 3; R40Xn; R22R52-53 | XnR: 22-40-52/53S: (2-)36/37-61 |
| 612-143-00-1 | N5,N5-diethyltoluene-2,5-diamine monohydrochloride;4-diethylamino-2-methylaniline monohydrochloride | 218-130-3 | 2051-79-8 | T; R25Xi; R36R43N; R50-53 | T; NR: 25-36-43-50/53S: (1/2-)24-26-37-45-60-61 |
| 612-144-00-7 | flumetralin (ISO);N-(2-chloro-6-fluorobenzyl)-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine | — | 62924-70-3 | Xi; R36/38R43N; R50-53 | Xi; NR: 36/38-43-50/53S: (2-)36/37-60-61 |
| 612-145-00-2 | o-phenylenediamine | 202-430-6 | 95-54-5 | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R25Xn; R20/21Xi; R36R43N; R50-53 | T; NR: 20/21-25-36-40-43-50/53-68S: (1/2-)28-36/37-45-60-61 |
| 612-146-00-8 | o-phenylenediamine dihydrochloride | 210-418-7 | 615-28-1 | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R25Xn; R20/21Xi; R36R43N; R50-53 | T; NR: 20/21-25-36-40-43-50/53-68S: (1/2-)28-36/37-45-60-61 |
| 612-147-00-3 | m-phenylenediamine | 203-584-7 | 108-45-2 | Muta. Cat. 3; R68T; R23/24/25Xi; R36R43N; R50-53 | T; NR: 23/24/25-36-43-50/53-68S: (1/2-)28-36/37-45-60-61 |
| 612-148-00-9 | m-phenylenediamine dihydrochloride | 208-790-0 | 541-69-5 | Muta. Cat. 3; R68T; R23/24/25Xi; R36R43N; R50-53 | T; NR: 23/24/25-36-43-50/53-68S: (1/2-)28-36/37-45-60-61 |
| 612-149-00-4 | 1,3-diphenylguanidine | 203-002-1 | 102-06-7 | Repr. Cat. 3; R62Xn; R22Xi; R36/37/38N; R51-53 | Xn; NR: 22-36/37/38-51/53-62S: (2-)26-36/37/39-61 |
| 612-150-00-X | spiroxamine (ISO);8-tert-butyl-1,4-dioxaspiro[4.5]decan-2-ylmethyl(ethyl)(propyl)amine | — | 118134-30-8 | Xn; R20/21/22Xi; R38R43N; R50-53 | Xn; NR: 20/21/22-38-43-50/53S: (2-)36/37/39-46-60-61 |
| 612-151-00-5 | diaminotoluene, technical product - reaction mass of [2] and [3];methyl-phenylenediamine; [1]4-methyl-m-phenylene diamine; [2]2-methyl-m-phenylene diamine [3] | 246-910-3 [1]202-453-1 [2]212-513-9 [3] | 25376-45-8 [1]95-80-7 [2]823-40-5 [3] | Carc. Cat. 2; R45T; R25Xn; R20/21Xi; R36R43N; R51-53 | T; NR: 45-20/21-25-36-43-51/53S: 53-45-61 | E |
| 612-152-00-0 | N,N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamine | 406-610-7 | 62478-82-4 | R10Xn; R20/22-48/20C; R35R52-53 | CR: 10-20/22-35-48/20-52/53S: (1/2-)26-28-36/37/39-45-61 |
| 612-153-00-6 | 4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzene, monohydrochloride | 407-020-2 | 132885-85-9 | Xn; R22R43R52-53 | XnR: 22-43-52/53S: (2-)22-24-37-61 |
| 612-154-00-1 | 6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthene] | 410-890-6 | 95235-29-3 | R53 | R: 53S: 61 |
| 612-155-00-7 | 2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthene | 411-730-8 | 93071-94-4 | R53 | R: 53S: 61 |
| 612-156-00-2 | reaction mass of: trihexadecylmethylammonium chloride;dihexadecyldimethylammonium chloride | 405-620-9 | — | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 612-157-00-8 | (Z)-1-benzo[b]thien-2-ylethanone oxime hydrochloride | 410-780-8 | — | Xn; R22-48/22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-48/22-51/53S: (2-)22-26-36/37/39-61 |
| 612-158-00-3 | reaction mass of: bis(5-dodecyl-2-hydroxybenzald-oximate) copper (II) C12-alkyl group is branched;4-dodecylsalicylaldoxime | 410-820-4 | — | R53 | R: 53S: 61 |
| 612-159-00-9 | Reaction products of: trimethylhexamethylene diamine (a mixture of 2,2,4-trimethyl-1,6-hexanediamine and 2,4,4-trimethyl-1,6-hexanediamine, EINECS listed), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxirane derivatives) and p-toluene-sulfonic acid | 410-880-1 | — | Xn; R22C; R34N; R50-53 | C; NR: 22-34-50/53S: (1/2-)23-26-36/37/39-45-60-61 |
| 612-160-00-4 | p-toluidine;4-aminotoluene; [1]toluidinium chloride; [2]toluidine sulphate (1:1) [3] | 203-403-1 [1]208-740-8 [2]208-741-3 [3] | 106-49-0 [1]540-23-8 [2]540-25-0 [3] | Carc. Cat. 3; R40T; R23/24/25Xi; R36R43N; R50 | T; NR: 23/24/25-36-40-43-50S: (1/2-)28-36/37-45-61 |
| 612-161-00-X | 2,6-xylidine;2,6-dimethylaniline | 201-758-7 | 87-62-7 | Carc. Cat. 3; R40Xn; R20/21/22Xi; R37/38N; R51-53 | Xn; NR: 20/21/22-37/38-40-51/53S: (2-)23-25-36/37-61 |
| 612-162-00-5 | dimethyldioctadecylammonium chloride;DODMAC | 203-508-2 | 107-64-2 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)24-26-39-46-60-61 |
| 612-163-00-0 | metalaxyl-M (ISO);mefenoxam;(R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propionic acid methyl ester | — | 70630-17-0 | Xn; R22Xi; R41 | XnR: 22-41S: (2-)26-39-46 |
| 612-164-00-6 | 2-butyl-2-ethyl-1,5-diaminopentane | 412-700-7 | 137605-95-9 | Xn; R21/22-48/22C; R34R43R52-53 | CR: 21/22-34-43-48/22-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-165-00-1 | N,N'-diphenyl-N,N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamine | 413-810-8 | 65181-78-4 | N; R51-53 | NR: 51/53S: 61 |
| 612-166-00-7 | reaction mass of: cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1);trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1) | 411-830-1 | 114765-88-7 | Xi; R41R43R52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 |
| 612-167-00-2 | 5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]azepine-hydrochloride | 410-490-1 | — | Xn; R22-48/22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-48/22-51/53S: (2-)22-26-36/37/39-61 |
| 612-168-00-8 | 3,5-dichloro-2,6-difluoropyrdine-4-amine | 220-630-1 | 2840-00-8 | Xn; R21/22N; R51-53 | Xn; NR: 21/22-51/53S: (2-)36/37-61 |
| 612-170-00-9 | 4-chlorophenyl cyclopropyl ketone O-(4-aminobenzyl)oxime | 405-260-2 | — | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 612-171-00-4 | N,N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethane | 410-060-3 | 130728-76-6 | Muta. Cat. 3; R68R43N; R51-53 | Xn; NR: 43-68-51/53S: (2-)36/37-61 |
| 612-172-00-X | 4,4'-methylenebis(N,N'-dimethylcyclohexanamine | 412-840-9 | 13474-64-1 | Xn; R22-48/22C; R35R52-53 | CR: 22-35-48/22-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-173-00-5 | lithium 1-amino-4-(4-tert-butylanilino)anthraquinone-2-sulfonate | 411-140-0 | 125328-86-1 | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)22-26-36/37/39-61 |
| 612-174-00-0 | 4,4-dimethoxybutylamine | 407-690-6 | 19060-15-2 | Xn; R22C; R34R43R52-53 | CR: 22-34-43-52/53S: (1/2-)26-36/37/39-45-61 |
| 612-175-00-6 | 2-(O-aminooxy)ethylamine dihydrochloride | 412-310-7 | 37866-45-8 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 612-176-00-1 | Polymer of 1,3-dibromopropane and N,N-diethyl-N',N'-dimethyl-1,3-propanediamine | 410-570-6 | 143747-73-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 612-177-00-7 | 2-naphthylamino-6-sulfomethylamide | 412-120-4 | 104295-55-8 | Xn; R48/22R43N; R51-53 | Xn; NR: 43-48/22-51/53S: (2-)22-36/37-61 |
| 612-178-00-2 | 1,4,7,10-tetraazacyclododecane disulfate | 412-080-8 | 112193-77-8 | Xn; R22Xi; R37-41R52-53 | XnR: 22-37-41-52/53S: (2-)26-36/37/39-61 |
| 612-179-00-8 | 1-(2-propenyl)pyridinium chloride | 412-740-5 | 25965-81-5 | Xn; R22R43 | XnR: 22-43S: (2-)24-37 |
| 612-180-00-3 | 3-aminobenzylamine | 412-230-2 | 4403-70-7 | Xn; R22C; R34N; R51-53 | C; NR: 22-34-51/53S: (1/2-)22-26-36/37/39-45-61 |
| 612-181-00-9 | 2-phenylthioaniline | 413-030-8 | 1134-94-7 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 612-182-00-4 | 1-ethyl-1-methylmorpholinium bromide | 418-210-1 | 65756-41-4 | Muta. Cat. 3; R68 | XnR: 68S: (2-)36/37 |
| 612-183-00-X | 1-ethyl-1-methylpyrrolidinium bromide | 418-200-5 | 69227-51-6 | Muta. Cat. 3; R68 | XnR: 68S: (2-)36/37 |
| 612-184-00-5 | 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-one | 403-830-5 | 89331-94-2 | R52-53 | R: 52/53S: 61 |
| 612-185-00-0 | 1-[3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide | 407-400-8 | 59493-72-0 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 612-186-00-6 | bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate | 406-770-8 | 149057-64-7 | Xn; R48/22Xi; R41R43N; R50-53 | Xn; NR: 41-43-48/22-50/53S: (2-)22-26-36/37/39-60-61 |
| 612-187-00-1 | 2,3,4-trifluoroaniline | 407-170-9 | 3862-73-5 | Xn; R21/22-48/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-48/22-51/53S: (2-)23-26-36/37/39-61 |
| 612-188-00-7 | 4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) | 407-560-9 | 107934-68-9 | N; R51-53 | NR: 51/53S: 61 |
| 612-189-00-2 | 4-amino-2-(aminomethyl)phenol dihydrochloride | 412-510-4 | 135043-64-0 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)22-24-37-60-61 |
| 612-190-00-8 | 4,4'-methylenebis(2-isopropyl-6-methylaniline) | 415-150-6 | 16298-38-7 | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)36-61 |
| 612-191-00-3 | Polymer of allylamine hydrochloride | 415-050-2 | 71550-12-4 | Xn; R22R43 | XnR: 22-43S: (2-)36/37 |
| 612-192-00-9 | 2-isopropyl-4-(N-methyl)aminomethylthiazole | 414-800-6 | 154212-60-9 | Xn; R21/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-51/53S: (2-)26-36/37/39-61 |
| 612-193-00-4 | 3-methylaminomethylphenylamine | 414-570-7 | 18759-96-1 | Xn; R21/22C; R34R43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-194-00-X | 2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N,N,N-trimethyl-1-propanammonium chloride | 414-670-0 | 141890-30-4 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)26-39-60-61 |
| 612-195-00-5 | bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate | 415-210-1 | 160236-81-7 | Xn; R20/22Xi; R41N; R50-53 | Xn; NR: 20/22-41-50/53S: (2-)26-36/39-60-61 |
| 612-196-00-0 | 4-chloro-o-toluidine; [1]4-chloro-o-toluidine hydrochloride [2] | 202-441-6 [1]221-627-8 [2] | 95-69-2 [1]3165-93-3 [2] | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R23/24/25N; R50-53 | T; NR: 45-23/24/25-68-50/53S: 53-45-60-61 | E |
| 612-197-00-6 | 2,4,5-trimethylaniline; [1]2,4,5-trimethylaniline hydrochloride [2] | 205-282-0 [1][2] | 137-17-7 [1]21436-97-5 [2] | Carc. Cat. 2; R45T; R23/24/25N; R51-53 | T; NR: 45-23/24/25-51/53S: 53-45-61 | E |
| 612-198-00-1 | 4,4'-thiodianiline and its salts | 205-370-9 | 139-65-1 | Carc. Cat. 2; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | E |
| 612-199-00-7 | 4,4'-oxydianiline and its salts;p-aminophenyl ether | 202-977-0 | 101-80-4 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 3; R62T; R23/24/25N; R51-53 | T; NR: 45-46-23/24/25-62-51/53S: 53-45-61 | E |
| 612-200-00-0 | 2,4-diaminoanisole;4-methoxy-m-phenylenediamine; [1]2,4-diaminoanisole sulphate [2] | 210-406-1 [1]254-323-9 [2] | 615-05-4 [1]39156-41-7 [2] | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R22N; R51-53 | T; NR: 45-22-68-51/53S: 53-45-61 | E |
| 612-201-00-6 | N,N,N',N'-tetramethyl-4,4'-methylendianiline | 202-959-2 | 101-61-1 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 |
| 612-202-00-1 | 3,4-dichloroaniline | 202-448-4 | 95-76-1 | T; R23/24/25Xi; R41R43N; R50-53 | T; NR: 23/24/25-41-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 612-204-00-2 | C.I. Basic Violet 3;4-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride | 208-953-6 | 548-62-9 | Carc. Cat. 3; R40Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-40-41-50/53S: (2-)26-36/37/39-46-60-61 |
| 612-205-00-8 | C.I. Basic Violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) | 208-953-6 | 548-62-9 | Carc. Cat. 2; R45Xn; R22Xi; R41N; R50-53 | T; NR: 45-22-41-50/53S: 53-45-60-61 | E |
| 612-206-00-3 | famoxadone (ISO);3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione | — | 131807-57-3 | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)46-60-61 |
| 612-207-00-9 | 4-ethoxyaniline;p-phenetidine | 205-855-5 | 156-43-4 | Muta. Cat. 3; R68Xn; R20/21/22Xi; R36R43 | XnR: 20/21/22-36-43-68S: (2-)36/37-46 |
| 612-209-00-X | 6-methoxy-m-toluidine;p-cresidine | 204-419-1 | 120-71-8 | Carc. Cat. 2; R45Xn; R22 | TR: 45-22S: 53-45 | E |
| 612-210-00-5 | 5-nitro-o-toluidine; [1]5-nitro-o-toluidine hydrochloride [2] | 202-765-8 [1]256-960-8 [2] | 99-55-8 [1]51085-52-0 [2] | Carc. Cat. 3; R40T; R23/24/25R52-53 | TR: 23/24/25-40-52/53S: (1/2-)36/37-45-61 |
| 612-211-00-0 | N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide | 416-470-9 | 170292-97-4 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 612-212-00-6 | 2,6-dichloro-4-trifluoromethylaniline | 416-430-0 | 24279-39-8 | Xn; R20/22Xi; R38R43N; R50-53 | Xn; NR: 20/22-38-43-50/53S: (2-)24-37-60-61 |
| 612-213-00-1 | isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine | 419-850-2 | 148348-13-4 | C; R34R52-53 | CR: 34-52/53S: (1/2-)23-26-36/37/39-45-61 |
| 612-214-00-7 | 4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine | 421-390-2 | 89114-90-9 | R53 | R: 53S: 61 |
| 612-215-00-2 | 3-chloro-2-(isopropylthio)aniline | 421-700-6 | 179104-32-6 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 612-217-00-3 | 1-methoxy-2-propylamine | 422-550-4 | 37143-54-7 | F; R11C; R34Xn; R22R52-53 | F; CR: 11-22-34-52/53S: (1/2-)9-26-36/37/39-45-61 |
| 613-001-00-1 | ethyleneimine;aziridine | 205-793-9 | 151-56-4 | F; R11Carc. Cat. 2; R45Muta. Cat. 2; R46T+; R26/27/28C; R34N; R51-53 | F; T+; NR: 45-46-11-26/27/28-34-51/53S: 53-45-61 | D E |
| 613-002-00-7 | pyridine | 203-809-9 | 110-86-1 | F; R11Xn; R20/21/22 | F; XnR: 11-20/21/22S: (2-)26-28 | Xn; R20/21/22: C ≥ 5 % |
| 613-003-00-2 | 1,2,3,4-tetranitrocarbazole | — | 6202-15-9 | E ⊗R1Xn; R20/21/22 | E; XnR: 1-20/21/22S: (2-)35 |
| 613-004-00-8 | crimidine (ISO);2-chloro-6-methylpyrimidin-4-yldimethylamine | 208-622-6 | 535-89-7 | T+; R28 | T+R: 28S: (1/2-)36/37-45 |
| 613-007-00-4 | desmetryne (ISO);6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine | 213-800-1 | 1014-69-3 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 613-008-00-X | dazomet (ISO);tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione | 208-576-7 | 533-74-4 | Xn; R22Xi; R36N; R50-53 | Xn; NR: 22-36-50/53S: (2-)15-22-24-60-61 |
| 613-009-00-5 | 2,4,6-trichloro-1,3,5-triazine;cyanuric chloride | 203-614-9 | 108-77-0 | R14T+; R26Xn; R22C; R34R43 | T+;R: 14-22-26-34-43S: (1/2-)26-28-36/37/39-45-46-63 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 613-010-00-0 | ametryn (ISO);2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazine | 212-634-7 | 834-12-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)36-60-61 |
| 613-011-00-6 | amitrole (ISO);1,2,4-triazol-3-ylamine | 200-521-5 | 61-82-5 | Repr. Cat. 3; R63Xn; R48/22N; R51-53 | Xn; NR: 48/22-63-51/53S: (2-)13-36/37-61 |
| 613-012-00-1 | bentazone (ISO);3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide | 246-585-8 | 25057-89-0 | Xn; R22Xi; R36R43R52-53 | XnR: 22-36-43-52/53S: (2-)24-37-61 |
| 613-013-00-7 | cyanazine (ISO);2-(4-chloro-6-ethylamino-1,3,5-triazine-2-ylamino)-2-methylpropionitrile | 244-544-9 | 21725-46-2 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)37-60-61 |
| 613-014-00-2 | ethoxyquin (ISO);6-ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | 202-075-7 | 91-53-2 | Xn; R22 | XnR: 22S: (2-)24 |
| 613-015-00-8 | fenazaflor (ISO);phenyl 5,6-dichloro-2-trifluoromethylbenzimidazole-1-carboxylate | 238-134-9 | 14255-88-0 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 613-016-00-3 | fuberidazole (ISO);2-(2-furyl)benzimidazole | 223-404-0 | 3878-19-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 |
| 613-017-00-9 | bis (8-hydroxyquinolinium) sulphate | 205-137-1 | 134-31-6 | Xn; R22 | XnR: 22S: (2-)36 |
| 613-018-00-4 | morfamquat (ISO);1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridilium ion | — | 7411-47-4 | Xn; R22Xi; R36/37/38R52-53 | XnR: 22-36/37/38-52/53S: (2-)22-36-61 |
| 613-019-00-X | thioquinox (ISO);2-thio-1,3-dithiolo(4,5,b)quinoxaline | 202-272-8 | 93-75-4 | Xn; R22 | XnR: 22S: (2-)24 |
| 613-020-00-5 | tridemorph (ISO);2,6-dimethyl-4-tridecylmorpholine | 246-347-3 | 24602-86-6 | Repr. Cat. 2; R61Xn; R20/22Xi; R38N; R50-53 | T; NR: 61-20/22-38-50/53S: 53-45-60-61 | E |
| 613-021-00-0 | dithianon (ISO);5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile | 222-098-6 | 3347-22-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-60-61 |
| 613-022-00-6 | pyrethrins including cinerins, with the exception of those specified elsewhere in this Annex | — | — | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 | A |
| 613-023-00-1 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S*(Z)],3β]]-chrysanthemate;pyrethrin I | 204-455-8 | 121-21-1 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 |
| 613-024-00-7 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S*(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate;pyrethrin II | 204-462-6 | 121-29-9 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)13-60-61 |
| 613-025-00-2 | cinerin I;3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | 246-948-0 | 25402-06-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-026-00-8 | cinerin II;3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropanecarboxylate | 204-454-2 | 121-20-0 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-027-00-3 | piperidine | 203-813-0 | 110-89-4 | F; R11T; R23/24C; R34 | F; TR: 11-23/24-34S: (1/2-)16-26-27-45 | T; R23/24: C ≥ 5 %Xn; R20/21: 1 % ≤ C < 5 %C; R34: C ≥ 5 %Xi: R36/38: 1 % ≤ C < 5 % |
| 613-028-00-9 | morpholine | 203-815-1 | 110-91-8 | R10Xn; R20/21/22C; R34 | CR: 10-20/21/22-34S: (1/2-)23-36-45 | C; R34: C ≥ 10 %Xi; R36/38: 1 % ≤ C < 10 % |
| 613-029-00-4 | dichloro-1,3,5-triazinetrione;dichloroisocyanuric acid | 220-487-5 | 2782-57-2 | O; R8Xn; R22R31Xi; R36/37N; R50-53 | O; Xn; NR: 8-22-31-36/37-50/53S: (2-)8-26-41-60-61 |
| 613-030-00-X | troclosene potassium; [1]troclosene sodium [2] | 218-828-8 [1]220-767-7 [2] | 2244-21-5 [1]2893-78-9 [2] | O; R8 ⊗Xn; R22R31Xi; R36/37N; R50-53 | O; Xn; NR: 8-22-31-36/37-50/53S: (2-)8-26-41-60-61 | Xn; R22: C ≥ 10 %Xi; R36/37: C ≥ 10 %R31: C ≥ 10 % |
| 613-030-01-7 | troclosene sodium, dihydrate | 220-767-7 | 51580-86-0 | Xn; R22R31Xi; R36/37N; R50-53 | Xn; NR: 22-31-36/37-50/53S: (2-)8-26-41-60-61 |
| 613-031-00-5 | symclosene;trichloroisocyanuric acid;trichloro-1,3,5-triazinetrion | 201-782-8 | 87-90-1 | O; R8Xn; R22Xi; R36/37R31N; R50-53 | O; Xn; NR: 8-22-31-36/37-50/53S: (2-)8-26-41-60-61 |
| 613-032-00-0 | methyl-2,3,5,6-tetrachloro-4-pyridylsulphone;2,3,5,6-tetrachloro-4-(methylsulphonyl)pyridine | 236-035-5 | 13108-52-6 | Xn; R21/22Xi; R36R43 | XnR: 21/22-36-43S: (2-)26-28 |
| 613-033-00-6 | 2-methylaziridine;propyleneimine | 200-878-7 | 75-55-8 | F; R11Carc. Cat. 2; R45T+; R26/27/28Xi; R41N; R51-53 | F; T+; NR: 45-11-26/27/28-41-51/53S: 53-45-61 | Carc. Cat. 2; R45: C ≥ 0,01 % | E |
| 613-034-00-1 | 1,2-dimethylimidazole | 217-101-2 | 1739-84-0 | Xn; R22Xi; R38-41 | XnR: 22-38-41S: (2-)24-26 |
| 613-035-00-7 | 1-methylimidazole | 210-484-7 | 616-47-7 | Xn; R21/22C; R34 | CR: 21/22-34S: (1/2-)26-36-45 |
| 613-036-00-2 | 2-methylpyridine;2-picoline | 203-643-7 | 109-06-8 | R10Xn; R20/21/22Xi; R36/37 | XnR: 10-20/21/22-36/37S: (2-)26-36 |
| 613-037-00-8 | 4-methylpyridine;4-picoline | 203-626-4 | 108-89-4 | R10T; R24Xn; R20/22Xi; R36/37/38 | TR: 10-20/22-24-36/37/38S: (1/2-)26-36-45 |
| 613-038-00-3 | 6-phenyl-1,3,5-triazine-2,4-diyldiamine;6-phenyl-1,3,5-triazine-2,4-diamine;benzoguanamine | 202-095-6 | 91-76-9 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 613-039-00-9 | ethylene thiourea;imidazolidine-2-thione;2-imidazoline-2-thiol | 202-506-9 | 96-45-7 | Repr. Cat. 2; R61Xn; R22 | TR: 61-22S: 53-45 | E |
| 613-040-00-4 | azaconazole (ISO);1-{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}-1H-1,2.4-triazole | 262-102-3 | 60207-31-0 | Xn; R22 | XnR: 22S: (2-)46 |
| 613-041-00-X | morpholine-4-carbonyl chloride | 239-213-0 | 15159-40-7 | R14Carc. Cat. 3; R40Xi; R36/38 | XnR: 14-36/38-40S: (2-)26-30-36-38 |
| 613-042-00-5 | imazalil (ISO);1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole | 252-615-0 | 35554-44-0 | Xn; R20/22Xi; R41N; R50-53 | Xn; NR: 20/22-41-50/53S: (2-)26-39-60-61 |
| 613-043-00-0 | imazalil sulphate (ISO) powder;1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1](±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] | 261-351-5 [1]281-291-3 [2] | 58594-72-2 [1]83918-57-4 [2] | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24/25-37-46-60-61 |
| 613-043-01-8 | imazalil sulphate (ISO), aqueous solution;1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate; [1](±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] | 261-351-5 [1]281-291-3 [2] | 58594-72-2 [1]83918-57-4 [2] | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (2-)26-36/37/39-45-60-61 | C; R34: C ≥ 50 %Xi; R38: 30 % ≤ C < 50 %Xi; R41: 15 % ≤ C < 50 %Xi; R36: 5 % ≤ C < 15 % |
| 613-044-00-6 | captan (ISO);1,2,3,6-tetrahydro-N-(trichloromethylthio)phthalimide | 205-087-0 | 133-06-2 | Carc. Cat. 3; R40T; R23Xi; R41R43N; R50 | T; NR: 23-40-41-43-50S: (1/2-)26-29-36/37/39-45-61 |
| 613-045-00-1 | folpet (ISO);N-(trichloromethylthio)phthalimide | 205-088-6 | 133-07-3 | Carc. Cat. 3; R40Xn; R20Xi; R36R43N; R50 | Xn; NR: 20-36-40-43-50S: (2-)36/37-46-61 |
| 613-046-00-7 | captafol (ISO);1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachloroethylthio)phthalimide | 219-363-3 | 2425-06-1 | Carc. Cat. 2; R45R43N; R50-53 | T; NR: 45-43-50/53S: 53-45-60-61 |
| 613-047-00-2 | 1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate;dimetilan (ISO) | 211-420-0 | 644-64-4 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)36/37-45-60-61 |
| 613-048-00-8 | carbendazim (ISO);methyl benzimidazol-2-ylcarbamate | 234-232-0 | 10605-21-7 | Muta. Cat. 2; R46Repr. Cat. 2; R60-61N; R50-53 | T; NR: 46-60-61-50/53S: 53-45-60-61 |
| 613-049-00-3 | benomyl (ISO);methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate | 241-775-7 | 17804-35-2 | Muta. Cat. 2; R46Repr. Cat. 2; R60-61Xi; R37/38R43N; R50-53 | T; NR: 46-60-61-37/38-43-50/53S: 53-45-60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 613-050-00-9 | carbadox (INN);methyl 3-(quinoxalin-2-ylmethylene)carbazate 1,4-dioxide;2-(methoxycarbonylhydrazonomethyl)quinoxaline 1,4-dioxide | 229-879-0 | 6804-07-5 | F; R11Carc. Cat. 2; R45Xn; R22 | F; TR: 45-11-22S: 53-45 | E |
| 613-051-00-4 | molinate (ISO);S-ethyl 1-perhydroazepinecarbothioate;S-ethyl perhydroazepine-1-carbothioate | 218-661-0 | 2212-67-1 | Carc. Cat. 3; R40Repr. Cat. 3; R62Xn; R20/2248/22R43N; R50-53 | Xn; NR: 20/22-40-43-48/22-62-50/53S: (2-)36/37-46-60-61 | N; R50-53: C ≥ 0,25 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 613-052-00-X | trifenmorph (ISO);4-tritylmorpholine | 215-812-2 | 1420-06-0 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-053-00-5 | anilazine (ISO);2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline | 202-910-5 | 101-05-3 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: (2-)22-60-61 |
| 613-054-00-0 | thiabendazol (ISO);2-(thiazole-4-yl)benzimidazole | 205-725-8 | 148-79-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-056-00-1 | 1,2-dimethyl-3,5-diphenylpyrazolium methylsulphate;difenzoquat methyl sulfate | 256-152-5 | 43222-48-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-057-00-7 | dodemorph (ISO);4-cyclododecyl-2,6-dimethylmorpholine | 216-474-9 | 1593-77-7 | Xi; R36/37/38N; R51-53 | Xi; NR: 36/37/38-51/53S: (2-)26-61 |
| 613-058-00-2 | permethrin (ISO);m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | 258-067-9 | 52645-53-1 | Xn; R20/22R43N; R50-53 | Xn; NR: 20/22-43-50/53S: (2-)13-24-36/37/39-60-61 | N; R50-53: C ≥ 0,025 %N; R51-53: 0,0025 % ≤ C < 0,025 %R52-53: 0,00025 % ≤ C < 0,0025 % |
| 613-059-00-8 | profluralin (ISO);N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine | 247-656-6 | 26399-36-0 | Xi; R36N; R50-53 | Xi; NR: 36-50/53S: (2-)60-61 |
| 613-060-00-3 | resmethrin (ISO);5-benzyl-3-furylmethyl (±)-cis-trans-chrysanthemate | 233-940-7 | 10453-86-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60/61 |
| 613-061-00-9 | 6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl) pyrrole-2-carboxylate;ryania | 239-732-2 | 15662-33-6 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 613-062-00-4 | sabadilla (ISO);veratrine | — | 8051-02-3 | Xi; R36/37/38 | XiR: 36/37/38S: (2-)36/37/39 |
| 613-063-00-X | secbumeton (ISO);2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | 247-554-1 | 26259-45-0 | Xn; R22Xi; R36N; R50-53 | Xn; NR: 22-36-50/53S: (2-)60-61 |
| 613-064-00-5 | 5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolane;sesamex | — | 51-14-9 | Xn; R22 | XnR: 22S: (2-) |
| 613-065-00-0 | simetryn (ISO);2,4-bis(ethylamino)-6-methylthio-1,3,5-triazine | 213-801-7 | 1014-70-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-066-00-6 | terbumeton (ISO);2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | 251-637-8 | 33693-04-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-067-00-1 | propazine (ISO);2-chloro-4,6-bis(isopropylamino)-1,3,5-triazine | 205-359-9 | 139-40-2 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 613-068-00-7 | atrazine (ISO);2-chloro-4-ethylamine-6-isopropylamine-1,3,5-triazine | 217-617-8 | 1912-24-9 | Xn; R48/22R43N; R50-53 | Xn; NR: 43-48/22-50/53S: (2-)36/37-60-61 |
| 613-069-00-2 | ε-caprolactam | 203-313-2 | 105-60-2 | Xn; R20/22Xi; R36/37/38 | XnR: 20/22-36/37/38S: (2-) |
| 613-070-00-8 | propylenethiourea | — | 2122-19-2 | Repr. Cat. 3; R63Xn; R22R52-53 | XnR: 22-52/53-63S: (2-)36/37-46-61 |
| 613-071-00-3 | 2-fluoro-5-trifluoromethylpyridine | 400-290-2 | 69045-82-5 | R10R43R52-53 | XiR: 10-43-52/53S: (2-)24-37-61 |
| 613-072-00-9 | N,N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine | 401-280-0 | 91273-04-0 | C; R34R43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-28-36/37/39-45-61 |
| 613-073-00-4 | N,N-dimethyl-2-(3-(4-chlorophenyl)-4,5-dihydropyrazol-1-ylphenylsulphonyl)ethylamine | 401-410-6 | 10357-99-0 | Xn; R48/22R43N; R51-53 | Xn; NR: 43-48/22-51/53S: (2-)24-37-61 |
| 613-074-00-X | 3-(3-methylpent-3-yl)isoxazol-5-ylamine | 401-460-9 | 82560-06-3 | T; R23/25Xi; R41R52-53 | TR: 23/25-41-52/53S: (1/2-)22-26-36/37/39-45-61 |
| 613-075-00-5 | 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione | 401-570-7 | 89415-87-2 | O; R8T; R23C; R34Xn; R22R43N; R50 | O; T; NR: 8-22-23-34-43-50S: (1/2-)8-26-36/37/39-45-61 |
| 613-076-00-0 | 3-chloro-5-trifluoromethyl-2-pyridylamine | 401-670-0 | 79456-26-1 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 613-077-00-6 | reaction mass of 5-heptyl-1,2,4-triazol-3-ylamine and 5-nonyl-1,2,4-triazol-3-ylamine | 401-940-8 | — | Xn; R22Xi; R36N; R51-53 | Xn; NR: 22-36-51/53S: (2-)22-26-61 |
| 613-078-00-1 | N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine | 401-990-0 | 106990-43-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 613-079-00-7 | 4-(1(or 4 or 5 or 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridine, reaction mass of isomers | 402-520-7 | — | Xn; R21/22Xi; R38R43N; R50-53 | Xn; NR: 21/22-38-43-50/53S: (2-)36/37-60-61 |
| 613-080-00-2 | 3-(bis(2-ethylhexyl)aminomethyl)benzothiazole-2(3H)-thione | 402-540-6 | 105254-85-1 | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-28-36/37/39-45-60-61 |
| 613-081-00-8 | 1-butyl-2-methylpyridinium bromide | 402-680-8 | 26576-84-1 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 613-082-00-3 | 2-methyl-1-pentylpyridinium bromide | 402-690-2 | — | Xn; R21/22R52-53 | XnR: 21/22-52/53S: (2-)36/37-61 |
| 613-083-00-9 | 2-(4-(3-(4-chlorophenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammonium formate | 402-120-2 | — | C; R34Xn; R48/22R43N; R50-53 | C; NR: 34-43-48/22-50/53S: (1/2-)24-26-28-37/39-45-60-61 |
| 613-084-00-4 | 2-(4-(3-(4-chlorophenyl)-4,5-dihydropyrazolyl)phenylsulphonyl)ethyldimethylammonium hydrogen phosphonate | 402-490-5 | 106359-93-7 | Xi; R36N; R50-53 | Xi; NR: 36-50/53S: (2-)26-60-61 |
| 613-085-00-X | reaction mass of 1,1'-(methylenebis(4,1-phenylene))dipyrrole-2,5-dione and N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamide and 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrole-2,5-dione | 401-970-1 | — | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 613-086-00-5 | caffeine | 200-362-1 | 58-08-2 | Xn; R22 | XnR: 22S: (2-) |
| 613-087-00-0 | tetrahydrothiophene | 203-728-9 | 110-01-0 | F; R11Xn; R20/21/22Xi; R36/38R52-53 | F; XnR: 11-20/21/22-36/38-52/53S: (2-)16-23-36/37-61 |
| 613-088-00-6 | 1,2-benzisothiazol-3(2H)-one;1,2-benzisothiazolin-3-one | 220-120-9 | 2634-33-5 | Xn; R22Xi; R38-41R43N; R50 | Xn; NR: 22-38-41-43-50S: (2-)24-26-37/39-61 | R43: C ≥ 0,05 % |
| 613-089-00-1 | diquat dibromide; [1]diquat dichloride; [2]6,7-dihydrodipyrido[1,2-α:2',1'-c]pyrazinediylium dihydroxide [3] | 201-579-4 [1]223-714-6 [2]301-467-6 [3] | 85-00-7 [1]4032-26-2 [2]94021-76-8 [3] | T+; R26T; R48/25Xn; R22Xi; R36/37/38R43N; R50-53 | T+; NR: 22-26-36/37/38-43-48/25-50/53S: (1/2-)28-36/37/39-45-60-61 |
| 613-090-00-7 | paraquat dichloride;1,1-dimethyl-4,4'-bipyridinium dichloride; [1]paraquat dimethylsulfate;1,1-dimethyl-4,4'-bipyridinium dimethyl sulphate [2] | 217-615-7 [1]218-196-3 [2] | 1910-42-5 [1]2074-50-2 [2] | T+; R26T; R24/25-48/25Xi; R36/37/38N; R50-53 | T+; NR: 24/25-26-36/37/38-48/25-50/53S: (1/2-)22-28-36/37/39-45-60-61 |
| 613-091-00-2 | morfamquat dichloride; [1]morfamquat sulfate [2] | 225-062-8 [1][2] | 4636-83-3 [1]29873-36-7 [2] | Xn; R22Xi; R36/37/38R52-53 | XnR: 22-36/37/38-52/53S: (2-)22-36-61 |
| 613-092-00-8 | 1,10-phenanthroline | 200-629-2 | 66-71-7 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)45-60-61 |
| 613-093-00-3 | hexasodium 6,13-dichloro-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | 400-050-7 | 85153-92-0 | R42/43 | XnR: 42/43S: (2-)22-24-37 |
| 613-094-00-9 | 4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamine | 401-360-5 | 5248-39-5 | Xn; R22-48/22 | XnR: 22-48/22S: (2-)22-36 |
| 613-095-00-4 | sodium 3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzenesulfonate | 403-080-9 | 92484-48-5 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 613-096-00-X | 2-amino-6-ethoxy-4-methylamino-1,3,5-triazine | 403-580-7 | 62096-63-3 | Xn; R22 | XnR: 22S: (2-) |
| 613-097-00-5 | 7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid | 403-690-5 | 111298-82-9 | R42/43R52-53 | XnR: 42/43-52/53S: (2-)22-24-37-61 |
| 613-098-00-0 | N-(n-octyl)-2-pyrrolidone | 403-700-8 | 2687-94-7 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)23-26-36/37/39-45 |
| 613-099-00-6 | 1-dodecyl-2-pyrrolidone | 403-730-1 | 2687-96-9 | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 613-100-00-X | 2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridine-7,14-dione | 404-230-6 | — | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 613-101-00-5 | N-tert-pentyl-2-benzothiazolesulfenamide | 404-380-2 | 110799-28-5 | R43R52-53 | XiR: 43-52/53S: (2-)36/37-61 |
| 613-102-00-0 | dimethomorph (ISO);4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine | 404-200-2 | 110488-70-5 | N; R51-53 | NR: 51/53S: 61 |
| 613-103-00-6 | sodium 5-n-butylbenzotriazole | 404-450-2 | 118685-34-0 | Xn; R22C; R34R43N; R51-53 | C; NR: 22-34-43-51/53S: (1/2-)26-36/37/39-45-61 |
| 613-104-00-1 | 5-tert-butyl-3-isoxazolylamine hydrochloride | 404-840-2 | — | Xn; R22-48/22Xi; R41R52-53 | XnR: 22-41-48/22-52/53S: (2-)26-36/39-61 |
| 613-105-00-7 | hexakis(tetramethylammonium) 4,4'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-morpholino-1,3,5-triazine-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalene-2,7-disulfonate) | 405-160-9 | 124537-30-0 | T; R25R43R52-53 | TR: 25-43-52/53S: (1/2-)24-37-45-61 |
| 613-106-00-2 | tetrapotassium 2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienylidene)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzene-1,4-disulfonate | 405-240-3 | — | R43 | XiR: 43S: (2-)24-37 |
| 613-107-00-8 | hexasodium 2,2'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-(N-cyanoethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazine-4,2-diyl)imino)dibenzene-1,4-disulfonate | 405-280-1 | 76508-02-6 | Xi; R36 | XiR: 36S: (2-)26 |
| 613-108-00-3 | benzothiazole-2-thiol | 205-736-8 | 149-30-4 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 613-109-00-9 | bis(piperidinothiocarbonyl) disulphide | 202-328-1 | 94-37-1 | Xi; R36/37/38R43 | XiR: 36/37/38-43S: (2-)24-26-37 |
| 613-110-00-4 | dimepiperate (ISO);S-(1-methyl-1-phenylethyl) piperidine-1-carbothioate | 262-784-2 | 61432-55-1 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 613-111-00-X | 1,2,4-triazole | 206-022-9 | 288-88-0 | Repr. Cat. 3; R63Xn; R22Xi; R36 | XnR: 22-36-63S: (2-)36/37 |
| 613-112-00-5 | octhilinone (ISO);2-octyl-2H-isothiazol-3-one | 247-761-7 | 26530-20-1 | T; R23/24Xn; R22C; R34R43N; R50-53 | T; NR: 22-23/24-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | R43: C ≥ 0,05 % |
| 613-113-00-0 | 2-(morpholinothio)benzothiazole | 203-052-4 | 102-77-2 | Xi; R36/38R43N; R51-53 | Xi; NR: 36/38-43-51/53S: (2-)24-26-37-61 |
| 613-114-00-6 | 2,2',2"-(hexahydro-1,3,5-triazine-1,3,5-triyl)triethanol;1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazine | 225-208-0 | 4719-04-4 | Xn; R22R43 | XnR: 22-43S: (2-)24-37 | R43: C ≥ 0,1 % |
| 613-115-00-1 | hymexazol (ISO);3-hydroxy-5-methylisoxazole | 233-000-6 | 10004-44-1 | Xn; R22Xi; R41R52-53 | XnR: 22-41-52/53S: (2-)26-39-61 |
| 613-116-00-7 | tolylfluanid (ISO);dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide | 211-986-9 | 731-27-1 | T; R23Xn; R48/20Xi; R36/37/38R43N; R50-53 | T; NR: 23-36/37/38-43-48/20-50/53S: (1/2-)24-26-37-38-45-60-61 |
| 613-117-00-2 | diniconazole (ISO);(E)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol;(E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol | — | 76714-88-0 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-118-00-8 | flubenzimine (ISO);N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]thiazolidin-2-ylidene]aniline; | 253-703-1 | 37893-02-0 | Xi; R36N; R50-53 | Xi; NR: 36-50/53S: (2-)26-60-61 |
| 613-119-00-3 | (benzothiazol-2-ylthio)methyl thiocyanate;TCMTB | 244-445-0 | 21564-17-0 | T+; R26Xn; R22Xi; R36/38R43N; R50-53 | T+; NR: 22-26-36/38-43-50/53S: (1/2-)28-36/37-38-45-60-61 |
| 613-120-00-9 | bioresmethrin;(5-bezylfur-3-yl)methyl(1R)-trans-2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboylate | 249-014-0 | 28434-01-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-121-00-4 | chlorsulfuron (ISO);2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulphonamide; | 265-268-5 | 64902-72-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-122-00-X | diclobutrazole (ISO);(R*, R*)-(±)-β-[(2,4-dichlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol;(2RS, 3RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol | — | 75736-33-3 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 |
| 613-123-00-5 | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione;etem | 251-684-4 | 33813-20-6 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-124-00-0 | fenpropimorph (ISO);cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine | 266-719-9 | 67564-91-4 | Repr. Cat. 3; R63Xn; R22Xi; R38N; R51-53 | Xn; NR: 22-38-63-51/53S: (2-)36/37-46-61 |
| 613-125-00-6 | hexythiazox (ISO);trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide | — | 78587-05-0 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-126-00-1 | imazapyr (ISO);2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate | — | 81334-34-1 | Xi; R36R52-53 | XiR: 36-52/53S: (2-)26-61 |
| 613-127-00-7 | 1,1-dimethylpiperidinium chloride;mepiquat chloride | 246-147-6 | 24307-26-4 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 613-128-00-2 | prochloraz (ISO);N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide; | 266-994-5 | 67747-09-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 613-129-00-8 | metamitron (ISO);4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one | 255-349-3 | 41394-05-2 | Xn; R22N; R50 | Xn; NR: 22-50S: (2-)61 |
| 613-131-00-9 | pyroquilon (ISO);1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one | — | 57369-32-1 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 613-132-00-4 | hexazinone (ISO);3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione; | 257-074-4 | 51235-04-2 | Xn; R22Xi; R36N; R50-53 | Xn; NR: 22-36-50/53S: (2-)60-61 |
| 613-133-00-X | etridiazole (ISO);5-ethoxy-3-trichloromethyl-1,2,4-thiadiazole | 219-991-8 | 2593-15-9 | Carc. Cat. 3; R40T; R23Xn; R21/22N; R50-53 | T; NR: 21/22-23-40-50/53S: (1/2-)36/37-38-45-60-61 |
| 613-134-00-5 | myclobutanil (ISO);2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile | — | 88671-89-0 | Repr. Cat. 3; R63Xn; R22Xi; R36N; R51-53 | Xn; NR: 22-36-51/53-63S: (2-)36/37-46-61 |
| 613-135-00-0 | di(benzothiazol-2-yl) disulphide | 204-424-9 | 120-78-5 | R31R43N; R50-53 | Xi; NR: 31-43-50/53S: (2-)36/37-60-61 |
| 613-136-00-6 | N-cyclohexylbenzothiazole-2-sulphenamide | 202-411-2 | 95-33-0 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 613-137-00-1 | methabenzthiazuron (ISO);1-(1,3-benzothiazol-2-yl)1,3-dimethylurea | 242-505-0 | 18691-97-9 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-138-00-7 | quinoxyfen (ISO);5,7-dichloro-4-(4-fluorophenoxy)quinoline | — | 124495-18-7 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-46-60-61 |
| 613-139-00-2 | metsulfuron-methyl;2-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl) benzoic acid | — | 74223-64-6 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-140-00-8 | cycloheximide (ISO);4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione | 200-636-0 | 66-81-9 | Muta. Cat. 3; R68Repr. Cat. 2; R61T+; R28N; R51-53 | T+; NR: 61-28-51/53-68S: 53-45-61 | E |
| 613-141-00-3 | 1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinone | 401-470-3 | 93686-63-6 | R53 | R: 53S: 61 |
| 613-142-00-9 | trans-N-methyl-2-styryl-[4'-aminomethine-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridinium acetate | 405-860-4 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 |
| 613-143-00-4 | 1-(3-phenylpropyl)-2-methylpyridinium bromide | 405-930-4 | 10551-42-5 | Xn; R22Xi; R36R52-53 | XnR: 22-36-52/53S: (2-)26-36/37-61 |
| 613-144-00-X | Reaction products of: poly(vinyl acetate), partially hydrolyzed, with (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethyl sulfate | 406-460-2 | 125139-08-4 | R52-53 | R: 52/53S: 61 |
| 613-145-00-5 | (S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium 4-methylbenzenesulfonate | 406-960-0 | 77497-97-3 | N; R51-53 | NR: 51/53S: 61 |
| 613-146-00-0 | N-ethyl-N-methylpiperidinium iodide | 407-780-5 | 4186-71-4 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 |
| 613-147-00-6 | 4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholine | 407-940-4 | 111681-72-2 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 613-148-00-1 | tetrasodium 1,2-bis(4-fluoro-6-[5-(1-amino-2-sulfonatoanthrachinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethane | 411-240-4 | 143683-23-2 | R43R52-53 | XiR: 43-52/53S: (2-)22-24/25-37-61 |
| 613-149-00-7 | pyridaben (ISO);2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one | 405-700-3 | 96489-71-3 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)36/37-45-60-61 |
| 613-150-00-2 | 2,2'-[3,3'-(piperazine-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l,m,n][3,8]phenanthroline-1,3,6-trione | 406-295-6 | — | R53 | R: 53S: 61 |
| 613-151-00-8 | 1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymine | 406-360-9 | 104218-44-2 | R53 | R: 53S: 61 |
| 613-152-00-3 | phenyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate | 406-600-2 | 89392-03-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 613-153-00-9 | 2,3,5-trichloropyridine | 407-270-2 | 16063-70-0 | R52-53 | R: 52/53S: 61 |
| 613-154-00-4 | 2-amino-4-chloro-6-methoxypyrimidine | 410-050-9 | 5734-64-5 | Xn; R22 | XnR: 22S: (2-)22 |
| 613-155-00-X | 5-chloro-2,3-difluoropyridine | 410-090-7 | 89402-43-7 | R10Xn; R22R52-53 | XnR: 10-22-52/53S: (2-)23-36-61 |
| 613-156-00-5 | 2-butyl-4-chloro-5-formylimidazole | 410-260-0 | 83857-96-9 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 613-157-00-0 | 2,4-diamino-5-methoxymethylpyrimidine | 410-330-0 | 54236-98-5 | Xn; R22-48/22Xi; R36 | XnR: 22-36-48/22S: (2-)22-26-36 |
| 613-158-00-6 | 2,3-dichloro-5-trifluoromethyl-pyridine | 410-340-5 | 69045-84-7 | Xn; R20/22Xi; R41R43N; R51-53 | Xn; NR: 20/22-41-43-51/53S: (2-)24-26-37/39-61 |
| 613-159-00-1 | fenazaquin (ISO);4-[2-[4-(1,1-dimethylethyl)phenyl]-ethoxy]quinazoline | 410-580-0 | 120928-09-8 | T; R25Xn; R20N; R50-53 | T; NR: 20-25-50/53S: (1/2-)37-45-60-61 |
| 613-160-00-7 | (1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptane dihydrobromide | 411-000-9 | 125224-62-6 | R43 | XiR: 43S: (2-)24-37 |
| 613-163-00-3 | azimsulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urea | — | 120162-55-2 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-164-00-9 | flufenacet (ISO);N-(4-fluorophenyl)-N-isopropyl-2-(5-trifluoromethyl-[1,3,4]thiadiazol-2-yloxy)acetamide | — | 142459-58-3 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)13-24-37-60-61 |
| 613-165-00-4 | flupyrsulfuron-methyl-sodium (ISO);methyl 2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluoromethyl]nicotinate, monosodium salt | — | 144740-54-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-166-00-X | flumioxazin (ISO);N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide | — | 103361-09-7 | Repr. Cat. 2; R61N; R50-53 | T; NR: 61-50/53S: 53-45-60-61 |
| 613-167-00-5 | reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-2H -isothiazol-3-one [EC no. 220-239-6] (3:1);reaction mass of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-4-isothiazolin-3-one [EC no. 220-239-6] (3:1) | — | 55965-84-9 | T; R23/24/25C; R34R43N; R50-53 | T; NR: 23/24/25-34-43-50/53S: (2-)26-28-36/37/39-45-60-61 | C; R34: C ≥ 0,6 %Xi; R36/38: 0,06 % ≤ C < 0,6 %R43: C ≥ 0,0015 % |
| 613-168-00-0 | 1-vinyl-2-pyrrolidone | 201-800-4 | 88-12-0 | Carc. Cat. 3; R40Xn; R20/21/22-48/20Xi; R37-41 | XnR: 20/21/22-37-40-41-48/20S: (2-)26-36/37/39 | D |
| 613-169-00-6 | 9-vinylcarbazole | 216-055-0 | 1484-13-5 | Muta. Cat. 3; R68Xn; R21/22Xi; R38R43N; R50-53 | Xn; NR: 21/22-38-43-50/53-68S: 22-23-36/37-60-61 |
| 613-170-00-1 | 2,2-ethylmethylthiazolidine | 404-500-3 | 694-64-4 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24-26-37/39-61 |
| 613-171-00-7 | hexaconazole (ISO);(RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol | 413-050-7 | 79983-71-4 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-37-61 |
| 613-172-00-2 | 5-chloro-1,3-dihydro-2H-indol-2-one | 412-200-9 | 17630-75-0 | Repr. Cat. 3; R62Xn; R22R43R52-53 | XnR: 22-43-62-52/53S: (2-)22-36/37-61 |
| 613-173-00-8 | fluquinconazole (ISO);3-(2,4-dichlorophenyl)-6-fluoro-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-one | 411-960-9 | 136426-54-5 | T; R23/25-48/25Xn; R21Xi; R38N; R50-53 | T; NR: 21-23/25-38-48/25-50/53S: (1/2-)36/37/39-38-45-60-61 |
| 613-174-00-3 | (±) 2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether | 407-760-6 | 112281-77-3 | Carc. Cat. 3; R40Xn; R20/22N; R51-53 | Xn; NR: 20/22-40-51/53S: (2-)36/37-41-61 |
| 613-175-00-9 | epoxiconazole (ISO);(2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane | 406-850-2 | 133855-98-8 | Carc. Cat. 3; R40Repr. Cat. 3; R62Repr. Cat. 3; R63N; R51-53 | Xn; NR: 40-62-63-51/53S: (2-)36/37-46-61 |
| 613-176-00-4 | 2-methyl-2-azabicyclo[2.2.1]heptane | 404-810-9 | 4524-95-2 | R10Xn; R21/22-48/20C; R34 | CR: 10-21/22-34-48/20S: (1/2-)16-26-36/37/39-45 |
| 613-177-00-X | 8-amino-7-methylquinoline | 412-760-4 | 5470-82-6 | Xn; R21/22R43N; R51-53 | Xn; NR: 21/22-43-51/53S: (2-)36/37-61 |
| 613-178-00-5 | 4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidine | 410-470-2 | 137796-06-6 | C; R34R43 | CR: 34-43S: (1/2-)7/8-26-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 613-179-00-0 | lithium 3-oxo-1,2(2H)-benzisothiazol-2-ide | 411-690-1 | 111337-53-2 | Xn; R22C; R34R43N; R51-53 | C; NR: 22-34-43-51/53S: (1/2-)26-36/37/39-45-61 |
| 613-180-00-6 | N-(1,1-dimethylethyl)bis(2-benzothiazolesulfen)amide | 407-430-1 | 3741-80-8 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-181-00-1 | 5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | 405-090-9 | 67485-29-4 | T; R48/25Xn; R22Xi; R36N; R50-53 | T; NR: 22-36-48/25-50/53S: (1/2-)22-26-36/37-45-60-61 |
| 613-182-00-7 | 1-(1-naphthylmethyl)quinolinium chloride | 406-220-7 | 65322-65-8 | Carc. Cat. 3; R40Muta. Cat. 3; R68Xn; R22Xi; R38-41R52-53 | XnR: 22-38-40-41-52/53-68S: (2-)22-26-36/37/39-61 |
| 613-183-00-2 | reaction mass of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one;5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one | 413-640-4 | — | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)36-60-61 |
| 613-184-00-8 | nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate | 413-670-8 | — | Xi; R36R43 | XiR: 36-43S: (2-)24-26-37 |
| 613-185-00-3 | 2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one | 407-630-9 | 82633-79-2 | T; R25Xi; R41R43N; R50-53 | T; NR: 25-41-43-50/53S: (1/2-)22-26-36/37/39-45-60-61 |
| 613-186-00-9 | (2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate | 408-050-9 | 76855-69-1 | Xi; R36R43N; R51-53 | Xi; NR: 36-43-51/53S: (2-)24-26-37-61 |
| 613-188-00-X | 1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinone | 411-500-7 | 116256-11-2 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)22-24-26-37/39-61 |
| 613-189-00-5 | 1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane | 414-030-0 | 52667-88-6 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 613-190-00-0 | disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate | 414-040-5 | 149530-93-8 | Xn; R22R43 | XnR: 22-43S: (2-)22-24-37 |
| 613-191-00-6 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 421-150-7 | 143860-04-2 | Repr. Cat. 2; R60C; R34N; R50-53 | T; NR: 60-34-50/53S: 53-45-60-61 |
| 613-193-00-7 | pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate | 414-930-3 | — | N; R51-53 | NR: 51/53S: 61 |
| 613-194-00-2 | 6,13-dichloro-3,10-bis{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt | 418-000-8 | 163062-28-0 | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 613-195-00-8 | 2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) | 418-280-1 | 18600-59-4 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 613-196-00-3 | 5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt | 418-380-5 | 168113-78-8 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 613-197-00-9 | reaction mass of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine;2,4,6-tri(methylcarbamoyl)-1,3,5-triazine;[(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine;[(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine | 420-390-1 | 187547-46-2 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 613-199-00-X | reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione;reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | 421-550-1 | — | Carc. Cat. 2; R45Repr. Cat. 2; R61R43R52-53 | TR: 45-61-43-52/53S: 53-45-61 |
| 613-200-00-3 | Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfonyl)aniline, sodium salts | 420-980-7 | — | Xi; R41 | XiR: 41S: (2-)22-26-39 |
| 613-201-00-9 | (R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole | 422-390-5 | 143322-57-0 | Repr. Cat. 3; R62T; R39-48/25Xn; R20/22Xi; R41R43N; R50-53 | T; NR: 20/22-39-41-43-48/25-62-50/53S: (1/2-)53-45-60-61 |
| 613-202-00-4 | pymetrozine (ISO);(E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | — | 123312-89-0 | Carc. Cat. 3; R40R52-53 | XnR: 40-52/53S: (2-)36/37-61 |
| 613-203-00-X | pyraflufen-ethyl; [1]pyraflufen [2] | [1][2] | 129630-19-9 [1]129630-17-7 [2] | N; R50-53 | NR: 50/53S: 60-61 |
| 613-204-00-5 | oxadiargyl (ISO);3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one;5-tert-butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one | 254-637-6 | 39807-15-3 | Repr. Cat. 3; R63Xn; R48/22N; R50-53 | Xn; NR: 48/22-63-50/53S: (2-)36/37-46-60-61 |
| 613-205-00-0 | propiconazole (ISO);(±)-1-[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole | 262-104-4 | 60207-90-1 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37-46-60-61 |
| 613-206-00-6 | fenamidone (ISO);(S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one | — | 161326-34-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-208-00-7 | imazamox (ISO);(RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid | — | 114311-32-9 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-209-00-2 | cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride | 417-430-3 | 63645-17-0 | T; R25Xn; R48/22R43N; R51-53 | T; NR: 25-43-48/22-51/53S: (1/2-)22-36/37-45-61 |
| 613-210-00-8 | 2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane | 417-650-1 | 88128-57-8 | Xn; R48/22R52-53 | XnR: 48/22-52/53S: (2-)23-25-36-61 |
| 613-211-00-3 | N-methyl-4-(p-formylstyryl)pyridinium methylsulfate | 418-240-3 | 74401-04-0 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 613-212-00-9 | 4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinane-1,1-dioxide) | 418-320-8 | 133467-41-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 |
| 613-213-00-4 | cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline | 416-040-0 | 120807-02-5 | R52-53 | R: 52/53S: 61 |
| 613-214-00-X | N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide | 416-260-7 | 147613-95-4 | R53 | R: 53S: 61 |
| 613-215-00-5 | 2-chloromethyl-3,4-dimethoxypyridinium chloride | 416-440-5 | 72830-09-2 | Xn; R21/22-48/22Xi; R38-41R43N; R51-53 | Xn; NR: 21/22-38-41-43-48/22-51/53S: (2-)26-36/37/39-61 |
| 613-216-00-0 | 6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole | 416-490-8 | 162208-01-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-217-00-6 | 4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidine | 416-770-1 | 73754-27-5 | R53 | R: 53S: 61 |
| 613-218-00-1 | 6-hydroxyindole | 417-020-4 | 2380-86-1 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24-26-37/39-61 |
| 613-219-00-7 | 7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole | 417-140-7 | 79185-77-6 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 |
| 613-220-00-2 | trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide | 417-290-3 | 147086-81-5 | Xn; R22 | XnR: 22S: (2-)36 |
| 613-221-00-8 | 2-chloro-5-methyl-pyridine | 418-050-0 | 18368-64-4 | Xn; R21/22Xi; R38R52-53 | XnR: 21/22-38-52/53S: (2-)23-25-36/37-61 |
| 613-222-00-3 | 4-(1-oxo-2-propenyl)-morpholine | 418-140-1 | 5117-12-4 | Xn; R22-48/22Xi; R41R43 | XnR: 22-41-43-48/22S: (2-)23-26-36/37/39 |
| 613-223-00-9 | N-isopropyl-3-(4-fluorophenyl)-1H-indole | 418-790-4 | 93957-49-4 | R53 | R: 53S: 61 |
| 613-224-00-4 | 2,5-dimercaptomethyl-1,4-dithiane | 419-770-8 | 136122-15-1 | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 613-225-00-X | reaction mass of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine;2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. | 421-290-9 | — | Xn; R48/22R53 | XnR: 48/22-53S: (2-)22-36-61 |
| 613-226-00-5 | 1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl)-pyridinium dichloride | 420-950-3 | 163831-67-2 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 |
| 613-227-00-0 | (±)-[(R*,R*) and (R*,S*)]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | 419-600-2 | 99199-90-3 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-28-36/37-61 |
| 613-228-00-6 | (±)-(R*,S*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | 419-630-6 | 793669-26-8 | N; R51-53 | NR: 51/53S: 24-61 |
| 613-230-00-7 | florasulam (ISO);2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c];pyrimidine-2-sulfonanilide | — | 145701-23-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 613-233-00-3 | 4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane | 423-230-7 | 56552-15-9 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 614-001-00-4 | nicotine (ISO);3-(N-methyl-2-pyrrolidinyl)pyridine | 200-193-3 | 54-11-5 | T+; R27T; R25N; R51-53 | T+; NR: 25-27-51/53S: (1/2-)36/37-45-61 |
| 614-002-00-X | salts of nicotine | — | — | T+; R26/27/28N; R51-53 | T+; NR: 26/27/28-51/53S: (1/2-)13-28-45-61 | A |
| 614-003-00-5 | strychnine | 200-319-7 | 57-24-9 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)36/37-45-60-61 |
| 614-004-00-0 | salts of strychnine | — | — | T+; R26/28N; R50-53 | T+; NR: 26/28-50/53S: (1/2-)13-28-45-60-61 | A |
| 614-005-00-6 | colchicine | 200-598-5 | 64-86-8 | T+; R26/28 | T+R: 26/28S: (1/2-)13-45 |
| 614-006-00-1 | brucine;2,3-dimethoxystrychnine | 206-614-7 | 357-57-3 | T+; R26/28R52-53 | T+R: 26/28-52/53S: (1/2-)13-45-61 |
| 614-007-00-7 | brucine sulphate; [1]brucine nitrate; [2]Strychnidin-10-one, 2,3-dimethoxy-, mono[(R)-1-methylheptyl 1,2-benzenedicarboxylate]; [3]Strychnidin-10-one, 2,3-dimethoxy-, compd. with (S)mono(1-methylheptyl)-1,2-benzenedicarboxylate (1:1) [4] | 225-432-9 [1]227-317-9 [2]269-439-5 [3]269-710-8 [4] | 4845-99-2 [1]5786-97-0 [2]68239-26-9 [3]68310-42-9 [4] | T+; R26/28R52-53 | T+R: 26/28-52/53S: (1/2-)13-45-61 | A |
| 614-008-00-2 | aconitine | 206-121-7 | 302-27-2 | T+; R26/28 | T+R: 26/28S: (1/2-)24-45 |
| 614-009-00-8 | salts of aconitine | — | — | T+; R26/28 | T+R: 26/28S: (1/2-)24-45 | A |
| 614-010-00-3 | atropine | 200-104-8 | 51-55-8 | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 |
| 614-011-00-9 | salts of atropine | — | — | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 | A |
| 614-012-00-4 | hyoscyamine | 202-933-0 | 101-31-5 | T+; R26/28 | T+R: 26/28S: (1/2-)24-45 |
| 614-013-00-X | salts of hyoscyamine | — | — | T+; R26/28 | T+R: 26/28S: (1/2-)24-45 | A |
| 614-014-00-5 | hyoscine | 200-090-3 | 51-34-3 | T+; R26/27/28 | T+R: 26/27/28S: (1/2-)25-45 |
| 614-015-00-0 | salts of hyoscine | — | — | T+; R26/27/28 | T+R: 26/27/28S: (1/2-)25-45 | A |
| 614-016-00-6 | pilocarpine | 202-128-4 | 92-13-7 | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 |
| 614-017-00-1 | salts of pilocarpine | — | — | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 | A |
| 614-018-00-7 | papaverine | 200-397-2 | 58-74-2 | Xn; R22 | XnR: 22S: (2-)22 |
| 614-019-00-2 | salts of papaverine | — | — | Xn; R22 | XnR: 22S: (2-)22 | A |
| 614-020-00-8 | physostigmine | 200-332-8 | 57-47-6 | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 |
| 614-021-00-3 | salts of physostigmine | — | — | T+; R26/28 | T+R: 26/28S: (1/2-)25-45 | A |
| 614-022-00-9 | digitoxin | 200-760-5 | 71-63-6 | T; R23/25R33 | TR: 23/25-33S: (1/2-)45 |
| 614-023-00-4 | ephedrine | 206-080-5 | 299-42-3 | Xn; R22 | XnR: 22S: (2-)22-25 |
| 614-024-00-X | salts of ephedrine | — | — | Xn; R22 | XnR: 22S: (2-)22-25 | A |
| 614-025-00-5 | ouabain | 211-139-3 | 630-60-4 | T; R23/25R33 | TR: 23/25-33S: (1/2-)45 |
| 614-026-00-0 | strophantin-K | 234-239-9 | 11005-63-3 | T; R23/25R33 | TR: 23/25-33S: (1/2-)45 |
| 614-027-00-6 | bufa-4,20,22-trienolide, 6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxy-, (3β, 6β)-;red squill;scilliroside | 208-077-4 | 507-60-8 | T+; R28 | T+R: 28S: (1/2-)36/37-45 |
| 614-028-00-1 | reaction mass of: 2-ethylhexyl mono-D-glucopyranoside;2-ethylhexyl di-D-glucopyranoside | 414-420-0 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 614-029-00-7 | constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside;constitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside;constitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside | 419-640-0 | 68784-14-5 | Xn; R22 | XnR: 22S: (2-) |
| 615-001-00-7 | methyl isocyanate | 210-866-3 | 624-83-9 | F+; R12 ⊗Repr. Cat. 3; R63T+; R26T; R24/25R42/43Xi; R37/38-41 | F+; T+R: 12-24/25-26-37/38-41-42/43-63S: (1/2-)26-27/28-36/37/39-45-63 |
| 615-002-00-2 | methyl isothiocyanate | 209-132-5 | 556-61-6 | T; R23/25C; R34R43N; R50-53 | T; NR: 23/25-34-43-50/53S: (1/2-)36/37-38-45-60-61 |
| 615-003-00-8 | thiocyanic acid | 207-337-4 | 463-56-9 | Xn; R20/21/22R32R52-53 | XnR: 20/21/22-32-52/53S: (2-)13-61 |
| 615-004-00-3 | salts of thiocyanic acid | — | — | Xn; R20/21/22R32R52-53 | XnR: 20/21/22-32-52/53S: (2-)13-61 | A |
| 615-005-00-9 | 4,4'-methylenediphenyl diisocyanate;diphenylmethane-4,4'-diisocyanate; [1]2,2'-methylenediphenyl diisocyanate;diphenylmethane-2,2'-diisocyanate; [2]o-(p-isocyanatobenzyl)phenyl isocyanate;diphenylmethane-2,4'-diisocyanate; [3]methylenediphenyl diisocyanate [4] | 202-966-0 [1]219-799-4 [2]227-534-9 [3]247-714-0 [4] | 101-68-8 [1]2536-05-2 [2]5873-54-1 [3]26447-40-5 [4] | Xn; R20Xi; R36/37/38R42/43 | XnR: 20-36/37/38-42/43S: (1/2-)23-36/37-45 | Xi; R36/37/38: C ≥ 5 %R42: C ≥ 0,1 % | C2 |
| 615-006-00-4 | 2-methyl-m-phenylene diisocyanate;toluene-2,4-di-isocyanate; [1]4-methyl-m-phenylene diisocyanate;toluene-2,6-di-isocyanate; [2]m-tolylidene diisocyanate;toluene-diisocyanate [3] | 202-039-0 [1]209-544-5 [2]247-722-4 [3] | 91-08-7 [1]584-84-9 [2]26471-62-5 [3] | Carc. Cat. 3; R40T+; R26Xi; R36/37/38R42/43R52-53 | T+R: 26-36/37/38-40-42/43-52/53S: (1/2-)23-36/37-45-61 | R42: C ≥ 0,1 % | C2 |
| 615-007-00-X | 1,5-naphthylene diisocyanate | 221-641-4 | 3173-72-6 | Xn; R20Xi; R36/37/38R42R52-53 | XnR: 20-36/37/38-42-52/53S: (2-)26-28-38-45-61 |
| 615-008-00-5 | 3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate;isophorone di-isocyanate | 223-861-6 | 4098-71-9 | T; R23Xi; R36/37/38R42/43N; R51-53 | T; NR: 23-36/37/38-42/43-51/53S: (1/2-)26-28-38-45-61 | T; R23: C ≥ 2 %Xn; R20: 0,5 % ≤ C < 2 %R42/43: C ≥ 0,5 % | 2 |
| 615-009-00-0 | 4,4'-methylenedi(cyclohexyl isocyanate);dicyclohexylmethane-4,4'-di-isocyanate | 225-863-2 | 5124-30-1 | T; R23Xi; R36/37/38R42/43 | TR: 23-36/37/38-42/43S: (1/2-)26-28-38-45 | T; R23: C ≥ 2 %Xn; R20: 0,5 % ≤ C < 2 %R42/43: C ≥ 0,5 % | 2 |
| 615-010-00-6 | 2,2,4-trimethylhexamethylene-1,6-di-isocyanate; [1]2,4,4-trimethylhexamethylene-1,6-di-isocyanate [2] | 241-001-8 [1]239-714-4 [2] | 16938-22-0 [1]15646-96-5 [2] | T; R23Xi; R36/37/38R42 | TR: 23-36/37/38-42S: (1/2-)26-28-38-45 | T; R23: C ≥ 2 %Xn; R20: 0,5 % ≤ C < 2 %R42: C ≥ 0,5 % | C2 |
| 615-011-00-1 | hexamethylene-di-isocyanate | 212-485-8 | 822-06-0 | T; R23Xi; R36/37/38R42/43 | TR: 23-36/37/38-42/43S: (1/2-)26-28-38-45 | T; R23: C ≥ 2 %Xn; R20: 0,5 % ≤ C < 2 %R42/43: C ≥ 0,5 % | 2 |
| 615-012-00-7 | 4-isocyanatosulphonyltoluene;tosyl isocyanate | 223-810-8 | 4083-64-1 | R14Xi; R36/37/38R42 | XnR: 14-36/37/38-42S: (2-)26-28-30 | Xi; R36/37/38: C ≥ 5 % |
| 615-013-00-2 | cyanamide;carbanonitril | 206-992-3 | 420-04-2 | T; R25Xn; R21Xi; R36/38R43 | TR: 21-25-36/38-43S: (1/2-)3-22-36/37-45 |
| 615-014-00-8 | tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrate | — | 7276-58-6 | Xn; R22 | XnR: 22S: (2-)24 |
| 615-015-00-3 | 1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate;isobornyl thiocyanoacetate | 204-081-5 | 115-31-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-60-61 |
| 615-016-00-9 | potassium cyanate | 209-676-3 | 590-28-3 | Xn; R22 | XnR: 22S: (2-)24/25 |
| 615-017-00-4 | calcium cyanamide | 205-861-8 | 156-62-7 | Xn; R22Xi; R37-41 | XnR: 22-37-41S: (2-)22-26-36/37/39 |
| 615-018-00-X | 2-(2-butoxyethoxy)ethyl thiocyanate | 203-985-7 | 112-56-1 | R10T; R24/25 | TR: 10-24/25S: (1/2-)13-36/37-45 |
| 615-019-00-5 | dicyclohexylcarbodiimide | 208-704-1 | 538-75-0 | T; R24Xn; R22Xi; R41R43 | TR: 22-24-41-43S: (1/2-)24-26-37/39-45 |
| 615-020-00-0 | methylene dithiocyanate | 228-652-3 | 6317-18-6 | T+; R26T; R25C; R34R43N; R50 | T+; NR: 25-26-34-43-50S: (1/2-)26-28-36/37/39-45-61 |
| 615-021-00-6 | 1,3,5-tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione;TGIC | 219-514-3 | 2451-62-9 | Muta. Cat. 2; R46T; R23/25Xn; R48/22Xi; R41R43R52-53 | TR: 46-23/25-41-43-48/22-52/53S: 53-45-61 | E |
| 615-022-00-1 | methyl 3-isocyanatosulfonyl-2-thiophene-carboxylate | 410-550-7 | 79277-18-2 | E; R2 ⊗R14Xn; R48/22R42/43 | E; XnR: 2-14-42/43-48/22S: (2-)22-30-35-36/37 |
| 615-023-00-7 | 2-(isocyanatosulfonylmethyl)benzoic acid methyl ester;(alt.):methyl 2-(isocyanatosulfonylmethyl)benzoate | 410-900-9 | 83056-32-0 | R10R14Muta. Cat. 3; R68Xn; R20-48/22Xi; R41R42 | XnR: 10-14-20-41-42-48/22-68S: (2-)23-26-36/37/39 |
| 615-024-00-2 | 2-phenylethylisocyanate | 413-080-0 | 1943-82-4 | T; R23Xn; R22C; R35R42/43N; R51-53 | T; C; NR: 22-23-35-42/43-51/53S: (1/2-)23-26-36/37/39-43-45-61 |
| 615-025-00-8 | 4,4'-ethylidenediphenyl dicyanate | 405-740-1 | 47073-92-7 | Xn; R20/22-48/22Xi; R41N; R50-53 | Xn; NR: 20/22-41-48/22-50/53S: (2-)26-36/37/39-60-61 |
| 615-026-00-3 | 4,4'-methylenebis(2,6-dimethylphenyl cyanate) | 405-790-4 | 101657-77-6 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 |
| 615-028-00-4 | ethyl 2-(isocyanatosulfonyl)benzoate | 410-220-2 | 77375-79-2 | E; R2 ⊗R14Xn; R22-48/22Xi; R41R42/43 | E; XnR: 2-14-22-41-42/43-48/22S: (2-)8-23-26-30-35-36/37/39 |
| 615-029-00-X | 2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane | 411-280-2 | — | T+; R26Xn; R22C; R34R42/43R52-53 | T+R: 22-26-34-42/43-52/53S: (1/2-)23-26-28-36/37/39-45-61 |
| 615-030-00-5 | alkali salts, alkali earth salts and other salts of thiocyanic acid not mentioned elsewhere in this Annex | — | — | Xn; R20/21/22R32R52-53 | XnR: 20/21/22-32-52/53S: (2-)13-61 | A |
| 615-031-00-0 | thallium salt of thiocyanic acid | 222-571-7 | 3535-84-0 | Xn; R20/21/22R32N; R51-53 | Xn; NR: 20/21/22-32-51/53S: (2-)13-61 | A |
| 615-032-00-6 | metal salts of thiocyanic acid not mentioned elsewhere in this Annex | — | — | Xn; R20/21/22R32N; R50-53 | Xn; NR: 20/21/22-32-50/53S: (2-)13-60-61 | A |
| 616-001-00-X | N,N-dimethylformamide;dimethyl formamide | 200-679-5 | 68-12-2 | Repr. Cat. 2; R61Xn; R20/21Xi; R36 | TR: 61-20/21-36S: 53-45 | E |
| 616-002-00-5 | 2-fluoroacetamide | 211-363-1 | 640-19-7 | T+; R28T; R24 | T+R: 24-28S: (1/2-)36/37-45 |
| 616-003-00-0 | acrylamide;prop-2-enamide | 201-173-7 | 79-06-1 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 3; R62T; R25-48/23/24/25Xn; R20/21Xi; R36/38R43 | TR: 45-46-20/21-25-36/38-43-48/23/24/25-62S: 53-45 | DE |
| 616-004-00-6 | allidochlor (ISO);N,N-diallylchloroacetamide | 202-270-7 | 93-71-0 | Xn; R21/22Xi; R36/38N; R51-53 | Xn; NR: 21/22-36/38-51/53S: (2-)26-28-36/37/39-61 |
| 616-005-00-1 | chlorthiamid (ISO);2,6-dichloro (thiobenzamide) | 217-637-7 | 1918-13-4 | Xn; R22 | XnR: 22S: (2-)36 |
| 616-006-00-7 | dichlofluanid (ISO);N-dichlorofluoromethylthio-N',N'-dimethyl-N-phenylsulphamide | 214-118-7 | 1085-98-9 | Xn; R20Xi; R36R43N; R50-53 | Xn; NR: 20-36-43-50/53S: (2-)24-37-60-61 |
| 616-007-00-2 | diphenamid (ISO);N,N-dimethyl-2,2-diphenylacetamide | 213-482-4 | 957-51-7 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 616-008-00-8 | propachlor (ISO);2-chloro-N-isopropylacetanilide;α-chloro-N-isopropylacetanilide | 217-638-2 | 1918-16-7 | Xn; R22Xi; R36R43N; R50-53 | Xn; NR: 22-36-43-50/53S: (2-)24-37-60-61 |
| 616-009-00-3 | propanil (ISO);3',4'-dichloropropionanilide | 211-914-6 | 709-98-8 | Xn; R22N; R50 | Xn; NR: 22-50S: (2-)22-61 |
| 616-010-00-9 | tosylchloramide sodium | 204-854-7 | 127-65-1 | Xn; R22R31C; R34R42 | CR: 22-31-34-42S: (1/2-)7-22-26-36/37/39-45 |
| 616-011-00-4 | N,N-dimethylacetamide | 204-826-4 | 127-19-5 | Repr. Cat. 2; R61Xn; R20/21 | TR: 61-20/21S: 53-45 | Repr. Cat. 2; R61: C ≥ 5 % | E |
| 616-012-00-X | N-(dichlorofluoromethylthio)phthalimide;N-(fluorodichloromethylthio)phthalimide | 211-952-3 | 719-96-0 | Xi; R38 | XiR: 38S: (2-)28 |
| 616-013-00-5 | butyraldehyde oxime | 203-792-8 | 110-69-0 | T; R24Xn; R22Xi; R36 | TR: 22-24-36S: (1/2-)23-36-45 |
| 616-014-00-0 | 2-butanone oxime;ethyl methyl ketoxime;ethyl methyl ketone oxime | 202-496-6 | 96-29-7 | Carc. Cat. 3; R40Xn; R21Xi; R41R43 | XnR: 21-40-41-43S: (2-)13-23-26-36/37/39 |
| 616-015-00-6 | alachlor (ISO);2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide | 240-110-8 | 15972-60-8 | Carc. Cat. 3; R40Xn; R22R43N; R50-53 | Xn; NR: 22-40-43-50/53S: (2-)36/37-46-60-61 | N; R50-53: C ≥ 0,2,5 %N; R51-53: 0,025 % ≤ C < 0,25 %R52-53: 0,0025 % ≤ C < 0,025 % |
| 616-016-00-1 | 1-(3,4-dichlorophenylimino) thiosemicarbazide | — | 5836-73-7 | T+; R28 | T+R: 28S: (1/2-)22-36/37-45 |
| 616-017-00-7 | cartap hydrochloride | 239-309-2 | 15263-52-2 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)36/37-60-61 |
| 616-018-00-2 | N,N-diethyl-m-toluamide;deet | 205-149-7 | 134-62-3 | Xn; R22Xi; R36/38R52-53 | XnR: 22-36/38-52/53S: (2-)61 |
| 616-019-00-8 | perfluidone (ISO);1,1,1-trifluoro-N-(4-phenylsulphonyl-o-tolyl)methanesulphonamide | 253-718-3 | 37924-13-3 | Xn; R22Xi; R36 | XnR: 22-36S: (2-) |
| 616-020-00-3 | tebuthiuron (ISO);1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | 251-793-7 | 34014-18-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)37-60-61 |
| 616-021-00-9 | thiazafluron (ISO);1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea | 246-901-4 | 25366-23-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 |
| 616-022-00-4 | acetamide | 200-473-5 | 60-35-5 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 |
| 616-023-00-X | N-hexadecyl(or octadecyl)-N-hexadecyl(or octadecyl)benzamide | 401-980-6 | — | Xi; R38R43 | XiR: 38-43S: (2-)24-37 |
| 616-024-00-5 | 2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide | 402-260-4 | 54942-74-4 | R53 | R: 53S: 61 |
| 616-025-00-0 | valinamide | 402-840-7 | 20108-78-5 | Repr. Cat. 3; R62Xi; R36R43 | XnR: 36-43-62S: (2-)26-36/37 |
| 616-026-00-6 | thioacetamide | 200-541-4 | 62-55-5 | Carc. Cat. 2; R45Xn; R22Xi; R36/38R52-53 | TR: 45-22-36/38-52/53S: 53-45-61 | E |
| 616-027-00-1 | tris(2-(2-hydroxyethoxy)ethyl)ammonium 3-acetoacetamido-4-methoxybenzenesulfonate | 403-760-5 | — | R43 | XiR: 43S: (2-)24-37 |
| 616-028-00-7 | N-(4-(3-(4-cyanophenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | 403-790-9 | 108673-51-4 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 616-029-00-2 | N,N'-ethylenebis(vinylsulfonylacetamide) | 404-790-1 | 66710-66-5 | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 |
| 616-030-00-8 | ethidimuron (ISO);1-(5-ethylsulphonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | 250-010-6 | 30043-49-3 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 616-031-00-3 | dimethachlor (ISO);2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide | 256-625-6 | 50563-36-5 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 |
| 616-032-00-9 | diflufenican (ISO);N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide | — | 83164-33-4 | R52-53 | R: 52/53S: 61 |
| 616-033-00-4 | cyprofuram (ISO);N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropanecarboxamide | 274-050-9 | 69581-33-5 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)36/37-60-61 |
| 616-034-00-X | pyracarbolid (ISO);3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide | 246-419-4 | 24691-76-7 | R52-53 | R: 52/53S: 61 |
| 616-035-00-5 | cymoxanil (ISO);2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide | 261-043-0 | 57966-95-7 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37-60-61 |
| 616-036-00-0 | 2-chloracetamide | 201-174-2 | 79-07-2 | Repr. Cat. 3; R62T; R25R43 | TR: 25-43-62S: (1/2-)22-36/37-45 | R43: C ≥ 0,1 % |
| 616-037-00-6 | acetochlor (ISO);2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide | 251-899-3 | 34256-82-1 | Xn; R20Xi; R37/38R43N; R50-53 | Xn; NR: 20-37/38-43-50/53S: (2-)36/37-60-61 |
| 616-038-00-1 | (4-aminophenyl)-N-methylmethylensulfonamide hydrochloride | 406-010-5 | 88918-84-7 | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 |
| 616-039-00-7 | 3',5'-dichloro-4'-ethyl-2'-hydroxypalmitanilide | 406-200-8 | 117827-06-2 | R43 | XiR: 43S: (2-)24-37 |
| 616-040-00-2 | potassium N-(4-toluenesulfonyl)-4-toluenesulfonamide | 406-650-5 | 97888-41-0 | Xi; R41 | XiR: 41S: (2-)26-39 |
| 616-041-00-8 | 3',5'-dichloro-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxyhexananilide | 406-840-8 | 101664-25-9 | R53 | R: 53S: 61 |
| 616-042-00-3 | N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamide | 407-070-5 | 142859-67-4 | R43R53 | XiR: 43-53S: (2-)22-24-37-61 |
| 616-043-00-9 | isoxaben (ISO);N-[3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide | 407-190-8 | 82558-50-7 | R53 | R: 53S: 61 |
| 616-044-00-4 | N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)-butanamide | 402-510-2 | — | N; R51-53 | NR: 51/53S: 61 |
| 616-045-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilide | 405-190-2 | 122371-93-1 | R43R53 | XiR: 43-53S: 2-22-24-37-61 |
| 616-046-00-5 | N-(2-(6-chloro-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | 406-390-2 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 616-047-00-0 | reaction mass of: 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide;2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C18)alkylacetamide | 406-640-0 | — | R43 | XiR: 43S: (2-)24-37 |
| 616-048-00-6 | 3'-trifluoromethylisobutyranilide | 406-740-4 | 1939-27-1 | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)22-36-61 |
| 616-049-00-1 | 2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-hexanamide | 408-150-2 | 99141-89-6 | R53 | R: 53S: 61 |
| 616-050-00-7 | lufenuron (ISO);N-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)-phenyl-aminocarbonyl]-2,6-difluorobenzamide | 410-690-9 | 103055-07-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 616-051-00-2 | reaction mass of: 2,4 -bis(N'-(4-methylphenyl)-ureido)-toluene;2,6 -bis(N'-(4-methylphenyl)-ureido)-toluene | 411-070-0 | — | R53 | R: 53S: 61 |
| 616-052-00-8 | formamide | 200-842-0 | 75-12-7 | Repr. Cat. 2; R61 | TR: 61S: 53-45 |
| 616-053-00-3 | N-methylacetamide | 201-182-6 | 79-16-3 | Repr. Cat. 2; R61 | TR: 61S: 53-45 |
| 616-054-00-9 | iprodione (ISO);3-(3,5-dichlorophenyl)-2,4-dioxo-N-isopropylimidazolidine-1-carboxamide | 253-178-9 | 36734-19-7 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 616-055-00-4 | propyzamide (ISO);3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide | 245-951-4 | 23950-58-5 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 |
| 616-056-00-X | N-methylformamide | 204-624-6 | 123-39-7 | Repr. Cat. 2; R61Xn; R21 | TR: 61-21S: 53-45 | E |
| 616-057-00-5 | reaction mass of: N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide;N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide;methacrylamide;2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide;N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide | 412-790-8 | — | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R48/22 | TR: 45-48/22S: 53-45 | E |
| 616-058-00-0 | 1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzene | 412-570-1 | 119462-56-5 | Xn; R48/22Xi; R41R43N; R50-53 | Xn; NR: 41-43-48/22-50/53S: (2-)26-36/37/39-60-61 |
| 616-059-00-6 | 4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalenecarboxamide | 412-650-6 | 121487-83-0 | R53 | R: 53S: 61 |
| 616-060-00-1 | Condensation product of: 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexene-1,2-dicarboxylic acid with polyamines (primarily amino-ethyl-piperazine and triethylenetetramine) | 413-770-1 | — | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 616-061-00-7 | N,N'-1,6-hexanediylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamide | 413-610-0 | 124172-53-8 | Xi; R36R52-53 | XiR: 36-52/53S: (2-)26-61 |
| 616-062-00-2 | N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenylacetamide | 411-590-8 | 70693-57-1 | C; R34R52-53 | CR: 34-52/53S: (1/2-)26-36/37/39-45-61 |
| 616-063-00-8 | 3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)-yl)-2,5-pyrrolidindione | 411-920-0 | 106917-30-0 | T; R23Xn; R22-48/22C; R35N; R50-53 | T; C; NR: 22-23-35-48/22-50/53S: (1/2-)26-28-36/37/39-45-60-61 |
| 616-064-00-3 | N-tert-butyl-3-methylpicolinamide | 406-720-5 | 32998-95-1 | R52-53 | R: 52/53S: 61 |
| 616-065-00-9 | 3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurea | 411-970-3 | 79881-89-3 | Xn; R22-48/22 | XnR: 22-48/22S: (2-)22-36 |
| 616-066-00-4 | 5,6,12,13-tetrachloroanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone | 405-100-1 | 115662-06-1 | Repr. Cat. 3; R62 | XnR: 62S: (2-)22-36/37 |
| 616-067-00-X | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorobenzoate | 407-300-4 | 92683-20-0 | R53 | R: 53S: 61 |
| 616-068-00-5 | potassium 4-(11-methacrylamidoundecanamido)benzenesulfonate | 406-500-9 | 174393-75-0 | R43 | XiR: 43S: (2-)22-24-37 |
| 616-069-00-0 | 1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamide | 406-210-2 | 110560-22-0 | R53 | R: 53S: 61 |
| 616-070-00-6 | reaction mass of: 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea;3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urea;3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-530-2 | — | R53 | R: 53S: 22-61 |
| 616-071-00-1 | reaction mass of: bis(N-cyclohexyl-N'-phenyleneureido)methylene;bis(N-octadecyl-N'-phenyleneureido)methylene;bis(N-dicyclohexyl-N'-phenyleneureido)methylene (1:2:1) | 406-550-1 | — | R43R53 | XiR: 43-53S: (2-)22-24-37-61 |
| 616-072-00-7 | 1-(2-deoxy-5-O-trityl-β-D-threopentofuranosyl)thymine | 407-120-6 | 55612-11-8 | R53 | R: 53S: 61 |
| 616-073-00-2 | 4'-ethoxy-2-benzimidazoleanilide | 407-600-5 | 120187-29-3 | Muta. Cat. 3; R68R53 | XnR: 68-53S: (2-)22-36/37-61 |
| 616-074-00-8 | N-butyl-2-(4-morpholinylcarbonyl)benzamide | 407-730-2 | 104958-67-0 | Xi; R36R43R52-53 | XiR: 36-43-52/53S: (2-)24-26-37-61 |
| 616-075-00-3 | D, L-(N,N-diethyl-2-hydroxy-2-phenylacetamide) | 408-120-9 | 65197-96-8 | Xn; R22Xi; R41 | XnR: 22-41S: (2-)26-39-46 |
| 616-076-00-9 | tebufenozide (ISO);N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide | 412-850-3 | 112410-23-8 | N; R51-53 | NR: 51/53S: 61 |
| 616-077-00-4 | reaction mass of: 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfonic acid;potassium 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfate | 411-310-4 | — | Xi; R41 | XiR: 41S: (2-)26-39 |
| 616-078-00-X | 2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)hexanamide | 411-330-3 | 104541-33-5 | R53 | R: 53S: 61 |
| 616-079-00-5 | 1,6-hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate | 411-700-4 | 140921-24-0 | R43 | XiR: 43S: (2-)24-37 |
| 616-080-00-0 | 4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzenesulfonamide) | 411-850-0 | 119018-29-0 | R52-53 | R: 52/53S: 61 |
| 616-081-00-6 | 5-bromo-8-naphtholactam | 413-480-5 | 24856-00-6 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)22-24-37-60-61 |
| 616-082-00-1 | N-(5-chloro-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)benzamide | 413-200-1 | 129604-78-0 | R43 | XiR: 43S: (2-)24-37 |
| 616-083-00-7 | [2-[(4-nitrophenyl)amino]ethyl]urea | 410-700-1 | 27080-42-8 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 616-084-00-2 | 2,4-bis[N'-(4-methylphenyl)ureido]toluene | 411-790-5 | — | N; R50-53 | NR: 50/53S: 60-61 |
| 616-085-00-8 | 3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione | 412-190-6 | 168900-02-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-086-00-3 | 2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene | 412-250-1 | 102387-48-4 | R53 | R: 53S: 61 |
| 616-087-00-9 | reaction mass of: 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecane-1,16-diyl-prop-2-enoate;7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoate | 412-260-6 | 52658-19-2 | Xi; R36R43N; R51-53 | Xi; NR: 36-43-51/53S: (2-)26-36/37-61 |
| 616-088-00-4 | 2-aminosulfonyl-N,N-dimethylnicotinamide | 413-440-7 | 112006-75-4 | R43R52-53 | XiR: 43-52/53S: (2-)24-37-61 |
| 616-089-00-X | 5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran | 415-360-8 | 41107-56-6 | Muta. Cat. 3; R68 | XnR: 68S: (2-)22-36/37 |
| 616-090-00-5 | 1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride | 415-660-9 | 70918-74-0 | T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 23/24/25-48/22-51/53S: 53-45-61 |
| 616-091-00-0 | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | 423-400-0 | 59653-74-6 | Muta. Cat. 2; R46T; R23Xn; R22-48/22Xi; R41R43 | TR: 46-22-23-41-43-48/22S: 53-45 | E |
| 616-092-00-6 | Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide | 404-035-6 | — | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 616-093-00-1 | Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride | 406-620-1 | 129217-90-9 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 616-094-00-7 | 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-370-3 | 58890-25-8 | R43R53 | XiR: 43-53S: (2-)24-37-61 |
| 616-095-00-2 | 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 406-690-3 | 43136-14-7 | R53 | R: 53S: 61 |
| 616-096-00-8 | N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide | 408-110-4 | 110483-07-3 | R53 | R: 53S: 61 |
| 616-097-00-3 | N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide | 411-840-6 | 83372-55-8 | R53 | R: 53S: 61 |
| 616-098-00-9 | 1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide | 411-750-7 | 119126-15-7 | N; R51-53 | NR: 51/53S: 61 |
| 616-099-00-4 | 2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl]-3-oxopentanamide | 414-170-2 | 135937-20-1 | R53 | R: 53S: 61 |
| 616-100-00-8 | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea | 414-180-7 | 10218-17-4 | Xn; R22Xi; R38 | XnR: 22-38S: (2-)36/37 |
| 616-101-00-3 | (S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide | 414-600-9 | 149182-72-9 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)61 |
| 616-102-00-9 | reaction mass of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene);1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl)-ω-oxy-poly(oxyethylene-co-oxypropylene)]-3-(or 2-)propanol;1,2,3-tris[α-(3-mercaptopropanoxycarbonyl-amino)methylphenylaminocarbonyl)-ω-oxy-poly-(oxyethylene-co-oxypropylene)]propane] | 415-870-0 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)36/37-61 |
| 616-103-00-4 | (S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide | 415-030-3 | 120298-38-6 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 |
| 616-104-00-X | benalaxyl (ISO);methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-Dl-alaninate | 275-728-7 | 71626-11-4 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-105-00-5 | chlorotoluron (ISO);3-(3-chloro-p-tolyl)-1,1-dimethylurea | 239-592-2 | 15545-48-9 | Carc. Cat. 3; R40Repr. Cat. 3; R63N; R50-53 | Xn; NR: 40-63-50/53S: (2-)26-36/37-46-60-61 |
| 616-106-00-0 | phenmedipham (ISO);methyl 3-(3-methylcarbaniloyloxy)carbanilate | 237-199-0 | 13684-63-4 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-108-00-1 | iodosulfuron-methyl-sodium;sodium ({[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide | — | 144550-36-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-109-00-7 | sulfosulfuron (ISO);1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea | — | 141776-32-1 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-110-00-2 | cyclanilide (ISO);1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid | 419-150-7 | 113136-77-9 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 |
| 616-111-00-8 | fenhexamid (ISO);N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid | 422-530-5 | 126833-17-8 | N; R51-53 | NR: 51/53S: 61 |
| 616-112-00-3 | oxasulfuron (ISO);oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate | — | 144651-06-9 | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)46-60-61 |
| 616-113-00-9 | desmedipham (ISO);ethyl 3-phenylcarbamoyloxyphenylcarbamate | 237-198-5 | 13684-56-5 | N; R50-53 | NR: 50/53S: 60-61 | N; R50-53: C ≥ 2,5 %N; R51-53: 0,25 % ≤ C < 2,5 %R52-53: 0,025 % ≤ C < 0,25 % |
| 616-114-00-4 | dodecanamide, N,N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- | 418-010-2 | 136897-58-0 | R53 | R: 53S: 22-61 |
| 616-115-00-X | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide | 416-150-9 | 136450-06-1 | R53 | R: 53S: 61 |
| 616-116-00-5 | N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate | 416-790-9 | 143052-96-4 | R53 | R: 53S: 61 |
| 616-117-00-0 | N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide | 416-860-9 | 777891-21-1 | Repr. Cat. 3; R62R43N; R50-53 | Xn; NR: 43-62-50/53S: (2-)22-36/37-60-61 |
| 616-118-00-6 | N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride | 417-950-0 | 65797-42-4 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 616-119-00-1 | 2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide | 418-060-5 | 118020-93-2 | R53 | R: 53S: 61 |
| 616-120-00-7 | reaction mass of: N-(3-dimethylamino-4-methyl-phenyl)-benzamide;N-(3-dimethylamino-2-methyl-phenyl)-benzamide;N-(3-dimethylamino-3-methyl-phenyl)-benzamide | 420-600-1 | — | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)36/37-61 |
| 616-121-00-2 | 2,4-dihydroxy-N-(2-methoxyphenyl)benzamide | 419-090-1 | 129205-19-2 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 616-123-00-3 | N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamide | 414-740-0 | 96141-86-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-124-00-9 | lithium bis(trifluoromethylsulfonyl)imide | 415-300-0 | 90076-65-6 | T; R24/25C; R34R52-53 | TR: 24/25-34-52/53S: (1/2-)22-26-36/37/39-45-61 |
| 616-125-00-4 | 3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide | 415-730-9 | 151338-11-3 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-127-00-5 | reaction mass of: N,N'-Ethane-1,2-diylbis(decanamide);12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamide;N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | 430-050-2 | — | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 |
| 616-128-00-0 | N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide | 417-530-7 | 123590-00-1 | R53 | R: 53S: 61 |
| 616-129-00-6 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | 419-710-0 | 42774-15-2 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)22-25-26 |
| 616-130-00-1 | N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide | 421-780-2 | 150919-56-5 | R53 | R: 53S: 61 |
| 616-132-00-2 | N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide | 423-250-6 | 130016-98-7 | N; R50-53 | NR: 50/53S: 60-61 |
| 616-133-00-8 | N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide | 423-990-1 | 149118-66-1 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-60-61 |
| 616-134-00-3 | 3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide | 401-820-5 | 793710-14-2 | R52-53 | R: 52/53S: 61 |
| 616-135-00-9 | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide | 430-230-0 | 136522-17-3 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 |
| 616-142-00-7 | 1,3-Bis(vinylsulfonylacetamido)propane | 428-350-3 | 93629-90-4 | Muta. Cat. 3; R68Xi; R41R43R52-53 | XnR: 41-43-68-52/53S: (2-)22-26-36/37/39-61 |
| 616-143-00-2 | N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide | 422-560-9 | 149591-38-8 | Repr. Cat. 3; R62Xi; R36R53 | XnR: 36-62-53S: (2-)26-36/37-61 |
| 617-001-00-2 | di-tert-butyl peroxide | 203-733-6 | 110-05-4 | O; R7F; R11 | O; FR: 7-11S: (2-)3/7-14-16-36/37/39 |
| 617-002-00-8 | α,α-dimethylbenzyl hydroperoxide;cumene hydroperoxide | 201-254-7 | 80-15-9 | O; R7T; R23Xn; R21/22-48/20/22C; R34N; R51-53 | O; T; NR: 7-21/22-23-34-48/20/22-51/53S: (1/2-)3/7-14-36/37/39-45-50-61 | C; R34: C ≥ 10 %Xi; R37/38-41: 3 % ≤ C < 10 %Xi; R36/37: 1 % ≤ C < 3 % |
| 617-003-00-3 | dilauroyl peroxide | 203-326-3 | 105-74-8 | O; R7 | OR: 7S: (2-)3/7-14-36/37/39 |
| 617-004-00-9 | 1,2,3,4-tetrahydro-1-naphthyl hydroperoxide | 212-230-0 | 771-29-9 | O; R7Xn; R22C; R34N; R50-53 | O; C; NR: 7-22-34-50/53S: (1/2-)3/7-14-26-36/37/39-45-60-61 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 617-006-00-X | bis(α,α-dimethylbenzyl) peroxide | 201-279-3 | 80-43-3 | O; R7Xi; R36/38N; R51-53 | O; Xi; NR: 7-36/38-51/53S: (2-)3/7-14-36/37/39-61 |
| 617-007-00-5 | tert-butyl α,α-dimethylbenzyl peroxide | 222-389-8 | 3457-61-2 | O; R7Xi; R38N; R51-53 | O; Xi; NR: 7-38-51/53S: (2-)3/7-14-36/37/39-61 |
| 617-008-00-0 | dibenzoyl peroxide;benzoyl peroxide | 202-327-6 | 94-36-0 | E; R2 ⊗Xi; R36R43 | E; XiR: 2-36-43S: (2-)3/7-14-36/37/39 |
| 617-010-00-1 | 1-hydroperoxycyclohexyl 1-hydroxycyclohexyl peroxide; [1]1,1'-dioxybiscyclohexan-1-ol; [2]cyclohexylidene hydroperoxide; [3]cyclohexanone, peroxide [4] | 201-091-1 [1]219-306-2 [2]220-279-4 [3]235-527-7 [4] | 78-18-2 [1]2407-94-5 [2]2699-11-8 [3]12262-58-7 [4] | E; R2 ⊗Xn; R22C; R34 | E; CR: 2-22-34S: (1/2-)3/7-14-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % | C |
| 617-012-00-2 | 8-p-menthyl hydroperoxide;p-menthane hydroperoxide | 201-281-4 | 80-47-7 | O; R7C; R34Xn; R20 | O; CR: 7-20-34S: (1/2-)3/7-14-36/37/39-45 | C; R34: C ≥ 10 %Xi; R36/37/38: 5 % ≤ C < 10 % |
| 617-013-00-8 | O,O-tert-butyl O-docosyl monoperoxyoxalate | 404-300-6 | 116753-76-5 | O; R7N; R50-53 | O; NR: 7-50/53S: (2-)7-14-36/37/39-47-60-61 |
| 617-014-00-3 | 6-(nonylamino)-6-oxo-peroxyhexanoic acid | 406-680-9 | 104788-63-8 | O; R7Xi; R41R43N; R50 | O; Xi; NR: 7-41-43-50S: (2-)3/7-14-26-36/37/39-61 |
| 617-015-00-9 | bis(4-methylbenzoyl)peroxide | 407-950-9 | 895-85-2 | E; R2O; R7N; R50-53 | E; NR: 2-7-50/53S: (2-)7-14-36/37/39-47-60-61 |
| 617-016-00-4 | 3-hydroxy-1,1-dimethylbutyl 2-ethyl-2-methylheptaneperoxoate | 413-910-1 | — | O; R7R10Xi; R38N; R50-53 | O; Xi; NR: 7-10-38-50/53S: (2-)7/47-14-36/37/39-60-61 |
| 617-017-00-X | reaction mass of: 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzene;2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzene | 412-140-3 | 32144-25-5 | O; R7 ⊗R53 | OR: 7-53S: (2-)3/7-14-36/37/39-61 |
| 617-018-00-5 | reaction mass of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63 % by weight;1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight | 410-840-3 | 71566-50-2 | O; R7N; R51-53 | O; NR: 7-51/53S: (2-)3/7-14-36/37/39-61 |
| 617-019-00-0 | 6-(phthalimido)peroxyhexanoic acid | 410-850-8 | 128275-31-0 | O; R7Xi; R41N; R50 | O; Xi; NR: 7-41-50S: (2-)3/7-14-26-36/37/39-61 |
| 617-020-00-6 | 1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) | 420-060-5 | 117663-11-3 | R10O; R7N; R51-53 | O; NR: 7-10-51/53S: (2-)7-14-36/37/39-47-61 |
| 647-001-00-8 | glucosidase, β- | 232-589-7 | 9001-22-3 | R42 | XnR: 42S: (2-)22-24-36/37 |
| 647-002-00-3 | cellulase | 232-734-4 | 9012-54-8 | R42 | XnR: 42S: (2-)22-24-36/37 |
| 647-003-00-9 | cellobiohydrolase, exo- | 253-465-9 | 37329-65-0 | R42 | XnR: 42S: (2-)22-24-36/37 |
| 647-004-00-4 | cellulases with the exception of those specified elsewhere in this Annex | — | — | R42 | XnR: 42S: (2-)22-24-36/37 | A |
| 647-005-00-X | bromelain, juice | 232-572-4 | 9001-00-7 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-006-00-5 | ficin | 232-599-1 | 9001-33-6 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-007-00-0 | papain | 232-627-2 | 9001-73-4 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-008-00-6 | pepsin A | 232-629-3 | 9001-75-6 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-009-00-1 | rennin | 232-645-0 | 9001-98-3 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-010-00-7 | trypsin | 232-650-8 | 9002-07-7 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-011-00-2 | chymotrypsin | 232-671-2 | 9004-07-3 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-012-00-8 | subtilisin | 232-752-2 | 9014-01-1 | Xi; R37/38-41R42 | XnR: 37/38-41-42S: (2-)22-24-26-36/37/39 |
| 647-013-00-3 | proteinase, microbial neutral | 232-966-6 | 9068-59-1 | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-014-00-9 | proteases with the exception of those specified elsewhere in this Annex | — | — | Xi; R36/37/38R42 | XnR: 36/37/38-42S: (2-)22-24-26-36/37 |
| 647-015-00-4 | amylase, α- | 232-565-6 | 9000-90-2 | R42 | XnR: 42S: (2-)22-24-36/37 |
| 647-016-00-X | amylases with the exception of those specified elsewhere in this Annex | — | — | R42 | XnR: 42S: (2-)22-24-36/37 |
| 648-001-00-0 | Distillates (coal tar), benzole fraction;Light Oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists of hydrocarbons having carbon numbers primarily in the range of C4 to C10 and distilling in the approximate range of 80 oC to 160 oC (175oF to 320oF).] | 283-482-7 | 84650-02-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-002-00-6 | Tar oils, brown-coal;Light Oil;[The distillate from lignite tar boiling in the range of approximately 80 oC to 250 oC (176oF to 482oF). Composed primarily of aliphatic and aromatic hydrocarbons and monobasic phenols.] | 302-674-4 | 94114-40-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-003-00-1 | Benzol forerunnings (coal);Light Oil Redistillate, low boiling;[The distillate from coke oven light oil having an approximate distillation range below 100 oC (212oF). Composed primarily of C4 to C6 aliphatic hydrocarbons.] | 266-023-5 | 65996-88-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-004-00-7 | Distillates (coal tar), benzole fraction, BTX-rich;Light Oil Redistillate, low boiling;[A residue from the distillation of crude benzole to remove benzole fronts. Composed primarily of benzene, toluene and xylenes boiling in the range of approximately 75 oC to 200 oC (167oF to 392oF).] | 309-984-9 | 101896-26-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-005-00-2 | Aromatic hydrocarbons, C6-10, C8-rich;Light Oil Redistillate, low boiling | 292-697-5 | 90989-41-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-006-00-8 | Solvent naphtha (coal), light;Light Oil Redistillate, low boiling | 287-498-5 | 85536-17-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-007-00-3 | Solvent naphtha (coal), xylene-styrene cut;Light Oil Redistillate, intermediate boiling | 287-502-5 | 85536-20-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-008-00-9 | Solvent naphtha (coal), coumarone-styrene contg.;Light Oil Redistillate, intermediate boiling | 287-500-4 | 85536-19-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-009-00-4 | Naphtha (coal), distn. residues;Light Oil Redistillate, high boiling;[The residue remaining from the distillation of recovered naphtha. Composed primarily of naphthalene and condensation products of indene and styrene.] | 292-636-2 | 90641-12-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-010-00-X | Aromatic hydrocarbons, C8;Light Oil Redistillate, high boiling | 292-694-9 | 90989-38-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-012-00-0 | Aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product;Light Oil Redistillate, high boiling;[A complex combination of hydrocarbons obtained from the evaporation of solvent under vacuum from polymerized hydrocarbon resin. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C9 and boiling in the range of approximately 120 oC to 215 oC (248oF to 419oF).] | 295-281-1 | 91995-20-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-013-00-6 | Aromatic hydrocarbons, C9-12, benzene distn.;Light Oil Redistillate, high boiling | 295-551-9 | 92062-36-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-014-00-1 | Extract residues (coal), benzole fraction alk., acid ext.;Light Oil Extract Residues, low boiling;[The redistillate from the distillate, freed of tar acids and tar bases, from bituminous coal high temperature tar boiling in the approximate range of 90 oC to 160 oC (194oF to 320oF). It consists predominantly of benzene, toluene and xylenes.] | 295-323-9 | 91995-61-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-015-00-7 | Extract residues (coal tar), benzole fraction alk., acid ext.;Light Oil Extract Residues, low boiling;[A complex combination of hydrocarbons obtained by the redistillation of the distillate of high temperature coal tar (tar acid and tar base free). It consists predominantly of unsubstituted and substituted mononuclear aromatic hydrocarbons boiling in the range of 85 oC-195 oC (185oF-383oF).] | 309-868-8 | 101316-63-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-016-00-2 | Extract residues (coal), benzole fraction acid;Light Oil Extract Residues, low boiling;[An acid sludge by-product of the sulphuric acid refining of crude high temperature coal. Composed primarily of sulfuric acid and organic compounds.] | 298-725-2 | 93821-38-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-017-00-8 | Extract residues (coal), light oil alk., distn. overheads;Light Oil Extract Residues, low boiling;[The first fraction from the distillation of aromatic hydrocarbons, coumarone, naphthalene and indene rich prefactionator bottoms or washed carbolic oil boiling substantially below 145 oC (293oF). Composed primarily of C7 and C8 aliphatic and aromatic hydrocarbons.] | 292-625-2 | 90641-02-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-018-00-3 | Extract residues (coal), light oil alk., acid ext., indene fraction;Light Oil Extract Residues, intermediate boiling | 309-867-2 | 101316-62-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-019-00-9 | Extract residues (coal), light oil alk., indene naphtha fraction;Light Oil Extract Residues, high boiling;[The distillate from aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oils, having an approximate boiling range of 155 oC to 180 oC (311oF to 356oF). Composed primarily of indene, indan and trimethylbenzenes.] | 292-626-8 | 90641-03-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-020-00-4 | Solvent naphtha (coal);Light Oil Extract Residues, high boiling;[The distillate from either high temperature coal tar, coke oven light oil, or coal tar oil alkaline extract residue having an approximate distillation range of 130 oC to 210 oC (266oF to 410oF) Composed primarily of indene and other polycyclic ring systems containing a single aromatic ring. May contain phenolic compounds and aromatic nitrogen bases.] | 266-013-0 | 65996-79-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-021-00-X | Distillates (coal tar), light oils, neutral fraction;Light Oil Extract Residues, high boiling;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of alkyl-substituted one ring aromatic hydrocarbons boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF). May also include unsaturated hydrocarbons such as indene and coumarone.] | 309-971-8 | 101794-90-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-022-00-5 | Distillates (coal tar), light oils, acid exts.;Light Oil Extract Residues, high boiling;[This oil is a complex mixture of aromatic hydrocarbons, primarily indene, naphthalene, coumarone, phenol, and o-, m- and p-cresol and boiling in the range of 140 oC to 215 oC (284oF to 419oF).] | 292-609-5 | 90640-87-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-023-00-0 | Distillates (coal tar), light oils;Carbolic Oil;[A complex combination of hydrocarbons obtained by distillation of coal tar. It consists of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills at the approximate range of 150 oC to 210 oC (302oF to 410oF).] | 283-483-2 | 84650-03-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-024-00-6 | Tar oils, coal;Carbolic Oil;[The distillate from high temperature coal tar having an approximate distillation range of 130 oC to 250 oC (266oF to 410oF). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bases.] | 266-016-7 | 65996-82-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-026-00-7 | Extract residues (coal), light oil alk., acid ext.;Carbolic Oil Extract Residue;[The oil resulting from the acid washing of alkali-washed carbolic oil to remove the minor amounts of basic compounds (tar bases). Composed primarily of indene, indan and alkylbenzenes.] | 292-624-7 | 90641-01-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-027-00-2 | Extract residues (coal), tar oil alk.;Carbolic Oil Extract Residue;[The residue obtained from coal tar oil by an alkaline wash such as aqueous sodium hydroxide after the removal of crude coal tar acids. Composed primarily of naphthalenes and aromatic nitrogen bases.] | 266-021-4 | 65996-87-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-028-00-8 | Extract oils (coal), light oil;Acid Extract;[The aqueous extract produced by an acidic wash of alkali-washed carbolic oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | 292-622-6 | 90640-99-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-029-00-3 | Pyridine, alkyl derivs.;Crude Tar Bases;[The complex combination of polyalkylated pyridines derived from coal tar distillation or as high-boiling distillates approximately above 150 oC (302oF) from the reaction of ammonia with acetaldehyde, formaldehyde or paraformaldehyde.] | 269-929-9 | 68391-11-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-030-00-9 | Tar bases, coal, picoline fraction;Distillate Bases;[Pyridine bases boiling in the range of approximately 125 oC to 160 oC (257oF 320oF) obtained by distillation of neutralized acid extract of the base-containing tar fraction obtained by the distillation of bituminous coal tars. Composed chiefly of lutidines and picolines.] | 295-548-2 | 92062-33-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-031-00-4 | Tar bases, coal, lutidine fraction;Distillate Bases | 293-766-2 | 91082-52-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-032-00-X | Extract oils (coal), tar base, collidine fraction;Distillate Bases;[The extract produced by the acidic extraction of bases from crude coal tar aromatic oils, neutralization, and distillation of the bases. Composed primarily of collidines, aniline, toluidines, lutidines, xylidines.] | 273-077-3 | 68937-63-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-033-00-5 | Tar bases, coal, collidine fraction;Distillate Bases;[The distillation fraction boiling in the range of approximately 181 oC to 186 oC (356oF to 367oF) from the crude bases obtained from the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of bituminous coal tar. It contains chiefly aniline and collidines.] | 295-543-5 | 92062-28-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-034-00-0 | Tar bases, coal, aniline fraction;Distillate Bases;[The distillation fraction boiling in the range of approximately 180 oC to 200 oC (356oF to 392oF) from the crude bases obtained by dephenolating and debasing the carbolated oil from the distillation of coal tar. It contains chiefly aniline, collidines, lutidines and toluidines.] | 295-541-4 | 92062-27-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-035-00-6 | Tar bases, coal, toluidine fraction;Distillate Bases | 293-767-8 | 91082-53-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-036-00-1 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction;Redistillates;[A complex combination of hydrocarbons obtained as a redistillate from the fractional distillation of bituminous coal high temperature tar and residual oils that are obtained by the pyrolytic production of alkenes and alkynes from petroleum products or natural gas. It consists predominantly of indene and boils in a range of approximately 160 oC to 190 oC (320oF to 374oF).] | 295-292-1 | 91995-31-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-037-00-7 | Distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils;Redistillates;[The redistillate obtained from the fractional distillation of bituminous coal high temperature tar and pyrolysis residual oils and boiling in the range of approximately 190 oC to 270 oC (374oF to 518oF). Composed primarily of substituted dinuclear aromatics.] | 295-295-8 | 91995-35-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-038-00-2 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate;Redistillates;[The redistillate from the fractional distillation of dephenolated and debased methylnaphthalene oil obtained from bituminous coal high temperature tar and pyrolysis residual oils boiling in the approximate range of 220 oC to 230 oC (428oF to 446oF). It consists predominantly of unsubstituted and substituted dinuclear aromatic hydrocarbons.] | 295-329-1 | 91995-66-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-039-00-8 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils;Redistillates;[A neutral oil obtained by debasing and dephenolating the oil obtained from the distillation of high temperature tar and pyrolysis residuel oils which has a boiling range of 225 oC to 255 oC (437oF to 491oF). Composed primarily of substituted dinuclear aromatic hydrocarbons.] | 310-170-0 | 122070-79-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-040-00-3 | Extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues;Redistillates;[Residue from the distillation of dephenolated and debased methylnaphthalene oil (from bituminous coal tar and pyrolysis residual oils) with a boiling range of 240 oC to 260 oC (464oF to 500oF). Composed primarily of substituted dinuclear aromatic and heterocyclic hydrocarbons.] | 310-171-6 | 122070-80-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-041-00-9 | Absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained as a redistillate from the distillation of wash oil. It consists predominantly of 2-ringed aromatic and heterocyclic hydrocarbons boiling in the range of approximately 260 oC to 290 oC (500oF to 554oF).] | 309-851-5 | 101316-45-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-042-00-4 | Distillates (coal tar), upper, fluorene-rich;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists af aromatic and polycyclic hydrocarbons primarily fluorene and some acenaphthene.] | 284-900-0 | 84989-11-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-043-00-X | Creosote oil, acenaphthene fraction, acenaphthene-free;Wash Oil Redistillate;[The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] | 292-606-9 | 90640-85-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-044-00-5 | Distillates (coal tar), heavy oils;Heavy Anthracene Oil;[Distillate from the fractional distillation of coal tar of bituminous coal, with boiling range of 240 oC to 400 oC (464oF to 752oF). Composed primarily of tri- and polynuclear hydrocarbons and heterocyclic compounds.] | 292-607-4 | 90640-86-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-045-00-0 | Distillates (coal tar), upper;Heavy Anthracene Oil;[The distillate from coal tar having an approximate distillation range of 220 oC to 450 oC (428oF to 842oF). Composed primarily of three to four membered condensed ring aromatic hydrocarbons and other hydrocarbons.] | 266-026-1 | 65996-91-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-046-00-6 | Anthracene oil, acid ext.;Anthracene Oil Extract Residue;[A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 oC to 365 oC (617oF to 689oF). It contains predominantly anthracene and phenanthrene and their alkyl derivatives.] | 295-274-3 | 91995-14-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-047-00-1 | Distillates (coal tar);Heavy Anthracene Oil;[The distillate from coal tar having an approximate distillation range of 100 oC to 450 oC (212oF to 842oF). Composed primarily of two to four membered condensed ring aromatic hydrocarbons, phenolic compounds, and aromatic nitrogen bases.] | 266-027-7 | 65996-92-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-048-00-7 | Distillates (coal tar), pitch, heavy oils;Heavy Anthracene Oil;[The distillate from the distillation of the pitch obtained from bituminous high temperature tar. Composed primarily of tri- and polynuclear aromatic hydrocarbons and boiling in the range of approximately 300 oC to 470 oC (572oF to 878oF). The product may also contain heteroatoms.] | 295-312-9 | 91995-51-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-049-00-2 | Distillates (coal tar), pitch;Heavy Anthracene Oil;[The oil obtained from condensation of the vapors from the heat treatment of pitch. Composed primarily of two- to four-ring aromatic compounds boiling in the range of 200 oC to greater than 400 oC (392oF to greater than 752oF).] | 309-855-7 | 101316-49-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-050-00-8 | Distillates (coal tar), heavy oils, pyrene fraction;Heavy Anthracene Oil Redistillate;[The redistillate obtained from the fractional distillation of pitch distillate boiling in the range of approximately 350 oC to 400 oC (662oF to 752oF). Consists predominantly of tri- and polynuclear aromatics and heterocyclic hydrocarbons.] | 295-304-5 | 91995-42-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-051-00-3 | Distillates (coal tar), pitch, pyrene fraction;Heavy Anthracene Oil Redistillate;[The redistillate obtained from the fractional distillation of pitch distillate and boiling in the range of approximately 380 oC to 410 oC (7160 to 770oF). Composed primarily of tri- and polynuclear aromatic hydrocarbons and heterocyclic compounds.] | 295-313-4 | 91995-52-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-052-00-9 | Paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated;Coal Tar Extract;[A complet combination of hydrocarbons obtained by the treatment of lignite carbonization tar with activated carbon for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-296-6 | 97926-76-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-053-00-4 | Paraffin waxes (coal), brown-coal high-temp tar, clay-treated;Coal Tar Extract;[A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with bentonite for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-297-1 | 97926-77-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-054-00-X | Pitch;Pitch | 263-072-4 | 61789-60-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-055-00-5 | Pitch, coal tar, high-temp.;Pitch;[The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 oC to 180 oC (86oF to 356oF). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | 266-028-2 | 65996-93-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-056-00-0 | Pitch, coal tar, high-temp., heat-treated;Pitch;[The heat treated residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 80 oC to 180 oC (176oF to 356oF). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | 310-162-7 | 121575-60-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-057-00-6 | Pitch, coal tar, high-temp., secondary;Pitch Redistillate;[The residue obtained during the distillation of high boiling fractions from bituminous coal high temperature tar and/or pitch coke oil, with a softening point of 140 oC to 170 oC (284oF to 392oF) according to DIN 52025. Composed primarily of tri- and polynuclear aromatic compounds which also contain heteroatoms.] | 302-650-3 | 94114-13-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-058-00-1 | Residues (coal tar), pitch distn.;Pitch Redistillate;[Residue from the fractional distillation of pitch distillate boiling in the range of approximately 400 oC to 470 oC (752oF to 846oF). Composed primarily of polynuclear aromatic hydrocarbons, and heterocyclic compounds.] | 295-507-9 | 92061-94-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-059-00-7 | Tar, coal, high-temp., distn. and storage residues;Coal Tar Solids Residue;[Coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage vessels. Consists predominantly of carbon and contains a small quantity of hetero compounds as well as ash components.] | 295-535-1 | 92062-20-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-060-00-2 | Tar, coal, storage residues;Coal Tar Solids Residue;[The deposit removed from crude coal tar storages. Composed primarily of coal tar and carbonaceous particulate matter.] | 293-764-1 | 91082-50-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-061-00-8 | Tar, coal, high-temp., residues;Coal Tar Solids Residue;[Solids formed during the coking of bituminous coal to produce crude bituminous coal high temperature tar. Composed primarily of coke and coal particles, highly aromatized compounds and mineral substances.] | 309-726-5 | 100684-51-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-062-00-3 | Tar, coal, high-temp., high-solids;Coal Tar Solids Residue;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons with a high solid content of coal-type materials.] | 273-615-7 | 68990-61-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-063-00-9 | Waste solids, coal-tar pitch coking;Coal Tar Solids Residue;[The combination of wastes formed by the coking of bituminous coal tar pitch. It consists predominantly of carbon.] | 295-549-8 | 92062-34-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-064-00-4 | Extract residues (coal), brown;Coal Tar Extract;[The residue from extraction of dried coal.] | 294-285-0 | 91697-23-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-065-00-X | Paraffin waxes (coal), brown-coal-high-temp. tar;Coal Tar Extract;[A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | 295-454-1 | 92045-71-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-066-00-5 | Paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated;Coal Tar Extract;[A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process treated with hydrogen in the presence of a catalyst. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | 295-455-7 | 92045-72-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-067-00-0 | Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated;Coal Tar Extract;[A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with silicic acid for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-298-7 | 97926-78-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-068-00-6 | Tar, coal, low-temp., distn. residues;Tar Oil, intermediate boiling;[Residues from fractional distillation of low temperature coal tar to remove oils that boil in a range up to approximately 300 oC (572oF). Composed primarily of aromatic compounds.] | 309-887-1 | 101316-85-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-069-00-1 | Pitch, coal tar, low-temp;Pitch Residue;[A complex black solid or semi-solid obtained from the distillation of a low temperature coal tar. It has a softening point within the approximate range of 40 oC to 180 oC (104oF to 356oF). Composed primarily of a complex mixture of hydrocarbons.] | 292-651-4 | 90669-57-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-070-00-7 | Pitch, coal tar, low-temp., oxidized;Pitch Residue, oxidised;[The product obtained by air-blowing, at elevated temperature, low-temperature coal tar pitch. It has a softening-point within the approximate range of 70 oC to 180 oC (158oF to 356oF). Composed primarily of a complex mixture of hydrocarbons.] | 292-654-0 | 90669-59-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-071-00-2 | Pitch, coal tar, low-temp., heat-treated;Pitch Residue, oxidised;Pitch Residue, heat-treated;[A complex black solid obtained by the heat treatment of low temperature coal tar pitch. It has a softening point within the approximate range of 50 oC to 140 oC (122oF to 284oF). Composed primarily of a complex mixture of aromatic compounds.] | 292-653-5 | 90669-58-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-072-00-8 | Distillates (coal-petroleum), condensed-ring arom;Distillates;[The distillate from a mixture of coal and tar and aromatic petroleum streams having an approximate distillation range of 220 oC to 450 oC (428oF to 842oF). Composed primarily of 3- to 4-membered condensed ring aromatic hydrocarbons.] | 269-159-3 | 68188-48-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-073-00-3 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived;Pyrolysis Products;[A complex combination hydrocarbons obtained from mixed coal tar pitch-polyethylene-polypropylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-956-6 | 101794-74-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-074-00-9 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived;Pyrolysis Products;[A complex combination of hydrocarbons obtained from mixed coal tar pitch-polyethylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-957-1 | 101794-75-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-075-00-4 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived;Pyrolysis Products;[A complex combination of hydrocarbons obtained from mixed coal tar pitch-polystyrene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 oC to 220 oC (212oF to 428oF) according to DIN 52025.] | 309-958-7 | 101794-76-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-076-00-X | Pitch, coal tar-petroleum;Pitch Residues;[The residue from the distillation of a mixture of coal tar and aromatic petroleum streams. A solid with a softening point from 40 oC to 180 oC (140oF to 356oF). Composed primarily of a complex combination of three or more membered condensed ring aromatic hydrocarbons.] | 269-109-0 | 68187-57-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-077-00-5 | Phenanthrene, distn. residues;Heavy Anthracene Oil Redistillate;[Residue from the distillation of crude phenanthrene boiling in the approximate range of 340 oC to 420 oC (644oF to 788oF). It consists predominantly of phenanthrene, anthracene and carbazole.] | 310-169-5 | 122070-78-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-078-00-0 | Distillates (coal tar), upper, fluorene-free;Wash Oil Redistillate;[A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists of aromatic polycyclic hydrocarbons, primarily diphenyl, dibenzofuran and acenaphthene.] | 284-899-7 | 84989-10-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-079-00-6 | Anthracene oil;Anthracene oil;[A complex combination of polycyclic aromatic hydrocarbons obtained from coal tar having an approximate distillation range of 300 oC ot 400 oC (572oF to 752oF). Composed primarily of phenanthrene, anthracene and carbazole.] | 292-602-7 | 90640-80-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-080-00-1 | Residues (coal tar), creosote oil distn.;Wash Oil Redistillate;[The residue from the fractional distillation of wash oil boiling in the approximate range of 270 oC to 330 oC (518oF to 626oF). It consists predominantly of dinuclear aromatic and heterocyclic hydrocarbons.] | 295-506-3 | 92061-93-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-081-00-7 | Tar, coal;Coal tar;[The by-product from the destructive distillation of coal. Almost black semisolid. A complex combination of aromatic hydro-carbons, phenolic compounds, nitrogen bases and thiophene.] | 232-361-7 | 8007-45-2 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 648-082-00-2 | Tar, coal, high-temp.;Coal tar;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons. May contain minor amounts of phenolic compounds and aromatic nitrogen bases.] | 266-024-0 | 65996-89-6 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 648-083-00-8 | Tar, coal, low-temp.;Coal oil;[The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in low temperature (less than 700 oC (1292oF)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of condensed ring aromatic hydrocarbons, phenolic compounds, aromatic nitrogen bases, and their alkyl derivatives.] | 266-025-6 | 65996-90-9 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 648-084-00-3 | Distillates (coal), coke-oven light oil, naphthalene cut;Naphthalene Oil;[The complex combination of hydrocarbons obtained from prefractionation (continuous distillation) of coke oven light oil. It consists predominantly of naphthalene, coumarone and indene and boils above 148 oC (298oF).] | 285-076-5 | 85029-51-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-085-00-9 | Distillates (coal tar), naphthalene oils;Naphthalene Oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills in the approximate range of 200 oC to 250 oC (392oF to 482oF).] | 283-484-8 | 84650-04-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-086-00-4 | Distillates (coal tar), naphthalene oils, naphthalene-low;Naphthalene Oil Redistillate;[A complex combination of hydrocarbons obtained by crystallization of naphthalene oil. Composed primarily of naphthalene, alkyl naphthalenes and phenolic compounds.] | 284-898-1 | 84989-09-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-087-00-X | Distillates (coal tar), naphthalene oil crystn. mother liquor;Naphthalene Oil Redistillate;[A complex combination of organic compounds obtained as a filtrate from the crystallization of the naphthalene fraction from coal tar and boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). Contains chiefly naphthalene, thionaphthene and alkylnaphthalenes.] | 295-310-8 | 91995-49-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-088-00-5 | Extract residues (coal), naphthalene oil, alk.;Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained from the alkali washing of naphthalene oil to remove phenolic compounds (tar acids). It is composed of naphthalene and alkyl naphthalenes.] | 310-166-9 | 121620-47-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-089-00-0 | Extract residues (coal), naphthalene oil, alk., naphthalene-low;Naphthalene Oil Extract Residue;[A complex combination of hydrocarbons remaining after the removal of naphthalene from alkali-washed naphthalene oil by a crystallization process. It is composed primarily of naphthalene and alkyl naphthalenes.] | 310-167-4 | 121620-48-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-090-00-6 | Distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.;Naphthalene Oil Extract Residue;[The oil remaining after the removal of phenolic compounds (tar acids) from drained naphthalene oil by an alkali wash. Composed primarily of naphthalene and alkyl naphthalenes.] | 292-612-1 | 90640-90-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-091-00-1 | Extract residues (coal), naphthalene oil alk., distn. overheads;Naphthalene Oil Extract Residue;[The distillation from alkali-washed naphthalene oil having an approximate distillation range of 180 oC to 220 oC (356oF to 428oF). Composed primarily of naphthalene, alkylbenzenes, indene and indan.] | 292-627-3 | 90641-04-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-092-00-7 | Distillates (coal tar), naphthalene oils, methylnaphthalene fraction;Methylnaphthalene Oil;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of substituted two ring aromatic hydrocarbons and aromatic nitrogen bases boiling in the range of approximately 225 oC to 255 oC (437oF to 491oF).] | 309-985-4 | 101896-27-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-093-00-2 | Distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction;Methylnaphthalene Oil;[A distillate from the fractional distillation of high temperature coal tar. Composed primarily of indole and methylnaphthalene boiling in the range of approximately 235 oC to 255 oC (455oF to 491oF).] | 309-972-3 | 101794-91-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-094-00-8 | Distillates (coal tar), naphthalene oils, acid exts.;Methylnaphthalene Oil Extract Residue;[A complex combination of hydrocarbons obtained by debasing the methylnaphthalene fraction obtained by the distillation of coal tar and boiling in the range of approximately 230 oC to 255 oC (446oF to 491oF). Contains chiefly 1(2)-methylnaphthalene, naphthalene, dimethylnaphthalene and biphenyl.] | 295-309-2 | 91995-48-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-095-00-3 | Extract residues (coal), naphthalene oil alk., distn. residues;Methylnaphthalene Oil Extract Residue;[The residue from the distillation of alkali-washed naphthalene oil having an approximate distillation range of 220 oC to 300 oC (428oF to 572oF). Composed primarily of naphthalene, alkylnaphthalenes and aromatic nitrogen bases.] | 292-628-9 | 90641-05-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-096-00-9 | Extract oils (coal), acidic, tar-base free;Methylnaphthalene Oil Extract Residue;[The extract oil boiling in the range of approximately 220 oC to 265 oC (428oF to 509oF) from coal tar alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove tar bases. Composed primarily of alkylnaphthalenes.] | 284-901-6 | 84989-12-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-097-00-4 | Distillates (coal tar), benzole fraction, distn. residues;Wash Oil;[A complex combination of hydrocarbons obtained from the distillation of crude benzole (high temperature coal tar). It may be a liquid with the approximate distillation range of 150 oC to 300 oC (302oF to 572oF) or a semi-solid or solid with a melting point up to 70 oC (158oF). It is composed primarily of naphthalene and alkyl naphthalenes.] | 310-165-3 | 121620-46-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-098-00-X | Creosote oil, acenaphthene fraction;Wash Oil;[A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240 oC to 280 oC (464oF to 536oF). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] | 292-605-3 | 90640-84-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-099-00-5 | Creosote oil;[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200 oC to 325 oC (392oF to 617oF).] | 263-047-8 | 61789-28-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-100-00-9 | Creosote oil, high-boiling distillate;Wash Oil;[The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5 oC (41oF).] | 274-565-9 | 70321-79-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-101-00-4 | Creosote;[The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] | 232-287-5 | 8001-58-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-102-00-X | Extract residues (coal), creosote oil acid;Wash Oil Extract Residue;[A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250 oC to 280 oC (482oF to 536oF). It consists predominantly of biphenyl and isomeric diphenylnaphthalenes.] | 310-189-4 | 122384-77-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-103-00-5 | Anthracene oil, anthracene paste;Anthracene Oil Fraction;[The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.] | 292-603-2 | 90640-81-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-104-00-0 | Anthracene oil, anthracene-low;Anthracene Oil Fraction;[The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered aromatic compounds.] | 292-604-8 | 90640-82-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-105-00-6 | Residues (coal tar), anthracene oil distn.;Anthracene Oil Fraction;[The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340 oC to 400 oC (644oF to 752oF). It consists predominantly of tri- and polynuclear aromatic and heterocyclic hydrocarbons.] | 295-505-8 | 92061-92-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-106-00-1 | Anthracene oil, anthracene paste, anthracene fraction;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling in the range of 330 oC to 350 oC (626oF to 662oF). It contains chiefly anthracene, carbazole and phenanthrene.] | 295-275-9 | 91995-15-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-107-00-7 | Anthracene oil, anthracene paste, carbazole fraction;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthrancene oil from bituminous coal high temperature tar and boiling in the approximate range of 350 oC to 360 oC (662oF to 680oF). It contains chiefly anthacene, carbazole and phenanthrene.] | 295-276-4 | 91995-16-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-108-00-2 | Anthracene oil, anthracene paste, distn. lights;Anthracene Oil Fraction;[A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous light temperature tar and boiling in the range of approximately 290 oC to 340 oC (554oF to 644oF). It contains chiefly trinuclear aromatics and their dihydro derivatives.] | 295-278-5 | 91995-17-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-109-00-8 | Tar oils, coal, low-temp.;Tar Oil, high boiling;[A distillate from low-temperature coal tar. Composed primarily of hydrocarbons, phenolic compounds and aromatic nitrogen bases boiling in the range of approximately 160 oC to 340 oC (320oF to 644oF).] | 309-889-2 | 101316-87-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-110-00-3 | Extract residues (coal), low temp. coal atar alk.;[The residue from low temperature coal tar oils after an alkaline wash, such as aqueous sodium hydroxide, to remove crude coal tar acids. Composed primarily of hydrocarbons and aromatic nitrogen bases.] | 310-191-5 | 122384-78-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-111-00-9 | Phenols, ammonia liquor ext.;Alkaline Extract;[The combination of phenols extracted, using isobutyl acetate, from the ammonia liquor condensed from the gas evolved in low-temperature (less than 700 oC (1292oF)) destructive distillation of coal. It consists predominantly of a mixture of monohydric and dihydric phenols.] | 284-881-9 | 84988-93-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-112-00-4 | Distillates (coal tar), light oils, alk. exts.;Alkaline Extract;[The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | 292-610-0 | 90640-88-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-113-00-X | Extracts, coal tar oil alk.;Alkaline Extract;[The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | 266-017-2 | 65996-83-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-114-00-5 | Distillates (coal tar), naphthalene oils, alk. exts.;Alkaline Extract;[The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxid. Composed primarily of the alkali salts of various phenolic compounds.] | 292-611-6 | 90640-89-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-115-00-0 | Extract residues (coal), tar oil alk., carbonated, limed;Crude Phenols;[The product obtained by treatment of coal tar oil alkaline extract with CO2 and CaO. Composed primarily of CaCO3, Ca(OH)2, Na2CO3 and other organic and inorganic impurities.] | 292-629-4 | 90641-06-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-116-00-6 | Tar acids, coal, crude;Crude Phenols;[The reaction product obtained by neutralizing coal tar oil alkaline extract with an acidic solution, such as aqueous sulfuric acid, or gaseous carbon dioxide, to obtain the free acids. Composed primarily of tar acids such as phenol, cresols, and xylenols.] | 266-019-3 | 65996-85-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-117-00-1 | Tar acids, brown-coal, crude;Crude Phenols;[An acidified alkaline extract of brown coal tar distillate. Composed primarily of phenol and phenol homologs.] | 309-888-7 | 101316-86-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-118-00-7 | Tar acids, brown-coal gasification;Crude Phenols;[A complex combination of organic compounds obtained from brown coal gasification. Composed primarily of C6-10 hydroxy aromatic phenols and their homologs.] | 295-536-7 | 92062-22-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-119-00-2 | Tar acids, distn. residues;Distillate Phenols;[A residue from the distillation of crude phenol from coal. It consists predominantly of phenols having carbon numbers in the range of C8 through C10 with a softening point of 60 oC to 80 oC (140oF to 176oF).] | 306-251-5 | 96690-55-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-120-00-8 | Tar acids, methylphenol fraction;Distillate Phenols;[The fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-892-9 | 84989-04-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-121-00-3 | Tar acids, polyalkylphenol fraction;Distillate Phenols;[The fraction of tar aicds, recovered by distillation of low-temperature coal tar crude tar acids, having an approximate boiling range of 225 oC to 320 oC (437oF to 608oF). Composed primarily of polyalkylphenols.] | 284-893-4 | 84989-05-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-122-00-9 | Tar acids, xylenol fraction;Distillate Phenols; [The fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-895-5 | 84989-06-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-123-00-4 | Tar acids, ethylphenol fraction;Distillate Phenols;[The fraction of tar acids, rich in 3- and 4-ethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | 284-891-3 | 84989-03-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-124-00-X | Tar acids, 3,5-xylenol fraction;Distillate Phenols;[The fraction of tar acids, rich in 3,5-dimethylphenol, recovered by distillation of low-temperature coal tar acids.] | 284-896-0 | 84989-07-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-125-00-5 | Tar acids, residues, distillates, first-cut;Distillate Phenols;[The residue from the distillation in the range of 235 oC to 355 oC (481oF to 697oF) of light carbolic oil.] | 270-713-1 | 68477-23-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-126-00-0 | Tar acids, cresylic, residues;Distillate Phenols;[The residue from crude coal tar acids after removal of phenol, cresols, xylenols and any higher boiling phenols. A black solid with a melting point approximately 80 oC (176oF). Composed primarily of polyalkyphenols, resin gums, and inorganic salts.] | 271-418-0 | 68555-24-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-127-00-6 | Phenols, C9-11;Distillate Phenols | 293-435-2 | 91079-47-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-128-00-1 | Tar acids, cresylic;Distillate Phenols;[A complex combination of organic compounds obtained from brown coal and boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). It contains chiefly phenols and pyridine bases.] | 295-540-9 | 92062-26-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-129-00-7 | Tar acids, brown-coal, C2-alkylphenol fraction;Distillate Phenols;[The distillate from the acidification of alkaline washed lignite tar distillate boiling in the range of approximately 200 oC to 230 oC (392oF to 446oF). Composed primarily of <{ITA}>m-<{/ITA}> and <{ITA}>p-<{/ITA}>ethylphenol as well as cresols and xylenols.] | 302-662-9 | 94114-29-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-130-00-2 | Extract oils (coal), naphthalene oils;Acid Extract;[The aqueous extract produced by an acidic wash of alkali-washed napthalene oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | 292-623-1 | 90641-00-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-131-00-8 | Tar bases, quinoline derivs.;Distillate Bases | 271-020-7 | 68513-87-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-132-00-3 | Tar bases, coal, quinoline derivs. fraction;Distillate Bases | 274-560-1 | 70321-67-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-133-00-9 | Tar bases, coal, distn. residues;Distillate Bases;[The distillation residue remaining after the distillation of the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of coal tars. It contains chiefly aniline, collidines, quinoline and quinoline derivatives and toluidines.] | 295-544-0 | 92062-29-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-134-00-4 | Hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of a polyethylene/polypropylene mixture with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70 oC to 120 oC (158oF to 248oF).] | 309-745-9 | 100801-63-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-135-00-X | Hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of polyethylene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of 70 oC to 120 oC (158oF to 248oF).] | 309-748-5 | 100801-65-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-136-00-5 | Hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction;Heat Treatment Products;[The oil obtained from the heat treatment of polystyrene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70 oC to 210 oC (158oF to 410oF).] | 309-749-0 | 100801-66-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-137-00-0 | Extract residues (coal), tar oil alk., naphthalene distn. residues;Naphthalene Oil Extract Residue;[The residue obtained from chemical oil extracted after the removal of naphthalene by distillation composed primarily of two to four membered condensed ring aromatic hydrocarbons and aromatic nitrogen bases.] | 277-567-8 | 73665-18-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-138-00-6 | Creosote oil, low-boiling distillate;Wash Oil;[The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38 oC (100oF).] | 274-566-4 | 70321-80-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-139-00-1 | Tar acids, cresylic, sodium salts, caustic solns.;Alkaline Extract | 272-361-4 | 68815-21-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-140-00-7 | Extract oils (coal), tar base;Acid Extract;[The extract from coal tar oil alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillatin to remove naphthalene. Composed primarily of the acid salts of various aromatic nitrogen bases including pyridine, quinoline, and their alkyl derivatives.] | 266-020-9 | 65996-86-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-141-00-2 | Tar bases, coal, crude;Crude Tar Bases;[The reaction product obtained by neutralizing coal tar base extract oil with an alkaline solution, such as aqueous sodium hydroxide, to obtain the free bases. Composed primarily of such organic bases as acridine, phenanthridine, pyridine, quinoline and their alkyl derivatives.] | 266-018-8 | 65996-84-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | HJM |
| 648-142-00-8 | Residues (coal), liq. solvent extn.;[A cohesive powder composed of coal mineral matter and undissolved coal remaining after extraction of coal by a liquid solvent.] | 302-681-2 | 94114-46-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-143-00-3 | Coal liquids, liq. solvent extn. soln.;[The product obtained by filtration of coal mineral matter and undissolved coal from coal extract solution produced by digesting coal in a liquid solvent. A black, viscous, highly complex liquid combination composed primarily of aromatic and partly hydro-genated aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic and other aromatic oxygen compounds and their alkyl derivatives.] | 302-682-8 | 94114-47-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-144-00-9 | Coal liquids, liq. solvent extn.;[The substantially solvent-free product obtained by the distillation of the solvent from filtered coal extract solution produced by digesting coal in a liquid solvent. A black semi-solid, composed primarily of a complex combination of condensed-ring aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic compounds and other aromatic oxygen compounds, and their alkyl derivatives.] | 302-683-3 | 94114-48-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H M |
| 648-145-00-4 | Tar brown-coal;[An oil distilled from brown-coal tar. Composed primarily of aliphatic, naphthenic and one- to three-ring aromatic hydrocarbons, their alkyl derivates, heteroaromatics and one- and two-ring phenols boiling in the range of approximately 150 oC to 360 oC (302oF to 680oF).] | 309-885-0 | 101316-83-0 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 648-146-00-X | Tar, brown-coal, low-temp.;[A tar obtained from low temperature carbonization and low temperature gasification of brown coal. Composed primarily of aliphatic, naphthenic and cyclic aromatic hydrocarbons, heteroaromatic hydrocarbons and cyclic phenols.] | 309-886-6 | 101316-84-1 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 648-147-00-5 | Light oil (coal), coke-oven;Crude benzole;[The volatile organic liquid extracted from the gas evolved in the high temperature (greater than 700 oC (1292oF)) destructive distillation of coal. Composed primarily of benzene, toluene, and xylenes. May contain other minor hydrocarbon constituents.] | 266-012-5 | 65996-78-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-148-00-0 | Distillates (coal), liq. solvent extn., primary;[The liquid product of condensation of vapors emitted during the digestion of coal in a liquid solvent and boiling in the range of approximately 30 oC to 300 oC (86oF to 572oF). Composed primarily of partly hydrogenated condensed-ring aromatic hydrocarbons, aromatic compounds containing nitrogen, oxygen and sulfur, and their alkyl derivatives having carbon numbers predominantly in the range of C4 through C14.] | 302-688-0 | 94114-52-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-149-00-6 | Distillates (coal), solvent extn., hydrocracked;[Distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction process and boiling in the range of approximately 30 oC to 300 oC (86oF to 572oF). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 through C14. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | 302-689-6 | 94114-53-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-150-00-1 | Naphtha (coal), solvent extn., hydrocracked;[Fraction of the distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30 oC to 180 oC (86oF to 356oF). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 to C9. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | 302-690-1 | 94114-54-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-151-00-7 | Gasoline, coal solvent extn., hydrocracked naphtha;[Motor fuel produced by the reforming of the refined naphtha fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30 oC to 180 oC (86oF to 356oF). Composed primarily of aromatic and naphthenic hydrocarbons, their alkyl derivatives and alkyl hydrocarbons having carbon numbers in the range of C4 through C9.] | 302-691-7 | 94114-55-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 648-152-00-2 | Distillates (coal), solvent extn., hydrocracked middle;[Distillate obtained from the hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 300 oC (356oF to 572oF). Composed primarily of two-ring aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes having carbon numbers predominantly in the range of C9 through C14. Nitrogen, sulfur and oxygen-containing compounds are also present.] | 302-692-2 | 94114-56-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-153-00-8 | Distillates (coal), solvent extn., hydrocracked hydrogenated middle;[Distillate from the hydrogenation of hydrocracked middle distillate from coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 280 oC (356oF to 536oF). Composed primarily of hydrogenated two- ring carbon compounds and their alkyl derivatives having carbon numbers predominantly in the range of C9 through C14.] | 302-693-8 | 94114-57-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 648-154-00-3 | Fuels, jet aircraft, coal solvent extn., hydrocracked hydrogenated;[Jet engine fuel produced by hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 oC to 225 oC (356oF to 473oF). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C10 through C12.] | 302-694-3 | 94114-58-6 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 648-155-00-9 | Fuels, diesel, coal solvent extn., hydrocracked hydrogenated;[Diesel engine fuel produced by the hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 200 oC to 280 oC (392oF to 536oF). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C11 through C14.] | 302-695-9 | 94114-59-7 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 648-156-00-4 | Light oil (coal), semi-coking process;Fresh oil;[The volatile organic liquid condensed from the gas evolved in the low temperature (less than 700 oC (1292oF) destructive distillation of coal. Composed primarily of C6-10 hydrocarbons.] | 292-635-7 | 90641-11-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H J |
| 649-001-00-3 | Extracts (petroleum), light naphthenic distillate solvent | 265-102-1 | 64742-03-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-002-00-9 | Extracts (petroleum), heavy paraffinic distillate solvent | 265-103-7 | 64742-04-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-003-00-4 | Extracts (petroleum), light paraffinic distillate solvent | 265-104-2 | 64742-05-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-004-00-X | Extracts (petroleum), heavy naphthenic distillate solvent | 265-111-0 | 64742-11-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-005-00-5 | Extracts (petroleum), light vacuum gas oil solvent | 295-341-7 | 91995-78-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-006-00-0 | hydrocarbons C26-55, arom-rich | 307-753-7 | 97722-04-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-007-00-6 | fatty acids, tall-oil, reaction products with iminodiethanol and boric acid | 400-160-5 | — | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)28-37-61 |
| 649-008-00-1 | Residues (petroleum), atm. tower;Heavy Fuel oil;[A complex residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-045-2 | 64741-45-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-009-00-7 | Gas oils (petroleum), heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 oC to 600 oC (662oF to 1112oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 265-058-3 | 64741-57-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-010-00-2 | Distillates (petroleum), heavy catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 oC to 500 oC (500oF to 932oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-063-0 | 64741-61-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-011-00-8 | Clarified oils (petroleum), catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-064-6 | 64741-62-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-012-00-3 | Residues (petroleum), hydrocracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the products of a hydrocracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF).] | 265-076-1 | 64741-75-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-013-00-9 | Residues (petroleum), thermal cracked;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-081-9 | 64741-80-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-014-00-4 | Distillates (petroleum), heavy thermal cracked;Heavy Fuel oil;[A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C15 through C36 and boiling in the range of approximately 260 oC to 480 oC (500oF to 896oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-082-4 | 64741-81-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-015-00-X | Gas oils (petroleum), hydrotreated vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C50 and boiling in the range of approximately 230 oC to 600 oC (446oF to 1112oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-162-9 | 64742-59-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-016-00-5 | Residues (petroleum), hydrodesulfurized atmospheric tower;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating an atmospheric tower residuum with hydrogen in the presence of a catalyst under conditions primarily to remove organic sulfur compounds. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-181-2 | 64742-78-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-017-00-0 | Gas oils (petroleum), hydrodesulfurized heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 oC to 600 oC (662oF to 1112 oC). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-189-6 | 64742-86-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-018-00-6 | Residues (petroleum), steam-cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained as the residual fraction from the distillation of the products of a steam cracking process (including steam cracking to produce ethylene). It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C14 and boiling above approximately 260 oC (500oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 265-193-8 | 64742-90-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-019-00-1 | Residues (petroleum), atmospheric;Heavy Fuel oil;[A complex residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 oC (392oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 269-777-3 | 68333-22-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-020-00-7 | Clarified oils (petroleum), hydrodesulfurized catalytic cracked;Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating catalytic cracked clarified oil with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | 269-782-0 | 68333-26-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-021-00-2 | Distillates (petroleum), hydrodesulfurized intermediate catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating intermediate catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 oC to 450 oC (401oF to 842oF). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | 269-783-6 | 68333-27-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-022-00-8 | Distillates (petroleum), hydrodesulfurized heavy catalytic cracked;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treatment of heavy catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 oC to 500 oC (500oF to 932oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 269-784-1 | 68333-28-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-023-00-3 | Fuel oil, residues-straight-run gas oils, high-sulfur;Heavy Fuel oil | 270-674-0 | 68476-32-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-024-00-9 | Fuel oil, residual;Heavy Fuel oil;[The liquid product from various refinery streams, usually residues. The composition is complex and varies with the source of the crude oil.] | 270-675-6 | 68476-33-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-025-00-4 | Residues (petroleum), catalytic reformer fractionator residue distn.;Heavy Fuel oil;[A complex residuum from the distillation of catalytic reformer fractionator residue. It boils approximately above 399 oC (750oF).] | 270-792-2 | 68478-13-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-026-00-X | Residues (petroleum), heavy coker gas oil and vacuum gas oil;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and vacuum gas oil. It predominantly consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-796-4 | 68478-17-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-027-00-5 | Residues (petroleum), heavy coker and light vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and light vacuum gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-983-0 | 68512-61-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-028-00-0 | Residues (petroleum), light vacuum;Heavy Fuel oil;[A complex residuum from the vacuum distillation of the residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 oC (446oF).] | 270-984-6 | 68512-62-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-029-00-6 | Residues (petroleum), steam-cracked light;Heavy Fuel oil;[A complex residuum from the distillation of the products from a steam-cracking process. It consists predominantly of aromatic and unsaturated hydrocarbons having carbon numbers greater than C7 and boiling in the range of approximately 101 oC to 555 oC (214oF to 1030oF).] | 271-013-9 | 68513-69-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-030-00-1 | Fuel oil, No 6;Heavy Fuel oil;[A distillate oil having a minimum viscosity of 900 SUS at 37.7 oC (100oF) to a maximum of 9000 SUS at 37.7 oC (100oF).] | 271-384-7 | 68553-00-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-031-00-7 | Residues (petroleum), topping plant, low-sulfur;Heavy Fuel oil;[A low-sulfur complex combination of hydrocarbons produced as the residual fraction from the topping plant distillation of crude oil. It is the residuum after the straight-run gasoline cut, kerosene cut and gas oil cut have been removed.] | 271-763-7 | 68607-30-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-032-00-2 | Gas oils (petroleum), heavy atmospheric;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C35 and boiling in the range of approximately 121 oC to 510 oC (250oF to 950oF).] | 272-184-2 | 68783-08-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-033-00-8 | Residues (petroleum), coker scrubber, Condensed-ring-arom.-contg.;Heavy Fuel oil;[A very complex combination of hydrocarbons produced as the residual fraction from the distillation of vaccum residuum and the products from a thermal cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 oC (662oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed rind aromatic hydrocarbons.] | 272-187-9 | 68783-13-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-034-00-3 | Distillates (petroleum), petroleum residues vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from the atmospheric distillation of crude oil.] | 273-263-4 | 68955-27-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-035-00-9 | Residues (petroleum), steam-cracked, resinous;Heavy Fuel oil;[A complex residuum from the distillation of steam-cracked petroleum residues.] | 273-272-3 | 68955-36-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-036-00-4 | Distillates (petroleum), intermediate vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum, distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C14 through C42 and boiling in the range of approximately 250 oC to 545 oC (482oF to 1013oF). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 274-683-0 | 70592-76-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-037-00-X | Distillates (petroleum), light vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C35 and boiling in the range of approximately 250 oC to 545 oC (482oF to 1013oF).] | 274-684-6 | 70592-77-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-038-00-5 | Distillates (petroleum), vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having numbers predominantly in the range of C15 through C50 and boiling in the range of approximately 270 oC to 600 oC (518oF to 1112oF). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 274-685-1 | 70592-78-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-039-00-0 | Gas oils (petroleum), hydrodesulfurized coker heavy vacuum;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by hydrodesulfurization of heavy coker distillate stocks, It consists predominantly of hydrocarbons having carbon numbers predominantly in the range C18 to C44 and boiling in the range of approximately 304 oC to 548 oC (579oF to 1018oF). Likely to contain 5 % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 285-555-9 | 85117-03-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-040-00-6 | Residues (petroleum), steam-cracked, distillates;Heavy Fuel oil;[A complex combination of hydrocarbons obtained during the production of refined petroleum tar by the distillation of steam cracked tar. It consists predominantly of aromatic and other hydrocarbons and organic sulfur compounds.] | 292-657-7 | 90669-75-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-041-00-1 | Residues (petroleum), vacuum, light;Heavy Fuel oil;[A complex residuum from the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C24 and boiling above approximately 390 oC (734oF).] | 292-658-2 | 90669-76-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-042-00-7 | Fuel oil, heavy, high-sulfur;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the distillation of crude petroleum. It consists predominantly of aliphatic, aromatic and cycloaliphatic hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 295-396-7 | 92045-14-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-043-00-2 | Residues (petroleum), catalytic cracking;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 oC (392oF).] | 295-511-0 | 92061-97-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-044-00-8 | Distillates (petroleum), intermediate catalytic cracked, thermally degraded;Heavy Fuel oil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 220 oC to 450 oC (428oF to 842oF). This stream is likely to contain organic sulfur compounds.] | 295-990-6 | 92201-59-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-045-00-3 | Residual oils (petroleum);Heavy Fuel oil;[A complex combination of hydrocarbons, sulfur compounds and metal-containing organic compounds obtained as the residue from refinery fractionation cracking processes. It produces a finished oil with a viscosity above 2cSt. at 100 oC.] | 298-754-0 | 93821-66-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-046-00-9 | Residues, steam cracked, thermally treated;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by the treatment and distillation of raw steam-cracked naphtha. It consists predominantly of unsaturated hydrocarbons boiling in the range above approximately 180 oC (356oF).] | 308-733-0 | 98219-64-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-047-00-4 | Distillates (petroleum), hydrodesulfurized full-range middle;Heavy Fuel oil;[A complex combination of hydrocarbons obtained by treating a petroleum stock with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF).] | 309-863-0 | 101316-57-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-048-00-X | Residues (petroleum), catalytic reformer fractionator;Heavy Fuel oil;[A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C25 and boiling in the range of approximately 160 oC to 400 oC (320oF to 725oF). This stream is likely to contain 5 wt. % or more of 4- or 6-membered condensed ring aromatic hydrocarbons.] | 265-069-3 | 64741-67-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-049-00-5 | Petroleum;Crude oil;[A complex combination of hydrocarbons, It consists predominantly of aliphatic, alicyclic and aromatic hydrocarbons. It may also contain small amounts of nitrogen, oxygen and sulfur compounds. This category encompasses light, medium, and heavy petroleums, as well as the oils extended from tar sands. Hydrocarbonaceous materials requiring major chemical changes for their recovery or conversion to petroleum refinery feedstocks such as crude shale oils; upgraded shale oils and liquid coal fuels are not included in this definition.] | 232-298-5 | 8002-05-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-050-00-0 | Distillates (petroleum), light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated aliphatic hydrocarbons normally present in this distillation range of crude oil.] | 265-051-5 | 64741-50-0 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-051-00-6 | Distillates (petroleum), heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated aliphatic hydrocarbons.] | 265-052-0 | 64741-51-1 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-052-00-1 | Distillates (petroleum), light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-053-6 | 64741-52-2 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-053-00-7 | Distillates (petroleum), heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-054-1 | 64741-53-3 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-054-00-2 | Distillates (petroleum), acid-treated heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-117-3 | 64742-18-3 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-055-00-8 | Distillates (petroleum), acid-treated light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-118-9 | 64742-19-4 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-056-00-3 | Distillates (petroleum), acid-treated heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of a least 100 SUS at 100oF (19cSt at 40 oC).] | 265-119-4 | 64742-20-7 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-057-00-9 | Distillates (petroleum), acid-treated light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-121-5 | 64742-21-8 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-058-00-4 | Distillates (petroleum), chemically neutralized heavy paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons obtained from a treating process to remove acidic materials. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of aliphatic hydrocarbons.] | 265-127-8 | 64742-27-4 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-059-00-X | Distillates (petroleum), chemically neutralized light paraffinic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-128-3 | 64742-28-5 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-060-00-5 | Distillates (petroleum), chemically neutralized heavy naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-135-1 | 64742-34-3 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-061-00-0 | Distillates (petroleum), chemically neutralized light naphthenic;Unrefined or mildly refined baseoil;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS a 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-136-7 | 64742-35-4 | Carc. Cat. 1; R45 | TR: 45S: 53-45 | H |
| 649-062-00-6 | Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consists of hydrocarbons having carbon numbers in the range of C2 through C4, predominantly C3.] | 270-755-0 | 68477-73-6 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-063-00-1 | Gases (petroleum), catalytic cracker;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-756-6 | 68477-74-7 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-064-00-7 | Gases (petroleum), catalytic cracker, C1-5-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C5.] | 270-757-1 | 68477-75-8 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-065-00-2 | Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons having carbon numbers in the range of C2 through C6, predominantly C2 through C4.] | 270-758-7 | 68477-76-9 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-066-00-8 | Gases (petroleum), catalytic reformer, C1-4-rich;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C4.] | 270-760-8 | 68477-79-2 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-067-00-3 | Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed;Petroleum gas;[A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normally exceed the critical temperature of these combinations.] | 270-765-5 | 68477-83-8 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-068-00-9 | Gases (petroleum), C4-rich;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | 270-767-6 | 68477-85-0 | ⊗⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-069-00-4 | Gases (petroleum), deethanizer overheads;Petroleum gas;[A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] | 270-768-1 | 68477-86-1 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-070-00-X | Gases (petroleum), deisobutanizer tower overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 270-769-7 | 68477-87-2 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-071-00-5 | Gases (petroleum), depropanizer dry, propene-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene with some ethane and propane.] | 270-772-3 | 68477-90-7 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-072-00-0 | Gases (petroleum), depropanizer overheads;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 270-773-9 | 68477-91-8 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-073-00-6 | Gases (petroleum), gas recovery plant depropanizer overheads;Petroleum gas;[A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4, predominantly propane.] | 270-777-0 | 68477-94-1 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-074-00-1 | Gases (petroleum), Girbatol unit feed;Petroleum gas;[A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 270-778-6 | 68477-95-2 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-075-00-7 | Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free;Petroleum gas | 270-782-8 | 68477-99-6 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-076-00-2 | Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked vacuum residue. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-802-5 | 68478-21-7 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-077-00-8 | Tail gas (petroleum), catalytic cracked naphtha stabilization absorber;Petroleum gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-803-0 | 68478-22-8 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-078-00-3 | Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and hydrodesulfurizing processes treated to remove acidic impurities. It consists predominantly of hydrocarbons having cabon numbers predominantly in the range of C1 through C5.] | 270-804-6 | 68478-24-0 | ⊗ Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-079-00-9 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 270-806-7 | 68478-26-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-080-00-4 | Tail gas (petroleum), saturate gas plant mixed stream, C4-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer tail gas. It consists of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly butane and isobutane.] | 270-813-5 | 68478-32-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-081-00-X | Tail gas (petroleum), saturate gas recovery plant, C1-2-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists predominantly of hydrocarbons having carbon numbers in the range of C1through C5, predominantly methane and ethane.] | 270-814-0 | 68478-33-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-082-00-5 | Tail gas (petroleum), vacuum residues thermal cracker;Petroleum gas;[A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-815-6 | 68478-34-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-083-00-0 | Hydrocarbons, C3-4-rich, petroleum distillate;Petroleum gas;[A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C3 through C4.] | 270-990-9 | 68512-91-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-084-00-6 | Gases (petroleum), full-range straight-run naphtha dehexanizer off;petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-000-8 | 68513-15-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-085-00-1 | Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich;Petroleum gas;[A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4. It may also contain small amounts of hydrogen and hydrogen sulfide.] | 271-001-3 | 68513-16-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-086-00-7 | Gases (petroleum), light straight-run naphtha stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-002-9 | 68513-17-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-087-00-2 | Residues (petroleum), alkylation splitter, C4-rich;Petroleum gas;[A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane and boiling in the range of approximately - 11.7 oC to 27.8 oC (11oF to 82oF).] | 271-010-2 | 68513-66-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-088-00-8 | Hydrocarbons, C1-4;Petroleum gas;[A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately minus 164 oC to minus 0.5 oC (-263oF to 31oF).] | 271-032-2 | 68514-31-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-089-00-3 | Hydrocarbons, C1-4, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately - 164 oC to - 0.5 oC (-263oF to 31oF).] | 271-038-5 | 68514-36-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-090-00-9 | Hydrocarbons, C1-3;Petroleum gas;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164 oC to minus 42 oC (-263oF to - 44oF).] | 271-259-7 | 68527-16-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-091-00-4 | Hydrocarbons, C1-4, debutanizer fraction;Petroleum gas | 271-261-8 | 68527-19-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-092-00-X | Gases (petroleum), C1-5, wet;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 271-624-0 | 68602-83-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-093-00-5 | Hydrocarbons, C2-4;Petroleum gas | 271-734-9 | 68606-25-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-094-00-0 | Hydrocarbons, C3;Petroleum gas | 271-735-4 | 68606-26-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-095-00-6 | Gases (petroleum), alkylation feed;Petroleum gas;[A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 271-737-5 | 68606-27-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-096-00-1 | Gases (petroleum), depropanizer bottoms fractionation off;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] | 271-742-2 | 68606-34-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-097-00-7 | Gases (petroleum), refinery blend;Petroleum gas;[A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-183-7 | 68783-07-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-098-00-2 | Gases (petroleum), catalytic cracking;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | 272-203-4 | 68783-64-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-099-00-8 | Gases (petroleum), C2-4, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C2 through C4 and boiling in the range of approximately - 51 oC to - 34 oC (-60oF to - 30oF).] | 272-205-5 | 68783-65-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-100-00-1 | Gases (petroleum), crude oil fractionation off;Petroleum gas;[A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-871-7 | 68918-99-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-101-00-7 | Gases (petroleum), dehexanizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-872-2 | 68919-00-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-102-00-2 | Gases (petroleum), light straight run gasoline fractionation stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-878-5 | 68919-05-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-103-00-8 | Gases (petroleum), naphtha unifiner desulfurization stripper off;Petroleum gas;[A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-879-0 | 68919-06-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-104-00-3 | Gases (petroleum), straight-run naphtha catalytic reforming off;Petroleum gas;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, and propane.] | 272-882-7 | 68919-09-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-105-00-9 | Gases (petroleum), fluidized catalytic cracker splitter overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the fractionation of the charge to the C3 -C4 splitter. It consists predominantly of C3 hydrocarbons.] | 272-893-7 | 68919-20-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-106-00-4 | Gases (petroleum), straight-run stabilizer off;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-883-2 | 68919-10-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45S: 53-45 | H K |
| 649-107-00-X | Gases (petroleum), catalytic cracked naphtha debutanizer;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-169-3 | 68952-76-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-108-00-5 | Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-170-9 | 68952-77-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-109-00-0 | Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber;petroleum gas;[A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-175-6 | 68952-81-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-110-00-6 | Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-176-1 | 68952-82-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-111-00-1 | Gases (petroleum, light steam-cracked, butadiene conc.;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process, It consists of hydrocarbons having a carbon number predominantly of C4.] | 273-265-5 | 68955-28-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-112-00-7 | Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead;Petroleum gas;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 273-270-2 | 68955-34-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-113-00-2 | Hydrocarbons, C4;Petroleum gas | 289-339-5 | 87741-01-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-114-00-8 | Alkanes, C1-4, C3-rich;Petroleum gas | 292-456-4 | 90622-55-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-115-00-3 | Gases (petroleum), steam-cracker C3-rich;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of approximately - 70 oC to 0 oC (-94oF to 32oF).] | 295-404-9 | 92045-22-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-116-00-9 | Hydrocarbons, C4, steam-cracker distillate;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predominantly 1-butene and 2-butene, containing also butane and isobutene and boiling in the range of approximately minus 12 oC to 5 oC (10.4oF to 41oF).] | 295-405-4 | 92045-23-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-117-00-4 | Petroleum gases, liquefied, sweetened, C4 fraction;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists predominantly of C4 saturated and unsaturated hydrocarbons.] | 295-463-0 | 92045-80-2 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 53-45 | HKS |
| 649-118-00-X | Hydrocarbons, C4, 1,3-butadiene- and isobutene-free;Petroleum gas | 306-004-1 | 95465-89-7 | ⊗Carc. Cat. 2; R45 | TR: 45S: 53-45 | H K |
| 649-119-00-5 | Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free;Petroleum gas | 307-769-4 | 97722-19-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-120-00-0 | Gases (petroleum), amine system feed;Refinery gas;[The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 may also be present.] | 270-746-1 | 68477-65-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-121-00-6 | Gases (petroleum), benzene unit hydrodesulfurizer off;Refinery gas;[Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, including benzene, may also be present.] | 270-747-7 | 68477-66-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-122-00-1 | Gases (petroleum), benzene unit recycle, hydrogen-rich;Refinery gas;[A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydrocarbons having carbon numbers in the range of C1 through C6.] | 270-748-2 | 68477-67-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-123-00-7 | Gases (petroleum), blend oil, hydrogen-nitrogen-rich;Refinery gas;[A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide, and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-749-8 | 68477-68-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-124-00-2 | Gases (petroleum), catalytic reformed naphtha stripper overheads;Refinery gas;[A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 270-759-2 | 68477-77-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-125-00-8 | Gases (petroleum), C6-8 catalytic reformer recycle;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It may also contain various small amounts of carbon monoxide, carbon dioxide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-761-3 | 68477-80-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-126-00-3 | Gases (petroleum), C6-8 catalytic reformer;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 and hydrogen.] | 270-762-9 | 68477-81-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-127-00-9 | Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich;Refinery gas | 270-763-4 | 68477-82-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-128-00-4 | Gases (petroleum), C2-return stream;Refinery gas;[A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and ethylene. It contains predominantly hydrocarbons such as methane, ethane, and ethylene with small amounts of hydrogen, nitrogen and carbon monoxide.] | 270-766-0 | 68477-84-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-129-00-X | Gases (petroleum), dry sour, gas-concn.-unit-off;Refinery gas;[The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 270-774-4 | 68477-92-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-130-00-5 | Gases (petroleum), gas concn. reabsorber distn.;Refinery gas;[A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide and hydrocarbons having carbon numbers in the range of C1 through C3.] | 270-776-5 | 68477-93-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-131-00-0 | Gases (petroleum), hydrogen absorber off;Refinery gas;[A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] | 270-779-1 | 68477-96-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-132-00-6 | Gases (petroleum), hydrogen-rich;Refinery gas;[A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] | 270-780-7 | 68477-97-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-133-00-1 | Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich;Refinery gas;[A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-781-2 | 68477-98-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-134-00-7 | Gases (petroleum), recycle, hydrogen-rich;Refinery gas;[A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | 270-783-3 | 68478-00-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-135-00-2 | Gases (petroleum), reformer make-up, hydrogen-rich;Refinery gas;[A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-784-9 | 68478-01-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-136-00-8 | Gases (petroleum), reforming hydrotreater;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 thorugh C5.] | 270-785-4 | 68478-02-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-137-00-3 | Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon dioxide, nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] | 270-787-5 | 68478-03-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-138-00-9 | Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich;Refinery gas;[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-788-0 | 68478-04-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-139-00-4 | Gases (petroleum), thermal cracking distn.;Refinery gas;[A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-789-6 | 68478-05-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-140-00-X | Tail gas (petroleum), catalytic cracker refractionation absorber;Refinery gas;[A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 270-805-1 | 68478-25-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-141-00-5 | Tail gas (petroleum), catalytic reformed naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-807-2 | 68478-27-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-142-00-0 | Tail gas (petroleum), catalytic reformed naphtha stabilizer;Refinery gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-808-8 | 68478-28-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-143-00-6 | Tail gas (petroleum), cracked distillate hydrotreater separator;Refinery gas;[A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 270-809-3 | 68478-29-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-144-00-1 | Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 270-810-9 | 68478-30-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-145-00-7 | Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads;Refinery gas;[A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consists of hydrogen, methane, ethane and propane.] | 270-999-8 | 68513-14-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-146-00-2 | Gases (petroleum), reformer effluent high-pressure flash drum off;Refinery gas;[A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-003-4 | 68513-18-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-147-00-8 | Gases (petroleum), reformer effluent low-pressure flash drum off;Refinery gas;[A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-005-5 | 68513-19-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-148-00-3 | Gases (petroleum), oil refinery gas distn. off;Refinery gas;[A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or obtained by cracking ethane and propane. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C2, hydrogen, nitrogen, and carbon monoxide.] | 271-258-1 | 68527-15-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-149-00-9 | Gases (petroleum), benzene unit hydrotreater depentanizer overheads;Refinery gas;[A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of hydrogen, ethane and propane with various small amounts of nitrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6. It may contain trace amounts of benzene.] | 271-623-5 | 68602-82-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-150-00-4 | Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator;Refinery gas;[A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cracker. It consists of hydrogen, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 271-625-6 | 68602-84-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-151-00-X | Petroleum products, refinery gases;Refinery gas;[A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | 271-750-6 | 68607-11-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-152-00-5 | Gases (petroleum), hydrocracking low-pressure separator;Refinery gas;[A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 272-182-1 | 68783-06-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-153-00-0 | Gases (petroleum), refinery;Refinery gas;[A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 272-338-9 | 68814-67-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-154-00-6 | Gases (petroleum), platformer products separator off;Refinery gas;[A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | 272-343-6 | 68814-90-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-155-00-1 | Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off;Refinery gas;[The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with various small amounts of nitrogen, hydrogen sulfide, carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C4 through C5.] | 272-775-5 | 68911-58-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-156-00-7 | Gases (petroleum), hydrotreated sour kerosine flash drum;Refinery gas;[A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane with various small amounts of nitrogen, carbon monoxide, and hydro-carbons having carbon numbers predominantly in the range of C2 through C5.] | 272-776-0 | 68911-59-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-157-00-2 | Gases (petroleum), distillate unifiner desulfurization stripper off;Refinery gas;[A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] | 272-873-8 | 68919-01-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-158-00-8 | Gases (petroleum), fluidized catalytic cracker fractionation off;Refinery gas;[A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-874-3 | 68919-02-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-159-00-3 | Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off;Refinery gas;[A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and propane.] | 272-875-9 | 68919-03-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-160-00-9 | Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off;Refinery gas;[A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-876-4 | 68919-04-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-161-00-4 | Gases (petroleum), platformer stabilizer off, light ends fractionation;Refinery gas;[A complex combination obtained by the fractionation of the light ends of the platinum reactors of the plattformer unit. It consists of hydrogen, methane, ethane and propane.] | 272-880-6 | 68919-07-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-162-00-X | Gases (petroleum), preflash tower off, crude distn.;Refinery gas;[A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-881-1 | 68919-08-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-163-00-5 | Gases (petroleum), tar stripper off;Refinery gas;[A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 272-884-8 | 68919-11-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-164-00-0 | Gases (petroleum), unifiner stripper off;Refinery gas;[A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] | 272-885-3 | 68919-12-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-165-00-6 | Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator;Refinery gas;[A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] | 273-173-5 | 68952-79-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-166-00-1 | Tail gas (petroleum), straight-run naphtha hydrodesulfurizer;Refinery gas;[A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 273-174-0 | 68952-80-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-167-00-7 | Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation;Refinery gas;[A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfurizer. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 273-269-7 | 68955-33-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-168-00-2 | Gases (petroleum), crude distn. and catalytic cracking;Refinery gas;[A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 273-563-5 | 68989-88-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-169-00-8 | Gases (petroleum), gas oil diethanolamine scrubber off;Refinery gas;[A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | 295-397-2 | 92045-15-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-170-00-3 | Gases (petroleum), gas oil hydrodesulfurization effluent;Refinery gas;[A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | 295-398-8 | 92045-16-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-171-00-9 | Gases (petroleum), gas oil hydrodesulfurization purge;Refinery gas;[A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 295-399-3 | 92045-17-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-172-00-4 | Gases (petroleum), hydrogenator effluent flash drum off;Refinery gas;[A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 295-400-7 | 92045-18-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-173-00-X | Gases (petroleum), naphtha steam cracking high-pressure residual;Refinery gas;[A complex combination obtained as a mixture of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained during the preparation of subsequent products. It consists predominantly of hydrogen and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 with which natural gas may also be mixed.] | 295-401-2 | 92045-19-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-174-00-5 | Gases (petroleum), residue visbaking off;Refinery gas;A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 295-402-8 | 92045-20-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-175-00-0 | Foots oil (petroleum), acid-treated;Foots oil;[A complex combination of hydrocarbons obtained by treatment of Foot's oil with sulfuric acid. It consists predominantly of branched-chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | 300-225-7 | 93924-31-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-176-00-6 | Foots oil (petroleum), clay-treated;Foots oil;[A complex combination of hydrocarbons obtained by treatment of Foot's oil with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of branched chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | 300-226-2 | 93924-32-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-177-00-1 | Gases (petroleum), C3-4;Petroleum gas;[A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane and propylene, and boiling in the range of approximately - 51 oC to - 1 oC (-60oF to 30oF.)] | 268-629-5 | 68131-75-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-178-00-7 | Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber;Petroleum gas;[The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | 269-617-2 | 68307-98-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-179-00-2 | Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | 269-618-8 | 68307-99-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-180-00-8 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-619-3 | 68308-00-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-181-00-3 | Tail gas (petroleum), cracked distillate hydrotreater stripper;Petroleum gas;[A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-620-9 | 68308-01-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-182-00-9 | Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-630-3 | 68308-10-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-183-00-4 | Tail gas (petroleum), gas oil catalytic cracking absorber;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-623-5 | 68308-03-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-184-00-X | Tail gas (petroleum), gas recovery plant;Petroleum gas;[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-624-0 | 68308-04-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-185-00-5 | Tail gas (petroleum), gas recovery plant deethanizer;Petroleum gas;[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbon having carbon numbers predominantly in the range of C1 through C4.] | 269-625-6 | 68308-05-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-186-00-0 | Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams and treated to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-626-1 | 68308-06-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-187-00-6 | Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-627-7 | 68308-07-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-188-00-1 | Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 269-629-8 | 68308-09-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-189-00-7 | Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-631-9 | 68308-11-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-190-00-2 | Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free;Petroleum gas;[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | 269-632-4 | 68308-12-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-191-00-8 | Gases (petroleum), catalytic cracked overheads;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C5 and boiling in the range of approximately - 48 oC to 32 oC (-54oF to 90oF).] | 270-071-2 | 68409-99-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-193-00-9 | Alkanes, C1-2;Petroleum gas | 270-651-5 | 68475-57-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-194-00-4 | Alkanes, C2-3;Petroleum gas | 270-652-0 | 68475-58-1 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-195-00-X | Alkanes, C3-4;Petroleum gas | 270-653-6 | 68475-59-2 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-196-00-5 | Alkanes, C4-5;Petroleum gas | 270-654-1 | 68475-60-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-197-00-0 | Fuel gases;Petroleum gas;[A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] | 270-667-2 | 68476-26-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-198-00-6 | Fuel gases, crude oil of distillates;Petroleum gas;[A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately - 217 oC to - 12 oC (-423oF to 10oF).] | 270-670-9 | 68476-29-9 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-199-00-1 | Hydrocarbons, C3-4;Petroleum gas | 270-681-9 | 68476-40-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-200-00-5 | Hydrocarbons, C4-5;Petroleum gas | 270-682-4 | 68476-42-6 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-201-00-0 | Hydrocarbons, C2-4, C3-rich;Petroleum gas | 270-689-2 | 68476-49-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-202-00-6 | Petroleum gases, liquefied;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately - 40 oC to 80 oC (-40 oF to 176 oF).] | 270-704-2 | 68476-85-7 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 53-45 | HKS |
| 649-203-00-1 | Petroleum gases, liquefied, sweetened;Petroleum gas;[A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately - 40 oC to 80 oC (-40 oF to 176 oF).] | 270-705-8 | 68476-86-8 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 45-53 | HKS |
| 649-204-00-7 | Gases (petroleum), C3-4, isobutane-rich;Petroleum gas;[A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C4, predominantly isobutane.] | 270-724-1 | 68477-33-8 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-205-00-2 | Distillates (petroleum), C3-6, piperylene-rich;Petroleum gas;[A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C6, predominantly piperylenes.] | 270-726-2 | 68477-35-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-206-00-8 | Gases (petroleum), butane splitter overheads;Petroleum gas;[A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | 270-750-3 | 68477-69-0 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-207-00-3 | Gases (petroleum), C2-;Petroleum gas;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] | 270-751-9 | 68477-70-3 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-208-00-9 | Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free;Petroleum gas;[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfide and other acidic components. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | 270-752-4 | 68477-71-4 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-209-00-4 | Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich;Petroleum gas;[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | 270-754-5 | 68477-72-5 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-210-00-X | Tail gas (petroleum), isomerized naphtha fractionation stabilizer;Petroleum gas;[A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | 269-628-2 | 68308-08-7 | ⊗Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | H K |
| 649-211-00-5 | Foots oil (petroleum), carbon-treated;Foots oil;[A complex combination of hydrocarbons obtained by the treatment of Foots oil with activated carbon for the removal of trace constituents and impurities. It consists predominantly of saturated straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-126-0 | 97862-76-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-212-00-0 | Distillates (petroleum), sweetened middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-088-7 | 64741-86-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-213-00-6 | Gas oils (petroleum), solvent-refined;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-092-9 | 64741-90-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-214-00-1 | Distillates (petroleum), solvent-refined middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-093-4 | 64741-91-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-215-00-7 | Gas oils (petroleum), acid-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-112-6 | 64742-12-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-216-00-2 | Distillates (petroleum), acid-treated middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 oC to 345 oC (401oF to 653oF).] | 265-113-1 | 64742-13-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-217-00-8 | Distillates (petroleum), acid-treated light;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-114-7 | 64742-14-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-218-00-3 | Gas oils (petroleum), chemically neutralized;Gasoil — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-129-9 | 64742-29-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-219-00-9 | Distillates (petroleum), chemically neutralized middle;Gasoil — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 oC to 345 oC (401oF to 653oF).] | 265-130-4 | 64742-30-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-220-00-4 | Distillates (petroleum), clay-treated middle;Gasoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 oC to 345 oC (302oF to 653oF).] | 265-139-3 | 64742-38-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-221-00-X | Distillates (petroleum), hydrotreated middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-148-2 | 64742-46-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-222-00-5 | Gas oils (petroleum), hydrodesulfurized;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 oC to 400 oC (446oF to 752oF).] | 265-182-8 | 64742-79-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-223-00-0 | Distillates (petroleum), hydrodesulfurized middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 265-183-3 | 64742-80-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-224-00-6 | Fuels, diesel;Gasoil — unspecified;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 163 oC to 357 oC (325oF to 675oF).] | 269-822-7 | 68334-30-5 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H N |
| 649-225-00-1 | Fuel oil, No 2;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 32,6 SUS at 37,7oC (100oF) to a maximum of 37,9 SUS at 37,7oC (100oF).] | 270-671-4 | 68476-30-2 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 649-226-00-7 | Fuel oil, No 4;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 45 SUS at 37,7oC (100oF) to a maximum of 125 SUS at 37,7oC (100oF).] | 270-673-5 | 68476-31-3 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 649-227-00-2 | Fuels, diesel, No 2;Gasoil — unspecified;[A distillate oil having a minimum viscosity of 32,6 SUS at 37,7oC (100oF).] | 270-676-1 | 68476-34-6 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 649-228-00-8 | Distillates (petroleum), catalytic reformer fractionator residue, high-boiling;Gasoil — unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fracftionator residue. It boils in the range of approximately 343 oC to 399 oC (650oF to 750oF).] | 270-719-4 | 68477-29-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-229-00-3 | Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling;Gasoil — unspecified;[A complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils in the range of approximately 288 oC to 371 oC (550oF to 700oF).] | 270-721-5 | 68477-30-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-230-00-9 | Distillates (petroleum), catalytic reformer fractionator residue, low-boiling;Gasoil — unspecified;[The complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils approximately below 288 oC (550oF).] | 270-722-0 | 68477-31-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-231-00-4 | Distillates (petroleum), highly refined middle;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the subjection of a petroleum fraction to several of the following steps: filtration, centrifugation, atmospheric distillation, vacuum distillation, acidification, neutralization and clay treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C20.] | 292-615-8 | 90640-93-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-232-00-X | Distillates (petroleum) catalytic reformer, heavy arom. conc.;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from the distillation of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C16 and boiling in the range of approximately 200 oC to 300 oC (392oF to 572oF).] | 295-294-2 | 91995-34-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-233-00-5 | Gas oils, paraffinic;Gasoil — unspecified;[A distillate obtained from the redistillation of a complex combination of hydrocarbons obtained by the distillation of the effluents from a severe catalytic hydrotreatment of paraffins. It boils in the range of approximately 190 oC to 330 oC (374oF to 594oF).] | 300-227-8 | 93924-33-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-234-00-0 | Naphtha (petroleum), solvent-refined hydrodesulfurized heavy;Gasoil — unspecified | 307-035-3 | 97488-96-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-235-00-6 | Hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a middle distillate with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 290 oC to 350 oC (554oF to 662oF). It produces a finished oil having a viscosity of 2cSt at 100 oC (212oF).] | 307-659-6 | 97675-85-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-236-00-1 | Hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights;Gasoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of heavy paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C20 and boiling in the range of approximately 230 oC to 350 oC (446oF to 662oF). It produces a finished oil having a viscosity of 2cSt at 100 oC (212oF).] | 307-660-1 | 97675-86-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-237-00-7 | Hydrocarbons, C11-17, solvent-extd. light naphthenic;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a visciosity of 2.2 cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 200 oC to 300 oC (392oF to 572oF).] | 307-757-9 | 97722-08-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-238-00-2 | Gas oils, hydrotreated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained from the redistillation of the effluents from the treatment of paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C27 and boiling in the range of approximately 330 oC to 340 oC (626oF to 644oF).] | 308-128-1 | 97862-78-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-239-00-8 | Distillates (petroleum), carbon-treated light paraffinic;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of a petroleum oil fraction with activated charcoal for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C28.] | 309-667-5 | 100683-97-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-240-00-3 | Distillates (petroleum), intermediate paraffinic, carbon-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of petroleum with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 309-668-0 | 100683-98-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-241-00-9 | Distillates (petroleum), intermediate paraffinic, clay-treated;Gasoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of petroleum with bleaching earth for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 309-669-6 | 100683-99-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-242-00-4 | Alkanes, C12-26-branched and linear | 292-454-3 | 90622-53-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-243-00-X | Lubricating greases;Grease;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. May contain organic salts of alkali metals, alkaline earth metals, and/or aluminium compounds.] | 278-011-7 | 74869-21-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-244-00-5 | Slack wax (petroleum);Slack wax;[A complex combination of hydrocarbons obtained from a petroleum fraction by solvent crystallization (solvent dewaxing) or as a distillation fraction from a very waxy crude. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 265-165-5 | 64742-61-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-245-00-0 | Slack wax (petroleum), acid-treated;Slack wax;[A complex combination of hydrocarbons obtained as a raffinate by treatment of a petroleum slack wax fraction with sulfuric acid treating process. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 292-659-8 | 90669-77-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-246-00-6 | Slack wax (petroleum), clay-treated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of a petroleum slack wax fraction with natural or modified clay in either a contacting or percolation process. It consists predominantly of saturated straight and branched hydrocarbons having carbon numbers predominantly greater than C20.] | 292-660-3 | 90669-78-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-247-00-1 | Slack wax (petroleum), hydrotreated;Slack wax;[A complex combination of hydrocarbons obtained by treating slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | 295-523-6 | 92062-09-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-248-00-7 | Slack wax (petroleum), low-melting;Slack wax;[A complex combination of hydrocarbons obtained from a petroleum fraction by solvent deparaffination. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 295-524-1 | 92062-10-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-249-00-2 | Slack wax (petroleum), low-melting, hydrotreated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of low-melting petroleum slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 295-525-7 | 92062-11-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-250-00-8 | Slack wax (petroleum), low-melting, carbon-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting slack wax with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-155-9 | 97863-04-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-251-00-3 | Slack wax (petroleum), low-melting, clay-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with bentonite for removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-156-4 | 97863-05-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-252-00-9 | Slack wax (petroleum), low-melting, silicic acid-treated;Slack wax;[A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-158-5 | 97863-06-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-253-00-4 | Slack wax (petroleum), carbon-treated;Slack wax;[A complex combination of hydrocarbons obtained by treatment of petroleum slack wax with activated charcoal for the removal of trace polar constituents and impurities.] | 309-723-9 | 100684-49-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-254-00-X | Petrolatum;Petrolatum;[A complex combination of hydrocarbons obtained as a semi-solid from dewaxing paraffinic residual oil. It consists predominantly of saturated crystalline and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | 232-373-2 | 8009-03-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-255-00-5 | Petrolatum (petroleum), oxidized;Petrolatum;[A complex combination of organic compounds, predominantly high molecular weight carboxylic acids, obtained by the air oxidation of petrolatum.] | 265-206-7 | 64743-01-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-256-00-0 | Petrolatum (petroleum), alumina-treated;Petrolatum;[A complex combination of hydrocarbons obtained when petrolatum is treated with Al2O3 to remove polar components and impurities. It consists predominantly of saturated, crystalline, and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | 285-098-5 | 85029-74-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-257-00-6 | Petrolatum (petroleum), hydrotreated;Petrolatum;[A complex combination of hydrocarbons obtained as a semi-solid from dewaxed paraffinic residual oil treated with hydrogen in the presence of a catalyst. It consists predominantly of saturated microcrystalline and liquid hydrocarbons having carbon numbers predominantly greater than C20.] | 295-459-9 | 92045-77-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-258-00-1 | Petrolatum (petroleum), carbon-treated;Petrolatum;[A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | 308-149-6 | 97862-97-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-259-00-7 | Petrolatum (petroleum), silicic acid-treated;Petrolatum;[A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | 308-150-1 | 97862-98-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-260-00-2 | Petrolatum (petroleum), clay-treated;Petrolatum;[A complex combination of hydrocarbons obtained by treatment of petrolatum with bleaching earth for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of greater than C25.] | 309-706-6 | 100684-33-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H N |
| 649-261-00-8 | Gasoline, natural;Low boiling point naphtha;[A complex combination of hydrocarbons separated from natural gas by processes such as refrigeration or absorption. It consists predominantly of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately minus 20 oC to 120 oC (-4oF to 248oF).] | 232-349-1 | 8006-61-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-262-00-3 | Naphtha;Low boiling point naphtha;[Refined, partly refined, or unrefined petroleum products by the distillation of natural gas. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 100 oC to 200 oC (212oF to 392oF).]] | 232-443-2 | 8030-30-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-263-00-9 | Ligroine;Low boiling point naphtha;[A complex combination of hydrocarbons obtained by the fractional distillation of petroleum. This fraction boils in a range of approximately 20 oC to 135 oC (58oF to 275oF).] | 232-453-7 | 8032-32-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-264-00-4 | Naphtha (petroleum), heavy straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-041-0 | 64741-41-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-265-00-X | Naphtha (petroleum), full-range straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 220 oC (-4oF to 428oF).] | 265-042-6 | 64741-42-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-266-00-5 | Naphtha (petroleum), light straight-run;Low boiling point naphtha;[A complex combination of hydrocarbons produced by distillation of crude oil. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately minus 20 oC to 180 oC (-4oF to 356oF).] | 265-046-8 | 64741-46-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-267-00-0 | Solvent naphtha (petroleum), light aliph.;Low boiling point naphtha;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 35 oC to 160 oC (95oF to 320oF).] | 265-192-2 | 64742-89-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-268-00-6 | Distillates (petroleum), straight-run light;Low boiling point naphtha;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C7 and boiling in the range of approximately - 88 oC to 99 oC (-127oF to 210oF).] | 270-077-5 | 68410-05-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-269-00-1 | Gasoline, vapor-recovery;Low boiling point naphtha;[A complex combination of hydrocarbons separated from the gases from vapor recovery systems by cooling. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately - 20 oC to 196 oC (-4oF to 384oF).] | 271-025-4 | 68514-15-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-270-00-7 | Gasoline, straight-run, topping-plant;Low boiling point naphtha;[A complex combination of hydrocarbons produced from the topping plant by the distillation of crude oil. It boils in the range of approximately 36,1oC to 193,3oC (97oF to 380oF).] | 271-727-0 | 68606-11-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-271-00-2 | Naphtha (petroleum), unsweetened;Low boiling point naphtha;[A complex combination of hydrocarbons produced from the distillation of naphtha streams from various refinery processes. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 0 oC to 230 oC (25oF to 446oF).] | 272-186-3 | 68783-12-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-272-00-8 | Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads;Low boiling point naphtha;[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C3 through C6..] | 272-931-2 | 68921-08-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-273-00-3 | Naphtha (petroleum), heavy straight run, arom.-contg.;Low boiling point naphtha;[A complex combination of hydrocarbons obtained from a distillation process of crude petroleum. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130 oC to 210 oC (266oF to 410oF).] | 309-945-6 | 101631-20-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-274-00-9 | Naphtha (petroleum), full-range alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consist of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 220 oC (194oF to 428oF).] | 265-066-7 | 64741-64-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-275-00-4 | Naphtha (petroleum), heavy alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 to C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 150 oC to 220 oC (302oF to 428oF).] | 265-067-2 | 64741-65-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-276-00-X | Naphtha (petroleum), light alkylate;Low boiling point modified naphtha;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of aproximately 90 oC to 160 oC (194oF to 320oF).] | 265-068-8 | 64741-66-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-277-00-5 | Naphtha (petroleum), isomerization;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained from catalytic isomerization of straight chain paraffinic C4 through C6 hydrocarbons. It consists predominantly of saturated hydrocarbons such as isobutane, isopentane, 2,2-dimethylbutane, 2-methylpentane, and 3-methylpentane.] | 265-073-5 | 64741-70-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-278-00-0 | Naphtha (petroleum), solvent-refined light;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF).] | 265-086-6 | 64741-84-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-279-00-6 | Naphtha (petroleum), solvent-refined heavy;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-095-5 | 64741-92-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-280-00-1 | Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts.;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinate from the UDEX extraction process on the catalytic reformer stream. It consists of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C9.] | 270-088-5 | 68410-71-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-281-00-7 | Raffinates (petroleum), reformer, Lurgi unit-sepd.;Low boiling point modified naphtha;[The complex combination of hydrocarbons obtained as a raffinate from a Lurgi separation unit. It consists predominantly of non-aromatic hydrocarbons with various small amounts of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8.] | 270-349-3 | 68425-35-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-282-00-2 | Naphtha (petroleum), full-range alkylate, butane-contg.;Low boiling point modified naphta;[A complex combination of hydrocarbons produced by the distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C7 through C12 with some butanes and boiling in the range of approximately 35 oC to 200 oC (95oF to 428oF).] | 271-267-0 | 68527-27-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-283-00-8 | Distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained as the raffinates from a solvent extraction process of hydrotreated light distillate from steam-cracked naphtha.] | 295-315-5 | 91995-53-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-284-00-3 | Naphtha (petroleum), C4-12 butane-alkylate, isooctane-rich;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by alkylation of butanes. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12, rich in isooctane, and boiling in the range of approximately 35 oC to 210 oC (95oF to 410oF).] | 295-430-0 | 92045-49-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-285-00-9 | Hydrocarbons, hydrotreated light naphtha distillates, solvent-refined;Low boiling point modified naphtha;[A combination of hydrocarbons obtained from the distillation of hydrotreated naphtha followed by a solvent extraction and distillation process. It consists predominantly of saturated hydrocarbons boiling in the range of approximately 94 oC to 99 oC (201oF to 210oF).] | 295-436-3 | 92045-55-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-286-00-4 | Naphtha (petroleum), isomerization, C6-fraction;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by distillation of a gasoline which has been catalytically isomerized. It consists predominantly of hexane isomers boiling in the range of approximately 60 oC to 66 oC (140oF to 151oF).] | 295-440-5 | 92045-58-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-287-00-X | Hydrocarbons, C6-7, naphtha-cracking, solvent-refined;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by the sorption of benzene from a catalytically fully hydrogenated benzene-rich hydrocarbon cut that was distillatively obtained from prehydrogenated cracked naphtha. It consists predominantly of paraffinic and naphthenic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 70 oC to 100 oC (158oF to 212oF).] | 295-446-8 | 92045-64-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-288-00-5 | Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined;Low boiling point modified naphtha;[A complex combination of hydrocarbons obtained by distillation of hydrotreated naphtha followed by solvent extraction. It consists predominantly of saturated hydrocarbons and boiling in the range of approximately 65 oC to 70 oC (149oF to 158oF).] | 309-871-4 | 101316-67-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-289-00-0 | Naphtha (petroleum), heavy catalytic cracked;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by a distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (148oF to 446oF). It contains a relatively large proportion of unsaturated hydrocarbons.] | 265-055-7 | 64741-54-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-290-00-6 | Naphtha (petroleum), light catalytic cracked;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF). It contains a relatively large proportion of unsaturated hydrocarbons.] | 265-056-2 | 64741-55-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-291-00-1 | Hydrocarbons, C3-11, catalytic cracker distillates;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillations of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C11 and boiling in a range approximately up to 204 oC (400oF).] | 270-686-6 | 68476-46-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-292-00-7 | Naphtha (petroleum), catalytic cracked light distd.;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | 272-185-8 | 68783-09-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-293-00-2 | Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.;Low boiling point cat-cracked naphtha.;[A complex combination of hydrocarbons obtained by treating a light distillate from steam-cracked naphtha. It consists predom-inantly of aromatic hydrocarbons.] | 295-311-3 | 91995-50-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-294-00-8 | Naphtha (petroleum), heavy catalytic cracked, sweetened;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting a catalytic cracked petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 60 oC to 200 oC (140oF to 392oF).] | 295-431-6 | 92045-50-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-295-00-3 | Naphtha (petroleum), light catalytic cracked sweetened;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting naphtha from a catalytic cracking process to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons boiling in a range of approxim-ately 35 oC to 210 oC (95oF to 410oF).] | 295-441-0 | 92045-59-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-296-00-9 | Hydrocarbons, C8-12, catalytic-cracking, chem. neutralized;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of a cut from the catalytic cracking process, having undergone an alkaline washing. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130 oC to 210 oC (266oF to 410oF).] | 295-794-0 | 92128-94-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-297-00-4 | Hydrocarbons, C8-12, catalytic cracker distillates;Low boiling point cat-cracked naphtha;[A complex combination of hydrocarbons obtained by distillation of products from a catalytic cracking process. It consists pre-dominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C12 and boiling in the range of approximately 140 oC to 210 oC (284oF to 410oF).] | 309-974-4 | 101794-97-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-298-00-X | Hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened;Low boiling point cat-cracked naphtha | 309-987-5 | 101896-28-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-299-00-5 | Naphtha (petroleum), light catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol. % or more benzene.]] | 265-065-1 | 64741-63-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-300-00-9 | Naphtha (petroleum), heavy catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-070-9 | 64741-68-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-301-00-4 | Distillates (petroleum), catalytic reformed depentanizer;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons from the distillation of products from a catalytic reforming process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 49 oC to 63 oC - 57oF to 145oF).] | 270-660-4 | 68475-79-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-302-00-X | Hydrocarbons, C2-6, C6-8 catalytic reformer;Low boiling point cat-reformed naphtha | 270-687-1 | 68476-47-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-303-00-5 | Residues (petroleum), C6-8 catalytic reformer;Low boiling point cat-reformed naphtha;[A complex residuum from the catalytic reforming of C6-8 feed. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 270-794-3 | 68478-15-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-304-00-0 | Naphtha (petroleum), light catalytic reformed, arom.-free;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained from distillation of products from a catalytic reforming process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 35 oC to 120 oC (95oF to 248oF). It contains a relatively large proportion of branched chain hydrocarbons with the aromatic components removed.] | 270-993-5 | 68513-03-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-305-00-6 | Distillates (petroleum), catalytic reformed straight-run naphtha overheads;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha followed by the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 271-008-1 | 68513-63-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-306-00-1 | Petroleum products, hydrofiner-powerformer reformates;Low boiling point cat-reformed naphtha;[The complex combination of hydrocarbons obtained in a hydrofiner-powerformer process and boiling in a range of approximately 27 oC to 210 oC (80oF to 410oF).] | 271-058-4 | 68514-79-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-307-00-7 | Naphtha (petroleum, full-range reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35 oC to 230 oC (95oF to 446oF).] | 272-895-8 | 68919-37-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-308-00-2 | Naphtha (petroleum), catalytic reformed;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30 oC to 220 oC (90oF to 430oF). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol.% or more benzene.] | 273-271-8 | 68955-35-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-309-00-8 | Distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction;Low boiling point cat-reformed naphtha;[A complex combination of alkylbenzenes obtained by the catalytic reforming of petroleum naphtha. It consists predominantly of alkylbenzenes having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 160 oC to 180 oC (320oF to 356oF).] | 285-509-8 | 85116-58-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-310-00-3 | Aromatic hydrocarbons, C8, catalytic reforming-derived;Low boiling point cat-reformed naphtha | 295-279-0 | 91995-18-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-311-00-9 | Aromatic hydrocarbons, C7-12, C8-rich;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 (primarily C8) and can contain nonaromatic hydrocarbons, both boiling in the range of approximately 130 oC to 200 oC (266oF to 392oF).] | 297-401-8 | 93571-75-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-312-00-4 | Gasoline, C5-11, high-octane stabilized reformed;Low boiling point cat-reformed naphtha;[A complex high octane combination of hydrocarbons obtained by the catalytic dehydrogenation of a predominantly naphthenic naphtha. It consists predominantly of aromatics and non-aromatics having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 45 oC to 185 oC (113oF to 365oF).] | 297-458-9 | 93572-29-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-313-00-X | Hydrocarbons, C7-12, C >9-arom.-rich, reforming heavy fraction;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 120 oC to 210 oC (248oF to 380oF) and C9 and higher aromatic hydrocarbons.] | 297-465-7 | 93572-35-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-314-00-5 | Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction;Low boiling point cat-reformed naphtha;[A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 35 oC to 125 oC (94oF to 257oF), benzene and toluene.] | 297-466-2 | 93572-36-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-315-00-0 | Foots oil (petroleum), silicic acid-treated;Foots oil;[A complex combination of hydrocarbons obtained by the treatment of Foots oil with silicic acid for removal of trace constituents and impurities. It consists predominantly of straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | 308-127-6 | 97862-77-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-316-00-6 | Naphtha (petroleum), light thermal cracked;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons from distillation of products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately minus 10 oC to 130 oC (14oF to 266oF).] | 265-075-6 | 64741-74-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-317-00-1 | Naphtha (petroleum), heavy thermal cracked;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons from distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 220 oC (148oF to 428oF).] | 265-085-0 | 64741-83-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-318-00-7 | Distillates (petroleum), heavy arom.;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This higher boiling fraction consists predominantly of C5-C7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having carbon number predominantly of C5. This stream may contain benzene.] | 267-563-4 | 67891-79-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-319-00-2 | Distillates (petroleum), light arom.;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This lower boiling fraction consists predominantly of C5-C7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having a carbon number predominantly of C5. This stream may contain benzene.] | 267-565-5 | 67891-80-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-320-00-8 | Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending;Low boiling point thermally cracked naphtha;[The complex combination of hydrocarbons obtained by the pyrolysis fractionation at 816 oC (1500oF) of naphtha and raffinate. It consists predominantly of hydrocarbons having a carbon number of C9 and boiling at approximately 204 oC (400oF).] | 270-344-6 | 68425-29-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-321-00-3 | Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived;Low boiling point thermally cracked naphtha;A complex combination of hydrocarbons obtained by the fractionation pyrolysis at 816 oC (1500oF) of naphtha and raffinate. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8, including benzene.] | 270-658-3 | 68475-70-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-322-00-9 | Distillates (petroleum), thermal cracked naphtha and gas oil;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by distillation of thermally cracked naphtha and/or gas oil. It consists predominantly of olefinic hydrocarbons having a carbon number of C5 and boiling in the range of approximately 33 oC to 60 oC (91oF to 140oF).] | 271-631-9 | 68603-00-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-323-00-4 | Distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists predominantly of hydrocarbons having a carbon number of C5 with some dimerized C5 olefins and boiling in the range of approximately 33 oC to 184 oC (91oF to 363oF).] | 271-632-4 | 68603-01-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-324-00-X | Distillates (petroleum), thermal cracked naphtha and gas oil, extractive;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists of paraffinic and olefinic hydrocarbons, predominantly isoamylenes such as 2-methyl-1-butene and 2-methyl-2-butene and boiling in the range of approximately 31 oC to 40 oC (88oF to 104oF).] | 271-634-5 | 68603-03-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-325-00-5 | Distillates (petroleum), light thermal cracked, debutanized arom.;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists predominantly of aromatic hydrocarbons, primarily benzene.] | 273-266-0 | 68955-29-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-326-00-0 | Naphtha (petroleum), light thermal cracked, sweetened;Low boiling point thermally cracked naphtha;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate from the high temperature thermal cracking of heavy oil fractions to a sweetening process to convert mercaptans. It consists predominantly of aromatics, olefins and saturated hydrocarbons boiling in the range of approximately 20 oC to 100 oC (68oF to 212oF).] | 295-447-3 | 92045-65-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-327-00-6 | Naphtha (petroleum), hydrotreated heavy;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C13 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-150-3 | 64742-48-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-328-00-1 | Naphtha (petroleum), hydrotreated light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-151-9 | 64742-49-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-329-00-7 | Naphtha (petroleum), hydrodesulfurized light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-178-6 | 64742-73-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-330-00-2 | Naphtha (petroleum), hydrodesulfurized heavy;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-185-4 | 64742-82-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-331-00-8 | Distillates (petroleum), hydrotreated middle, intermediate boiling;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by the distillation of products from a middle distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 127 oC to 188 oC (262oF to 370oF).] | 270-092-7 | 68410-96-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-332-00-3 | Distillates (petroleum), light distillate hydrotreating process, low-boiling;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by the distillation of products from the light distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C9 and boiling in the range of approximately 3 oC to 194 oC (37oF to 382oF).] | 270-093-2 | 68410-97-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-333-00-9 | Distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by distillation of the products from a heavy naphtha hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 49 oC to 68 oC (-57oF to 155oF).] | 270-094-8 | 68410-98-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-334-00-4 | Solvent naphtha (petroleum), light arom., hydrotreated;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF).] | 270-988-8 | 68512-78-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-335-00-X | Naphtha (petroleum), hydrodesulfurized thermal cracked light;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by fractionation of hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23 oC to 195 oC (73oF to 383oF).] | 285-511-9 | 85116-60-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-336-00-5 | Naphtha (petroleum), hydrotreated light, cycloalkane-contg.;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from the distillation of a petroleum fraction. It consists predominantly of alkanes and cycloalkanes boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 285-512-4 | 85116-61-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-337-00-0 | Naphtha (petroleum), heavy steam-cracked, hydrogenated;Low boiling point hydrogen treated naphtha | 295-432-1 | 92045-51-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-338-00-6 | Naphtha (petroleum), hydrodesulfurized full-range;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately 30 oC to 250 oC (86oF to 482oF).] | 295-433-7 | 92045-52-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-339-00-1 | Naphtha (petroleum), hydrotreated light steam-cracked;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction, derived from a pyrolysis process, with hydrogen in the presence of a catalyst. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35 oC to 190 oC (95oF to 374oF).] | 295-438-4 | 92045-57-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-340-00-7 | Hydrocarbons, C4-12, naphtha-cracking, hydrotreated;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by distillation from the product of a naphtha steam cracking process and subsequent catalytic selective hydrogenation of gum formers. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30 oC to 230 oC (86oF to 446oF).] | 295-443-1 | 92045-61-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-341-00-2 | Solvent naphtha (petroleum), hydrotreated light naphthenic;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of cycloparaffinic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 73 oC to 85 oC (163oF to 185oF).] | 295-529-9 | 92062-15-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-342-00-8 | Naphtha (petroleum), light steam-cracked, hydrogenated;Low boiling point hydrogen treated naphtha;[A complex comination of hydrocarbons produced from the separation and subsequent hydrogenation of the products of a steam-cracking process to produce ethylene. It consists predominantly of saturated and unsaturated paraffins, cyclic paraffins and cyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately 50 oC to 200 oC (122oF to 392oF). The proportion of benzene hydrocarbons may vary up to 30 wt. % and the stream may also contain small amounts of sulphur and oxygenated compounds.] | 296-942-7 | 93165-55-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-343-00-3 | Hydrocarbons, C6-11, hydrotreated, dearomatized;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-852-0 | 93763-33-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-344-00-9 | Hydrocarbons, C9-12, hydrotreated, dearomatized;Low boiling point hydrogen treated naphtha;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-853-6 | 93763-34-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-345-00-4 | Stoddard solvent;Low boiling point naphtha — unspecified;[A colourless, refined petroleum distillate that is free from rancid or objectionable odors and that boils in a range of approximately 300oF to 400oF.] | 232-489-3 | 8052-41-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-346-00-X | Natural gas condensates (petroleum);Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated as a liquid from natural gas in a surface separator by retrograde condensation. It consists mainly of hydrocarbons having carbon numbers predominantly in the range of C2 to C20. It is a liquid at atmospheric temperature and pressure.] | 265-047-3 | 64741-47-5 | Carc. Cat. 2; R4Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-347-00-5 | Natural gas (petroleum), raw liq. mix;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated as a liquid from natural gas in a gas recycling plant by processes such as refrigeration or absorption. It consists mainly of saturated aliphatic hydrocarbons having carbon numbers in the range of C2 through C8.] | 265-048-9 | 64741-48-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-348-00-0 | Naphtha (petroleum), light hydrocracked;Low boiling naphtha — unspecified;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C4 through C10, and boiling in the range of approximately minus 20 oC to 180 oC (-4oF to 356oF).] | 265-071-4 | 64741-69-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-349-00-6 | Naphtha (petroleum), heavy hydrocracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12, and boiling in the range of approximately 65 oC to 230 oC (148oF to 446oF).] | 265-079-8 | 64741-78-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-350-00-1 | Naphtha (petroleum), sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately minus 10 oC to 230 oC (14oF to 446oF).] | 265-089-2 | 64741-87-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-351-00-7 | Naphtha (petroleum), acid-treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 230 oC (194oF to 446oF).] | 265-115-2 | 64742-15-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-352-00-2 | Naphtha (petroleum), chemically neutralized heavy;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65 oC to 230 oC (149oF to 446oF).] | 265-122-0 | 64742-22-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-353-00-8 | Naphtha (petroleum), chemically neutralized light;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF).] | 265-123-6 | 64742-23-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-354-00-3 | Naphtha (petroleum), catalytic dewaxed;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the catalytic dewaxing of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35 oC to 230 oC (95oF to 446oF).] | 265-170-2 | 64742-66-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-355-00-9 | Naphtha (petroleum), light steam-cracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20 oC to 190 oC (-4oF to 374oF). This stream is likely to contain 10 vol.% or more benzene.] | 265-187-5 | 64742-83-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-356-00-4 | Solvent naphtha (petroleum), light arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135 oC to 210 oC (275oF to 410oF).] | 265-199-0 | 64742-95-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-357-00-X | Aromatic hydrocarbons, C6-10, acid-treated, neutralized;Low boiling point naphtha — unspecified | 268-618-5 | 68131-49-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-358-00-5 | Distillates (petroleum), C3-5, 2-methyl-2-butene-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons from the distillation of hydrocarbons usually ranging in carbon numbers from C3 through C5, predominantly isopentane and 3-methyl-1-butene. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C5, predominantly 2-methyl-2-butene.] | 270-725-7 | 68477-34-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-359-00-0 | Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the distillation of polymerized steam-cracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12.]] | 270-735-1 | 68477-50-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-360-00-6 | Distillates (petroleum), steam-cracked, C5-12 fraction;Low boiling point naphtha — unspecified;[A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C12.] | 270-736-7 | 68477-53-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-361-00-1 | Distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction;Low boiling point naphtha — unspecified | 270-738-8 | 68477-55-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-362-00-7 | Extracts (petroleum), cold-acid, C4-6;Low boiling point naphtha — unspecified;[A complex combination of organic compounds produced by cold acid unit extraction of saturated and unsaturated aliphatic hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly pentanes and amylenes. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | 270-741-4 | 68477-61-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-363-00-2 | Distillates (petroleum), depentanizer overheads;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from a catalytic cracked gas stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | 270-771-8 | 68477-89-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-364-00-8 | Residues (petroleum), butane splitter bottoms;Low boiling point naphtha — unspecified;[A complex residuum from the distillation of butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4through C6.] | 270-791-7 | 68478-12-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-365-00-3 | Residual oils (petroleum), deisobutanizer tower;Low boiling point naphtha — unspecified;[A complex residuum from the atmospheric distillation of the butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | 270-795-9 | 68478-16-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-366-00-9 | Naphtha (petroleum), full-range coker;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C15 and boiling in the range of approximately 43 oC to 250 oC (110oF to 500oF).] | 270-991-4 | 68513-02-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-367-00-4 | Naphtha (petroleum), steam-cracked middle arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by the distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 130 oC to 220 oC (266oF to 428oF).]] | 271-138-9 | 68516-20-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-368-00-X | Naphtha (petroleum), clay-treated full-range straight-run;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons resulting from treatment of full-range straight-run naphtha with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately - 20 oC to 220 oC (-4oF to 429oF).] | 271-262-3 | 68527-21-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-369-00-5 | Naphtha (petroleum), clay-treated light straight-run;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons resulting from treatment of light straight-run naphtha with a natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities, present. It consists of hydro-carbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of approximately 93 oC to 180 oC (200oF to 356oF.] | 271-263-9 | 68527-22-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-370-00-0 | Naphtha (petroleum), light steam-cracked arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C9 and boiling in the range of approximately 110 oC to 165 oC (230oF to 329oF).] | 271-264-4 | 68527-23-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-371-00-6 | Naphtha (petroleum), light steam-cracked, debenzenized;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 80 oC to 218 oC (176oF to 424oF).] | 271-266-5 | 68527-26-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-372-00-1 | Naphtha (petroleum), arom.-contg.;Low boiling point naphtha — unspecified | 271-635-0 | 68603-08-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-373-00-7 | Gasoline, pyrolysis, debutanizer bottoms;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists of hydrocarbons having carbon numbers predominantly greater than C5.] | 271-726-5 | 68606-10-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-374-00-2 | Naphtha (petroleum), light, sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately - 20 oC to 100 oC (-4oF to 212oF).] | 272-206-0 | 68783-66-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-375-00-8 | Natural gas condensates;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons separated and/or condensed from natural gas during transportation and collected at the wellhead and/or from the production, gathering, transmission, and distribution pipelines in deeps, scrubbers, etc. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C2 through C8.] | 272-896-3 | 68919-39-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H J |
| 649-376-00-3 | Distillates (petroleum), naphtha unifiner stripper;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons produced by stripping the products from the naphtha unifiner. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | 272-932-8 | 68921-09-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-377-00-9 | Naphtha (petroleum), catalytic reformed light, arom.-free fraction;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons remaining after removal of aromatic compounds from catalytic reformed light naphtha in a selective absorption process. It consists predominantly of paraffinic and cyclic compounds having carbon numbers predominantly in the range of C5 to C8 and boiling in the range of approximately 66 oC to 121 oC (151oF to 250oF).] | 285-510-3 | 85116-59-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-378-00-4 | Gasoline;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons consisting primarily of paraffins, cycloparaffins, aromatic and olefinic hydrocarbons having carbon numbers predominantly greater than C3 and boiling in the range of 30 oC to 260 oC (86oF to 500oF).] | 289-220-8 | 86290-81-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-379-00-X | Aromatic hydrocarbons, C7-8, dealkylation products, distn. residues;Low boiling point naphtha — unspecified | 292-698-0 | 90989-42-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-380-00-5 | Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the depentanizer column before hydrotreatment of the aromatic charges. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C6, predominantly pentanes and pentenes, and boiling in the range of approximately 25 oC to 40 oC (77oF to 104oF).] | 295-298-4 | 91995-38-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-381-00-0 | Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of heat-soaked steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | 295-302-4 | 91995-41-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-382-00-6 | Extracts (petroleum), catalytic reformed light naphtha solvent;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained as the extract from the solvent extraction of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C8 and boiling in the range of approximately 100 oC to 200 oC (212oF to 392oF).] | 295-331-2 | 91995-68-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-383-00-1 | Naphtha (petroleum), hydrodesulfurized light, dearomatized; Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of hydrodesulfurized and dearomatized light petroleum fractions. It consists predominantly of C7 paraffins and cycloparaffins boiling in a range of approximately 90 oC to 100 oC (194oF to 212oF).] | 295-434-2 | 92045-53-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-384-00-7 | Naphtha (petroleum), light, C5-rich, sweetened;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C5, predominantly C5, and boiling in the range of approximately minus 10 oC to 35 oC (14oF to 95oF).] | 295-442-6 | 92045-60-8 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-385-00-2 | Hydrocarbons, C8-11, naphtha-cracking, toluene cut;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation from prehydrogenated cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C11 and boiling in the range of approximately 130 oC to 205 oC (266oF to 401oF).] | 295-444-7 | 92045-62-0 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-386-00-8 | Hydrocarbons, C4-11, naphtha-cracking, arom.-free;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from prehydrogenated cracked naphtha after distillative separation of benzene- and toluene-containing hydrocarbon cuts and a higher boiling fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range C4 through C11 and boiling in the range of approximately 30 oC to 205 oC (86oF to 401oF).] | 295-445-2 | 92045-63-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-387-00-3 | Naphtha (petroleum), light heat-soaked, steam-cracked;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the fractionation of steam cracked naphtha after recovery from a heat soaking process. It consists predominantly of hydrocarbons having a carbon numbers predominantly in the range of C4 through C6 and boiling in the range of approximately 0 oC to 80 oC (32oF to 176oF.] | 296-028-8 | 92201-97-3 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-388-00-9 | Distillates (petroleum), C6-rich;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained from the distillation of a petroleum feedstock. It consists predominantly of hydrocarbons having carbon numbers of C5 through C7, rich in C6, and boiling in the range of approximately 60 oC to 70 oC (140oF to 158oF).] | 296-903-4 | 93165-19-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-389-00-4 | Gasoline, pyrolysis, hydrogenated;Low boiling point naphtha-unspecified;[A distillation fraction from the hydrogenation of pyrolysis gasoline boiling in the range of approximately 20 oC to 200 oC (68oF to 392oF).] | 302-639-3 | 94114-03-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-390-00-X | Distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of the polymerized C8 through C12 fraction from steam-cracked petroleum distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | 305-750-5 | 95009-23-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-391-00-5 | Extracts (petroleum) heavy naphtha solvent, clay-treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment of heavy naphthic solvent petroleum extract with bleaching earth. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C18 and boiling in the range of approximately 80 oC to 180 oC (175oF to 356oF).] | 308-261-5 | 97926-43-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-392-00-0 | Naphtha (petroleum), light steam-cracked, debenzenized, thermally treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment and distillation of debenzenized light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 95 oC to 200 oC (203oF to 392oF).] | 308-713-1 | 98219-46-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-393-00-6 | Naphtha (petroleum), light steam-cracked, thermally treated;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the treatment and distillation of light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 35 oC to 80 oC (95oF to 176oF).] | 308-714-7 | 98219-47-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-394-00-1 | Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of petroleum light fraction, hydrodesulfurized and dearomatized. It consists predominantly of hydrocarbons having carbon numbers in the range of C7 through C9, predominantly C8 paraffins and cycloparaffins, boiling in the range of approximately 120 oC to 130 oC (248oF to 266oF).] | 309-862-5 | 101316-56-7 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-395-00-7 | Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained during the sorptions of toluene from a hydrocarbon fraction from cracked gasoline treated with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C8 and boiling in the range of approximately 80 oC to 135 oC (176oF to 275oF).] | 309-870-9 | 101316-66-9 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-396-00-2 | Naphtha (petroleum), hydrodesulfurized full-range coker;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23 oC to 196 oC (73oF to 385oF).] | 309-879-8 | 101316-76-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-397-00-8 | Naphtha (petroleum), sweetened light;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 20 oC to 130 oC (68oF to 266oF).] | 309-976-5 | 101795-01-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-398-00-3 | Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly C5.] | 310-012-0 | 102110-14-5 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-399-00-9 | Hydrocarbons, C5-rich, dicyclopentadiene-contg.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by distillation of the products from a stream-cracking process. It consists predominantly of hydrocarbons having carbon numbers of C5 and dicyclopentadiene and boiling in the range of approximately 30 oC to 170 oC (86oF to 338oF).] | 310-013-6 | 102110-15-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-400-00-2 | Residues (petroleum), steam-cracked light, arom.;Low boiling point naphtha — unspecified;[A complex combination of hydrocarbons obtained by the distillation of the products of steam cracking or similar processes after taking off the very light products resulting in a residue starting with hydrocarbons having carbon numbers greater than C5. It consists predominantly of aromatic hydrocarbons having carbon numbers greater than C5 and boiling above approximately 40 oC (104oF).] | 310-057-6 | 102110-55-4 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-401-00-8 | Hydrocarbons, C ≥ 5, C5-6-rich;Low boiling point naphtha — unspecified | 270-690-8 | 68476-50-6 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-402-00-3 | Hydrocarbons, C5-rich;Low boiling point naphtha — unspecified | 270-695-5 | 68476-55-1 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-403-00-9 | Aromatic hydrocarbons, C8-10;Low boiling point naphtha — unspecified | 292-695-4 | 90989-39-2 | Carc. Cat. 2; R45Xn; R65 | TR: 45-65S: 53-45 | H P |
| 649-404-00-4 | Kerosine (petroleum);Straight run kerosine;[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (320oF to 554oF).] | 232-366-4 | 8008-20-6 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-405-00-X | Solvent naphtha (petroleum), medium aliph.;Straight run kerosine;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 140 oC to 220 oC (284oF to 428oF).] | 265-191-7 | 64742-88-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-406-00-5 | Solvent naphtha (petroleum) heavy aliph.;Straight run kerosine;[A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C11 through C16 and boiling in the range of approximately 190 oC to 290 oC (374oF to 554oF).] | 265-200-4 | 64742-96-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-407-00-0 | Kerosine (petroleum), straight-run wide-cut;Straight run kerosine;[A complex combination of hydrocarbons obtained as a wide cut hydrocarbon fuel cut from atmospheric distillation and boiling in the range of approximately 70 oC to 220 oC (158oF to 428oF).] | 295-418-5 | 92045-37-9 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-408-00-6 | Distillates (petroleum), steam-cracked;Cracked kerosine;[A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C7 through C16 and boiling in the range of approximately 90 oC to 290 oC (190oF to 554oF).] | 265-194-3 | 64742-91-2 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-409-00-1 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction;Cracked kerosine;[A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists of hydro-carbons having carbon numbers in the range of C8 through C10 and boiling in the range of approximately 129 oC to 194 oC (264oF to 382oF).] | 270-728-3 | 68477-39-4 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-410-00-7 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction;Cracked kerosine;[A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C10 through C12.] | 270-729-9 | 68477-40-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-411-00-2 | Distillates (petroleum), steam-cracked, C8-12 fraction;Cracked kerosine;[A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | 270-737-2 | 68477-54-3 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-412-00-8 | Kerosine (petroleum), hydrodesulfurized thermal cracked;Cracked kerosine;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons predominantly in the range of C8 to C16 and boiling in the range of approximately 120 oC to 283 oC (284oF to 541oF).] | 285-507-7 | 85116-55-8 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-413-00-3 | Aromtic hydrocarbons, C≥10, steam-cracking, hydrotreated;Cracked kerosine;[A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly greater than C10 and boiling in the range of approximately 150 oC to 320 oC (302oF to 608oF).] | 292-621-0 | 90640-98-5 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-414-00-9 | Naphtha (petroleum), steam-cracked, hydrotreated, C9-10-arom.-rich;Cracked kerosine;[A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process thereafter treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C9 through C10 and boiling in the range of approximately 140 oC to 200 oC (284oF to 392oF).] | 292-637-8 | 90641-13-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-415-00-4 | Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of thermal-cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF.] | 309-866-7 | 101316-61-4 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-416-00-X | Distillates (petroleum), catalytic cracked heavy tar light;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of catalytic cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF).] | 309-938-8 | 101631-13-4 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-417-00-5 | Solvent naphtha (petroleum), hydrocracked heavy arom.;Cracked kerosine;[A complex combination of hydrocarbons obtained by the distillation of hydrocracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 235 oC to 290 oC (455oF to 554oF).] | 309-881-9 | 101316-80-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-418-00-0 | Distillates (petroleum), steam-cracked heavy tar light;Cracked kerosine;[A complex combination of hydrocarbons obtained by distillation of steam cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 oC to 250 oC (212oF to 482oF).] | 309-940-9 | 101631-15-6 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-419-00-6 | Distillates (petroleum), alkylate;Kerosine — unspecified;[A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 205 oC to 320 oC (401oF to 608oF).] | 265-074-0 | 64741-73-7 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-420-00-1 | Extracts (petroleum), heavy naphtha solvent;Kerosine — unspecified;[A complex combination of hydrocarbons obtained as the extract from a solvent extraction process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 oC to 220 oC (194oF to 428oF).] | 265-099-7 | 64741-98-6 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-421-00-7 | Distillates (petroleum), chemically neutralized light;Kerosine — unspecified;[A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-132-5 | 64742-31-0 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-422-00-2 | Distillates (petroleum), hydrotreated light;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-149-8 | 64742-47-8 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-423-00-8 | Kerosine (petroleum), hydrodesulfurized;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 oC to 290 oC (302oF to 554oF).] | 265-184-9 | 64742-81-0 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-424-00-3 | Solvent naphtha (petroleum), heavy arom.; Kerosine — unspecified;[A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 165 oC to 290 oC (330oF to 554oF).] | 265-198-5 | 64742-94-5 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-425-00-9 | Naphtha (petroleum), heavy coker;Kerosine — unspecified;[A complex combination of hydrocarbons from the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C15 and boiling in the range of approximately 157 oC to 288 oC (315oF to 550oF).] | 269-778-9 | 68333-23-3 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-426-00-4 | Naphtha (petroleum), catalytic reformed hydrodesulfurized heavy, arom. fraction;Kerosine — unspecified;[A complex combination of hydrocarbons produced by fractionation from catalytically reformed hydrodesulfurized naphtha. It consists predominantly of aromatic hydrocarbons having carbon numbers predominently in the range of C7 to C 13 and boiling in the range of approximately 98 oC to 218 oC (208oF to 424oF).] | 285-508-2 | 85116-57-0 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-427-00-X | Kerosine (petroleum), sweetened;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of 130 oC to 290 oC (266oF to 554oF).] | 294-799-5 | 91770-15-9 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-428-00-5 | Kerosine (petroleum), solvent-refined sweetened;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from a petroleum stock by solvent refining and sweetening and boiling in the range of approximately 150 oC to 260 oC (302oF to 500oF).] | 295-416-4 | 92045-36-8 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-429-00-0 | Hydrocarbons, C9-16, hydrotreated, dearomatized;Kerosine — unspecified;[A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | 297-854-1 | 93763-35-0 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-430-00-6 | Kerosine (petroleum), solvent-refined hydrodesulfurized;Kerosine — unspecified | 307-033-2 | 97488-94-3 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-431-00-1 | Distillates (petroleum), hydrodesulfurized full-range middle coker;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C16 and boiling in the range of approximately 120 oC to 283 oC (248oF to 541oF).] | 309-864-6 | 101316-58-9 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-432-00-7 | Solvent naphtha (petroleum), hydrodesulfurized heavy arom.;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 180 oC to 240 oC (356oF to 464oF).] | 309-882-4 | 101316-81-8 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-433-00-2 | Solvent naphtha (petroleum), hydrodesulfurized medium;Kerosine — unspecified;[A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 175 oC to 220 oC (347oF to 428oF).] | 309-884-5 | 101316-82-9 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-434-00-8 | Kerosine (petroleum), hydrotreated;Kerosine — unspecified;[A complex combination of hydrocarbons obtained from the distillation of petroleum and subsequent hydrotreatment. It consists predominantly of alkanes, cycloalkanes and alkylbenzenes having carbon numbers predominantly in the range of C12 through C16 and boiling in the range of approximately 230 oC to 270 oC (446oF to 518oF).] | 309-944-0 | 101631-19-0 | Xn; R65 | XnR: 65S: (2-)23-24-62 | H |
| 649-435-00-3 | Distillates (petroleum), light catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | 265-060-4 | 64741-59-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-436-00-9 | Distillates (petroleum), intermediate catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 oC to 450 oC (401oF to 842oF). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | 265-062-5 | 64741-60-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-437-00-4 | Distillates (petroleum), light hydrocracked;Cracked gasoil;[A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C10 through C18 and boiling in the range of approximately 160 oC to 320 oC (320oF to 608oF).] | 265-078-2 | 64741-77-1 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 649-438-00-X | Distillates (petroleum), light thermal cracked;Cracked gasoil;[A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C10 through C22 and boiling in the range of approximately 160 oC to 370 oC (320oF to 698oF).] | 265-084-5 | 64741-82-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-439-00-5 | Distillates (petroleum), hydrodesulfurized light catalytic cracked;Cracked gasoil;[A complex combination of hydrocarbons obtained by treating light catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 oC to 400 oC (302oF to 752oF). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | 269-781-5 | 68333-25-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-440-00-0 | Distillates (petroleum), light steam-cracked naphtha;Cracked gasoil;[A complex combination of hydrocarbons from the multiple distillation of products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C10 through C18.] | 270-662-5 | 68475-80-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-441-00-6 | Distillates (petroleum), cracked steam-cracked petroleum distillates;Cracked gasoil;[A complex combination of hydrocarbons produced by distilling cracked steam cracked distillate and/or its fractionation products. It consists of hydrocarbons having carbon numbers predominently in the range of C10 to low molecular weight polymers.] | 270-727-8 | 68477-38-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-442-00-1 | Gas oils (petroleum), steam-cracked;Cracked gasoil;[A complex combination of hydrocarbons produced by distillation of the products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C9 and boiling in the range of from approximately 205 oC to 400 oC (400oF to 752oF).] | 271-260-2 | 68527-18-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-443-00-7 | Distillates (petroleum), hydrodesulfurized thermal cracked middle;Cracked gasoil;[A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized themal cracker distillate stocks. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 to C25 and boiling in the range of approximately 205 oC to 400 oC (401oF to 752oF).] | 285-505-6 | 85116-53-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-444-00-2 | Gas oils (petroleum), thermal-cracked, hydrodesulfurized;Cracked gasoil | 295-411-7 | 92045-29-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-445-00-8 | Residues (petroleum), hydrogenated steam-cracked naphtha;Cracked gasoil;[A complex combination of hydrocarbons obtained as a residual fraction from the distillation of hydrotreated steam-cracked naphtha. It consists predominantly of hydrocarbons boiling in the range of approximately 200 oC to 350 oC (32oF to 662oF).] | 295-514-7 | 92062-00-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-446-00-3 | Residues (petroleum), steam-cracked naphtha distn.;Cracked gasoil;[A complex combination of hydrocarbons obtained as a column bottom from the separation of effluents from steam cracking naphtha at a high temperature. It boils in the range of approximately 147 oC to 300 oC (297oF to 572oF) and produces a finished oil having a viscosity of 18cSt at 50 oC.] | 295-517-3 | 92062-04-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-447-00-9 | Distillates (petroleum), light catalytic cracked, thermally degraded;Cracked gasoil;[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 190 oC to 340 oC (374oF to 644oF). This stream is likely to contain organic sulfur compounds.] | 295-991-1 | 92201-60-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-448-00-4 | Residues (petroleum), steam-cracked heat-soaked naphtha;Cracked gasoil;[A complex combination of hydrocarbons obtained as residue from the distillation of steam cracked heat soaked naphtha and boiling in the range of approximately 150 oC to 350 oC (302oF to 662oF).] | 297-905-8 | 93763-85-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-449-00-X | Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distn. residue;Cracked gasoil;[A complex combination of hydrocarbons obtained by solvent dewaxing of a distillation residue from a hydrocracked paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 360 oC to 500 oC (680 oF to 932 oF). It produces a finished oil having a viscosity of 4,5 cSt at approximately 100 oC (212 oF).] | 307-662-2 | 97675-88-2 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | H |
| 649-450-00-5 | Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized;Cracked gasoil;[A complex combination of hydrocarbons obtained by catalytic dehydrosulfurization of thermal-cracked light vacuum petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C20 and boiling in the range of approximately 270 oC to 370 oC (518oF to 698oF).] | 308-278-8 | 97926-59-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-451-00-0 | Distillates (petroleum), hydrodesulfurized middle coker;Cracked gasoil;[A complex combination of hydrocarbons by fractionation from hydrodesulfurised coker distillate stocks. Is consists of hydro-carbons having carbon numbers predominantly in the range of C12 through C21 and boiling in the range of approximately 200 oC to 360 oC (392oF to 680oF).] | 309-865-1 | 101316-59-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-452-00-6 | Distillates (petroleum), heavy steam-cracked;Cracked gasoil;[A complex combination of hydrocarbons obtained by distillation of steam cracking heavy residues. It consists predominantly of highly alkylated heavy aromatic hydrocarbons boiling in the range of approximately 250 oC to 400 oC (482oF to 752oF).] | 309-939-3 | 101631-14-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H |
| 649-453-00-1 | Distillates (petroleum), heavy hydrocracked;Baseoil — unspecified;[A complex combination of hydrocarbons from the distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers in the range of C15-C39 and boiling in the range of approximately 260 oC to 600 oC (500oF to 1112oF).] | 265-077-7 | 64741-76-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-454-00-7 | Distillates (petroleum), solvent-refined heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC).] | 265-090-8 | 64741-88-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-455-00-2 | Distillates (petroleum), solvent-refined light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-091-3 | 64741-89-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-456-00-8 | Residual oils (petroleum), solvent deasphalted;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the solvent soluble fraction from C3-C4 solvent deasphalting of a residuum. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-096-0 | 64741-95-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-457-00-3 | Distillates (petroleum), solvent-refined heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt a 40 oC). It contains relatively few normal paraffins.] | 265-097-6 | 64741-96-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-458-00-9 | Distillates (petroleum), solvent-refined light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-098-1 | 64741-97-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-459-00-4 | Residual oils (petroleum,) solvent-refined;Baseoil — unspecified;[A complex combination by hydrocarbons obtained as the solvent insoluble fraction from solvent refining of a residuum using a polar organic solvent such as phenol or furfural. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-101-6 | 64742-01-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-460-00-X | Distillates (petroleum), clay-treated paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-137-2 | 64742-36-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-461-00-5 | Distillates (petroleum), clay-treated light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-138-8 | 64742-37-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-462-00-0 | Residual oils (petroleum), clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treatment of a residual oil with a natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydro-carbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 oC (752oF).] | 265-143-5 | 64742-41-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-463-00-6 | Distillates (petroleum), clay-treated heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-146-1 | 64742-44-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-464-00-1 | Distillates (petroleum), clay-treated light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-147-7 | 64742-45-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-465-00-7 | Distillates (petroleum), hydrotreated heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-155-0 | 64742-52-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-466-00-2 | Distillates (petroleum), hydrotreated light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-156-6 | 64742-53-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-467-00-8 | Distillates (petroleum), hydrotreated heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-157-1 | 64742-54-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-468-00-3 | Distillates (petroleum), hydrotreated light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains a relatively large proportion of saturated hydrocarbons.] | 265-158-7 | 64742-55-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-469-00-9 | Distillates (petroleum), solvent-dewaxed light paraffinic;Baseoil — unspecified;[A complex comination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-159-2 | 64742-56-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-470-00-4 | Residual oils (petroleum), hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 oC (752oF).] | 265-160-8 | 64742-57-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-471-00-X | Residual oils (petroleum), solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of long, branched chain hydrocarbons from a residual oil by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 oC (752oF).] | 265-166-0 | 64742-62-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-472-00-5 | Distillates (petroleum), solvent-dewaxed heavy naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 . through C50 and produces a finished oil of not less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-167-6 | 64742-63-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-473-00-0 | Distillates (petroleum), solvent-dewaxed light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-168-1 | 64742-64-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-474-00-6 | Distillates (petroleum), solvent-dewaxed heavy paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity not less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-169-7 | 64742-65-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-475-00-1 | Naphthenic oils (petroleum), catalytic dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-172-3 | 64742-68-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-476-00-7 | Naphthenic oils (petroleum), catalytic dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-173-9 | 64742-69-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-477-00-2 | Paraffin oils (petroleum), catalytic dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC).] | 265-174-4 | 64742-70-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-478-00-8 | Paraffin oils (petroleum), catalytic dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC).] | 265-176-5 | 64742-71-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-479-00-3 | Naphthenic oils (petroleum), complex dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by removing straight chain paraffin hydrocarbons as a solid by treatment with an agent such as urea. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of at least 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-179-1 | 64742-75-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-480-00-9 | Naphthenic oils (petroleum), complex dewaxed light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 265-180-7 | 64742-76-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-481-00-4 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil, and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of approximately 112cSt at 40 oC. It contains a relatively large proportion of saturated hydrocarbons.] | 276-736-3 | 72623-85-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-482-00-X | Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil and heavy vacuum gas oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of approximately 15cSt at 40 oC. It contains a relatively large proportion of saturated hydrocabons.] | 276-737-9 | 72623-86-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-483-00-5 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of approximately 32cSt at 40 oC. It contains a relatively large proportion of saturated hydrocarbons.] | 276-738-4 | 72623-87-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-484-00-0 | Lubricating oils;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from solvent extraction and dewaxing processes. It consists predominantly of saturated hydrocarbons having carbon numbers in the range C15 through C50.] | 278-012-2 | 74869-22-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-485-00-6 | Distillates (petroleum), complex dewaxed heavy paraffinci;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by dewaxing heavy paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of equal to or greater than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 292-613-7 | 90640-91-8 | Carc. Cat. 2; R45 | TR: 4S: 53-45 | H L |
| 649-486-00-1 | Distillates (petroleum), complex dewaxed light paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by dewaxing light paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100oF (19cSt at 40 oC). It contains relatively few normal paraffins.] | 292-614-2 | 90640-92-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-487-00-7 | Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating dewaxed heavy paraffinic distillate with neutral or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 292-616-3 | 90640-94-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-488-00-2 | Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons produced by treating dewaxed heavy paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 292-617-9 | 90640-95-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-489-00-8 | Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated;Baseoil — unspecified;[A complex combination of hydrocarbons resulting from treatment of dewaxed light paraffinic distillate with natural or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | 292-618-4 | 90640-96-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-490-00-3 | Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons produced by treating a dewaxed light paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | 292-620-5 | 90640-97-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-491-00-9 | Residual oils (petroleum), hydrotreated solvent dewaxed;Baseoil — unspecified | 292-656-1 | 90669-74-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-492-00-4 | Residual oils (petroleum), catalytic dewaxed;Baseoil — unspecified | 294-843-3 | 91770-57-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-493-00-X | Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C25 through C39 and produces a finished oil with a viscosity of approximately 44 cSt at 50 oC.] | 295-300-3 | 91995-39-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-494-00-5 | Distillates (petroleum), dewaxed light paraffinic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C21 through C29 and produces a finished oil with a viscosity of approximately 13 cSt at 50 oC.] | 295-301-9 | 91995-40-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-495-00-0 | Distillates (petroleum), hydrocracked solvent-refined, dewaxed;Baseoil — unspecified;[A complex combination of liquid hydrocarbons obtained by recrystallization of dewaxed hydrocracked solvent-refined petroleum distillates.] | 295-306-6 | 91995-45-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-496-00-6 | Distillates (petroleum), solvent-refined light naphthenic, hydrotreated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst and removing the aromatic hydrocarbons by solvent extraction. It consists predominantly of naphthenic hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of between 13-15cSt at 40 oC.] | 295-316-0 | 91995-54-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-497-00-1 | Lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated;Baseoil — unspecified | 295-423-2 | 92045-42-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-498-00-7 | Lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined;Baseoil — unspecified | 295-424-8 | 92045-43-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-499-00-2 | Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons produced by solvent removal of paraffins from the residue of the distillation of acid-treated, hydrocracked heavy paraffins and boiling approximately above 380 oC (716oF).] | 295-499-7 | 92061-86-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-500-00-6 | Paraffin oils (petroleum), solvent-refined dewaxed heavy;Baseoil — unspecified;[A complex combination of hydrocarbons obtained from sulfur-containing paraffinic crude oil. It consists predominantly of a solvent refined deparaffinated lubricating oil with a viscosity of 65cSt at 50 oC.] | 295-810-6 | 92129-09-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-501-00-1 | Lubricating oils (petroleum), base oils, paraffinic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by refining of crude oil. It consists predominantly of aromatics, naphthenics and paraffinics and produces a finished oil with a viscosity of 120 SUS at 100oF (23cSt at 40 oC).] | 297-474-6 | 93572-43-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-502-00-7 | Hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed;Baseoil — unspecified | 297-857-8 | 93763-38-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-503-00-2 | Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate;Baseoil — unspecified | 300-257-1 | 93924-61-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-504-00-8 | Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated;Baseoil — unspecified | 305-588-5 | 94733-08-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-505-00-3 | Distillates (petroleum), solvent-refined hydrocracked light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent dearomatization of the residue of hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 oC to 450 oC (698oF to 842oF).] | 305-589-0 | 94733-09-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-506-00-9 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent deparaffination of the distillation residue from hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 oC to 550 oC (698oF to 1022oF).] | 305-594-8 | 94733-15-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-507-00-4 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent deparaffination of the hydrogenated raffinate obtained by solvent extraction of a hydrotreated petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 oC to 550 oC (698oF to 1022oF).] | 305-595-3 | 94733-16-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-508-00-X | Hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate;Baseoil — unspecified | 305-971-7 | 95371-04-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-509-00-5 | Hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate;Baseoil — unspecified | 305-972-2 | 95371-05-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-510-00-0 | Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues;Baseoil — unspecified | 305-974-3 | 95371-07-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-511-00-6 | Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues;Baseoil — unspecified | 305-975-9 | 95371-08-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-512-00-1 | Distillates (petroleum), hydrocracked solvent-refined light;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by the solvent treatment of a distillate from hydrocracked petroleum distillates. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 oC to 450 oC (698oF to 842oF.] | 307-010-7 | 97488-73-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-513-00-7 | Distillates (petroleum), solvent-refined hydrogenated heavy;Baseoil — unspecified;[A complex combination of hydrocarbons, obtained by the treatment of a hydrogenated petroleum distillate with a solvent. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C19 through C40 and boiling in the range of approximately 390 oC to 550 oC (734oF to 1022oF).] | 307-011-2 | 97488-74-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-514-00-2 | Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed;Baseoil — unspecified | 307-034-8 | 97488-95-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-515-00-8 | Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a solvent deasphalted short residue with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C30 and boiling in the range of approximately 300 oC to 400 oC (572oF to 752oF). It produces a finished oil having a viscosity of 4cSt at approximately 100 oC (212oF).] | 307-661-7 | 97675-87-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-516-00-3 | Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights;Baseoil — unspecified;[A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the catalytic hydrotreatment of a solvent deasphalted short residue having a viscosity of 8cSt at approximately 100 oC (212oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C40 and boiling in the range of approximately 300 oC to 500 oC (592oF to 932oF).] | 307-755-8 | 97722-06-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-517-00-9 | Hydrocarbons, C13-27, solvent-extd. light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 9.5cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C27 and boiling in the range of approximately 240 oC to 400 oC (464oF to 752oF.] | 307-758-4 | 97722-09-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-518-00-4 | Hydrocarbons, C14-29, solvent-extd. light naphthenic;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 16cSt at 40 oC (104oF). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C29 and boiling in the range of approximately 250 oC to 425 oC (482oF to 797oF).] | 307-760-5 | 97722-10-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-519-00-X | Hydrocarbons, C27-42, dearomatized;Baseoil — unspecified | 308-131-8 | 97862-81-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-520-00-5 | Hydrocarbons, C17-30, hydrotreated distillates, distn. lights;Baseoil — unspecified | 308-132-3 | 97862-82-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-521-00-0 | Hydrocarbons, C27-45, naphthenic vacuum distn.;Baseoil — unspecified | 308-133-9 | 97862-83-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-522-00-6 | Hydrocarbons, C27-45, dearomatized;Baseoil — unspecified | 308-287-7 | 97926-68-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-523-00-1 | Hydrocarbons, C20-58, hydrotreated;Baseoil — unspecified | 308-289-8 | 97926-70-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-524-00-7 | Hydrocarbons, C27-42, naphthenic;Baseoil — unspecified | 308-290-3 | 97926-71-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-525-00-2 | Residual oils (petroleum), carbon-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by the treatment of solvent-dewaxed petroleum residual oils with activated charcoal for the removal of trace polar constituents and impurities.] | 309-710-8 | 100684-37-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-526-00-8 | Residual oils (petroleum), clay-treated solvent-dewaxed;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by treatment of solvent-dewaxed petroleum residual oils with bleaching earth for the removal of trace polar constituents and impurities.] | 309-711-3 | 100684-38-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-527-00-3 | Lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of vacuum distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C25 and produces a finished oil with a viscosity in the order of 32cSt to 37cSt at 100 oC (212oF).] | 309-874-0 | 101316-69-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-528-00-9 | Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C32 and produced a finished oil with a viscosity in the order of 17cSt to 23cSt at 40 oC (104oF.] | 309-875-6 | 101316-70-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-529-00-4 | Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C35 and produces a finished oil with a viscosity in the order of 37cSt to 44cSt at 40 oC (104oF).] | 309-876-1 | 101316-71-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-530-00-X | Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated;Baseoil — unspecified;[A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C24 through C50 and produces a finished oil with a viscosity in the order of 16cSt to 75cSt at 40 oC (104oF).] | 309-877-7 | 101316-72-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-531-00-5 | Extracts (petroleum), heavy naphthenic distillate solvent, arom. conc.;Distillate aromatic extract (treated);[An aromatic concentrate produced by adding water to heavy naphthenic distillate solvent extract and extraction solvent.] | 272-175-3 | 68783-00-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-532-00-0 | Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from the re-extraction of solvent-refined heavy paraffinic distillate. It consists of saturated and aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 272-180-0 | 68783-04-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-533-00-6 | Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from a solvent extraction of heavy paraffinic distillate.] | 272-342-0 | 68814-89-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-534-00-1 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by treating a heavy naphthenic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 19cSt at 40 oC (100 SUS at 100oF).] | 292-631-5 | 90641-07-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-535-00-7 | Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons produced by treating a heavy paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C21 through C33 and boiling in the range of approximately 350 oC to 480 oC (662oF to 896oF). | 292-632-0 | 90641-08-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-536-00-2 | Extracts (petroleum), light paraffinic distillate solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons produced by treating a light paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C26 and boiling in the range of approximately 280 oC to 400 oC (536oF to 752oF).] | 292-633-6 | 90641-09-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-537-00-8 | Extracts (petroleum), hydrotreated light paraffinic distillate solvent;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as the extract from solvent extraction of intermediate paraffinic top solvent distillate that is treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | 295-335-4 | 91995-73-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-538-00-3 | Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by treating the extract, obtained from a solvent extraction process, with hydrogen in the presence of a catalyst under conditions primarily to remove sulfur compounds. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C15 through C30. This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | 295-338-0 | 91995-75-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-539-00-9 | Extracts (petroleum), light paraffinic distillate solvent, acid-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction of the distillation of an extract from the solvent extraction of light paraffinic top petroleum distillates that is subjected to a sulfuric acid refining. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 295-339-6 | 91995-76-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-540-00-4 | Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of a light paraffin distillate and treated with hydrogen to convert the organic sulfur to hydrogen sulfide which is eliminated. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C40 and produces a finished oil with a viscosity of greater than 10cSt at 40 oC.] | 295-340-1 | 91995-77-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-541-00-X | Extracts (petroleum), light vacuum gas oil solvent, hydrotreated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons, obtained by solvent extraction from light vacuum petroleum gas oils and treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 295-342-2 | 91995-79-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-542-00-5 | Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contact or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50. This stream is likely to contain 5 wt.% or more 4-6 membered ring aromatic hydrocarbons.] | 296-437-1 | 92704-08-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-543-00-0 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 oC.] | 297-827-4 | 93763-10-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-544-00-6 | Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained from a solvent dewaxed petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 oC.] | 297-829-5 | 93763-11-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-545-00-1 | Extracts (petroleum), light paraffinic distillate solvent, carbon-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillate treated with activated charcoal to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 309-672-2 | 100684-02-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-546-00-7 | Extracts (petroleum), light paraffinic distillate solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillates treated with bleaching earth to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | 309-673-8 | 100684-03-5 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-547-00-2 | Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oil treated with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 309-674-3 | 100684-04-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-548-00-8 | Extracts (petroleum), light vacuum gas oil solvent, clay-treated;Distillate aromatic extract (treated);[A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oils treated with bleaching earth for removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | 309-675-9 | 100684-05-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-549-00-3 | Foots oil (petroleum);Foots oil;[A complex combination of hydrocarbons obtained as the oil fraction from a solvent deoiling or a wax sweating process. It consists predominantly of branched chain hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | 265-171-8 | 64742-67-2 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 649-550-00-9 | Foots oil (petroleum), hydrotreated;Foots oil | 295-394-6 | 92045-12-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | H L |
| 650-002-00-6 | turpentine, oil | 232-350-7 | 8006-64-2 | R10Xn; R20/21/22-65Xi; R36/38R43N; R51-53 | Xn; NR: 10-20/21/22-36/38-43-51/53-65S: (2-)36/37-46-61-62 |
| 650-003-00-1 | fenson (ISO);4-chlorophenyl benzenesulphonate; | 201-274-6 | 80-38-6 | Xn; R22Xi; R36N; R51-53 | Xn; NR: 22-36-51/53S: (2-)24-26-61 |
| 650-004-00-7 | norbormide (ISO);5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)bicyclo [2.2.1] hept-5-ene-2,3-dicarboximide | 213-589-6 | 991-42-4 | Xn; R22 | XnR: 22S: (2-) |
| 650-005-00-2 | (2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one, rotenone | 201-501-9 | 83-79-4 | T; R25Xi; R36/37/38N; R50-53 | T; NR: 25-36/37/38-50/53S: (1/2-)22-24/25-36-45-60-61 |
| 650-006-00-8 | benquinox (ISO);p-benzoquinone 1-benzoylhydrazone 4-oxime | 207-807-9 | 495-73-8 | T; R25Xn; R21 | TR: 21-25S: (1/2-)36/37-45 |
| 650-007-00-3 | chlordimeform (ISO);N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine | 228-200-5 | 6164-98-3 | Carc. Cat. 3; R40Xn; R21/22N; R50-53 | Xn; NR: 21/22-40-50/53S: (2-)22-36/37-60-61 |
| 650-008-00-9 | drazoxolon (ISO);4-(2-chlorophenylhydrazone)-3-methyl-5-isoxazolone | 227-197-8 | 5707-69-7 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)22-24-36/37-45-60-61 |
| 650-009-00-4 | chlordimeform hydrochloride;N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride;N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine hydorchloride | 243-269-1 | 19750-95-9 | Carc. Cat. 3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)22-36/37-60-61 |
| 650-010-00-X | benzyl violet 4B; α-[4-(4-dimethylamino-α-{4-[ethyl(3-sodiosulphonatobenzyl)amino] phenyl}benzylidene)cyclohexa-2,5-dienylidene(ethyl)ammonio]toluene-3-sulphonate | 216-901-9 | 1694-09-3 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 |
| 650-012-00-0 | erionite | — | 12510-42-8 | Carc. Cat. 1; R45 | TR: 45S: 53-45 |
| 650-013-00-6 | asbestos | ——————— | 12001-28-4132207-32-012172-73-577536-66-477536-68-677536-67-512001-29-5 | Carc. Cat. 1; R45T; R48/23 | TR: 45-48/23 S: 53-45 | E |
| 650-014-00-1 | diethyl 2,4-dihydroxycyclodisiloxane-2,4-diylbis(trimethylene)diphosphonate, tetrasodium salt, reaction products with disodium metasilicate | 401-770-4 | — | C; R34Xn; R22 | CR: 22-34S: (1/2-)26-36/37/39-45 |
| 650-015-00-7 | rosin; colophony | 232-475-7232-484-6277-299-1 | 8050-09-78052-10-673138-82-6 | R43 | XiR: 43S: (2-)24-37 |
| 650-016-00-2 | Mineral wool, with the exception of those specified elsewhere in this Annex;[Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight] | — | — | Carc. Cat. 3; R40Xi; R38 | XnR: 38-40S: (2-)36/37 | AQR |
| 650-017-00-8 | Refractory Ceramic Fibres;Special Purpose Fibres, with the exception of those specified elsewhere in this Annex;[Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+ MgO+BaO) content less or equal to 18 % by weight] | — | — | Carc. Cat. 2; R49Xi; R38 | TR: 49-38S: 53-45 | A R |
| 650-018-00-3 | reaction product of: acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid | 406-230-1 | — | R10Carc. Cat. 3; R40C; R34Xn; R20R43N; R50-53 | C; NR: 10-20-34-40-43-50/53S: (1/2-)26-36/37/39-45-60-61 |
| 650-031-00-4 | bis(4-hydroxy-N-methylanilinium) sulphate | 200-237-1 | 55-55-0 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)36/37-46-60-61 |
| 650-032-00-X | cyproconazole (ISO);(2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | — | 94361-06-5 | Repr. Cat. 3; R63Xn; R22N; R50-53 | Xn; NR: 22-50/53-63S: (2-)36/37-60-61 |
| 650-033-00-5 | (S)-α-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate; esfenvalerate | — | 66230-04-4 | T; R23/25R43N; R50-53 | T; NR: 23/25-43-50/53S: (1/2-)24-36/37/39-45-60-61 |
| 650-041-00-9 | triasulfuron (ISO);1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | — | 82097-50-5 | N; R50-53 | NR: 50/53S: 60-61 |
| 650-042-00-4 | reaction product of: polyethylene-polyamine-(C16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates | 417-450-2 | — | Xi; R36/38R43R52-53 | XiR: 36/38-43-52/53S: (2-)24-26-37-61 |
| 650-043-00-X | reaction product of: 3,5-bis-tert-butylsalicylic acid and aluminiumsulfate | 420-310-3 | — | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-56-60-61 |
| 650-044-00-5 | mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin | 420-480-9 | 158570-99-1 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 |
| 650-045-00-0 | reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate | 417-110-3 | — | F; R11Xi; R38-41N; R51-53 | F; Xi; NR: 11-38-41-51/53S: (2-)9-16-26-37/39-61 |
| 650-046-00-6 | di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates | 416-180-2 | 12222-04-7 | Xn; R22-48/22N; R51-53 | Xn; NR: 22-48/22-51/53S: (2-)22-36-61 |
| 650-047-00-1 | dibenzylphenylsulfonium hexafluoroantimonate | 417-760-8 | 134164-24-2 | T; R48/25Xn; R22Xi; R41R43N; R51-53 | T; NR: 22-41-43-48/25-51/53S: (1/2-)22-26-36/37/39-45-61 |
| 650-048-00-7 | reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid | 420-070-1 | — | O; R7Xn; R20/21/22C; R35N; R50 | O; C; NR: 7-20/21/22-35-50S: (1/2-)3/7-14-26-36/37/39-45-61 |
| 650-049-00-2 | 2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85 % unsaturated octadecoyl, 0.5 to 10 % saturated octadecoyl, and 2 to 18 % saturated hexadecoyl | 417-960-5 | — | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 |
| 650-050-00-8 | reaction mass of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate;1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers;1,3-butanediol bis[3-(3',5'-(1,1-dimethylethyl)-4'-hydroxyphenyl)propionate] isomers | 423-600-8 | — | N; R51-53 | NR: 51/53S: 61 |
| 650-055-00-5 | silver sodium zirconium hydrogenphosphate | 422-570-3 | 155925-27-2 | N; R50-53 | NR: 50/53S: 60-61 |
Rückverweise
Keine Ergebnisse gefunden
EUR-Lex